Merge "Transcoder: Fixed codec leaks on cancel."
diff --git a/apex/Android.bp b/apex/Android.bp
index c1ef3d8..ef296d6 100644
--- a/apex/Android.bp
+++ b/apex/Android.bp
@@ -59,6 +59,16 @@
     name: "com.android.media",
     manifest: "manifest.json",
     defaults: ["com.android.media-defaults"],
+    prebuilts: [
+        "media-linker-config",
+    ],
+}
+
+prebuilt_etc {
+    name: "media-linker-config",
+    src: "linker.config.txt",
+    filename: "linker.config.txt",
+    installable: false,
 }
 
 filegroup {
diff --git a/apex/TEST_MAPPING b/apex/TEST_MAPPING
index f036516..09c46d6 100644
--- a/apex/TEST_MAPPING
+++ b/apex/TEST_MAPPING
@@ -14,17 +14,9 @@
         },
         {
           "include-filter": "com.google.android.media.gts.WidevineGenericOpsTests"
-        }
-      ]
-    },
-    {
-      "name": "GtsExoPlayerTestCases",
-      "options" : [
-        {
-          "include-annotation": "android.platform.test.annotations.SocPresubmit"
         },
         {
-          "include-filter": "com.google.android.exoplayer.gts.DashTest#testWidevine23FpsH264Fixed"
+          "include-filter": "com.google.android.media.gts.WidevineYouTubePerformanceTests"
         }
       ]
     }
diff --git a/apex/linker.config.txt b/apex/linker.config.txt
new file mode 100644
index 0000000..d1c815b
--- /dev/null
+++ b/apex/linker.config.txt
@@ -0,0 +1,7 @@
+# Extra linker configurations for media APEX
+# See https://android.googlesource.com/platform/system/linkerconfig/+/master/README.md#apex_etc_linker_config_txt
+
+[properties]
+
+# Set media APEX as force visible so media APEX namespace is accessible via android_get_exported_namespace
+visible = true
diff --git a/apex/mediaswcodec.rc b/apex/mediaswcodec.rc
index d17481b..0c9b8c8 100644
--- a/apex/mediaswcodec.rc
+++ b/apex/mediaswcodec.rc
@@ -2,6 +2,5 @@
     class main
     user mediacodec
     group camera drmrpc mediadrm
-    override
     ioprio rt 4
     writepid /dev/cpuset/foreground/tasks
diff --git a/camera/CameraBase.cpp b/camera/CameraBase.cpp
index aecb70a..0b0f584 100644
--- a/camera/CameraBase.cpp
+++ b/camera/CameraBase.cpp
@@ -29,6 +29,7 @@
 #include <binder/IMemory.h>
 
 #include <camera/CameraBase.h>
+#include <camera/CameraUtils.h>
 
 // needed to instantiate
 #include <camera/Camera.h>
@@ -124,9 +125,7 @@
 {
     Mutex::Autolock _l(gLock);
     if (gCameraService.get() == 0) {
-        char value[PROPERTY_VALUE_MAX];
-        property_get("config.disable_cameraservice", value, "0");
-        if (strncmp(value, "0", 2) != 0 && strncasecmp(value, "false", 6) != 0) {
+        if (CameraUtils::isCameraServiceDisabled()) {
             return gCameraService;
         }
 
diff --git a/camera/CameraMetadata.cpp b/camera/CameraMetadata.cpp
index 135384a..7e4c91e 100644
--- a/camera/CameraMetadata.cpp
+++ b/camera/CameraMetadata.cpp
@@ -22,6 +22,7 @@
 
 #include <binder/Parcel.h>
 #include <camera/CameraMetadata.h>
+#include <camera_metadata_hidden.h>
 
 namespace android {
 
@@ -872,5 +873,8 @@
     return OK;
 }
 
+metadata_vendor_id_t CameraMetadata::getVendorId() {
+    return get_camera_metadata_vendor_id(mBuffer);
+}
 
 }; // namespace android
diff --git a/camera/CameraUtils.cpp b/camera/CameraUtils.cpp
index 67fc116..f9b1b37 100644
--- a/camera/CameraUtils.cpp
+++ b/camera/CameraUtils.cpp
@@ -23,6 +23,7 @@
 #include <system/window.h>
 #include <system/graphics.h>
 
+#include <cutils/properties.h>
 #include <utils/Log.h>
 
 namespace android {
@@ -122,4 +123,10 @@
     return OK;
 }
 
+bool CameraUtils::isCameraServiceDisabled() {
+    char value[PROPERTY_VALUE_MAX];
+    property_get("config.disable_cameraservice", value, "0");
+    return (strncmp(value, "0", 2) != 0 && strncasecmp(value, "false", 6) != 0);
+}
+
 } /* namespace android */
diff --git a/camera/VendorTagDescriptor.cpp b/camera/VendorTagDescriptor.cpp
index d713d2d..24fa912 100644
--- a/camera/VendorTagDescriptor.cpp
+++ b/camera/VendorTagDescriptor.cpp
@@ -660,6 +660,16 @@
     return sGlobalVendorTagDescriptorCache;
 }
 
+bool VendorTagDescriptorCache::isVendorCachePresent(metadata_vendor_id_t vendorId) {
+    Mutex::Autolock al(sLock);
+    if ((sGlobalVendorTagDescriptorCache.get() != nullptr) &&
+            (sGlobalVendorTagDescriptorCache->getVendorIdsAndTagDescriptors().find(vendorId) !=
+             sGlobalVendorTagDescriptorCache->getVendorIdsAndTagDescriptors().end())) {
+        return true;
+    }
+    return false;
+}
+
 extern "C" {
 
 int vendor_tag_descriptor_get_tag_count(const vendor_tag_ops_t* /*v*/) {
diff --git a/camera/include/camera/CameraMetadata.h b/camera/include/camera/CameraMetadata.h
index 9d1b5c7..83abdb6 100644
--- a/camera/include/camera/CameraMetadata.h
+++ b/camera/include/camera/CameraMetadata.h
@@ -237,6 +237,11 @@
     static status_t getTagFromName(const char *name,
             const VendorTagDescriptor* vTags, uint32_t *tag);
 
+    /**
+     * Return the current vendor tag id associated with this metadata.
+     */
+    metadata_vendor_id_t getVendorId();
+
   private:
     camera_metadata_t *mBuffer;
     mutable bool       mLocked;
diff --git a/camera/include/camera/CameraUtils.h b/camera/include/camera/CameraUtils.h
index f596f80..a397ccd 100644
--- a/camera/include/camera/CameraUtils.h
+++ b/camera/include/camera/CameraUtils.h
@@ -47,6 +47,11 @@
          */
         static bool isNativeHandleMetadata(const sp<IMemory>& imageData);
 
+        /**
+         * Check if camera service is disabled on this device
+         */
+        static bool isCameraServiceDisabled();
+
     private:
         CameraUtils();
 };
diff --git a/camera/include/camera/VendorTagDescriptor.h b/camera/include/camera/VendorTagDescriptor.h
index b2fbf3a..b3440d5 100644
--- a/camera/include/camera/VendorTagDescriptor.h
+++ b/camera/include/camera/VendorTagDescriptor.h
@@ -249,6 +249,12 @@
      */
     static void clearGlobalVendorTagCache();
 
+    /**
+     * Return true if given vendor id is present in the vendor tag caches, return
+     * false otherwise.
+     */
+    static bool isVendorCachePresent(metadata_vendor_id_t vendorId);
+
 };
 
 } /* namespace android */
diff --git a/camera/ndk/impl/ACameraManager.cpp b/camera/ndk/impl/ACameraManager.cpp
index 419250c..73cabbf 100644
--- a/camera/ndk/impl/ACameraManager.cpp
+++ b/camera/ndk/impl/ACameraManager.cpp
@@ -24,6 +24,7 @@
 #include <utils/Vector.h>
 #include <cutils/properties.h>
 #include <stdlib.h>
+#include <camera/CameraUtils.h>
 #include <camera/VendorTagDescriptor.h>
 
 using namespace android::acam;
@@ -70,12 +71,6 @@
     mCameraService.clear();
 }
 
-static bool isCameraServiceDisabled() {
-    char value[PROPERTY_VALUE_MAX];
-    property_get("config.disable_cameraservice", value, "0");
-    return (strncmp(value, "0", 2) != 0 && strncasecmp(value, "false", 6) != 0);
-}
-
 sp<hardware::ICameraService> CameraManagerGlobal::getCameraService() {
     Mutex::Autolock _l(mLock);
     return getCameraServiceLocked();
@@ -83,7 +78,7 @@
 
 sp<hardware::ICameraService> CameraManagerGlobal::getCameraServiceLocked() {
     if (mCameraService.get() == nullptr) {
-        if (isCameraServiceDisabled()) {
+        if (CameraUtils::isCameraServiceDisabled()) {
             return mCameraService;
         }
 
diff --git a/drm/TEST_MAPPING b/drm/TEST_MAPPING
index 2595e3e..9f6a532 100644
--- a/drm/TEST_MAPPING
+++ b/drm/TEST_MAPPING
@@ -9,17 +9,9 @@
         },
         {
           "include-filter": "com.google.android.media.gts.WidevineGenericOpsTests"
-        }
-      ]
-    },
-    {
-      "name": "GtsExoPlayerTestCases",
-      "options" : [
-        {
-          "include-annotation": "android.platform.test.annotations.SocPresubmit"
         },
         {
-          "include-filter": "com.google.android.exoplayer.gts.DashTest#testWidevine23FpsH264Fixed"
+          "include-filter": "com.google.android.media.gts.WidevineYouTubePerformanceTests"
         }
       ]
     }
diff --git a/drm/drmserver/DrmManager.cpp b/drm/drmserver/DrmManager.cpp
index 9a32cc5..74e3223 100644
--- a/drm/drmserver/DrmManager.cpp
+++ b/drm/drmserver/DrmManager.cpp
@@ -99,13 +99,13 @@
         }
         default:
         {
-            ALOGW("Unrecognized message type: %zd", msg->what());
+            ALOGW("Unrecognized message type: %u", msg->what());
         }
     }
 }
 
 int64_t DrmManager::getMetricsFlushPeriodUs() {
-    return 1000 * 1000 * std::max(1ll, property_get_int64("drmmanager.metrics.period", 86400));
+    return 1000 * 1000 * std::max(1ll, (long long)property_get_int64("drmmanager.metrics.period", 86400));
 }
 
 void DrmManager::recordEngineMetrics(
diff --git a/drm/libmediadrm/DrmMetricsConsumer.cpp b/drm/libmediadrm/DrmMetricsConsumer.cpp
index b47b4ff..5f0b26e 100644
--- a/drm/libmediadrm/DrmMetricsConsumer.cpp
+++ b/drm/libmediadrm/DrmMetricsConsumer.cpp
@@ -37,8 +37,8 @@
 template <> std::string GetAttributeName<KeyStatusType>(KeyStatusType type) {
     static const char *type_names[] = {"USABLE", "EXPIRED",
                                        "OUTPUT_NOT_ALLOWED", "STATUS_PENDING",
-                                       "INTERNAL_ERROR"};
-    if (((size_t)type) > arraysize(type_names)) {
+                                       "INTERNAL_ERROR", "USABLE_IN_FUTURE"};
+    if (((size_t)type) >= arraysize(type_names)) {
         return "UNKNOWN_TYPE";
     }
     return type_names[(size_t)type];
@@ -48,7 +48,7 @@
     static const char *type_names[] = {"PROVISION_REQUIRED", "KEY_NEEDED",
                                        "KEY_EXPIRED", "VENDOR_DEFINED",
                                        "SESSION_RECLAIMED"};
-    if (((size_t)type) > arraysize(type_names)) {
+    if (((size_t)type) >= arraysize(type_names)) {
         return "UNKNOWN_TYPE";
     }
     return type_names[(size_t)type];
diff --git a/drm/libmediadrm/include/mediadrm/DrmSessionManager.h b/drm/libmediadrm/include/mediadrm/DrmSessionManager.h
index 9e43504..c56bf01 100644
--- a/drm/libmediadrm/include/mediadrm/DrmSessionManager.h
+++ b/drm/libmediadrm/include/mediadrm/DrmSessionManager.h
@@ -62,7 +62,7 @@
     void removeSession(const Vector<uint8_t>& sessionId);
     bool reclaimSession(int callingPid);
 
-    // sanity check APIs
+    // inspection APIs
     size_t getSessionCount() const;
     bool containsSession(const Vector<uint8_t>& sessionId) const;
 
diff --git a/include/drm/TEST_MAPPING b/include/drm/TEST_MAPPING
index 28e432e..512e844 100644
--- a/include/drm/TEST_MAPPING
+++ b/include/drm/TEST_MAPPING
@@ -8,17 +8,9 @@
         },
         {
           "include-filter": "com.google.android.media.gts.WidevineGenericOpsTests"
-        }
-      ]
-    },
-    {
-      "name": "GtsExoPlayerTestCases",
-      "options" : [
-        {
-          "include-annotation": "android.platform.test.annotations.SocPresubmit"
         },
         {
-          "include-filter": "com.google.android.exoplayer.gts.DashTest#testWidevine23FpsH264Fixed"
+          "include-filter": "com.google.android.media.gts.WidevineYouTubePerformanceTests"
         }
       ]
     }
diff --git a/media/TEST_MAPPING b/media/TEST_MAPPING
index b006f38..50facfb 100644
--- a/media/TEST_MAPPING
+++ b/media/TEST_MAPPING
@@ -26,17 +26,9 @@
                 },
                 {
                     "include-filter": "com.google.android.media.gts.WidevineGenericOpsTests"
-                }
-            ]
-        },
-        {
-            "name": "GtsExoPlayerTestCases",
-            "options" : [
-                {
-                    "include-annotation": "android.platform.test.annotations.SocPresubmit"
                 },
                 {
-                    "include-filter": "com.google.android.exoplayer.gts.DashTest#testWidevine23FpsH264Fixed"
+                    "include-filter": "com.google.android.media.gts.WidevineYouTubePerformanceTests"
                 }
             ]
         }
diff --git a/media/audioserver/main_audioserver.cpp b/media/audioserver/main_audioserver.cpp
index 533d330..8ee1efb 100644
--- a/media/audioserver/main_audioserver.cpp
+++ b/media/audioserver/main_audioserver.cpp
@@ -49,7 +49,12 @@
 
     signal(SIGPIPE, SIG_IGN);
 
+#if 1
+    // FIXME See bug 165702394 and bug 168511485
+    const bool doLog = false;
+#else
     bool doLog = (bool) property_get_bool("ro.test_harness", 0);
+#endif
 
     pid_t childPid;
     // FIXME The advantage of making the process containing media.log service the parent process of
diff --git a/media/codec2/core/include/C2Enum.h b/media/codec2/core/include/C2Enum.h
index b0fad8f..da1f43b 100644
--- a/media/codec2/core/include/C2Enum.h
+++ b/media/codec2/core/include/C2Enum.h
@@ -54,7 +54,7 @@
 /// \note this will contain any initialization, which we will remove when converting to lower-case
 #define _C2_GET_ENUM_NAME(x, y) #x
 /// mapper to get value of enum
-#define _C2_GET_ENUM_VALUE(x, type) (_C2EnumConst<type>)x
+#define _C2_GET_ENUM_VALUE(x, type_) (_C2EnumConst<typename std::underlying_type<type_>::type>)type_::x
 
 /// \endcond
 
@@ -106,7 +106,7 @@
 template<> \
 C2FieldDescriptor::NamedValuesType C2FieldDescriptor::namedValuesFor(const name &r __unused) { \
     return _C2EnumUtils::sanitizeEnumValues( \
-            std::vector<C2Value::Primitive> { _C2_MAP(_C2_GET_ENUM_VALUE, type, __VA_ARGS__) }, \
+            std::vector<C2Value::Primitive> { _C2_MAP(_C2_GET_ENUM_VALUE, name, __VA_ARGS__) }, \
             { _C2_MAP(_C2_GET_ENUM_NAME, type, __VA_ARGS__) }, \
             prefix); \
 }
diff --git a/media/codec2/core/include/C2Param.h b/media/codec2/core/include/C2Param.h
index 51d417a..436269a 100644
--- a/media/codec2/core/include/C2Param.h
+++ b/media/codec2/core/include/C2Param.h
@@ -508,6 +508,14 @@
         return _mIndex.setPort(output);
     }
 
+    /// sets the size of this parameter.
+    inline void setSize(size_t size) {
+        if (size < sizeof(C2Param)) {
+            size = 0;
+        }
+        _mSize = c2_min(size, _mSize);
+    }
+
 public:
     /// invalidate this parameter. There is no recovery from this call; e.g. parameter
     /// cannot be 'corrected' to be valid.
diff --git a/media/codec2/core/include/C2ParamDef.h b/media/codec2/core/include/C2ParamDef.h
index 0a33283..d578820 100644
--- a/media/codec2/core/include/C2ParamDef.h
+++ b/media/codec2/core/include/C2ParamDef.h
@@ -97,6 +97,9 @@
         PARAM_TYPE = CoreIndex | TypeFlags
     };
 
+    // the underlying param struct type
+    typedef S Struct;
+
 protected:
     enum : uint32_t {
         FLEX_SIZE = 0,
@@ -270,6 +273,11 @@
         } \
         return 0; \
     } \
+    inline void setFlexCount(size_t count) { \
+        if (count < flexCount()) { \
+            this->setSize(sizeof(_Type) + _Type::FLEX_SIZE * count); \
+        } \
+    } \
 
 /// Mark flexible member variable and make structure flexible.
 #define FLEX(cls, m) \
diff --git a/media/codec2/sfplugin/CCodec.cpp b/media/codec2/sfplugin/CCodec.cpp
index 73b3857..1405b97 100644
--- a/media/codec2/sfplugin/CCodec.cpp
+++ b/media/codec2/sfplugin/CCodec.cpp
@@ -1331,8 +1331,6 @@
         mCallback->onError(err2, ACTION_CODE_FATAL);
         return;
     }
-    // We're not starting after flush.
-    (void)mSentConfigAfterResume.test_and_set();
     err2 = mChannel->start(inputFormat, outputFormat, buffersBoundToCodec);
     if (err2 != OK) {
         mCallback->onError(err2, ACTION_CODE_FATAL);
@@ -1580,7 +1578,6 @@
         return;
     }
 
-    mSentConfigAfterResume.clear();
     {
         Mutexed<std::unique_ptr<Config>>::Locked configLocked(mConfig);
         const std::unique_ptr<Config> &config = *configLocked;
@@ -1797,7 +1794,7 @@
             // handle configuration changes in work done
             Mutexed<std::unique_ptr<Config>>::Locked configLocked(mConfig);
             const std::unique_ptr<Config> &config = *configLocked;
-            bool changed = !mSentConfigAfterResume.test_and_set();
+            bool changed = false;
             Config::Watcher<C2StreamInitDataInfo::output> initData =
                 config->watch<C2StreamInitDataInfo::output>();
             if (!work->worklets.empty()
diff --git a/media/codec2/sfplugin/CCodecBuffers.cpp b/media/codec2/sfplugin/CCodecBuffers.cpp
index c49a16c..3c99bf6 100644
--- a/media/codec2/sfplugin/CCodecBuffers.cpp
+++ b/media/codec2/sfplugin/CCodecBuffers.cpp
@@ -91,7 +91,9 @@
             newFormat->setInt32(KEY_STRIDE, stride);
             ALOGD("[%s] updating stride = %d", mName, stride);
             if (img->mNumPlanes > 1 && stride > 0) {
-                int32_t vstride = (img->mPlane[1].mOffset - img->mPlane[0].mOffset) / stride;
+                int64_t offsetDelta =
+                    (int64_t)img->mPlane[1].mOffset - (int64_t)img->mPlane[0].mOffset;
+                int32_t vstride = int32_t(offsetDelta / stride);
                 newFormat->setInt32(KEY_SLICE_HEIGHT, vstride);
                 ALOGD("[%s] updating vstride = %d", mName, vstride);
             }
diff --git a/media/codec2/sfplugin/include/media/stagefright/CCodec.h b/media/codec2/sfplugin/include/media/stagefright/CCodec.h
index ecb2506..dbbb5d5 100644
--- a/media/codec2/sfplugin/include/media/stagefright/CCodec.h
+++ b/media/codec2/sfplugin/include/media/stagefright/CCodec.h
@@ -193,7 +193,6 @@
 
     Mutexed<std::unique_ptr<CCodecConfig>> mConfig;
     Mutexed<std::list<std::unique_ptr<C2Work>>> mWorkDoneQueue;
-    std::atomic_flag mSentConfigAfterResume;
 
     friend class CCodecCallbackImpl;
 
diff --git a/media/codec2/tests/C2Param_test.cpp b/media/codec2/tests/C2Param_test.cpp
index 564d4d2..c39605a 100644
--- a/media/codec2/tests/C2Param_test.cpp
+++ b/media/codec2/tests/C2Param_test.cpp
@@ -2328,6 +2328,17 @@
         static_assert(std::is_same<decltype(blobValue->m.value), uint8_t[]>::value, "should be uint8_t[]");
         EXPECT_EQ(0, memcmp(blobValue->m.value, "ABCD\0", 6));
         EXPECT_EQ(6u, blobValue->flexCount());
+        blobValue->setFlexCount(7u); // increasing the count does not change it
+        EXPECT_EQ(6u, blobValue->flexCount());
+        blobValue->setFlexCount(2u); // decreasing the count changes it to it
+        EXPECT_EQ(2u, blobValue->flexCount());
+        blobValue->setFlexCount(0u); // can decrease to 0 and blob remains valid
+        EXPECT_EQ(0u, blobValue->flexCount());
+        EXPECT_TRUE(*blobValue);
+        blobValue->invalidate(); // flex params can be invalidated => results in 0 size
+        EXPECT_FALSE(*blobValue);
+        EXPECT_EQ(0u, blobValue->size());
+
         std::vector<C2FieldDescriptor> fields = blobValue->FieldList();
         EXPECT_EQ(1u, fields.size());
         EXPECT_EQ(FD::BLOB, fields.cbegin()->type());
diff --git a/media/codec2/tests/C2UtilTest.cpp b/media/codec2/tests/C2UtilTest.cpp
index 59cd313..2d66df1 100644
--- a/media/codec2/tests/C2UtilTest.cpp
+++ b/media/codec2/tests/C2UtilTest.cpp
@@ -78,7 +78,7 @@
       { "value2", Enum3Value2 },
       { "value4", Enum3Value4 },
       { "invalid", Invalid } });
-    Enum3 e3;
+    Enum3 e3(Invalid);
     C2FieldDescriptor::namedValuesFor(e3);
 
     // upper case
diff --git a/media/extractors/TEST_MAPPING b/media/extractors/TEST_MAPPING
index 038b99a..4984b8f 100644
--- a/media/extractors/TEST_MAPPING
+++ b/media/extractors/TEST_MAPPING
@@ -1,7 +1,5 @@
 {
   "presubmit": [
-    // TODO(b/148094059): unit tests not allowed to download content
-    // { "name": "ExtractorUnitTest" },
 
     // TODO(b/153661591) enable test once the bug is fixed
     // This tests the extractor path
@@ -16,5 +14,14 @@
     //      }
     //    ]
     //  }
+  ],
+
+  // tests which require dynamic content
+  // invoke with: atest -- --enable-module-dynamic-download=true
+  // TODO(b/148094059): unit tests not allowed to download content
+  "dynamic-presubmit": [
+    { "name": "ExtractorUnitTest" }
   ]
+
+
 }
diff --git a/media/janitors/OWNERS-codecs b/media/janitors/OWNERS-codecs
new file mode 100644
index 0000000..e201399
--- /dev/null
+++ b/media/janitors/OWNERS-codecs
@@ -0,0 +1,5 @@
+# gerrit owner/approvers for the actual software codec libraries
+# differentiated from plugins connecting those codecs to either omx or codec2 infrastructure
+essick@google.com
+lajos@google.com
+marcone@google.com
diff --git a/media/janitors/README b/media/janitors/README
new file mode 100644
index 0000000..9db8e0e
--- /dev/null
+++ b/media/janitors/README
@@ -0,0 +1,4 @@
+A collection of OWNERS files that we reference from other projects,
+such as the software codecs in directories like external/libavc.
+This is to simplify our owner/approver management across the multiple
+projects related to media.
diff --git a/media/libaaudio/Android.bp b/media/libaaudio/Android.bp
index 140052f..e81ab06 100644
--- a/media/libaaudio/Android.bp
+++ b/media/libaaudio/Android.bp
@@ -32,5 +32,6 @@
 cc_library_headers {
     name: "libaaudio_headers",
     export_include_dirs: ["include"],
+    export_header_lib_headers: ["aaudio-aidl-cpp"],
+    header_libs: ["aaudio-aidl-cpp"],
 }
-
diff --git a/media/libaaudio/src/Android.bp b/media/libaaudio/src/Android.bp
index 717f31a..328ceda 100644
--- a/media/libaaudio/src/Android.bp
+++ b/media/libaaudio/src/Android.bp
@@ -85,6 +85,7 @@
         "libcutils",
         "libutils",
         "libbinder",
+        "aaudio-aidl-cpp",
     ],
 
     cflags: [
@@ -114,11 +115,10 @@
         "client/AudioStreamInternalPlay.cpp",
         "client/IsochronousClockModel.cpp",
         "binding/AudioEndpointParcelable.cpp",
+        "binding/AAudioBinderAdapter.cpp",
         "binding/AAudioBinderClient.cpp",
         "binding/AAudioStreamRequest.cpp",
         "binding/AAudioStreamConfiguration.cpp",
-        "binding/IAAudioClient.cpp",
-        "binding/IAAudioService.cpp",
         "binding/RingBufferParcelable.cpp",
         "binding/SharedMemoryParcelable.cpp",
         "binding/SharedRegionParcelable.cpp",
@@ -138,3 +138,33 @@
         misc_undefined: ["bounds"],
     },
 }
+
+aidl_interface {
+    name: "aaudio-aidl",
+    unstable: true,
+    local_include_dir: "binding/aidl",
+    srcs: [
+        "binding/aidl/aaudio/Endpoint.aidl",
+        "binding/aidl/aaudio/RingBuffer.aidl",
+        "binding/aidl/aaudio/SharedRegion.aidl",
+        "binding/aidl/aaudio/StreamParameters.aidl",
+        "binding/aidl/aaudio/StreamRequest.aidl",
+        "binding/aidl/aaudio/IAAudioClient.aidl",
+        "binding/aidl/aaudio/IAAudioService.aidl",
+    ],
+    imports: [
+        "audio_common-aidl",
+        "shared-file-region-aidl",
+    ],
+    backend:
+    {
+        cpp: {
+            enabled: true,
+        },
+        java: {
+            // TODO: need to have audio_common-aidl available in Java to enable
+            //       this.
+            enabled: false,
+        },
+    },
+}
diff --git a/media/libaaudio/src/binding/AAudioBinderAdapter.cpp b/media/libaaudio/src/binding/AAudioBinderAdapter.cpp
new file mode 100644
index 0000000..2b2fe6d
--- /dev/null
+++ b/media/libaaudio/src/binding/AAudioBinderAdapter.cpp
@@ -0,0 +1,125 @@
+/*
+ * Copyright (C) 2020 The Android Open Source Project
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ *      http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+#include <binding/AAudioBinderAdapter.h>
+#include <utility/AAudioUtilities.h>
+
+namespace aaudio {
+
+using android::binder::Status;
+
+AAudioBinderAdapter::AAudioBinderAdapter(IAAudioService* delegate)
+        : mDelegate(delegate) {}
+
+void AAudioBinderAdapter::registerClient(const android::sp<IAAudioClient>& client) {
+    mDelegate->registerClient(client);
+}
+
+aaudio_handle_t AAudioBinderAdapter::openStream(const AAudioStreamRequest& request,
+                                                AAudioStreamConfiguration& config) {
+    aaudio_handle_t result;
+    StreamParameters params;
+    Status status = mDelegate->openStream(request.parcelable(),
+                                          &params,
+                                          &result);
+    if (!status.isOk()) {
+        result = AAudioConvert_androidToAAudioResult(status.transactionError());
+    }
+    config = params;
+    return result;
+}
+
+aaudio_result_t AAudioBinderAdapter::closeStream(aaudio_handle_t streamHandle) {
+    aaudio_result_t result;
+    Status status = mDelegate->closeStream(streamHandle, &result);
+    if (!status.isOk()) {
+        result = AAudioConvert_androidToAAudioResult(status.transactionError());
+    }
+    return result;
+}
+
+aaudio_result_t AAudioBinderAdapter::getStreamDescription(aaudio_handle_t streamHandle,
+                                                          AudioEndpointParcelable& endpointOut) {
+    aaudio_result_t result;
+    Endpoint endpoint;
+    Status status = mDelegate->getStreamDescription(streamHandle,
+                                                    &endpoint,
+                                                    &result);
+    if (!status.isOk()) {
+        result = AAudioConvert_androidToAAudioResult(status.transactionError());
+    }
+    endpointOut = std::move(endpoint);
+    return result;
+}
+
+aaudio_result_t AAudioBinderAdapter::startStream(aaudio_handle_t streamHandle) {
+    aaudio_result_t result;
+    Status status = mDelegate->startStream(streamHandle, &result);
+    if (!status.isOk()) {
+        result = AAudioConvert_androidToAAudioResult(status.transactionError());
+    }
+    return result;
+}
+
+aaudio_result_t AAudioBinderAdapter::pauseStream(aaudio_handle_t streamHandle) {
+    aaudio_result_t result;
+    Status status = mDelegate->pauseStream(streamHandle, &result);
+    if (!status.isOk()) {
+        result = AAudioConvert_androidToAAudioResult(status.transactionError());
+    }
+    return result;
+}
+
+aaudio_result_t AAudioBinderAdapter::stopStream(aaudio_handle_t streamHandle) {
+    aaudio_result_t result;
+    Status status = mDelegate->stopStream(streamHandle, &result);
+    if (!status.isOk()) {
+        result = AAudioConvert_androidToAAudioResult(status.transactionError());
+    }
+    return result;
+}
+
+aaudio_result_t AAudioBinderAdapter::flushStream(aaudio_handle_t streamHandle) {
+    aaudio_result_t result;
+    Status status = mDelegate->flushStream(streamHandle, &result);
+    if (!status.isOk()) {
+        result = AAudioConvert_androidToAAudioResult(status.transactionError());
+    }
+    return result;
+}
+
+aaudio_result_t AAudioBinderAdapter::registerAudioThread(aaudio_handle_t streamHandle,
+                                                         pid_t clientThreadId,
+                                                         int64_t periodNanoseconds) {
+    aaudio_result_t result;
+    Status status = mDelegate->registerAudioThread(streamHandle, clientThreadId, periodNanoseconds, &result);
+    if (!status.isOk()) {
+        result = AAudioConvert_androidToAAudioResult(status.transactionError());
+    }
+    return result;
+}
+
+aaudio_result_t AAudioBinderAdapter::unregisterAudioThread(aaudio_handle_t streamHandle,
+                                                           pid_t clientThreadId) {
+    aaudio_result_t result;
+    Status status = mDelegate->unregisterAudioThread(streamHandle, clientThreadId, &result);
+    if (!status.isOk()) {
+        result = AAudioConvert_androidToAAudioResult(status.transactionError());
+    }
+    return result;
+}
+
+}  // namespace aaudio
diff --git a/media/libaaudio/src/binding/AAudioBinderAdapter.h b/media/libaaudio/src/binding/AAudioBinderAdapter.h
new file mode 100644
index 0000000..5e9ab57
--- /dev/null
+++ b/media/libaaudio/src/binding/AAudioBinderAdapter.h
@@ -0,0 +1,64 @@
+/*
+ * Copyright (C) 2020 The Android Open Source Project
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ *      http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+#pragma once
+
+#include <aaudio/IAAudioService.h>
+#include <binding/AAudioServiceInterface.h>
+
+namespace aaudio {
+
+/**
+ * An adapter that takes in an underlying IAAudioService and exposes an
+ * AAudioServiceInterface.
+ *
+ * This class is abstract: the client is expected to inherit from this class and implement those
+ * methods from AAudioServiceInterface that don't have counterparts in IAAudioService.
+ */
+class AAudioBinderAdapter : public AAudioServiceInterface {
+public:
+    explicit AAudioBinderAdapter(IAAudioService* delegate);
+
+    void registerClient(const android::sp<IAAudioClient>& client) override;
+
+    aaudio_handle_t openStream(const AAudioStreamRequest& request,
+                               AAudioStreamConfiguration& configuration) override;
+
+    aaudio_result_t closeStream(aaudio_handle_t streamHandle) override;
+
+    aaudio_result_t getStreamDescription(aaudio_handle_t streamHandle,
+                                         AudioEndpointParcelable& endpoint) override;
+
+    aaudio_result_t startStream(aaudio_handle_t streamHandle) override;
+
+    aaudio_result_t pauseStream(aaudio_handle_t streamHandle) override;
+
+    aaudio_result_t stopStream(aaudio_handle_t streamHandle) override;
+
+    aaudio_result_t flushStream(aaudio_handle_t streamHandle) override;
+
+    aaudio_result_t registerAudioThread(aaudio_handle_t streamHandle,
+                                        pid_t clientThreadId,
+                                        int64_t periodNanoseconds) override;
+
+    aaudio_result_t unregisterAudioThread(aaudio_handle_t streamHandle,
+                                          pid_t clientThreadId) override;
+
+private:
+    IAAudioService* const mDelegate;
+};
+
+}  // namespace aaudio
diff --git a/media/libaaudio/src/binding/AAudioBinderClient.cpp b/media/libaaudio/src/binding/AAudioBinderClient.cpp
index 7b0d31f..fa5a2da 100644
--- a/media/libaaudio/src/binding/AAudioBinderClient.cpp
+++ b/media/libaaudio/src/binding/AAudioBinderClient.cpp
@@ -19,35 +19,30 @@
 //#define LOG_NDEBUG 0
 #include <utils/Log.h>
 
-#include <binder/IInterface.h>
 #include <binder/IServiceManager.h>
 #include <binder/ProcessState.h>
 #include <utils/Mutex.h>
 #include <utils/RefBase.h>
 #include <utils/Singleton.h>
-#include <media/AudioSystem.h>
-
 #include <aaudio/AAudio.h>
 
 #include "AudioEndpointParcelable.h"
-#include "binding/AAudioBinderClient.h"
-//#include "binding/AAudioStreamRequest.h"
-//#include "binding/AAudioStreamConfiguration.h"
-//#include "binding/IAAudioService.h"
-//#include "binding/AAudioServiceMessage.h"
 
-//#include "AAudioServiceInterface.h"
+#include "binding/AAudioBinderClient.h"
+
+#define AAUDIO_SERVICE_NAME  "media.aaudio"
 
 using android::String16;
 using android::IServiceManager;
 using android::defaultServiceManager;
 using android::interface_cast;
 using android::IInterface;
-using android::IAAudioService;
 using android::Mutex;
 using android::ProcessState;
 using android::sp;
+using android::status_t;
 using android::wp;
+using android::binder::Status;
 
 using namespace aaudio;
 
@@ -67,20 +62,18 @@
 AAudioBinderClient::~AAudioBinderClient() {
     ALOGV("%s - destroying %p", __func__, this);
     Mutex::Autolock _l(mServiceLock);
-    if (mAAudioService != 0) {
-        IInterface::asBinder(mAAudioService)->unlinkToDeath(mAAudioClient);
-    }
 }
 
 // TODO Share code with other service clients.
 // Helper function to get access to the "AAudioService" service.
 // This code was modeled after frameworks/av/media/libaudioclient/AudioSystem.cpp
-const sp<IAAudioService> AAudioBinderClient::getAAudioService() {
+std::shared_ptr<AAudioServiceInterface> AAudioBinderClient::getAAudioService() {
+    std::shared_ptr<AAudioServiceInterface> result;
     sp<IAAudioService> aaudioService;
     bool needToRegister = false;
     {
         Mutex::Autolock _l(mServiceLock);
-        if (mAAudioService.get() == nullptr) {
+        if (mAdapter == nullptr) {
             sp<IBinder> binder;
             sp<IServiceManager> sm = defaultServiceManager();
             // Try several times to get the service.
@@ -99,7 +92,8 @@
                 if (status != NO_ERROR) {
                     ALOGE("%s() - linkToDeath() returned %d", __func__, status);
                 }
-                mAAudioService = interface_cast<IAAudioService>(binder);
+                aaudioService = interface_cast<IAAudioService>(binder);
+                mAdapter.reset(new Adapter(aaudioService, mAAudioClient));
                 needToRegister = true;
                 // Make sure callbacks can be received by mAAudioClient
                 ProcessState::self()->startThreadPool();
@@ -107,18 +101,18 @@
                 ALOGE("AAudioBinderClient could not connect to %s", AAUDIO_SERVICE_NAME);
             }
         }
-        aaudioService = mAAudioService;
+        result = mAdapter;
     }
     // Do this outside the mutex lock.
     if (needToRegister && aaudioService.get() != nullptr) { // new client?
         aaudioService->registerClient(mAAudioClient);
     }
-    return aaudioService;
+    return result;
 }
 
 void AAudioBinderClient::dropAAudioService() {
     Mutex::Autolock _l(mServiceLock);
-    mAAudioService.clear(); // force a reconnect
+    mAdapter.reset();
 }
 
 /**
@@ -127,13 +121,13 @@
 * @return handle to the stream or a negative error
 */
 aaudio_handle_t AAudioBinderClient::openStream(const AAudioStreamRequest &request,
-                                               AAudioStreamConfiguration &configurationOutput) {
+                                               AAudioStreamConfiguration &configuration) {
     aaudio_handle_t stream;
     for (int i = 0; i < 2; i++) {
-        const sp<IAAudioService> &service = getAAudioService();
+        std::shared_ptr<AAudioServiceInterface> service = getAAudioService();
         if (service.get() == nullptr) return AAUDIO_ERROR_NO_SERVICE;
 
-        stream = service->openStream(request, configurationOutput);
+        stream = service->openStream(request, configuration);
 
         if (stream == AAUDIO_ERROR_NO_SERVICE) {
             ALOGE("openStream lost connection to AAudioService.");
@@ -146,8 +140,9 @@
 }
 
 aaudio_result_t AAudioBinderClient::closeStream(aaudio_handle_t streamHandle) {
-    const sp<IAAudioService> service = getAAudioService();
+    std::shared_ptr<AAudioServiceInterface> service = getAAudioService();
     if (service.get() == nullptr) return AAUDIO_ERROR_NO_SERVICE;
+
     return service->closeStream(streamHandle);
 }
 
@@ -155,33 +150,38 @@
 * used to communicate with the underlying HAL or Service.
 */
 aaudio_result_t AAudioBinderClient::getStreamDescription(aaudio_handle_t streamHandle,
-                                                         AudioEndpointParcelable &parcelable) {
-    const sp<IAAudioService> service = getAAudioService();
+                                                         AudioEndpointParcelable& endpointOut) {
+    std::shared_ptr<AAudioServiceInterface> service = getAAudioService();
     if (service.get() == nullptr) return AAUDIO_ERROR_NO_SERVICE;
-    return service->getStreamDescription(streamHandle, parcelable);
+
+    return service->getStreamDescription(streamHandle, endpointOut);
 }
 
 aaudio_result_t AAudioBinderClient::startStream(aaudio_handle_t streamHandle) {
-    const sp<IAAudioService> service = getAAudioService();
+    std::shared_ptr<AAudioServiceInterface> service = getAAudioService();
     if (service.get() == nullptr) return AAUDIO_ERROR_NO_SERVICE;
+
     return service->startStream(streamHandle);
 }
 
 aaudio_result_t AAudioBinderClient::pauseStream(aaudio_handle_t streamHandle) {
-    const sp<IAAudioService> service = getAAudioService();
+    std::shared_ptr<AAudioServiceInterface> service = getAAudioService();
     if (service.get() == nullptr) return AAUDIO_ERROR_NO_SERVICE;
+
     return service->pauseStream(streamHandle);
 }
 
 aaudio_result_t AAudioBinderClient::stopStream(aaudio_handle_t streamHandle) {
-    const sp<IAAudioService> service = getAAudioService();
+    std::shared_ptr<AAudioServiceInterface> service = getAAudioService();
     if (service.get() == nullptr) return AAUDIO_ERROR_NO_SERVICE;
+
     return service->stopStream(streamHandle);
 }
 
 aaudio_result_t AAudioBinderClient::flushStream(aaudio_handle_t streamHandle) {
-    const sp<IAAudioService> service = getAAudioService();
+    std::shared_ptr<AAudioServiceInterface> service = getAAudioService();
     if (service.get() == nullptr) return AAUDIO_ERROR_NO_SERVICE;
+
     return service->flushStream(streamHandle);
 }
 
@@ -191,17 +191,16 @@
 aaudio_result_t AAudioBinderClient::registerAudioThread(aaudio_handle_t streamHandle,
                                                         pid_t clientThreadId,
                                                         int64_t periodNanoseconds) {
-    const sp<IAAudioService> service = getAAudioService();
+    std::shared_ptr<AAudioServiceInterface> service = getAAudioService();
     if (service.get() == nullptr) return AAUDIO_ERROR_NO_SERVICE;
-    return service->registerAudioThread(streamHandle,
-                                        clientThreadId,
-                                        periodNanoseconds);
+
+    return service->registerAudioThread(streamHandle, clientThreadId, periodNanoseconds);
 }
 
 aaudio_result_t AAudioBinderClient::unregisterAudioThread(aaudio_handle_t streamHandle,
                                                           pid_t clientThreadId) {
-    const sp<IAAudioService> service = getAAudioService();
+    std::shared_ptr<AAudioServiceInterface> service = getAAudioService();
     if (service.get() == nullptr) return AAUDIO_ERROR_NO_SERVICE;
-    return service->unregisterAudioThread(streamHandle,
-                                          clientThreadId);
+
+    return service->unregisterAudioThread(streamHandle, clientThreadId);
 }
diff --git a/media/libaaudio/src/binding/AAudioBinderClient.h b/media/libaaudio/src/binding/AAudioBinderClient.h
index e8c91fc..6a7b639 100644
--- a/media/libaaudio/src/binding/AAudioBinderClient.h
+++ b/media/libaaudio/src/binding/AAudioBinderClient.h
@@ -21,12 +21,15 @@
 #include <utils/Singleton.h>
 
 #include <aaudio/AAudio.h>
-#include "AAudioServiceDefinitions.h"
+#include <binder/IInterface.h>
+
+#include "aaudio/BnAAudioClient.h"
+#include "aaudio/IAAudioService.h"
 #include "AAudioServiceInterface.h"
+#include "binding/AAudioBinderAdapter.h"
 #include "binding/AAudioStreamRequest.h"
-#include "binding/AAudioStreamConfiguration.h"
 #include "binding/AudioEndpointParcelable.h"
-#include "binding/IAAudioService.h"
+#include "core/AAudioStreamParameters.h"
 
 /**
  * Implements the AAudioServiceInterface by talking to the service through Binder.
@@ -44,11 +47,7 @@
 
     virtual ~AAudioBinderClient();
 
-    const android::sp<android::IAAudioService> getAAudioService();
-
-    void dropAAudioService();
-
-    void registerClient(const android::sp<android::IAAudioClient>& client __unused) override {}
+    void registerClient(const android::sp<IAAudioClient>& client __unused) override {}
 
     /**
      * @param request info needed to create the stream
@@ -64,7 +63,7 @@
     * used to communicate with the underlying HAL or Service.
     */
     aaudio_result_t getStreamDescription(aaudio_handle_t streamHandle,
-                                                 AudioEndpointParcelable &parcelable) override;
+                                         AudioEndpointParcelable &endpointOut) override;
 
     /**
      * Start the flow of data.
@@ -115,8 +114,7 @@
         ALOGW("onStreamChange called!");
     }
 
-    class AAudioClient : public android::IBinder::DeathRecipient , public android::BnAAudioClient
-    {
+    class AAudioClient : public android::IBinder::DeathRecipient, public BnAAudioClient {
     public:
         AAudioClient(android::wp<AAudioBinderClient> aaudioBinderClient)
                 : mBinderClient(aaudioBinderClient) {
@@ -132,21 +130,66 @@
         }
 
         // implement BnAAudioClient
-        void onStreamChange(aaudio_handle_t handle, int32_t opcode, int32_t value) {
+        android::binder::Status onStreamChange(int32_t handle, int32_t opcode, int32_t value) {
+            static_assert(std::is_same_v<aaudio_handle_t, int32_t>);
             android::sp<AAudioBinderClient> client = mBinderClient.promote();
             if (client.get() != nullptr) {
                 client->onStreamChange(handle, opcode, value);
             }
+            return android::binder::Status::ok();
         }
     private:
         android::wp<AAudioBinderClient> mBinderClient;
     };
 
-private:
+    // This adapter is used to convert the binder interface (delegate) to the AudioServiceInterface
+    // conventions (translating between data types and respective parcelables, translating error
+    // codes and calling conventions).
+    // The adapter also owns the underlying service object and is responsible to unlink its death
+    // listener when destroyed.
+    class Adapter : public AAudioBinderAdapter {
+    public:
+        Adapter(const android::sp<IAAudioService>& delegate,
+                const android::sp<AAudioClient>& aaudioClient)
+                : AAudioBinderAdapter(delegate.get()),
+                  mDelegate(delegate),
+                  mAAudioClient(aaudioClient) {}
 
-    android::Mutex                  mServiceLock;
-    android::sp<android::IAAudioService>  mAAudioService;
-    android::sp<AAudioClient>       mAAudioClient;
+        virtual ~Adapter() {
+            if (mDelegate != nullptr) {
+                android::IInterface::asBinder(mDelegate)->unlinkToDeath(mAAudioClient);
+            }
+        }
+
+        // This should never be called (call is rejected at the AudioBinderClient level).
+        aaudio_result_t startClient(aaudio_handle_t streamHandle __unused,
+                                    const android::AudioClient& client __unused,
+                                    const audio_attributes_t* attr __unused,
+                                    audio_port_handle_t* clientHandle __unused) override {
+            LOG_ALWAYS_FATAL("Shouldn't get here");
+            return AAUDIO_ERROR_UNAVAILABLE;
+        }
+
+        // This should never be called (call is rejected at the AudioBinderClient level).
+        aaudio_result_t stopClient(aaudio_handle_t streamHandle __unused,
+                                   audio_port_handle_t clientHandle __unused) override {
+            LOG_ALWAYS_FATAL("Shouldn't get here");
+            return AAUDIO_ERROR_UNAVAILABLE;
+        }
+
+    private:
+        android::sp<IAAudioService> mDelegate;
+        android::sp<AAudioClient> mAAudioClient;
+    };
+
+private:
+    android::Mutex                          mServiceLock;
+    std::shared_ptr<AAudioServiceInterface> mAdapter;
+    android::sp<AAudioClient>               mAAudioClient;
+
+    std::shared_ptr<AAudioServiceInterface> getAAudioService();
+
+    void dropAAudioService();
 
 };
 
diff --git a/media/libaaudio/src/binding/AAudioServiceInterface.h b/media/libaaudio/src/binding/AAudioServiceInterface.h
index 9c28cc7..5d11512 100644
--- a/media/libaaudio/src/binding/AAudioServiceInterface.h
+++ b/media/libaaudio/src/binding/AAudioServiceInterface.h
@@ -20,11 +20,11 @@
 #include <utils/StrongPointer.h>
 #include <media/AudioClient.h>
 
+#include "aaudio/IAAudioClient.h"
 #include "binding/AAudioServiceDefinitions.h"
 #include "binding/AAudioStreamRequest.h"
 #include "binding/AAudioStreamConfiguration.h"
 #include "binding/AudioEndpointParcelable.h"
-#include "binding/IAAudioClient.h"
 
 /**
  * This has the same methods as IAAudioService but without the Binder features.
@@ -40,7 +40,7 @@
     AAudioServiceInterface() {};
     virtual ~AAudioServiceInterface() = default;
 
-    virtual void registerClient(const android::sp<android::IAAudioClient>& client) = 0;
+    virtual void registerClient(const android::sp<IAAudioClient>& client) = 0;
 
     /**
      * @param request info needed to create the stream
diff --git a/media/libaaudio/src/binding/AAudioStreamConfiguration.cpp b/media/libaaudio/src/binding/AAudioStreamConfiguration.cpp
index b785f88..2d501ef 100644
--- a/media/libaaudio/src/binding/AAudioStreamConfiguration.cpp
+++ b/media/libaaudio/src/binding/AAudioStreamConfiguration.cpp
@@ -23,101 +23,66 @@
 #include <sys/mman.h>
 #include <aaudio/AAudio.h>
 
-#include <binder/Parcel.h>
-#include <binder/Parcelable.h>
-
 #include "binding/AAudioStreamConfiguration.h"
 
-using android::NO_ERROR;
-using android::status_t;
-using android::Parcel;
-using android::Parcelable;
-
 using namespace aaudio;
 
-AAudioStreamConfiguration::AAudioStreamConfiguration() {}
-AAudioStreamConfiguration::~AAudioStreamConfiguration() {}
+using android::media::audio::common::AudioFormat;
 
-status_t AAudioStreamConfiguration::writeToParcel(Parcel* parcel) const {
-    status_t status;
-
-    status = parcel->writeInt32(getDeviceId());
-    if (status != NO_ERROR) goto error;
-    status = parcel->writeInt32(getSampleRate());
-    if (status != NO_ERROR) goto error;
-    status = parcel->writeInt32(getSamplesPerFrame());
-    if (status != NO_ERROR) goto error;
-    status = parcel->writeInt32((int32_t) getSharingMode());
-    if (status != NO_ERROR) goto error;
-    status = parcel->writeInt32((int32_t) getFormat());
-    if (status != NO_ERROR) goto error;
-
-    status = parcel->writeInt32((int32_t) getDirection());
-    if (status != NO_ERROR) goto error;
-    status = parcel->writeInt32(getBufferCapacity());
-    if (status != NO_ERROR) goto error;
-    status = parcel->writeInt32((int32_t) getUsage());
-    if (status != NO_ERROR) goto error;
-    status = parcel->writeInt32((int32_t) getContentType());
-    if (status != NO_ERROR) goto error;
-    status = parcel->writeInt32((int32_t) getInputPreset());
-    if (status != NO_ERROR) goto error;
-    status = parcel->writeInt32((int32_t) getAllowedCapturePolicy());
-    if (status != NO_ERROR) goto error;
-    status = parcel->writeInt32(getSessionId());
-    if (status != NO_ERROR) goto error;
-    status = parcel->writeInt32(isPrivacySensitive() ? 1 : 0);
-    if (status != NO_ERROR) goto error;
-    return NO_ERROR;
-error:
-    ALOGE("%s(): write failed = %d", __func__, status);
-    return status;
+AAudioStreamConfiguration::AAudioStreamConfiguration(const StreamParameters& parcelable) {
+    setSamplesPerFrame(parcelable.samplesPerFrame);
+    setSampleRate(parcelable.sampleRate);
+    setDeviceId(parcelable.deviceId);
+    static_assert(sizeof(aaudio_sharing_mode_t) == sizeof(parcelable.sharingMode));
+    setSharingMode(parcelable.sharingMode);
+    static_assert(sizeof(audio_format_t) == sizeof(parcelable.audioFormat));
+    setFormat(static_cast<audio_format_t>(parcelable.audioFormat));
+    static_assert(sizeof(aaudio_direction_t) == sizeof(parcelable.direction));
+    setDirection(parcelable.direction);
+    static_assert(sizeof(audio_usage_t) == sizeof(parcelable.usage));
+    setUsage(parcelable.usage);
+    static_assert(sizeof(aaudio_content_type_t) == sizeof(parcelable.contentType));
+    setContentType(parcelable.contentType);
+    static_assert(sizeof(aaudio_input_preset_t) == sizeof(parcelable.inputPreset));
+    setInputPreset(parcelable.inputPreset);
+    setBufferCapacity(parcelable.bufferCapacity);
+    static_assert(
+            sizeof(aaudio_allowed_capture_policy_t) == sizeof(parcelable.allowedCapturePolicy));
+    setAllowedCapturePolicy(parcelable.allowedCapturePolicy);
+    static_assert(sizeof(aaudio_session_id_t) == sizeof(parcelable.sessionId));
+    setSessionId(parcelable.sessionId);
+    setPrivacySensitive(parcelable.isPrivacySensitive);
 }
 
-status_t AAudioStreamConfiguration::readFromParcel(const Parcel* parcel) {
-    int32_t value;
-    status_t status = parcel->readInt32(&value);
-    if (status != NO_ERROR) goto error;
-    setDeviceId(value);
-    status = parcel->readInt32(&value);
-    if (status != NO_ERROR) goto error;
-    setSampleRate(value);
-    status = parcel->readInt32(&value);
-    if (status != NO_ERROR) goto error;
-    setSamplesPerFrame(value);
-    status = parcel->readInt32(&value);
-    if (status != NO_ERROR) goto error;
-    setSharingMode((aaudio_sharing_mode_t) value);
-    status = parcel->readInt32(&value);
-    if (status != NO_ERROR) goto error;
-    setFormat((audio_format_t) value);
+AAudioStreamConfiguration&
+AAudioStreamConfiguration::operator=(const StreamParameters& parcelable) {
+    this->~AAudioStreamConfiguration();
+    new (this) AAudioStreamConfiguration(parcelable);
+    return *this;
+}
 
-    status = parcel->readInt32(&value);
-    if (status != NO_ERROR) goto error;
-    setDirection((aaudio_direction_t) value);
-    status = parcel->readInt32(&value);
-    if (status != NO_ERROR) goto error;
-    setBufferCapacity(value);
-    status = parcel->readInt32(&value);
-    if (status != NO_ERROR) goto error;
-    setUsage((aaudio_usage_t) value);
-    status = parcel->readInt32(&value);
-    if (status != NO_ERROR) goto error;
-    setContentType((aaudio_content_type_t) value);
-    status = parcel->readInt32(&value);
-    if (status != NO_ERROR) goto error;
-    setInputPreset((aaudio_input_preset_t) value);
-    status = parcel->readInt32(&value);
-    if (status != NO_ERROR) goto error;
-    setAllowedCapturePolicy((aaudio_allowed_capture_policy_t) value);
-    status = parcel->readInt32(&value);
-    if (status != NO_ERROR) goto error;
-    setSessionId(value);
-    status = parcel->readInt32(&value);
-    if (status != NO_ERROR) goto error;
-    setPrivacySensitive(value == 1);
-    return NO_ERROR;
-error:
-    ALOGE("%s(): read failed = %d", __func__, status);
-    return status;
+StreamParameters AAudioStreamConfiguration::parcelable() const {
+    StreamParameters result;
+    result.samplesPerFrame = getSamplesPerFrame();
+    result.sampleRate = getSampleRate();
+    result.deviceId = getDeviceId();
+    static_assert(sizeof(aaudio_sharing_mode_t) == sizeof(result.sharingMode));
+    result.sharingMode = getSharingMode();
+    static_assert(sizeof(audio_format_t) == sizeof(result.audioFormat));
+    result.audioFormat = static_cast<AudioFormat>(getFormat());
+    static_assert(sizeof(aaudio_direction_t) == sizeof(result.direction));
+    result.direction = getDirection();
+    static_assert(sizeof(audio_usage_t) == sizeof(result.usage));
+    result.usage = getUsage();
+    static_assert(sizeof(aaudio_content_type_t) == sizeof(result.contentType));
+    result.contentType = getContentType();
+    static_assert(sizeof(aaudio_input_preset_t) == sizeof(result.inputPreset));
+    result.inputPreset = getInputPreset();
+    result.bufferCapacity = getBufferCapacity();
+    static_assert(sizeof(aaudio_allowed_capture_policy_t) == sizeof(result.allowedCapturePolicy));
+    result.allowedCapturePolicy = getAllowedCapturePolicy();
+    static_assert(sizeof(aaudio_session_id_t) == sizeof(result.sessionId));
+    result.sessionId = getSessionId();
+    result.isPrivacySensitive = isPrivacySensitive();
+    return result;
 }
diff --git a/media/libaaudio/src/binding/AAudioStreamConfiguration.h b/media/libaaudio/src/binding/AAudioStreamConfiguration.h
index b324896..f428eb0 100644
--- a/media/libaaudio/src/binding/AAudioStreamConfiguration.h
+++ b/media/libaaudio/src/binding/AAudioStreamConfiguration.h
@@ -20,24 +20,24 @@
 #include <stdint.h>
 
 #include <aaudio/AAudio.h>
+#include <aaudio/StreamParameters.h>
 #include <binder/Parcel.h>
 #include <binder/Parcelable.h>
 #include "core/AAudioStreamParameters.h"
 
-using android::status_t;
-using android::Parcel;
-using android::Parcelable;
-
 namespace aaudio {
 
-class AAudioStreamConfiguration : public AAudioStreamParameters, public Parcelable {
+// This is a holder for AAudioStreamParameters, which allows conversion to/from it parcelable
+// representation, StreamParameters.
+class AAudioStreamConfiguration : public AAudioStreamParameters {
 public:
-    AAudioStreamConfiguration();
-    virtual ~AAudioStreamConfiguration();
+    AAudioStreamConfiguration() = default;
 
-    virtual status_t writeToParcel(Parcel* parcel) const override;
+    explicit AAudioStreamConfiguration(const StreamParameters& parcelable);
 
-    virtual status_t readFromParcel(const Parcel* parcel) override;
+    AAudioStreamConfiguration& operator=(const StreamParameters& parcelable);
+
+    StreamParameters parcelable() const;
 };
 
 } /* namespace aaudio */
diff --git a/media/libaaudio/src/binding/AAudioStreamRequest.cpp b/media/libaaudio/src/binding/AAudioStreamRequest.cpp
index c30c5b9..536395a 100644
--- a/media/libaaudio/src/binding/AAudioStreamRequest.cpp
+++ b/media/libaaudio/src/binding/AAudioStreamRequest.cpp
@@ -21,67 +21,32 @@
 #include <stdint.h>
 
 #include <sys/mman.h>
-#include <binder/Parcel.h>
-#include <binder/Parcelable.h>
 
 #include <aaudio/AAudio.h>
 
 #include "binding/AAudioStreamConfiguration.h"
 #include "binding/AAudioStreamRequest.h"
 
-using android::NO_ERROR;
-using android::status_t;
-using android::Parcel;
-using android::Parcelable;
-
 using namespace aaudio;
 
-AAudioStreamRequest::AAudioStreamRequest()
-    : mConfiguration()
-    {}
-
-AAudioStreamRequest::~AAudioStreamRequest() {}
-
-status_t AAudioStreamRequest::writeToParcel(Parcel* parcel) const {
-    status_t status = parcel->writeInt32((int32_t) mUserId);
-    if (status != NO_ERROR) goto error;
-
-    status = parcel->writeBool(mSharingModeMatchRequired);
-    if (status != NO_ERROR) goto error;
-
-    status = parcel->writeBool(mInService);
-    if (status != NO_ERROR) goto error;
-
-    status = mConfiguration.writeToParcel(parcel);
-    if (status != NO_ERROR) goto error;
-
-    return NO_ERROR;
-
-error:
-    ALOGE("writeToParcel(): write failed = %d", status);
-    return status;
+AAudioStreamRequest::AAudioStreamRequest(const StreamRequest& parcelable) :
+        mConfiguration(std::move(parcelable.params)),
+        mUserId(parcelable.userId),
+        mProcessId(parcelable.processId),
+        mSharingModeMatchRequired(parcelable.sharingModeMatchRequired),
+        mInService(parcelable.inService) {
+    static_assert(sizeof(mUserId) == sizeof(parcelable.userId));
+    static_assert(sizeof(mProcessId) == sizeof(parcelable.processId));
 }
 
-status_t AAudioStreamRequest::readFromParcel(const Parcel* parcel) {
-    int32_t temp;
-    status_t status = parcel->readInt32(&temp);
-    if (status != NO_ERROR) goto error;
-    mUserId = (uid_t) temp;
-
-    status = parcel->readBool(&mSharingModeMatchRequired);
-    if (status != NO_ERROR) goto error;
-
-    status = parcel->readBool(&mInService);
-    if (status != NO_ERROR) goto error;
-
-    status = mConfiguration.readFromParcel(parcel);
-    if (status != NO_ERROR) goto error;
-
-    return NO_ERROR;
-
-error:
-    ALOGE("readFromParcel(): read failed = %d", status);
-    return status;
+StreamRequest AAudioStreamRequest::parcelable() const {
+    StreamRequest result;
+    result.params = std::move(mConfiguration).parcelable();
+    result.userId = mUserId;
+    result.processId = mProcessId;
+    result.sharingModeMatchRequired = mSharingModeMatchRequired;
+    result.inService = mInService;
+    return result;
 }
 
 aaudio_result_t AAudioStreamRequest::validate() const {
diff --git a/media/libaaudio/src/binding/AAudioStreamRequest.h b/media/libaaudio/src/binding/AAudioStreamRequest.h
index 492f69d..31d3ea1 100644
--- a/media/libaaudio/src/binding/AAudioStreamRequest.h
+++ b/media/libaaudio/src/binding/AAudioStreamRequest.h
@@ -20,21 +20,18 @@
 #include <stdint.h>
 
 #include <aaudio/AAudio.h>
-#include <binder/Parcel.h>
-#include <binder/Parcelable.h>
+#include <aaudio/StreamRequest.h>
 
 #include "binding/AAudioStreamConfiguration.h"
 
-using android::status_t;
-using android::Parcel;
-using android::Parcelable;
-
 namespace aaudio {
 
-class AAudioStreamRequest : public Parcelable {
+class AAudioStreamRequest {
 public:
-    AAudioStreamRequest();
-    virtual ~AAudioStreamRequest();
+    AAudioStreamRequest() = default;
+
+    // Construct based on a parcelable representation.
+    explicit AAudioStreamRequest(const StreamRequest& parcelable);
 
     uid_t getUserId() const {
         return mUserId;
@@ -76,15 +73,14 @@
         mInService = inService;
     }
 
-    virtual status_t writeToParcel(Parcel* parcel) const override;
-
-    virtual status_t readFromParcel(const Parcel* parcel) override;
-
     aaudio_result_t validate() const;
 
     void dump() const;
 
-protected:
+    // Extract a parcelable representation of this object.
+    StreamRequest parcelable() const;
+
+private:
     AAudioStreamConfiguration  mConfiguration;
     uid_t                      mUserId = (uid_t) -1;
     pid_t                      mProcessId = (pid_t) -1;
diff --git a/media/libaaudio/src/binding/AudioEndpointParcelable.cpp b/media/libaaudio/src/binding/AudioEndpointParcelable.cpp
index 61d7d27..aa4ac27 100644
--- a/media/libaaudio/src/binding/AudioEndpointParcelable.cpp
+++ b/media/libaaudio/src/binding/AudioEndpointParcelable.cpp
@@ -29,22 +29,43 @@
 #include "binding/AudioEndpointParcelable.h"
 
 using android::base::unique_fd;
+using android::media::SharedFileRegion;
 using android::NO_ERROR;
 using android::status_t;
-using android::Parcel;
-using android::Parcelable;
 
 using namespace aaudio;
 
-/**
- * Container for information about the message queues plus
- * general stream information needed by AAudio clients.
- * It contains no addresses, just sizes, offsets and file descriptors for
- * shared memory that can be passed through Binder.
- */
-AudioEndpointParcelable::AudioEndpointParcelable() {}
+AudioEndpointParcelable::AudioEndpointParcelable(Endpoint&& parcelable)
+        : mUpMessageQueueParcelable(std::move(parcelable.upMessageQueueParcelable)),
+          mDownMessageQueueParcelable(std::move(parcelable.downMessageQueueParcelable)),
+          mUpDataQueueParcelable(std::move(parcelable.upDataQueueParcelable)),
+          mDownDataQueueParcelable(std::move(parcelable.downDataQueueParcelable)),
+          mNumSharedMemories(parcelable.sharedMemories.size()) {
+    for (size_t i = 0; i < parcelable.sharedMemories.size() && i < MAX_SHARED_MEMORIES; ++i) {
+        // Re-construct.
+        mSharedMemories[i].~SharedMemoryParcelable();
+        new(&mSharedMemories[i]) SharedMemoryParcelable(std::move(parcelable.sharedMemories[i]));
+    }
+}
 
-AudioEndpointParcelable::~AudioEndpointParcelable() {}
+AudioEndpointParcelable& AudioEndpointParcelable::operator=(Endpoint&& parcelable) {
+    this->~AudioEndpointParcelable();
+    new(this) AudioEndpointParcelable(std::move(parcelable));
+    return *this;
+}
+
+Endpoint AudioEndpointParcelable::parcelable()&& {
+    Endpoint result;
+    result.upMessageQueueParcelable = std::move(mUpMessageQueueParcelable).parcelable();
+    result.downMessageQueueParcelable = std::move(mDownMessageQueueParcelable).parcelable();
+    result.upDataQueueParcelable = std::move(mUpDataQueueParcelable).parcelable();
+    result.downDataQueueParcelable = std::move(mDownDataQueueParcelable).parcelable();
+    result.sharedMemories.reserve(std::min(mNumSharedMemories, MAX_SHARED_MEMORIES));
+    for (size_t i = 0; i < mNumSharedMemories && i < MAX_SHARED_MEMORIES; ++i) {
+        result.sharedMemories.emplace_back(std::move(mSharedMemories[i]).parcelable());
+    }
+    return result;
+}
 
 /**
  * Add the file descriptor to the table.
@@ -60,60 +81,6 @@
     return index;
 }
 
-/**
- * The read and write must be symmetric.
- */
-status_t AudioEndpointParcelable::writeToParcel(Parcel* parcel) const {
-    status_t status = AAudioConvert_aaudioToAndroidStatus(validate());
-    if (status != NO_ERROR) goto error;
-
-    status = parcel->writeInt32(mNumSharedMemories);
-    if (status != NO_ERROR) goto error;
-
-    for (int i = 0; i < mNumSharedMemories; i++) {
-        status = mSharedMemories[i].writeToParcel(parcel);
-        if (status != NO_ERROR) goto error;
-    }
-    status = mUpMessageQueueParcelable.writeToParcel(parcel);
-    if (status != NO_ERROR) goto error;
-    status = mDownMessageQueueParcelable.writeToParcel(parcel);
-    if (status != NO_ERROR) goto error;
-    status = mUpDataQueueParcelable.writeToParcel(parcel);
-    if (status != NO_ERROR) goto error;
-    status = mDownDataQueueParcelable.writeToParcel(parcel);
-    if (status != NO_ERROR) goto error;
-
-    return NO_ERROR;
-
-error:
-    ALOGE("%s returning %d", __func__, status);
-    return status;
-}
-
-status_t AudioEndpointParcelable::readFromParcel(const Parcel* parcel) {
-    status_t status = parcel->readInt32(&mNumSharedMemories);
-    if (status != NO_ERROR) goto error;
-
-    for (int i = 0; i < mNumSharedMemories; i++) {
-        mSharedMemories[i].readFromParcel(parcel);
-        if (status != NO_ERROR) goto error;
-    }
-    status = mUpMessageQueueParcelable.readFromParcel(parcel);
-    if (status != NO_ERROR) goto error;
-    status = mDownMessageQueueParcelable.readFromParcel(parcel);
-    if (status != NO_ERROR) goto error;
-    status = mUpDataQueueParcelable.readFromParcel(parcel);
-    if (status != NO_ERROR) goto error;
-    status = mDownDataQueueParcelable.readFromParcel(parcel);
-    if (status != NO_ERROR) goto error;
-
-    return AAudioConvert_aaudioToAndroidStatus(validate());
-
-error:
-    ALOGE("%s returning %d", __func__, status);
-    return status;
-}
-
 aaudio_result_t AudioEndpointParcelable::resolve(EndpointDescriptor *descriptor) {
     aaudio_result_t result = mUpMessageQueueParcelable.resolve(mSharedMemories,
                                                            &descriptor->upMessageQueueDescriptor);
diff --git a/media/libaaudio/src/binding/AudioEndpointParcelable.h b/media/libaaudio/src/binding/AudioEndpointParcelable.h
index e4f8b9e..5237a1a 100644
--- a/media/libaaudio/src/binding/AudioEndpointParcelable.h
+++ b/media/libaaudio/src/binding/AudioEndpointParcelable.h
@@ -20,16 +20,13 @@
 #include <stdint.h>
 
 //#include <sys/mman.h>
+#include <aaudio/Endpoint.h>
 #include <android-base/unique_fd.h>
-#include <binder/Parcel.h>
-#include <binder/Parcelable.h>
 
 #include "binding/AAudioServiceDefinitions.h"
 #include "binding/RingBufferParcelable.h"
 
 using android::status_t;
-using android::Parcel;
-using android::Parcelable;
 
 namespace aaudio {
 
@@ -39,10 +36,15 @@
  * It contains no addresses, just sizes, offsets and file descriptors for
  * shared memory that can be passed through Binder.
  */
-class AudioEndpointParcelable : public Parcelable {
+class AudioEndpointParcelable {
 public:
-    AudioEndpointParcelable();
-    virtual ~AudioEndpointParcelable();
+    AudioEndpointParcelable() = default;
+
+    // Ctor/assignment from a parcelable representation.
+    // Since the parcelable object owns unique FDs (for shared memory blocks), move semantics are
+    // provided to avoid the need to dupe.
+    AudioEndpointParcelable(Endpoint&& parcelable);
+    AudioEndpointParcelable& operator=(Endpoint&& parcelable);
 
     /**
      * Add the file descriptor to the table.
@@ -50,16 +52,17 @@
      */
     int32_t addFileDescriptor(const android::base::unique_fd& fd, int32_t sizeInBytes);
 
-    virtual status_t writeToParcel(Parcel* parcel) const override;
-
-    virtual status_t readFromParcel(const Parcel* parcel) override;
-
     aaudio_result_t resolve(EndpointDescriptor *descriptor);
 
     aaudio_result_t close();
 
     void dump();
 
+    // Extract a parcelable representation of this object.
+    // Since our shared memory objects own a unique FD, move semantics are provided to avoid the
+    // need to dupe.
+    Endpoint parcelable()&&;
+
 public: // TODO add getters
     // Set capacityInFrames to zero if Queue is unused.
     RingBufferParcelable    mUpMessageQueueParcelable;   // server to client
diff --git a/media/libaaudio/src/binding/IAAudioClient.cpp b/media/libaaudio/src/binding/IAAudioClient.cpp
deleted file mode 100644
index c69c4e8..0000000
--- a/media/libaaudio/src/binding/IAAudioClient.cpp
+++ /dev/null
@@ -1,85 +0,0 @@
-/*
- * Copyright (C) 2017 The Android Open Source Project
- *
- * Licensed under the Apache License, Version 2.0 (the "License");
- * you may not use this file except in compliance with the License.
- * You may obtain a copy of the License at
- *
- *      http://www.apache.org/licenses/LICENSE-2.0
- *
- * Unless required by applicable law or agreed to in writing, software
- * distributed under the License is distributed on an "AS IS" BASIS,
- * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
- * See the License for the specific language governing permissions and
- * limitations under the License.
- */
-
-#define LOG_TAG "AAudio"
-//#define LOG_NDEBUG 0
-#include <utils/Log.h>
-
-#include <aaudio/AAudio.h>
-
-#include "binding/AAudioBinderClient.h"
-#include "binding/AAudioServiceDefinitions.h"
-#include "binding/IAAudioClient.h"
-#include "utility/AAudioUtilities.h"
-
-namespace android {
-
-using aaudio::aaudio_handle_t;
-
-/**
- * This is used by the AAudio Service to talk to an AAudio Client.
- *
- * The order of parameters in the Parcels must match with code in AAudioClient.cpp.
- */
-class BpAAudioClient : public BpInterface<IAAudioClient>
-{
-public:
-    explicit BpAAudioClient(const sp<IBinder>& impl)
-        : BpInterface<IAAudioClient>(impl)
-    {
-    }
-
-    void onStreamChange(aaudio_handle_t handle, int32_t opcode, int32_t value) override {
-        Parcel data, reply;
-        data.writeInterfaceToken(IAAudioClient::getInterfaceDescriptor());
-        data.writeInt32(handle);
-        data.writeInt32(opcode);
-        data.writeInt32(value);
-        remote()->transact(ON_STREAM_CHANGE, data,  &reply, IBinder::FLAG_ONEWAY);
-    }
-
-};
-
-// Implement an interface to the service.
-IMPLEMENT_META_INTERFACE(AAudioClient, "IAAudioClient");
-
-// The order of parameters in the Parcels must match with code in BpAAudioClient
-
-status_t BnAAudioClient::onTransact(uint32_t code, const Parcel& data,
-                                        Parcel* reply, uint32_t flags) {
-    aaudio_handle_t streamHandle;
-    int32_t opcode = 0;
-    int32_t value = 0;
-    ALOGV("BnAAudioClient::onTransact(%u) %u", code, flags);
-
-    switch(code) {
-        case ON_STREAM_CHANGE: {
-            CHECK_INTERFACE(IAAudioClient, data, reply);
-            data.readInt32(&streamHandle);
-            data.readInt32(&opcode);
-            data.readInt32(&value);
-            onStreamChange(streamHandle, opcode, value);
-            ALOGD("BnAAudioClient onStreamChange(%x, %d, %d)", streamHandle, opcode, value);
-            return NO_ERROR;
-        } break;
-
-        default:
-            // ALOGW("BnAAudioClient::onTransact not handled %u", code);
-            return BBinder::onTransact(code, data, reply, flags);
-    }
-}
-
-} /* namespace android */
diff --git a/media/libaaudio/src/binding/IAAudioClient.h b/media/libaaudio/src/binding/IAAudioClient.h
deleted file mode 100644
index f21fd93..0000000
--- a/media/libaaudio/src/binding/IAAudioClient.h
+++ /dev/null
@@ -1,48 +0,0 @@
-/*
- * Copyright (C) 2017 The Android Open Source Project
- *
- * Licensed under the Apache License, Version 2.0 (the "License");
- * you may not use this file except in compliance with the License.
- * You may obtain a copy of the License at
- *
- *      http://www.apache.org/licenses/LICENSE-2.0
- *
- * Unless required by applicable law or agreed to in writing, software
- * distributed under the License is distributed on an "AS IS" BASIS,
- * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
- * See the License for the specific language governing permissions and
- * limitations under the License.
- */
-
-#ifndef ANDROID_AAUDIO_IAAUDIO_CLIENT_H
-#define ANDROID_AAUDIO_IAAUDIO_CLIENT_H
-
-#include <stdint.h>
-#include <binder/IInterface.h>
-
-#include <aaudio/AAudio.h>
-
-#include "binding/AAudioCommon.h"
-
-namespace android {
-
-
-// Interface (our AIDL) - client methods called by service
-class IAAudioClient : public IInterface {
-public:
-
-    DECLARE_META_INTERFACE(AAudioClient);
-
-    virtual void onStreamChange(aaudio::aaudio_handle_t handle, int32_t opcode, int32_t value) = 0;
-
-};
-
-class BnAAudioClient : public BnInterface<IAAudioClient> {
-public:
-    virtual status_t onTransact(uint32_t code, const Parcel& data,
-                                Parcel* reply, uint32_t flags = 0);
-};
-
-} /* namespace android */
-
-#endif //ANDROID_AAUDIO_IAAUDIO_SERVICE_H
diff --git a/media/libaaudio/src/binding/IAAudioService.cpp b/media/libaaudio/src/binding/IAAudioService.cpp
deleted file mode 100644
index e017b3a..0000000
--- a/media/libaaudio/src/binding/IAAudioService.cpp
+++ /dev/null
@@ -1,424 +0,0 @@
-/*
- * Copyright (C) 2016 The Android Open Source Project
- *
- * Licensed under the Apache License, Version 2.0 (the "License");
- * you may not use this file except in compliance with the License.
- * You may obtain a copy of the License at
- *
- *      http://www.apache.org/licenses/LICENSE-2.0
- *
- * Unless required by applicable law or agreed to in writing, software
- * distributed under the License is distributed on an "AS IS" BASIS,
- * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
- * See the License for the specific language governing permissions and
- * limitations under the License.
- */
-
-#define LOG_TAG "AAudio"
-//#define LOG_NDEBUG 0
-#include <utils/Log.h>
-
-#include <aaudio/AAudio.h>
-#include <binder/IPCThreadState.h>
-
-#include "binding/AudioEndpointParcelable.h"
-#include "binding/AAudioStreamRequest.h"
-#include "binding/AAudioServiceDefinitions.h"
-#include "binding/AAudioStreamConfiguration.h"
-#include "binding/IAAudioService.h"
-#include "utility/AAudioUtilities.h"
-
-namespace android {
-
-using aaudio::aaudio_handle_t;
-
-/**
- * This is used by the AAudio Client to talk to the AAudio Service.
- *
- * The order of parameters in the Parcels must match with code in AAudioService.cpp.
- */
-class BpAAudioService : public BpInterface<IAAudioService>
-{
-public:
-    explicit BpAAudioService(const sp<IBinder>& impl)
-        : BpInterface<IAAudioService>(impl)
-    {
-    }
-
-    void registerClient(const sp<IAAudioClient>& client) override
-    {
-        Parcel data, reply;
-        data.writeInterfaceToken(IAAudioService::getInterfaceDescriptor());
-        data.writeStrongBinder(IInterface::asBinder(client));
-        remote()->transact(REGISTER_CLIENT, data, &reply);
-    }
-
-    aaudio_handle_t openStream(const aaudio::AAudioStreamRequest &request,
-                               aaudio::AAudioStreamConfiguration &configurationOutput) override {
-        Parcel data, reply;
-        // send command
-        data.writeInterfaceToken(IAAudioService::getInterfaceDescriptor());
-        // request.dump();
-        request.writeToParcel(&data);
-        status_t err = remote()->transact(OPEN_STREAM, data, &reply);
-        if (err != NO_ERROR) {
-            ALOGE("BpAAudioService::client openStream transact failed %d", err);
-            return AAudioConvert_androidToAAudioResult(err);
-        }
-        // parse reply
-        aaudio_handle_t stream;
-        err = reply.readInt32(&stream);
-        if (err != NO_ERROR) {
-            ALOGE("BpAAudioService::client transact(OPEN_STREAM) readInt %d", err);
-            return AAudioConvert_androidToAAudioResult(err);
-        } else if (stream < 0) {
-            return stream;
-        }
-        err = configurationOutput.readFromParcel(&reply);
-        if (err != NO_ERROR) {
-            ALOGE("BpAAudioService::client openStream readFromParcel failed %d", err);
-            closeStream(stream);
-            return AAudioConvert_androidToAAudioResult(err);
-        }
-        return stream;
-    }
-
-    virtual aaudio_result_t closeStream(aaudio_handle_t streamHandle) override {
-        Parcel data, reply;
-        // send command
-        data.writeInterfaceToken(IAAudioService::getInterfaceDescriptor());
-        data.writeInt32(streamHandle);
-        status_t err = remote()->transact(CLOSE_STREAM, data, &reply);
-        if (err != NO_ERROR) {
-            ALOGE("BpAAudioService::client closeStream transact failed %d", err);
-            return AAudioConvert_androidToAAudioResult(err);
-        }
-        // parse reply
-        aaudio_result_t res;
-        reply.readInt32(&res);
-        return res;
-    }
-
-    virtual aaudio_result_t getStreamDescription(aaudio_handle_t streamHandle,
-                                               aaudio::AudioEndpointParcelable &parcelable)   {
-        Parcel data, reply;
-        // send command
-        data.writeInterfaceToken(IAAudioService::getInterfaceDescriptor());
-        data.writeInt32(streamHandle);
-        status_t err = remote()->transact(GET_STREAM_DESCRIPTION, data, &reply);
-        if (err != NO_ERROR) {
-            ALOGE("BpAAudioService::client transact(GET_STREAM_DESCRIPTION) returns %d", err);
-            return AAudioConvert_androidToAAudioResult(err);
-        }
-        // parse reply
-        aaudio_result_t result;
-        err = reply.readInt32(&result);
-        if (err != NO_ERROR) {
-            ALOGE("BpAAudioService::client transact(GET_STREAM_DESCRIPTION) readInt %d", err);
-            return AAudioConvert_androidToAAudioResult(err);
-        } else if (result != AAUDIO_OK) {
-            ALOGE("BpAAudioService::client GET_STREAM_DESCRIPTION passed result %d", result);
-            return result;
-        }
-        err = parcelable.readFromParcel(&reply);
-        if (err != NO_ERROR) {
-            ALOGE("BpAAudioService::client transact(GET_STREAM_DESCRIPTION) read endpoint %d", err);
-            return AAudioConvert_androidToAAudioResult(err);
-        }
-        return result;
-    }
-
-    // TODO should we wait for a reply?
-    virtual aaudio_result_t startStream(aaudio_handle_t streamHandle) override {
-        Parcel data, reply;
-        // send command
-        data.writeInterfaceToken(IAAudioService::getInterfaceDescriptor());
-        data.writeInt32(streamHandle);
-        status_t err = remote()->transact(START_STREAM, data, &reply);
-        if (err != NO_ERROR) {
-            return AAudioConvert_androidToAAudioResult(err);
-        }
-        // parse reply
-        aaudio_result_t res;
-        reply.readInt32(&res);
-        return res;
-    }
-
-    virtual aaudio_result_t pauseStream(aaudio_handle_t streamHandle) override {
-        Parcel data, reply;
-        // send command
-        data.writeInterfaceToken(IAAudioService::getInterfaceDescriptor());
-        data.writeInt32(streamHandle);
-        status_t err = remote()->transact(PAUSE_STREAM, data, &reply);
-        if (err != NO_ERROR) {
-            return AAudioConvert_androidToAAudioResult(err);
-        }
-        // parse reply
-        aaudio_result_t res;
-        reply.readInt32(&res);
-        return res;
-    }
-
-    virtual aaudio_result_t stopStream(aaudio_handle_t streamHandle) override {
-        Parcel data, reply;
-        // send command
-        data.writeInterfaceToken(IAAudioService::getInterfaceDescriptor());
-        data.writeInt32(streamHandle);
-        status_t err = remote()->transact(STOP_STREAM, data, &reply);
-        if (err != NO_ERROR) {
-            return AAudioConvert_androidToAAudioResult(err);
-        }
-        // parse reply
-        aaudio_result_t res;
-        reply.readInt32(&res);
-        return res;
-    }
-
-    virtual aaudio_result_t flushStream(aaudio_handle_t streamHandle) override {
-        Parcel data, reply;
-        // send command
-        data.writeInterfaceToken(IAAudioService::getInterfaceDescriptor());
-        data.writeInt32(streamHandle);
-        status_t err = remote()->transact(FLUSH_STREAM, data, &reply);
-        if (err != NO_ERROR) {
-            return AAudioConvert_androidToAAudioResult(err);
-        }
-        // parse reply
-        aaudio_result_t res;
-        reply.readInt32(&res);
-        return res;
-    }
-
-    virtual aaudio_result_t registerAudioThread(aaudio_handle_t streamHandle,
-                                                pid_t clientThreadId,
-                                                int64_t periodNanoseconds)
-    override {
-        Parcel data, reply;
-        // send command
-        data.writeInterfaceToken(IAAudioService::getInterfaceDescriptor());
-        data.writeInt32(streamHandle);
-        data.writeInt32((int32_t) clientThreadId);
-        data.writeInt64(periodNanoseconds);
-        status_t err = remote()->transact(REGISTER_AUDIO_THREAD, data, &reply);
-        if (err != NO_ERROR) {
-            return AAudioConvert_androidToAAudioResult(err);
-        }
-        // parse reply
-        aaudio_result_t res;
-        reply.readInt32(&res);
-        return res;
-    }
-
-    virtual aaudio_result_t unregisterAudioThread(aaudio_handle_t streamHandle,
-                                                  pid_t clientThreadId)
-    override {
-        Parcel data, reply;
-        // send command
-        data.writeInterfaceToken(IAAudioService::getInterfaceDescriptor());
-        data.writeInt32(streamHandle);
-        data.writeInt32((int32_t) clientThreadId);
-        status_t err = remote()->transact(UNREGISTER_AUDIO_THREAD, data, &reply);
-        if (err != NO_ERROR) {
-            return AAudioConvert_androidToAAudioResult(err);
-        }
-        // parse reply
-        aaudio_result_t res;
-        reply.readInt32(&res);
-        return res;
-    }
-
-};
-
-// Implement an interface to the service.
-// This is here so that you don't have to link with libaaudio static library.
-IMPLEMENT_META_INTERFACE(AAudioService, "IAAudioService");
-
-// The order of parameters in the Parcels must match with code in BpAAudioService
-
-status_t BnAAudioService::onTransact(uint32_t code, const Parcel& data,
-                                        Parcel* reply, uint32_t flags) {
-    aaudio_handle_t streamHandle = 0;
-    aaudio::AAudioStreamRequest request;
-    aaudio::AAudioStreamConfiguration configuration;
-    pid_t tid = 0;
-    int64_t nanoseconds = 0;
-    aaudio_result_t result = AAUDIO_OK;
-    status_t status = NO_ERROR;
-    ALOGV("BnAAudioService::onTransact(%i) %i", code, flags);
-
-    switch(code) {
-        case REGISTER_CLIENT: {
-            CHECK_INTERFACE(IAAudioService, data, reply);
-            sp<IAAudioClient> client = interface_cast<IAAudioClient>(
-                    data.readStrongBinder());
-            // readStrongBinder() can return null
-            if (client.get() == nullptr) {
-                ALOGE("BnAAudioService::%s(REGISTER_CLIENT) client is NULL!", __func__);
-                android_errorWriteLog(0x534e4554, "116230453");
-                return DEAD_OBJECT;
-            } else {
-                registerClient(client);
-                return NO_ERROR;
-            }
-        } break;
-
-        case OPEN_STREAM: {
-            CHECK_INTERFACE(IAAudioService, data, reply);
-            request.readFromParcel(&data);
-            result = request.validate();
-            if (result != AAUDIO_OK) {
-                streamHandle = result;
-            } else {
-                //ALOGD("BnAAudioService::client openStream request dump --------------------");
-                //request.dump();
-                // Override the uid and pid from the client in case they are incorrect.
-                request.setUserId(IPCThreadState::self()->getCallingUid());
-                request.setProcessId(IPCThreadState::self()->getCallingPid());
-                streamHandle = openStream(request, configuration);
-                //ALOGD("BnAAudioService::onTransact OPEN_STREAM server handle = 0x%08X",
-                //        streamHandle);
-            }
-            reply->writeInt32(streamHandle);
-            configuration.writeToParcel(reply);
-            return NO_ERROR;
-        } break;
-
-        case CLOSE_STREAM: {
-            CHECK_INTERFACE(IAAudioService, data, reply);
-            status = data.readInt32(&streamHandle);
-            if (status != NO_ERROR) {
-                ALOGE("BnAAudioService::%s(CLOSE_STREAM) streamHandle failed!", __func__);
-                return status;
-            }
-            result = closeStream(streamHandle);
-            //ALOGD("BnAAudioService::onTransact CLOSE_STREAM 0x%08X, result = %d",
-            //      streamHandle, result);
-            reply->writeInt32(result);
-            return NO_ERROR;
-        } break;
-
-        case GET_STREAM_DESCRIPTION: {
-            CHECK_INTERFACE(IAAudioService, data, reply);
-            status = data.readInt32(&streamHandle);
-            if (status != NO_ERROR) {
-                ALOGE("BnAAudioService::%s(GET_STREAM_DESCRIPTION) streamHandle failed!", __func__);
-                return status;
-            }
-            aaudio::AudioEndpointParcelable parcelable;
-            result = getStreamDescription(streamHandle, parcelable);
-            if (result != AAUDIO_OK) {
-                return AAudioConvert_aaudioToAndroidStatus(result);
-            }
-            status = reply->writeInt32(result);
-            if (status != NO_ERROR) {
-                return status;
-            }
-            return parcelable.writeToParcel(reply);
-        } break;
-
-        case START_STREAM: {
-            CHECK_INTERFACE(IAAudioService, data, reply);
-            status = data.readInt32(&streamHandle);
-            if (status != NO_ERROR) {
-                ALOGE("BnAAudioService::%s(START_STREAM) streamHandle failed!", __func__);
-                return status;
-            }
-            result = startStream(streamHandle);
-            ALOGV("BnAAudioService::onTransact START_STREAM 0x%08X, result = %d",
-                    streamHandle, result);
-            reply->writeInt32(result);
-            return NO_ERROR;
-        } break;
-
-        case PAUSE_STREAM: {
-            CHECK_INTERFACE(IAAudioService, data, reply);
-            status = data.readInt32(&streamHandle);
-            if (status != NO_ERROR) {
-                ALOGE("BnAAudioService::%s(PAUSE_STREAM) streamHandle failed!", __func__);
-                return status;
-            }
-            result = pauseStream(streamHandle);
-            ALOGV("BnAAudioService::onTransact PAUSE_STREAM 0x%08X, result = %d",
-                  streamHandle, result);
-            reply->writeInt32(result);
-            return NO_ERROR;
-        } break;
-
-        case STOP_STREAM: {
-            CHECK_INTERFACE(IAAudioService, data, reply);
-            status = data.readInt32(&streamHandle);
-            if (status != NO_ERROR) {
-                ALOGE("BnAAudioService::%s(STOP_STREAM) streamHandle failed!", __func__);
-                return status;
-            }
-            result = stopStream(streamHandle);
-            ALOGV("BnAAudioService::onTransact STOP_STREAM 0x%08X, result = %d",
-                  streamHandle, result);
-            reply->writeInt32(result);
-            return NO_ERROR;
-        } break;
-
-        case FLUSH_STREAM: {
-            CHECK_INTERFACE(IAAudioService, data, reply);
-            status = data.readInt32(&streamHandle);
-            if (status != NO_ERROR) {
-                ALOGE("BnAAudioService::%s(FLUSH_STREAM) streamHandle failed!", __func__);
-                return status;
-            }
-            result = flushStream(streamHandle);
-            ALOGV("BnAAudioService::onTransact FLUSH_STREAM 0x%08X, result = %d",
-                    streamHandle, result);
-            reply->writeInt32(result);
-            return NO_ERROR;
-        } break;
-
-        case REGISTER_AUDIO_THREAD: {
-            CHECK_INTERFACE(IAAudioService, data, reply);
-            status = data.readInt32(&streamHandle);
-            if (status != NO_ERROR) {
-                ALOGE("BnAAudioService::%s(REGISTER_AUDIO_THREAD) streamHandle failed!", __func__);
-                return status;
-            }
-            status = data.readInt32(&tid);
-            if (status != NO_ERROR) {
-                ALOGE("BnAAudioService::%s(REGISTER_AUDIO_THREAD) tid failed!", __func__);
-                return status;
-            }
-            status = data.readInt64(&nanoseconds);
-            if (status != NO_ERROR) {
-                ALOGE("BnAAudioService::%s(REGISTER_AUDIO_THREAD) nanoseconds failed!", __func__);
-                return status;
-            }
-            result = registerAudioThread(streamHandle, tid, nanoseconds);
-            ALOGV("BnAAudioService::%s(REGISTER_AUDIO_THREAD) 0x%08X, result = %d",
-                    __func__, streamHandle, result);
-            reply->writeInt32(result);
-            return NO_ERROR;
-        } break;
-
-        case UNREGISTER_AUDIO_THREAD: {
-            CHECK_INTERFACE(IAAudioService, data, reply);
-            status = data.readInt32(&streamHandle);
-            if (status != NO_ERROR) {
-                ALOGE("BnAAudioService::%s(UNREGISTER_AUDIO_THREAD) streamHandle failed!", __func__);
-                return status;
-            }
-            status = data.readInt32(&tid);
-            if (status != NO_ERROR) {
-                ALOGE("BnAAudioService::%s(UNREGISTER_AUDIO_THREAD) tid failed!", __func__);
-                return status;
-            }
-            result = unregisterAudioThread(streamHandle, tid);
-            ALOGV("BnAAudioService::onTransact UNREGISTER_AUDIO_THREAD 0x%08X, result = %d",
-                    streamHandle, result);
-            reply->writeInt32(result);
-            return NO_ERROR;
-        } break;
-
-        default:
-            // ALOGW("BnAAudioService::onTransact not handled %u", code);
-            return BBinder::onTransact(code, data, reply, flags);
-    }
-}
-
-} /* namespace android */
diff --git a/media/libaaudio/src/binding/IAAudioService.h b/media/libaaudio/src/binding/IAAudioService.h
deleted file mode 100644
index 6bdb826..0000000
--- a/media/libaaudio/src/binding/IAAudioService.h
+++ /dev/null
@@ -1,109 +0,0 @@
-/*
- * Copyright (C) 2016 The Android Open Source Project
- *
- * Licensed under the Apache License, Version 2.0 (the "License");
- * you may not use this file except in compliance with the License.
- * You may obtain a copy of the License at
- *
- *      http://www.apache.org/licenses/LICENSE-2.0
- *
- * Unless required by applicable law or agreed to in writing, software
- * distributed under the License is distributed on an "AS IS" BASIS,
- * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
- * See the License for the specific language governing permissions and
- * limitations under the License.
- */
-
-#ifndef ANDROID_AAUDIO_IAAUDIO_SERVICE_H
-#define ANDROID_AAUDIO_IAAUDIO_SERVICE_H
-
-#include <stdint.h>
-#include <utils/RefBase.h>
-#include <binder/TextOutput.h>
-#include <binder/IInterface.h>
-
-#include <aaudio/AAudio.h>
-
-#include "binding/AAudioCommon.h"
-#include "binding/AAudioServiceDefinitions.h"
-#include "binding/AAudioStreamConfiguration.h"
-#include "binding/AAudioStreamRequest.h"
-#include "binding/AudioEndpointParcelable.h"
-#include "binding/IAAudioClient.h"
-
-namespace android {
-
-#define AAUDIO_SERVICE_NAME  "media.aaudio"
-
-// Interface (our AIDL) - service methods called by client
-class IAAudioService : public IInterface {
-public:
-
-    DECLARE_META_INTERFACE(AAudioService);
-
-    // Register an object to receive audio input/output change and track notifications.
-    // For a given calling pid, AAudio service disregards any registrations after the first.
-    // Thus the IAAudioClient must be a singleton per process.
-    virtual void registerClient(const sp<IAAudioClient>& client) = 0;
-
-    /**
-     * @param request info needed to create the stream
-     * @param configuration contains information about the created stream
-     * @return handle to the stream or a negative error
-     */
-    virtual aaudio::aaudio_handle_t openStream(const aaudio::AAudioStreamRequest &request,
-                                     aaudio::AAudioStreamConfiguration &configurationOutput) = 0;
-
-    virtual aaudio_result_t closeStream(aaudio::aaudio_handle_t streamHandle) = 0;
-
-    /* Get an immutable description of the in-memory queues
-    * used to communicate with the underlying HAL or Service.
-    */
-    virtual aaudio_result_t getStreamDescription(aaudio::aaudio_handle_t streamHandle,
-                                               aaudio::AudioEndpointParcelable &parcelable) = 0;
-
-    /**
-     * Start the flow of data.
-     * This is asynchronous. When complete, the service will send a STARTED event.
-     */
-    virtual aaudio_result_t startStream(aaudio::aaudio_handle_t streamHandle) = 0;
-
-    /**
-     * Stop the flow of data such that start() can resume without loss of data.
-     * This is asynchronous. When complete, the service will send a PAUSED event.
-     */
-    virtual aaudio_result_t pauseStream(aaudio::aaudio_handle_t streamHandle) = 0;
-
-    /**
-     * Stop the flow of data such that the data currently in the buffer is played.
-     * This is asynchronous. When complete, the service will send a STOPPED event.
-     */
-    virtual aaudio_result_t stopStream(aaudio::aaudio_handle_t streamHandle) = 0;
-
-    /**
-     *  Discard any data held by the underlying HAL or Service.
-     * This is asynchronous. When complete, the service will send a FLUSHED event.
-     */
-    virtual aaudio_result_t flushStream(aaudio::aaudio_handle_t streamHandle) = 0;
-
-    /**
-     * Manage the specified thread as a low latency audio thread.
-     */
-    virtual aaudio_result_t registerAudioThread(aaudio::aaudio_handle_t streamHandle,
-                                              pid_t clientThreadId,
-                                              int64_t periodNanoseconds) = 0;
-
-    virtual aaudio_result_t unregisterAudioThread(aaudio::aaudio_handle_t streamHandle,
-                                                pid_t clientThreadId) = 0;
-};
-
-class BnAAudioService : public BnInterface<IAAudioService> {
-public:
-    virtual status_t onTransact(uint32_t code, const Parcel& data,
-                                Parcel* reply, uint32_t flags = 0);
-
-};
-
-} /* namespace android */
-
-#endif //ANDROID_AAUDIO_IAAUDIO_SERVICE_H
diff --git a/media/libaaudio/src/binding/RingBufferParcelable.cpp b/media/libaaudio/src/binding/RingBufferParcelable.cpp
index 4996b3f..a4b3cec 100644
--- a/media/libaaudio/src/binding/RingBufferParcelable.cpp
+++ b/media/libaaudio/src/binding/RingBufferParcelable.cpp
@@ -29,8 +29,29 @@
 
 using namespace aaudio;
 
-RingBufferParcelable::RingBufferParcelable() {}
-RingBufferParcelable::~RingBufferParcelable() {}
+RingBufferParcelable::RingBufferParcelable(const RingBuffer& parcelable)
+        : mReadCounterParcelable(std::move(parcelable.readCounterParcelable)),
+          mWriteCounterParcelable(std::move(parcelable.writeCounterParcelable)),
+          mDataParcelable(std::move(parcelable.dataParcelable)),
+          mBytesPerFrame(parcelable.bytesPerFrame),
+          mFramesPerBurst(parcelable.framesPerBurst),
+          mCapacityInFrames(parcelable.capacityInFrames),
+          mFlags(static_cast<RingbufferFlags>(parcelable.flags)) {
+    static_assert(sizeof(mFlags) == sizeof(parcelable.flags));
+}
+
+RingBuffer RingBufferParcelable::parcelable() const {
+    RingBuffer result;
+    result.readCounterParcelable = std::move(mReadCounterParcelable).parcelable();
+    result.writeCounterParcelable = std::move(mWriteCounterParcelable).parcelable();
+    result.dataParcelable = std::move(mDataParcelable).parcelable();
+    result.bytesPerFrame = mBytesPerFrame;
+    result.framesPerBurst = mFramesPerBurst;
+    result.capacityInFrames = mCapacityInFrames;
+    static_assert(sizeof(mFlags) == sizeof(result.flags));
+    result.flags = static_cast<int32_t>(mFlags);
+    return result;
+}
 
 // TODO This assumes that all three use the same SharedMemoryParcelable
 void RingBufferParcelable::setupMemory(int32_t sharedMemoryIndex,
@@ -76,58 +97,6 @@
     mCapacityInFrames = capacityInFrames;
 }
 
-/**
- * The read and write must be symmetric.
- */
-status_t RingBufferParcelable::writeToParcel(Parcel* parcel) const {
-    status_t status = AAudioConvert_aaudioToAndroidStatus(validate());
-    if (status != NO_ERROR) goto error;
-
-    status = parcel->writeInt32(mCapacityInFrames);
-    if (status != NO_ERROR) goto error;
-    if (mCapacityInFrames > 0) {
-        status = parcel->writeInt32(mBytesPerFrame);
-        if (status != NO_ERROR) goto error;
-        status = parcel->writeInt32(mFramesPerBurst);
-        if (status != NO_ERROR) goto error;
-        status = parcel->writeInt32(mFlags);
-        if (status != NO_ERROR) goto error;
-        status = mReadCounterParcelable.writeToParcel(parcel);
-        if (status != NO_ERROR) goto error;
-        status = mWriteCounterParcelable.writeToParcel(parcel);
-        if (status != NO_ERROR) goto error;
-        status = mDataParcelable.writeToParcel(parcel);
-        if (status != NO_ERROR) goto error;
-    }
-    return NO_ERROR;
-error:
-    ALOGE("%s returning %d", __func__, status);
-    return status;
-}
-
-status_t RingBufferParcelable::readFromParcel(const Parcel* parcel) {
-    status_t status = parcel->readInt32(&mCapacityInFrames);
-    if (status != NO_ERROR) goto error;
-    if (mCapacityInFrames > 0) {
-        status = parcel->readInt32(&mBytesPerFrame);
-        if (status != NO_ERROR) goto error;
-        status = parcel->readInt32(&mFramesPerBurst);
-        if (status != NO_ERROR) goto error;
-        status = parcel->readInt32((int32_t *)&mFlags);
-        if (status != NO_ERROR) goto error;
-        status = mReadCounterParcelable.readFromParcel(parcel);
-        if (status != NO_ERROR) goto error;
-        status = mWriteCounterParcelable.readFromParcel(parcel);
-        if (status != NO_ERROR) goto error;
-        status = mDataParcelable.readFromParcel(parcel);
-        if (status != NO_ERROR) goto error;
-    }
-    return AAudioConvert_aaudioToAndroidStatus(validate());
-error:
-    ALOGE("%s returning %d", __func__, status);
-    return status;
-}
-
 aaudio_result_t RingBufferParcelable::resolve(SharedMemoryParcelable *memoryParcels, RingBufferDescriptor *descriptor) {
     aaudio_result_t result;
 
diff --git a/media/libaaudio/src/binding/RingBufferParcelable.h b/media/libaaudio/src/binding/RingBufferParcelable.h
index 1dbcf07..2508cea 100644
--- a/media/libaaudio/src/binding/RingBufferParcelable.h
+++ b/media/libaaudio/src/binding/RingBufferParcelable.h
@@ -19,6 +19,7 @@
 
 #include <stdint.h>
 
+#include <aaudio/RingBuffer.h>
 #include <binder/Parcelable.h>
 
 #include "binding/AAudioServiceDefinitions.h"
@@ -26,10 +27,12 @@
 
 namespace aaudio {
 
-class RingBufferParcelable : public Parcelable {
+class RingBufferParcelable  {
 public:
-    RingBufferParcelable();
-    virtual ~RingBufferParcelable();
+    RingBufferParcelable() = default;
+
+    // Construct based on a parcelable representation.
+    explicit RingBufferParcelable(const RingBuffer& parcelable);
 
     // TODO This assumes that all three use the same SharedMemoryParcelable
     void setupMemory(int32_t sharedMemoryIndex,
@@ -57,21 +60,14 @@
 
     bool isFileDescriptorSafe(SharedMemoryParcelable *memoryParcels);
 
-    /**
-     * The read and write must be symmetric.
-     */
-    virtual status_t writeToParcel(Parcel* parcel) const override;
-
-    virtual status_t readFromParcel(const Parcel* parcel) override;
-
     aaudio_result_t resolve(SharedMemoryParcelable *memoryParcels, RingBufferDescriptor *descriptor);
 
     void dump();
 
+    // Extract a parcelable representation of this object.
+    RingBuffer parcelable() const;
+
 private:
-
-    aaudio_result_t validate() const;
-
     SharedRegionParcelable  mReadCounterParcelable;
     SharedRegionParcelable  mWriteCounterParcelable;
     SharedRegionParcelable  mDataParcelable;
@@ -79,6 +75,8 @@
     int32_t                 mFramesPerBurst = 0;    // for ISOCHRONOUS queues
     int32_t                 mCapacityInFrames = 0;  // zero if unused
     RingbufferFlags         mFlags = RingbufferFlags::NONE;
+
+    aaudio_result_t validate() const;
 };
 
 } /* namespace aaudio */
diff --git a/media/libaaudio/src/binding/SharedMemoryParcelable.cpp b/media/libaaudio/src/binding/SharedMemoryParcelable.cpp
index b6e8472..685b779 100644
--- a/media/libaaudio/src/binding/SharedMemoryParcelable.cpp
+++ b/media/libaaudio/src/binding/SharedMemoryParcelable.cpp
@@ -18,6 +18,7 @@
 //#define LOG_NDEBUG 0
 #include <utils/Log.h>
 
+#include <inttypes.h>
 #include <stdint.h>
 #include <stdio.h>
 
@@ -33,61 +34,36 @@
 using android::base::unique_fd;
 using android::NO_ERROR;
 using android::status_t;
-using android::Parcel;
-using android::Parcelable;
+using android::media::SharedFileRegion;
 
 using namespace aaudio;
 
-SharedMemoryParcelable::SharedMemoryParcelable() {}
-SharedMemoryParcelable::~SharedMemoryParcelable() {};
+SharedMemoryParcelable::SharedMemoryParcelable(SharedFileRegion&& parcelable) {
+    mFd = parcelable.fd.release();
+    mSizeInBytes = parcelable.size;
+    mOffsetInBytes = parcelable.offset;
+}
+
+SharedFileRegion SharedMemoryParcelable::parcelable() && {
+    SharedFileRegion result;
+    result.fd.reset(std::move(mFd));
+    result.size = mSizeInBytes;
+    result.offset = mOffsetInBytes;
+    return result;
+}
+
+SharedMemoryParcelable SharedMemoryParcelable::dup() const {
+    SharedMemoryParcelable result;
+    result.setup(mFd, static_cast<int32_t>(mSizeInBytes));
+    return result;
+}
 
 void SharedMemoryParcelable::setup(const unique_fd& fd, int32_t sizeInBytes) {
-    mFd.reset(dup(fd.get())); // store a duplicate fd
+    mFd.reset(::dup(fd.get())); // store a duplicate fd
     ALOGV("setup(fd = %d -> %d, size = %d) this = %p\n", fd.get(), mFd.get(), sizeInBytes, this);
     mSizeInBytes = sizeInBytes;
 }
 
-status_t SharedMemoryParcelable::writeToParcel(Parcel* parcel) const {
-    status_t status = AAudioConvert_aaudioToAndroidStatus(validate());
-    if (status != NO_ERROR) return status;
-
-    status = parcel->writeInt32(mSizeInBytes);
-    if (status != NO_ERROR) return status;
-    if (mSizeInBytes > 0) {
-        ALOGV("writeToParcel() mFd = %d, this = %p\n", mFd.get(), this);
-        status = parcel->writeUniqueFileDescriptor(mFd);
-        ALOGE_IF(status != NO_ERROR, "SharedMemoryParcelable writeDupFileDescriptor failed : %d",
-                 status);
-    }
-    return status;
-}
-
-status_t SharedMemoryParcelable::readFromParcel(const Parcel* parcel) {
-    status_t status = parcel->readInt32(&mSizeInBytes);
-    if (status != NO_ERROR) goto error;
-
-    if (mSizeInBytes > 0) {
-        // The Parcel owns the file descriptor and will close it later.
-        unique_fd mmapFd;
-        status = parcel->readUniqueFileDescriptor(&mmapFd);
-        if (status != NO_ERROR) {
-            ALOGE("readFromParcel() readUniqueFileDescriptor() failed : %d", status);
-            goto error;
-        }
-
-        // Resolve the memory now while we still have the FD from the Parcel.
-        // Closing the FD will not affect the shared memory once mmap() has been called.
-        aaudio_result_t result = resolveSharedMemory(mmapFd);
-        status = AAudioConvert_aaudioToAndroidStatus(result);
-        if (status != NO_ERROR) goto error;
-    }
-
-    return AAudioConvert_aaudioToAndroidStatus(validate());
-
-error:
-    return status;
-}
-
 aaudio_result_t SharedMemoryParcelable::close() {
     if (mResolvedAddress != MMAP_UNRESOLVED_ADDRESS) {
         int err = munmap(mResolvedAddress, mSizeInBytes);
@@ -104,7 +80,7 @@
     mResolvedAddress = (uint8_t *) mmap(0, mSizeInBytes, PROT_READ | PROT_WRITE,
                                         MAP_SHARED, fd.get(), 0);
     if (mResolvedAddress == MMAP_UNRESOLVED_ADDRESS) {
-        ALOGE("mmap() failed for fd = %d, nBytes = %d, errno = %s",
+        ALOGE("mmap() failed for fd = %d, nBytes = %" PRId64 ", errno = %s",
               fd.get(), mSizeInBytes, strerror(errno));
         return AAUDIO_ERROR_INTERNAL;
     }
@@ -118,7 +94,7 @@
         return AAUDIO_ERROR_OUT_OF_RANGE;
     } else if ((offsetInBytes + sizeInBytes) > mSizeInBytes) {
         ALOGE("out of range, offsetInBytes = %d, "
-                      "sizeInBytes = %d, mSizeInBytes = %d",
+                      "sizeInBytes = %d, mSizeInBytes = %" PRId64,
               offsetInBytes, sizeInBytes, mSizeInBytes);
         return AAUDIO_ERROR_OUT_OF_RANGE;
     }
@@ -148,7 +124,11 @@
 
 aaudio_result_t SharedMemoryParcelable::validate() const {
     if (mSizeInBytes < 0 || mSizeInBytes >= MAX_MMAP_SIZE_BYTES) {
-        ALOGE("invalid mSizeInBytes = %d", mSizeInBytes);
+        ALOGE("invalid mSizeInBytes = %" PRId64, mSizeInBytes);
+        return AAUDIO_ERROR_OUT_OF_RANGE;
+    }
+    if (mOffsetInBytes != 0) {
+        ALOGE("invalid mOffsetInBytes = %" PRId64, mOffsetInBytes);
         return AAUDIO_ERROR_OUT_OF_RANGE;
     }
     return AAUDIO_OK;
@@ -156,5 +136,5 @@
 
 void SharedMemoryParcelable::dump() {
     ALOGD("mFd = %d", mFd.get());
-    ALOGD("mSizeInBytes = %d", mSizeInBytes);
+    ALOGD("mSizeInBytes = %" PRId64, mSizeInBytes);
 }
diff --git a/media/libaaudio/src/binding/SharedMemoryParcelable.h b/media/libaaudio/src/binding/SharedMemoryParcelable.h
index 3927f58..1f2c335 100644
--- a/media/libaaudio/src/binding/SharedMemoryParcelable.h
+++ b/media/libaaudio/src/binding/SharedMemoryParcelable.h
@@ -21,8 +21,7 @@
 #include <sys/mman.h>
 
 #include <android-base/unique_fd.h>
-#include <binder/Parcel.h>
-#include <binder/Parcelable.h>
+#include <android/media/SharedFileRegion.h>
 
 namespace aaudio {
 
@@ -36,10 +35,14 @@
  * It may be divided into several regions.
  * The memory can be shared using Binder or simply shared between threads.
  */
-class SharedMemoryParcelable : public android::Parcelable {
+class SharedMemoryParcelable {
 public:
-    SharedMemoryParcelable();
-    virtual ~SharedMemoryParcelable();
+    SharedMemoryParcelable() = default;
+
+    // Ctor from a parcelable representation.
+    // Since the parcelable object owns a unique FD, move semantics are provided to avoid the need
+    // to dupe.
+    explicit SharedMemoryParcelable(android::media::SharedFileRegion&& parcelable);
 
     /**
      * Make a dup() of the fd and store it for later use.
@@ -49,10 +52,6 @@
      */
     void setup(const android::base::unique_fd& fd, int32_t sizeInBytes);
 
-    virtual android::status_t writeToParcel(android::Parcel* parcel) const override;
-
-    virtual android::status_t readFromParcel(const android::Parcel* parcel) override;
-
     // mmap() shared memory
     aaudio_result_t resolve(int32_t offsetInBytes, int32_t sizeInBytes, void **regionAddressPtr);
 
@@ -63,20 +62,23 @@
 
     void dump();
 
-protected:
+    // Extract a parcelable representation of this object.
+    // Since we own a unique FD, move semantics are provided to avoid the need to dupe.
+    android::media::SharedFileRegion parcelable() &&;
 
-#define MMAP_UNRESOLVED_ADDRESS    reinterpret_cast<uint8_t*>(MAP_FAILED)
-
-    aaudio_result_t resolveSharedMemory(const android::base::unique_fd& fd);
-
-    android::base::unique_fd   mFd;
-    int32_t                    mSizeInBytes = 0;
-    uint8_t                   *mResolvedAddress = MMAP_UNRESOLVED_ADDRESS;
+    // Copy this instance. Duplicates the underlying FD.
+    SharedMemoryParcelable dup() const;
 
 private:
+#define MMAP_UNRESOLVED_ADDRESS    reinterpret_cast<uint8_t*>(MAP_FAILED)
 
+    android::base::unique_fd   mFd;
+    int64_t                    mSizeInBytes = 0;
+    int64_t                    mOffsetInBytes = 0;
+    uint8_t                   *mResolvedAddress = MMAP_UNRESOLVED_ADDRESS;
+
+    aaudio_result_t resolveSharedMemory(const android::base::unique_fd& fd);
     aaudio_result_t validate() const;
-
 };
 
 } /* namespace aaudio */
diff --git a/media/libaaudio/src/binding/SharedRegionParcelable.cpp b/media/libaaudio/src/binding/SharedRegionParcelable.cpp
index c776116..56b99c0 100644
--- a/media/libaaudio/src/binding/SharedRegionParcelable.cpp
+++ b/media/libaaudio/src/binding/SharedRegionParcelable.cpp
@@ -36,8 +36,18 @@
 
 using namespace aaudio;
 
-SharedRegionParcelable::SharedRegionParcelable() {}
-SharedRegionParcelable::~SharedRegionParcelable() {}
+SharedRegionParcelable::SharedRegionParcelable(const SharedRegion& parcelable)
+        : mSharedMemoryIndex(parcelable.sharedMemoryIndex),
+          mOffsetInBytes(parcelable.offsetInBytes),
+          mSizeInBytes(parcelable.sizeInBytes) {}
+
+SharedRegion SharedRegionParcelable::parcelable() const {
+    SharedRegion result;
+    result.sharedMemoryIndex = mSharedMemoryIndex;
+    result.offsetInBytes = mOffsetInBytes;
+    result.sizeInBytes = mSizeInBytes;
+    return result;
+}
 
 void SharedRegionParcelable::setup(int32_t sharedMemoryIndex,
                                    int32_t offsetInBytes,
@@ -47,41 +57,6 @@
     mSizeInBytes = sizeInBytes;
 }
 
-status_t SharedRegionParcelable::writeToParcel(Parcel* parcel) const {
-    status_t status = AAudioConvert_aaudioToAndroidStatus(validate());
-    if (status != NO_ERROR) goto error;
-
-    status = parcel->writeInt32(mSizeInBytes);
-    if (status != NO_ERROR) goto error;
-    if (mSizeInBytes > 0) {
-        status = parcel->writeInt32(mSharedMemoryIndex);
-        if (status != NO_ERROR) goto error;
-        status = parcel->writeInt32(mOffsetInBytes);
-        if (status != NO_ERROR) goto error;
-    }
-    return NO_ERROR;
-
-error:
-    ALOGE("%s returning %d", __func__, status);
-    return status;
-}
-
-status_t SharedRegionParcelable::readFromParcel(const Parcel* parcel) {
-    status_t status = parcel->readInt32(&mSizeInBytes);
-    if (status != NO_ERROR) goto error;
-    if (mSizeInBytes > 0) {
-        status = parcel->readInt32(&mSharedMemoryIndex);
-        if (status != NO_ERROR) goto error;
-        status = parcel->readInt32(&mOffsetInBytes);
-        if (status != NO_ERROR) goto error;
-    }
-    return AAudioConvert_aaudioToAndroidStatus(validate());
-
-error:
-    ALOGE("%s returning %d", __func__, status);
-    return status;
-}
-
 aaudio_result_t SharedRegionParcelable::resolve(SharedMemoryParcelable *memoryParcels,
                                               void **regionAddressPtr) {
     if (mSizeInBytes == 0) {
diff --git a/media/libaaudio/src/binding/SharedRegionParcelable.h b/media/libaaudio/src/binding/SharedRegionParcelable.h
index 0cd8c04..c15fc30 100644
--- a/media/libaaudio/src/binding/SharedRegionParcelable.h
+++ b/media/libaaudio/src/binding/SharedRegionParcelable.h
@@ -20,41 +20,39 @@
 #include <stdint.h>
 
 #include <sys/mman.h>
-#include <binder/Parcelable.h>
 
 #include <aaudio/AAudio.h>
+#include <aaudio/SharedRegion.h>
 
 #include "binding/SharedMemoryParcelable.h"
 
 using android::status_t;
-using android::Parcel;
-using android::Parcelable;
 
 namespace aaudio {
 
-class SharedRegionParcelable : public Parcelable {
+class SharedRegionParcelable {
 public:
-    SharedRegionParcelable();
-    virtual ~SharedRegionParcelable();
+    SharedRegionParcelable() = default;
+
+    // Construct based on a parcelable representation.
+    explicit SharedRegionParcelable(const SharedRegion& parcelable);
 
     void setup(int32_t sharedMemoryIndex, int32_t offsetInBytes, int32_t sizeInBytes);
 
-    virtual status_t writeToParcel(Parcel* parcel) const override;
-
-    virtual status_t readFromParcel(const Parcel* parcel) override;
-
     aaudio_result_t resolve(SharedMemoryParcelable *memoryParcels, void **regionAddressPtr);
 
     bool isFileDescriptorSafe(SharedMemoryParcelable *memoryParcels);
 
     void dump();
 
-protected:
+    // Extract a parcelable representation of this object.
+    SharedRegion parcelable() const;
+
+private:
     int32_t mSharedMemoryIndex = -1;
     int32_t mOffsetInBytes     = 0;
     int32_t mSizeInBytes       = 0;
 
-private:
     aaudio_result_t validate() const;
 };
 
diff --git a/media/libaaudio/src/binding/aidl/aaudio/Endpoint.aidl b/media/libaaudio/src/binding/aidl/aaudio/Endpoint.aidl
new file mode 100644
index 0000000..3600b6a
--- /dev/null
+++ b/media/libaaudio/src/binding/aidl/aaudio/Endpoint.aidl
@@ -0,0 +1,29 @@
+/*
+ * Copyright (C) 2020 The Android Open Source Project
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ *      http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+package aaudio;
+
+import aaudio.RingBuffer;
+import android.media.SharedFileRegion;
+
+parcelable Endpoint {
+    // Set capacityInFrames to zero if Queue is unused.
+    RingBuffer upMessageQueueParcelable;   // server to client
+    RingBuffer downMessageQueueParcelable; // to server
+    RingBuffer upDataQueueParcelable;      // eg. record, could share same queue
+    RingBuffer downDataQueueParcelable;    // eg. playback
+    SharedFileRegion[] sharedMemories;
+}
diff --git a/media/libaaudio/src/binding/aidl/aaudio/IAAudioClient.aidl b/media/libaaudio/src/binding/aidl/aaudio/IAAudioClient.aidl
new file mode 100644
index 0000000..a010dbc
--- /dev/null
+++ b/media/libaaudio/src/binding/aidl/aaudio/IAAudioClient.aidl
@@ -0,0 +1,21 @@
+/*
+ * Copyright (C) 2020 The Android Open Source Project
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ *      http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+package aaudio;
+
+interface IAAudioClient {
+    oneway void onStreamChange(int handle, int opcode, int value);
+}
diff --git a/media/libaaudio/src/binding/aidl/aaudio/IAAudioService.aidl b/media/libaaudio/src/binding/aidl/aaudio/IAAudioService.aidl
new file mode 100644
index 0000000..44d2211
--- /dev/null
+++ b/media/libaaudio/src/binding/aidl/aaudio/IAAudioService.aidl
@@ -0,0 +1,81 @@
+/*
+ * Copyright (C) 2020 The Android Open Source Project
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ *      http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+package aaudio;
+
+import aaudio.Endpoint;
+import aaudio.IAAudioClient;
+import aaudio.StreamParameters;
+import aaudio.StreamRequest;
+
+interface IAAudioService {
+    /**
+     * Register an object to receive audio input/output change and track notifications.
+     * For a given calling pid, AAudio service disregards any registrations after the first.
+     * Thus the IAAudioClient must be a singleton per process.
+     */
+    void registerClient(IAAudioClient client);
+
+    /**
+     * @param request info needed to create the stream
+     * @param paramsOut contains information about the created stream
+     * @return handle to the stream or a negative error
+     */
+    int openStream(in StreamRequest request,
+                   out StreamParameters paramsOut);
+
+    int closeStream(int streamHandle);
+
+    /*
+     * Get an immutable description of the in-memory queues
+     * used to communicate with the underlying HAL or Service.
+     */
+    int getStreamDescription(int streamHandle, out Endpoint endpoint);
+
+    /**
+     * Start the flow of data.
+     * This is asynchronous. When complete, the service will send a STARTED event.
+     */
+    int startStream(int streamHandle);
+
+    /**
+     * Stop the flow of data such that start() can resume without loss of data.
+     * This is asynchronous. When complete, the service will send a PAUSED event.
+     */
+    int pauseStream(int streamHandle);
+
+    /**
+     * Stop the flow of data such that the data currently in the buffer is played.
+     * This is asynchronous. When complete, the service will send a STOPPED event.
+     */
+    int stopStream(int streamHandle);
+
+    /**
+     *  Discard any data held by the underlying HAL or Service.
+     * This is asynchronous. When complete, the service will send a FLUSHED event.
+     */
+    int flushStream(int streamHandle);
+
+    /**
+     * Manage the specified thread as a low latency audio thread.
+     */
+    int registerAudioThread(int streamHandle,
+                            int clientThreadId,
+                            long periodNanoseconds);
+
+    int unregisterAudioThread(int streamHandle,
+                              int clientThreadId);
+}
diff --git a/media/libaaudio/src/binding/aidl/aaudio/RingBuffer.aidl b/media/libaaudio/src/binding/aidl/aaudio/RingBuffer.aidl
new file mode 100644
index 0000000..a58b33a
--- /dev/null
+++ b/media/libaaudio/src/binding/aidl/aaudio/RingBuffer.aidl
@@ -0,0 +1,29 @@
+/*
+ * Copyright (C) 2020 The Android Open Source Project
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ *      http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+package aaudio;
+
+import aaudio.SharedRegion;
+
+parcelable RingBuffer {
+    SharedRegion        readCounterParcelable;
+    SharedRegion        writeCounterParcelable;
+    SharedRegion        dataParcelable;
+    int                 bytesPerFrame;     // index is in frames
+    int                 framesPerBurst;    // for ISOCHRONOUS queues
+    int                 capacityInFrames;  // zero if unused
+    int /* RingbufferFlags */ flags;  // = RingbufferFlags::NONE;
+}
\ No newline at end of file
diff --git a/media/libaaudio/src/binding/aidl/aaudio/SharedRegion.aidl b/media/libaaudio/src/binding/aidl/aaudio/SharedRegion.aidl
new file mode 100644
index 0000000..26153e8
--- /dev/null
+++ b/media/libaaudio/src/binding/aidl/aaudio/SharedRegion.aidl
@@ -0,0 +1,23 @@
+/*
+ * Copyright (C) 2020 The Android Open Source Project
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ *      http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+package aaudio;
+
+parcelable SharedRegion {
+    int sharedMemoryIndex;
+    int offsetInBytes;
+    int sizeInBytes;
+}
diff --git a/media/libaaudio/src/binding/aidl/aaudio/StreamParameters.aidl b/media/libaaudio/src/binding/aidl/aaudio/StreamParameters.aidl
new file mode 100644
index 0000000..b7c4f70
--- /dev/null
+++ b/media/libaaudio/src/binding/aidl/aaudio/StreamParameters.aidl
@@ -0,0 +1,35 @@
+/*
+ * Copyright (C) 2020 The Android Open Source Project
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ *      http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+package aaudio;
+
+import android.media.audio.common.AudioFormat;
+
+parcelable StreamParameters {
+    int                                       samplesPerFrame;  //      = AAUDIO_UNSPECIFIED;
+    int                                       sampleRate;  //           = AAUDIO_UNSPECIFIED;
+    int                                       deviceId;  //             = AAUDIO_UNSPECIFIED;
+    int /* aaudio_sharing_mode_t */           sharingMode;  //          = AAUDIO_SHARING_MODE_SHARED;
+    AudioFormat                               audioFormat;  //          = AUDIO_FORMAT_DEFAULT;
+    int /* aaudio_direction_t */              direction;  //            = AAUDIO_DIRECTION_OUTPUT;
+    int /* aaudio_usage_t */                  usage;  //                = AAUDIO_UNSPECIFIED;
+    int /* aaudio_content_type_t */           contentType;  //          = AAUDIO_UNSPECIFIED;
+    int /* aaudio_input_preset_t */           inputPreset;  //          = AAUDIO_UNSPECIFIED;
+    int                                       bufferCapacity;  //       = AAUDIO_UNSPECIFIED;
+    int /* aaudio_allowed_capture_policy_t */ allowedCapturePolicy;  // = AAUDIO_UNSPECIFIED;
+    int /* aaudio_session_id_t */             sessionId;  //            = AAUDIO_SESSION_ID_NONE;
+    boolean                                   isPrivacySensitive;  //   = false;
+}
diff --git a/media/libaaudio/src/binding/aidl/aaudio/StreamRequest.aidl b/media/libaaudio/src/binding/aidl/aaudio/StreamRequest.aidl
new file mode 100644
index 0000000..9bf4077
--- /dev/null
+++ b/media/libaaudio/src/binding/aidl/aaudio/StreamRequest.aidl
@@ -0,0 +1,27 @@
+/*
+ * Copyright (C) 2020 The Android Open Source Project
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ *      http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+package aaudio;
+
+import aaudio.StreamParameters;
+
+parcelable StreamRequest {
+    StreamParameters    params;
+    int                 userId; // = (uid_t) -1;
+    int                 processId; // = (pid_t) -1;
+    boolean             sharingModeMatchRequired; // = false;
+    boolean             inService; // = false; // Stream opened by AAudioservice
+}
\ No newline at end of file
diff --git a/media/libaaudio/src/client/AudioStreamInternal.cpp b/media/libaaudio/src/client/AudioStreamInternal.cpp
index ac7ad9a..2688597 100644
--- a/media/libaaudio/src/client/AudioStreamInternal.cpp
+++ b/media/libaaudio/src/client/AudioStreamInternal.cpp
@@ -34,7 +34,6 @@
 #include "AudioEndpointParcelable.h"
 #include "binding/AAudioStreamRequest.h"
 #include "binding/AAudioStreamConfiguration.h"
-#include "binding/IAAudioService.h"
 #include "binding/AAudioServiceMessage.h"
 #include "core/AudioGlobal.h"
 #include "core/AudioStreamBuilder.h"
diff --git a/media/libaaudio/src/client/AudioStreamInternal.h b/media/libaaudio/src/client/AudioStreamInternal.h
index 63be978..162f098 100644
--- a/media/libaaudio/src/client/AudioStreamInternal.h
+++ b/media/libaaudio/src/client/AudioStreamInternal.h
@@ -20,7 +20,6 @@
 #include <stdint.h>
 #include <aaudio/AAudio.h>
 
-#include "binding/IAAudioService.h"
 #include "binding/AudioEndpointParcelable.h"
 #include "binding/AAudioServiceInterface.h"
 #include "client/IsochronousClockModel.h"
@@ -29,7 +28,6 @@
 #include "utility/AudioClock.h"
 
 using android::sp;
-using android::IAAudioService;
 
 namespace aaudio {
 
diff --git a/media/libaaudio/src/client/AudioStreamInternalCapture.h b/media/libaaudio/src/client/AudioStreamInternalCapture.h
index 1d65d87..251a7f2 100644
--- a/media/libaaudio/src/client/AudioStreamInternalCapture.h
+++ b/media/libaaudio/src/client/AudioStreamInternalCapture.h
@@ -23,7 +23,6 @@
 #include "client/AudioStreamInternal.h"
 
 using android::sp;
-using android::IAAudioService;
 
 namespace aaudio {
 
diff --git a/media/libaaudio/src/client/AudioStreamInternalPlay.cpp b/media/libaaudio/src/client/AudioStreamInternalPlay.cpp
index b47b472..980592c 100644
--- a/media/libaaudio/src/client/AudioStreamInternalPlay.cpp
+++ b/media/libaaudio/src/client/AudioStreamInternalPlay.cpp
@@ -32,6 +32,7 @@
 #define LOG_TAG (mInService ? "AudioStreamInternalPlay_Service" \
                             : "AudioStreamInternalPlay_Client")
 
+using android::status_t;
 using android::WrappingBuffer;
 
 using namespace aaudio;
diff --git a/media/libaaudio/src/client/AudioStreamInternalPlay.h b/media/libaaudio/src/client/AudioStreamInternalPlay.h
index be95da6..7b1cddc 100644
--- a/media/libaaudio/src/client/AudioStreamInternalPlay.h
+++ b/media/libaaudio/src/client/AudioStreamInternalPlay.h
@@ -25,7 +25,6 @@
 #include "client/AudioStreamInternal.h"
 
 using android::sp;
-using android::IAAudioService;
 
 namespace aaudio {
 
diff --git a/media/libaaudio/src/legacy/AudioStreamRecord.cpp b/media/libaaudio/src/legacy/AudioStreamRecord.cpp
index 43b63d6..a8ae0fb 100644
--- a/media/libaaudio/src/legacy/AudioStreamRecord.cpp
+++ b/media/libaaudio/src/legacy/AudioStreamRecord.cpp
@@ -118,6 +118,7 @@
         setDeviceFormat(getFormat());
     }
 
+    // To avoid glitching, let AudioFlinger pick the optimal burst size.
     uint32_t notificationFrames = 0;
 
     // Setup the callback if there is one.
@@ -128,7 +129,6 @@
         streamTransferType = AudioRecord::transfer_type::TRANSFER_CALLBACK;
         callback = getLegacyCallback();
         callbackData = this;
-        notificationFrames = builder.getFramesPerDataCallback();
     }
     mCallbackBufferSize = builder.getFramesPerDataCallback();
 
diff --git a/media/libaaudio/src/legacy/AudioStreamTrack.cpp b/media/libaaudio/src/legacy/AudioStreamTrack.cpp
index 9e826bd..4ba08fd 100644
--- a/media/libaaudio/src/legacy/AudioStreamTrack.cpp
+++ b/media/libaaudio/src/legacy/AudioStreamTrack.cpp
@@ -96,6 +96,7 @@
 
     size_t frameCount = (size_t)builder.getBufferCapacity();
 
+    // To avoid glitching, let AudioFlinger pick the optimal burst size.
     int32_t notificationFrames = 0;
 
     const audio_format_t format = (getFormat() == AUDIO_FORMAT_DEFAULT)
@@ -118,8 +119,6 @@
             // Take advantage of a special trick that allows us to create a buffer
             // that is some multiple of the burst size.
             notificationFrames = 0 - DEFAULT_BURSTS_PER_BUFFER_CAPACITY;
-        } else {
-            notificationFrames = builder.getFramesPerDataCallback();
         }
     }
     mCallbackBufferSize = builder.getFramesPerDataCallback();
diff --git a/media/libaaudio/tests/Android.bp b/media/libaaudio/tests/Android.bp
index 8935d57..95d6543 100644
--- a/media/libaaudio/tests/Android.bp
+++ b/media/libaaudio/tests/Android.bp
@@ -11,10 +11,12 @@
     defaults: ["libaaudio_tests_defaults"],
     srcs: ["test_marshalling.cpp"],
     shared_libs: [
+        "aaudio-aidl-cpp",
         "libaaudio_internal",
         "libbinder",
         "libcutils",
         "libutils",
+        "shared-file-region-aidl-unstable-cpp",
     ],
 }
 
diff --git a/media/libaaudio/tests/test_marshalling.cpp b/media/libaaudio/tests/test_marshalling.cpp
index c51fbce..49213dc 100644
--- a/media/libaaudio/tests/test_marshalling.cpp
+++ b/media/libaaudio/tests/test_marshalling.cpp
@@ -33,6 +33,29 @@
 using namespace android;
 using namespace aaudio;
 
+template<typename T>
+T copy(const T& object) {
+    return T(object);
+}
+
+template<>
+SharedMemoryParcelable copy<SharedMemoryParcelable>(const SharedMemoryParcelable& object) {
+    return object.dup();
+}
+
+template<typename T>
+void writeToParcel(const T& object, Parcel* parcel) {
+    copy(object).parcelable().writeToParcel(parcel);
+}
+
+template<typename T>
+T readFromParcel(const Parcel& parcel) {
+    using ParcelType = std::decay_t<decltype(std::declval<T>().parcelable())>;
+    ParcelType parcelable;
+    parcelable.readFromParcel(&parcel);
+    return T(std::move(parcelable));
+}
+
 // Test adding one value.
 TEST(test_marshalling, aaudio_one_read_write) {
     Parcel parcel;
@@ -48,7 +71,6 @@
 // Test SharedMemoryParcel.
 TEST(test_marshalling, aaudio_shared_memory) {
     SharedMemoryParcelable sharedMemoryA;
-    SharedMemoryParcelable sharedMemoryB;
     const size_t memSizeBytes = 840;
     unique_fd fd(ashmem_create_region("TestMarshalling", memSizeBytes));
     ASSERT_LE(0, fd);
@@ -63,10 +85,10 @@
 
     Parcel parcel;
     size_t pos = parcel.dataPosition();
-    sharedMemoryA.writeToParcel(&parcel);
+    writeToParcel(sharedMemoryA, &parcel);
 
     parcel.setDataPosition(pos);
-    sharedMemoryB.readFromParcel(&parcel);
+    SharedMemoryParcelable sharedMemoryB = readFromParcel<SharedMemoryParcelable>(parcel);
     EXPECT_EQ(sharedMemoryA.getSizeInBytes(), sharedMemoryB.getSizeInBytes());
 
     // should see same value at two different addresses
@@ -81,7 +103,6 @@
 TEST(test_marshalling, aaudio_shared_region) {
     SharedMemoryParcelable sharedMemories[2];
     SharedRegionParcelable sharedRegionA;
-    SharedRegionParcelable sharedRegionB;
     const size_t memSizeBytes = 840;
     unique_fd fd(ashmem_create_region("TestMarshalling", memSizeBytes));
     ASSERT_LE(0, fd);
@@ -97,10 +118,10 @@
 
     Parcel parcel;
     size_t pos = parcel.dataPosition();
-    sharedRegionA.writeToParcel(&parcel);
+    writeToParcel(sharedRegionA, &parcel);
 
     parcel.setDataPosition(pos);
-    sharedRegionB.readFromParcel(&parcel);
+    SharedRegionParcelable sharedRegionB = readFromParcel<SharedRegionParcelable>(parcel);
 
     // should see same value
     void *region2;
@@ -113,7 +134,6 @@
 TEST(test_marshalling, aaudio_ring_buffer_parcelable) {
     SharedMemoryParcelable sharedMemories[2];
     RingBufferParcelable ringBufferA;
-    RingBufferParcelable ringBufferB;
 
     const size_t bytesPerFrame = 8;
     const size_t framesPerBurst = 32;
@@ -147,11 +167,11 @@
     // write A to parcel
     Parcel parcel;
     size_t pos = parcel.dataPosition();
-    ringBufferA.writeToParcel(&parcel);
+    writeToParcel(ringBufferA, &parcel);
 
     // read B from parcel
     parcel.setDataPosition(pos);
-    ringBufferB.readFromParcel(&parcel);
+    RingBufferParcelable ringBufferB = readFromParcel<RingBufferParcelable>(parcel);
 
     RingBufferDescriptor descriptorB;
     EXPECT_EQ(AAUDIO_OK, ringBufferB.resolve(sharedMemories, &descriptorB));
diff --git a/media/libaudioclient/Android.bp b/media/libaudioclient/Android.bp
index 2a1e56c..d7e9461 100644
--- a/media/libaudioclient/Android.bp
+++ b/media/libaudioclient/Android.bp
@@ -118,14 +118,14 @@
     export_header_lib_headers: ["libaudioclient_headers"],
     export_static_lib_headers: [
         "effect-aidl-cpp",
-        "shared-file-region-aidl-cpp",
+        "shared-file-region-aidl-unstable-cpp",
     ],
 
     static_libs: [
         "effect-aidl-cpp",
         // for memory heap analysis
         "libc_malloc_debug_backtrace",
-        "shared-file-region-aidl-cpp",
+        "shared-file-region-aidl-unstable-cpp",
     ],
     cflags: [
         "-Wall",
diff --git a/media/libaudioclient/AudioRecord.cpp b/media/libaudioclient/AudioRecord.cpp
index 509e063..d6671e3 100644
--- a/media/libaudioclient/AudioRecord.cpp
+++ b/media/libaudioclient/AudioRecord.cpp
@@ -742,6 +742,8 @@
     void *iMemPointer;
     audio_track_cblk_t* cblk;
     status_t status;
+    static const int32_t kMaxCreateAttempts = 3;
+    int32_t remainingAttempts = kMaxCreateAttempts;
 
     if (audioFlinger == 0) {
         ALOGE("%s(%d): Could not get audioflinger", __func__, mPortId);
@@ -803,15 +805,24 @@
     input.sessionId = mSessionId;
     originalSessionId = mSessionId;
 
-    record = audioFlinger->createRecord(input,
-                                                              output,
-                                                              &status);
+    do {
+        record = audioFlinger->createRecord(input, output, &status);
+        if (status == NO_ERROR) {
+            break;
+        }
+        if (status != FAILED_TRANSACTION || --remainingAttempts <= 0) {
+            ALOGE("%s(%d): AudioFlinger could not create record track, status: %d",
+                  __func__, mPortId, status);
+            goto exit;
+        }
+        // FAILED_TRANSACTION happens under very specific conditions causing a state mismatch
+        // between audio policy manager and audio flinger during the input stream open sequence
+        // and can be recovered by retrying.
+        // Leave time for race condition to clear before retrying and randomize delay
+        // to reduce the probability of concurrent retries in locked steps.
+        usleep((20 + rand() % 30) * 10000);
+    } while (1);
 
-    if (status != NO_ERROR) {
-        ALOGE("%s(%d): AudioFlinger could not create record track, status: %d",
-              __func__, mPortId, status);
-        goto exit;
-    }
     ALOG_ASSERT(record != 0);
 
     // AudioFlinger now owns the reference to the I/O handle,
diff --git a/media/libaudioclient/AudioSystem.cpp b/media/libaudioclient/AudioSystem.cpp
index 49c4bc0..edb0889 100644
--- a/media/libaudioclient/AudioSystem.cpp
+++ b/media/libaudioclient/AudioSystem.cpp
@@ -47,8 +47,9 @@
 record_config_callback AudioSystem::gRecordConfigCallback = NULL;
 
 // Required to be held while calling into gSoundTriggerCaptureStateListener.
+class CaptureStateListenerImpl;
 Mutex gSoundTriggerCaptureStateListenerLock;
-sp<AudioSystem::CaptureStateListener> gSoundTriggerCaptureStateListener = nullptr;
+sp<CaptureStateListenerImpl> gSoundTriggerCaptureStateListener = nullptr;
 
 // establish binder interface to AudioFlinger service
 const sp<IAudioFlinger> AudioSystem::get_audio_flinger()
@@ -1634,45 +1635,110 @@
     return aps->getDevicesForRoleAndStrategy(strategy, role, devices);
 }
 
+status_t AudioSystem::setDevicesRoleForCapturePreset(audio_source_t audioSource,
+                                                     device_role_t role,
+                                                     const AudioDeviceTypeAddrVector &devices)
+{
+    const sp<IAudioPolicyService>& aps = AudioSystem::get_audio_policy_service();
+    if (aps == 0) {
+        return PERMISSION_DENIED;
+    }
+    return aps->setDevicesRoleForCapturePreset(audioSource, role, devices);
+}
+
+status_t AudioSystem::addDevicesRoleForCapturePreset(audio_source_t audioSource,
+                                                     device_role_t role,
+                                                     const AudioDeviceTypeAddrVector &devices)
+{
+    const sp<IAudioPolicyService>& aps = AudioSystem::get_audio_policy_service();
+    if (aps == 0) {
+        return PERMISSION_DENIED;
+    }
+    return aps->addDevicesRoleForCapturePreset(audioSource, role, devices);
+}
+
+status_t AudioSystem::removeDevicesRoleForCapturePreset(
+        audio_source_t audioSource, device_role_t role, const AudioDeviceTypeAddrVector& devices)
+{
+    const sp<IAudioPolicyService>& aps = AudioSystem::get_audio_policy_service();
+    if (aps == 0) {
+        return PERMISSION_DENIED;
+    }
+    return aps->removeDevicesRoleForCapturePreset(audioSource, role, devices);
+}
+
+status_t AudioSystem::clearDevicesRoleForCapturePreset(audio_source_t audioSource,
+                                                       device_role_t role)
+{
+    const sp<IAudioPolicyService>& aps = AudioSystem::get_audio_policy_service();
+    if (aps == 0) {
+        return PERMISSION_DENIED;
+    }
+    return aps->clearDevicesRoleForCapturePreset(audioSource, role);
+}
+
+status_t AudioSystem::getDevicesForRoleAndCapturePreset(audio_source_t audioSource,
+                                                        device_role_t role,
+                                                        AudioDeviceTypeAddrVector &devices)
+{
+    const sp<IAudioPolicyService>& aps = AudioSystem::get_audio_policy_service();
+    if (aps == 0) {
+        return PERMISSION_DENIED;
+    }
+    return aps->getDevicesForRoleAndCapturePreset(audioSource, role, devices);
+}
+
 class CaptureStateListenerImpl : public media::BnCaptureStateListener,
                                  public IBinder::DeathRecipient {
 public:
+    CaptureStateListenerImpl(
+            const sp<IAudioPolicyService>& aps,
+            const sp<AudioSystem::CaptureStateListener>& listener)
+            : mAps(aps), mListener(listener) {}
+
+    void init() {
+        bool active;
+        status_t status = mAps->registerSoundTriggerCaptureStateListener(this, &active);
+        if (status != NO_ERROR) {
+            mListener->onServiceDied();
+            return;
+        }
+        mListener->onStateChanged(active);
+        IInterface::asBinder(mAps)->linkToDeath(this);
+    }
+
     binder::Status setCaptureState(bool active) override {
         Mutex::Autolock _l(gSoundTriggerCaptureStateListenerLock);
-        gSoundTriggerCaptureStateListener->onStateChanged(active);
+        mListener->onStateChanged(active);
         return binder::Status::ok();
     }
 
     void binderDied(const wp<IBinder>&) override {
         Mutex::Autolock _l(gSoundTriggerCaptureStateListenerLock);
-        gSoundTriggerCaptureStateListener->onServiceDied();
+        mListener->onServiceDied();
         gSoundTriggerCaptureStateListener = nullptr;
     }
+
+private:
+    // Need this in order to keep the death receipent alive.
+    sp<IAudioPolicyService> mAps;
+    sp<AudioSystem::CaptureStateListener> mListener;
 };
 
 status_t AudioSystem::registerSoundTriggerCaptureStateListener(
     const sp<CaptureStateListener>& listener) {
+    LOG_ALWAYS_FATAL_IF(listener == nullptr);
+
     const sp<IAudioPolicyService>& aps =
             AudioSystem::get_audio_policy_service();
     if (aps == 0) {
         return PERMISSION_DENIED;
     }
 
-    sp<CaptureStateListenerImpl> wrapper = new CaptureStateListenerImpl();
-
     Mutex::Autolock _l(gSoundTriggerCaptureStateListenerLock);
+    gSoundTriggerCaptureStateListener = new CaptureStateListenerImpl(aps, listener);
+    gSoundTriggerCaptureStateListener->init();
 
-    bool active;
-    status_t status =
-        aps->registerSoundTriggerCaptureStateListener(wrapper, &active);
-    if (status != NO_ERROR) {
-        listener->onServiceDied();
-        return NO_ERROR;
-    }
-    gSoundTriggerCaptureStateListener = listener;
-    listener->onStateChanged(active);
-    sp<IBinder> binder = IInterface::asBinder(aps);
-    binder->linkToDeath(wrapper);
     return NO_ERROR;
 }
 
diff --git a/media/libaudioclient/AudioTrack.cpp b/media/libaudioclient/AudioTrack.cpp
index 807aa13..41af78c 100644
--- a/media/libaudioclient/AudioTrack.cpp
+++ b/media/libaudioclient/AudioTrack.cpp
@@ -210,7 +210,11 @@
     return NO_ERROR;
 }
 
-AudioTrack::AudioTrack()
+AudioTrack::AudioTrack() : AudioTrack("" /*opPackageName*/)
+{
+}
+
+AudioTrack::AudioTrack(const std::string& opPackageName)
     : mStatus(NO_INIT),
       mState(STATE_STOPPED),
       mPreviousPriority(ANDROID_PRIORITY_NORMAL),
@@ -218,6 +222,7 @@
       mPausedPosition(0),
       mSelectedDeviceId(AUDIO_PORT_HANDLE_NONE),
       mRoutedDeviceId(AUDIO_PORT_HANDLE_NONE),
+      mOpPackageName(opPackageName),
       mAudioTrackCallback(new AudioTrackCallback())
 {
     mAttributes.content_type = AUDIO_CONTENT_TYPE_UNKNOWN;
@@ -244,12 +249,14 @@
         const audio_attributes_t* pAttributes,
         bool doNotReconnect,
         float maxRequiredSpeed,
-        audio_port_handle_t selectedDeviceId)
+        audio_port_handle_t selectedDeviceId,
+        const std::string& opPackageName)
     : mStatus(NO_INIT),
       mState(STATE_STOPPED),
       mPreviousPriority(ANDROID_PRIORITY_NORMAL),
       mPreviousSchedulingGroup(SP_DEFAULT),
       mPausedPosition(0),
+      mOpPackageName(opPackageName),
       mAudioTrackCallback(new AudioTrackCallback())
 {
     mAttributes = AUDIO_ATTRIBUTES_INITIALIZER;
@@ -277,13 +284,15 @@
         pid_t pid,
         const audio_attributes_t* pAttributes,
         bool doNotReconnect,
-        float maxRequiredSpeed)
+        float maxRequiredSpeed,
+        const std::string& opPackageName)
     : mStatus(NO_INIT),
       mState(STATE_STOPPED),
       mPreviousPriority(ANDROID_PRIORITY_NORMAL),
       mPreviousSchedulingGroup(SP_DEFAULT),
       mPausedPosition(0),
       mSelectedDeviceId(AUDIO_PORT_HANDLE_NONE),
+      mOpPackageName(opPackageName),
       mAudioTrackCallback(new AudioTrackCallback())
 {
     mAttributes = AUDIO_ATTRIBUTES_INITIALIZER;
@@ -1555,6 +1564,7 @@
     input.selectedDeviceId = mSelectedDeviceId;
     input.sessionId = mSessionId;
     input.audioTrackCallback = mAudioTrackCallback;
+    input.opPackageName = mOpPackageName;
 
     IAudioFlinger::CreateTrackOutput output;
 
diff --git a/media/libaudioclient/IAudioFlinger.cpp b/media/libaudioclient/IAudioFlinger.cpp
index 225713a..b4e07e0 100644
--- a/media/libaudioclient/IAudioFlinger.cpp
+++ b/media/libaudioclient/IAudioFlinger.cpp
@@ -24,6 +24,7 @@
 
 #include <binder/IPCThreadState.h>
 #include <binder/Parcel.h>
+#include <media/IAudioPolicyService.h>
 #include <mediautils/ServiceUtilities.h>
 #include <mediautils/TimeCheck.h>
 #include "IAudioFlinger.h"
@@ -1024,6 +1025,16 @@
     std::string tag("IAudioFlinger command " + std::to_string(code));
     TimeCheck check(tag.c_str());
 
+    // Make sure we connect to Audio Policy Service before calling into AudioFlinger:
+    //  - AudioFlinger can call into Audio Policy Service with its global mutex held
+    //  - If this is the first time Audio Policy Service is queried from inside audioserver process
+    //  this will trigger Audio Policy Manager initialization.
+    //  - Audio Policy Manager initialization calls into AudioFlinger which will try to lock
+    //  its global mutex and a deadlock will occur.
+    if (IPCThreadState::self()->getCallingPid() != getpid()) {
+        AudioSystem::get_audio_policy_service();
+    }
+
     switch (code) {
         case CREATE_TRACK: {
             CHECK_INTERFACE(IAudioFlinger, data, reply);
diff --git a/media/libaudioclient/IAudioPolicyService.cpp b/media/libaudioclient/IAudioPolicyService.cpp
index 1491afe..9d3212b 100644
--- a/media/libaudioclient/IAudioPolicyService.cpp
+++ b/media/libaudioclient/IAudioPolicyService.cpp
@@ -119,6 +119,11 @@
     AUDIO_MODULES_UPDATED,  // oneway
     SET_CURRENT_IME_UID,
     REGISTER_SOUNDTRIGGER_CAPTURE_STATE_LISTENER,
+    SET_DEVICES_ROLE_FOR_CAPTURE_PRESET,
+    ADD_DEVICES_ROLE_FOR_CAPTURE_PRESET,
+    REMOVE_DEVICES_ROLE_FOR_CAPTURE_PRESET,
+    CLEAR_DEVICES_ROLE_FOR_CAPTURE_PRESET,
+    GET_DEVICES_FOR_ROLE_AND_CAPTURE_PRESET,
 };
 
 #define MAX_ITEMS_PER_LIST 1024
@@ -1408,6 +1413,95 @@
         return static_cast<status_t>(reply.readInt32());
     }
 
+    virtual status_t setDevicesRoleForCapturePreset(audio_source_t audioSource,
+            device_role_t role, const AudioDeviceTypeAddrVector &devices) {
+        Parcel data, reply;
+        data.writeInterfaceToken(IAudioPolicyService::getInterfaceDescriptor());
+        data.writeUint32(static_cast<uint32_t>(audioSource));
+        data.writeUint32(static_cast<uint32_t>(role));
+        status_t status = data.writeParcelableVector(devices);
+        if (status != NO_ERROR) {
+            return status;
+        }
+        status = remote()->transact(SET_DEVICES_ROLE_FOR_CAPTURE_PRESET, data, &reply);
+        if (status != NO_ERROR) {
+            return status;
+        }
+        return static_cast<status_t>(reply.readInt32());
+    }
+
+    virtual status_t addDevicesRoleForCapturePreset(audio_source_t audioSource,
+            device_role_t role, const AudioDeviceTypeAddrVector &devices)
+    {
+        Parcel data, reply;
+        data.writeInterfaceToken(IAudioPolicyService::getInterfaceDescriptor());
+        data.writeUint32(static_cast<uint32_t>(audioSource));
+        data.writeUint32(static_cast<uint32_t>(role));
+        status_t status = data.writeParcelableVector(devices);
+        if (status != NO_ERROR) {
+            return status;
+        }
+        status = remote()->transact(ADD_DEVICES_ROLE_FOR_CAPTURE_PRESET, data, &reply);
+        if (status != NO_ERROR) {
+           return status;
+        }
+        return static_cast<status_t>(reply.readInt32());
+    }
+
+    virtual status_t removeDevicesRoleForCapturePreset(
+            audio_source_t audioSource, device_role_t role,
+            const AudioDeviceTypeAddrVector& devices)
+    {
+        Parcel data, reply;
+        data.writeInterfaceToken(IAudioPolicyService::getInterfaceDescriptor());
+        data.writeUint32(static_cast<uint32_t>(audioSource));
+        data.writeUint32(static_cast<uint32_t>(role));
+        status_t status = data.writeParcelableVector(devices);
+        if (status != NO_ERROR) {
+            return status;
+        }
+        status = remote()->transact(REMOVE_DEVICES_ROLE_FOR_CAPTURE_PRESET,
+                data, &reply);
+        if (status != NO_ERROR) {
+           return status;
+        }
+        return static_cast<status_t>(reply.readInt32());
+    }
+
+    virtual status_t clearDevicesRoleForCapturePreset(
+            audio_source_t audioSource, device_role_t role)
+    {
+        Parcel data, reply;
+        data.writeInterfaceToken(IAudioPolicyService::getInterfaceDescriptor());
+        data.writeUint32(static_cast<uint32_t>(audioSource));
+        data.writeUint32(static_cast<uint32_t>(role));
+        status_t status = remote()->transact(CLEAR_DEVICES_ROLE_FOR_CAPTURE_PRESET,
+                data, &reply);
+        if (status != NO_ERROR) {
+           return status;
+        }
+        return static_cast<status_t>(reply.readInt32());
+    }
+
+    virtual status_t getDevicesForRoleAndCapturePreset(audio_source_t audioSource,
+            device_role_t role, AudioDeviceTypeAddrVector &devices)
+    {
+        Parcel data, reply;
+        data.writeInterfaceToken(IAudioPolicyService::getInterfaceDescriptor());
+        data.writeUint32(static_cast<uint32_t>(audioSource));
+        data.writeUint32(static_cast<uint32_t>(role));
+        status_t status = remote()->transact(GET_DEVICES_FOR_ROLE_AND_CAPTURE_PRESET,
+                data, &reply);
+        if (status != NO_ERROR) {
+            return status;
+        }
+        status = reply.readParcelableVector(&devices);
+        if (status != NO_ERROR) {
+            return status;
+        }
+        return static_cast<status_t>(reply.readInt32());
+    }
+
     virtual status_t getDevicesForAttributes(const AudioAttributes &aa,
             AudioDeviceTypeAddrVector *devices) const
     {
@@ -1544,7 +1638,12 @@
         case SET_ALLOWED_CAPTURE_POLICY:
         case AUDIO_MODULES_UPDATED:
         case SET_CURRENT_IME_UID:
-        case REGISTER_SOUNDTRIGGER_CAPTURE_STATE_LISTENER: {
+        case REGISTER_SOUNDTRIGGER_CAPTURE_STATE_LISTENER:
+        case SET_DEVICES_ROLE_FOR_CAPTURE_PRESET:
+        case ADD_DEVICES_ROLE_FOR_CAPTURE_PRESET:
+        case REMOVE_DEVICES_ROLE_FOR_CAPTURE_PRESET:
+        case CLEAR_DEVICES_ROLE_FOR_CAPTURE_PRESET:
+        case GET_DEVICES_FOR_ROLE_AND_CAPTURE_PRESET: {
             if (!isServiceUid(IPCThreadState::self()->getCallingUid())) {
                 ALOGW("%s: transaction %d received from PID %d unauthorized UID %d",
                       __func__, code, IPCThreadState::self()->getCallingPid(),
@@ -2729,6 +2828,71 @@
             return NO_ERROR;
         } break;
 
+        case SET_DEVICES_ROLE_FOR_CAPTURE_PRESET: {
+            CHECK_INTERFACE(IAudioPolicyService, data, reply);
+            audio_source_t audioSource = (audio_source_t) data.readUint32();
+            device_role_t role = (device_role_t) data.readUint32();
+            AudioDeviceTypeAddrVector devices;
+            status_t status = data.readParcelableVector(&devices);
+            if (status != NO_ERROR) {
+                return status;
+            }
+            status = setDevicesRoleForCapturePreset(audioSource, role, devices);
+            reply->writeInt32(status);
+            return NO_ERROR;
+        }
+
+        case ADD_DEVICES_ROLE_FOR_CAPTURE_PRESET: {
+            CHECK_INTERFACE(IAudioPolicyService, data, reply);
+            audio_source_t audioSource = (audio_source_t) data.readUint32();
+            device_role_t role = (device_role_t) data.readUint32();
+            AudioDeviceTypeAddrVector devices;
+            status_t status = data.readParcelableVector(&devices);
+            if (status != NO_ERROR) {
+                return status;
+            }
+            status = addDevicesRoleForCapturePreset(audioSource, role, devices);
+            reply->writeInt32(status);
+            return NO_ERROR;
+        }
+
+        case REMOVE_DEVICES_ROLE_FOR_CAPTURE_PRESET: {
+            CHECK_INTERFACE(IAudioPolicyService, data, reply);
+            audio_source_t audioSource = (audio_source_t) data.readUint32();
+            device_role_t role = (device_role_t) data.readUint32();
+            AudioDeviceTypeAddrVector devices;
+            status_t status = data.readParcelableVector(&devices);
+            if (status != NO_ERROR) {
+                return status;
+            }
+            status = removeDevicesRoleForCapturePreset(audioSource, role, devices);
+            reply->writeInt32(status);
+            return NO_ERROR;
+        }
+
+        case CLEAR_DEVICES_ROLE_FOR_CAPTURE_PRESET: {
+            CHECK_INTERFACE(IAudioPolicyService, data, reply);
+            audio_source_t audioSource = (audio_source_t) data.readUint32();
+            device_role_t role = (device_role_t) data.readUint32();
+            status_t status = clearDevicesRoleForCapturePreset(audioSource, role);
+            reply->writeInt32(status);
+            return NO_ERROR;
+        }
+
+        case GET_DEVICES_FOR_ROLE_AND_CAPTURE_PRESET: {
+            CHECK_INTERFACE(IAudioPolicyService, data, reply);
+            audio_source_t audioSource = (audio_source_t) data.readUint32();
+            device_role_t role = (device_role_t) data.readUint32();
+            AudioDeviceTypeAddrVector devices;
+            status_t status = getDevicesForRoleAndCapturePreset(audioSource, role, devices);
+            status_t marshall_status = reply->writeParcelableVector(devices);
+            if (marshall_status != NO_ERROR) {
+                return marshall_status;
+            }
+            reply->writeInt32(status);
+            return NO_ERROR;
+        }
+
         default:
             return BBinder::onTransact(code, data, reply, flags);
     }
diff --git a/media/libaudioclient/include/media/AudioSystem.h b/media/libaudioclient/include/media/AudioSystem.h
index 09025d1..848743a 100644
--- a/media/libaudioclient/include/media/AudioSystem.h
+++ b/media/libaudioclient/include/media/AudioSystem.h
@@ -433,6 +433,22 @@
     static status_t getDevicesForRoleAndStrategy(product_strategy_t strategy,
             device_role_t role, AudioDeviceTypeAddrVector &devices);
 
+    static status_t setDevicesRoleForCapturePreset(audio_source_t audioSource,
+            device_role_t role, const AudioDeviceTypeAddrVector &devices);
+
+    static status_t addDevicesRoleForCapturePreset(audio_source_t audioSource,
+            device_role_t role, const AudioDeviceTypeAddrVector &devices);
+
+    static status_t removeDevicesRoleForCapturePreset(
+            audio_source_t audioSource, device_role_t role,
+            const AudioDeviceTypeAddrVector& devices);
+
+    static status_t clearDevicesRoleForCapturePreset(
+            audio_source_t audioSource, device_role_t role);
+
+    static status_t getDevicesForRoleAndCapturePreset(audio_source_t audioSource,
+            device_role_t role, AudioDeviceTypeAddrVector &devices);
+
     static status_t getDeviceForStrategy(product_strategy_t strategy,
             AudioDeviceTypeAddr &device);
 
diff --git a/media/libaudioclient/include/media/AudioTrack.h b/media/libaudioclient/include/media/AudioTrack.h
index 0dbd842..a9946da 100644
--- a/media/libaudioclient/include/media/AudioTrack.h
+++ b/media/libaudioclient/include/media/AudioTrack.h
@@ -26,6 +26,8 @@
 #include <media/Modulo.h>
 #include <utils/threads.h>
 
+#include <string>
+
 #include "android/media/BnAudioTrackCallback.h"
 #include "android/media/IAudioTrackCallback.h"
 
@@ -177,6 +179,8 @@
      */
                         AudioTrack();
 
+                        AudioTrack(const std::string& opPackageName);
+
     /* Creates an AudioTrack object and registers it with AudioFlinger.
      * Once created, the track needs to be started before it can be used.
      * Unspecified values are set to appropriate default values.
@@ -258,7 +262,8 @@
                                     const audio_attributes_t* pAttributes = NULL,
                                     bool doNotReconnect = false,
                                     float maxRequiredSpeed = 1.0f,
-                                    audio_port_handle_t selectedDeviceId = AUDIO_PORT_HANDLE_NONE);
+                                    audio_port_handle_t selectedDeviceId = AUDIO_PORT_HANDLE_NONE,
+                                    const std::string& opPackageName = "");
 
     /* Creates an audio track and registers it with AudioFlinger.
      * With this constructor, the track is configured for static buffer mode.
@@ -288,7 +293,8 @@
                                     pid_t pid = -1,
                                     const audio_attributes_t* pAttributes = NULL,
                                     bool doNotReconnect = false,
-                                    float maxRequiredSpeed = 1.0f);
+                                    float maxRequiredSpeed = 1.0f,
+                                    const std::string& opPackageName = "");
 
     /* Terminates the AudioTrack and unregisters it from AudioFlinger.
      * Also destroys all resources associated with the AudioTrack.
@@ -1236,6 +1242,8 @@
 
     sp<media::VolumeHandler>       mVolumeHandler;
 
+    const std::string      mOpPackageName;
+
 private:
     class DeathNotifier : public IBinder::DeathRecipient {
     public:
diff --git a/media/libaudioclient/include/media/IAudioFlinger.h b/media/libaudioclient/include/media/IAudioFlinger.h
index b950d0f..a01b681 100644
--- a/media/libaudioclient/include/media/IAudioFlinger.h
+++ b/media/libaudioclient/include/media/IAudioFlinger.h
@@ -35,6 +35,7 @@
 #include <system/audio_policy.h>
 #include <utils/String8.h>
 #include <media/MicrophoneInfo.h>
+#include <string>
 #include <vector>
 
 #include "android/media/IAudioRecord.h"
@@ -85,6 +86,11 @@
             speed = parcel->readFloat();
             audioTrackCallback = interface_cast<media::IAudioTrackCallback>(
                     parcel->readStrongBinder());
+            const char* opPackageNamePtr = parcel->readCString();
+            if (opPackageNamePtr == nullptr) {
+                return FAILED_TRANSACTION;
+            }
+            opPackageName = opPackageNamePtr;
 
             /* input/output arguments*/
             (void)parcel->read(&flags, sizeof(audio_output_flags_t));
@@ -109,6 +115,7 @@
             (void)parcel->writeInt32(notificationsPerBuffer);
             (void)parcel->writeFloat(speed);
             (void)parcel->writeStrongBinder(IInterface::asBinder(audioTrackCallback));
+            (void)parcel->writeCString(opPackageName.c_str());
 
             /* input/output arguments*/
             (void)parcel->write(&flags, sizeof(audio_output_flags_t));
@@ -127,6 +134,7 @@
         uint32_t notificationsPerBuffer;
         float speed;
         sp<media::IAudioTrackCallback> audioTrackCallback;
+        std::string opPackageName;
 
         /* input/output */
         audio_output_flags_t flags;
diff --git a/media/libaudioclient/include/media/IAudioPolicyService.h b/media/libaudioclient/include/media/IAudioPolicyService.h
index afb0fda..2d5f687 100644
--- a/media/libaudioclient/include/media/IAudioPolicyService.h
+++ b/media/libaudioclient/include/media/IAudioPolicyService.h
@@ -252,6 +252,25 @@
                                                   device_role_t role,
                                                   AudioDeviceTypeAddrVector &devices) = 0;
 
+    virtual status_t setDevicesRoleForCapturePreset(audio_source_t audioSource,
+                                                    device_role_t role,
+                                                    const AudioDeviceTypeAddrVector &devices) = 0;
+
+    virtual status_t addDevicesRoleForCapturePreset(audio_source_t audioSource,
+                                                    device_role_t role,
+                                                    const AudioDeviceTypeAddrVector &devices) = 0;
+
+    virtual status_t removeDevicesRoleForCapturePreset(
+            audio_source_t audioSource, device_role_t role,
+            const AudioDeviceTypeAddrVector& devices) = 0;
+
+    virtual status_t clearDevicesRoleForCapturePreset(audio_source_t audioSource,
+                                                      device_role_t role) = 0;
+
+    virtual status_t getDevicesForRoleAndCapturePreset(audio_source_t audioSource,
+                                                       device_role_t role,
+                                                       AudioDeviceTypeAddrVector &devices) = 0;
+
     // The return code here is only intended to represent transport errors. The
     // actual server implementation should always return NO_ERROR.
     virtual status_t registerSoundTriggerCaptureStateListener(
diff --git a/media/libaudiofoundation/AudioDeviceTypeAddr.cpp b/media/libaudiofoundation/AudioDeviceTypeAddr.cpp
index da2e109..d8fce38 100644
--- a/media/libaudiofoundation/AudioDeviceTypeAddr.cpp
+++ b/media/libaudiofoundation/AudioDeviceTypeAddr.cpp
@@ -19,6 +19,7 @@
 #include <arpa/inet.h>
 #include <iostream>
 #include <regex>
+#include <set>
 #include <sstream>
 
 namespace android {
@@ -80,6 +81,14 @@
     return false;
 }
 
+bool AudioDeviceTypeAddr::operator==(const AudioDeviceTypeAddr &rhs) const {
+    return equals(rhs);
+}
+
+bool AudioDeviceTypeAddr::operator!=(const AudioDeviceTypeAddr &rhs) const {
+    return !operator==(rhs);
+}
+
 void AudioDeviceTypeAddr::reset() {
     mType = AUDIO_DEVICE_NONE;
     setAddress("");
@@ -118,6 +127,20 @@
     return deviceTypes;
 }
 
+AudioDeviceTypeAddrVector excludeDeviceTypeAddrsFrom(
+        const AudioDeviceTypeAddrVector& devices,
+        const AudioDeviceTypeAddrVector& devicesToExclude) {
+    std::set<AudioDeviceTypeAddr> devicesToExcludeSet(
+            devicesToExclude.begin(), devicesToExclude.end());
+    AudioDeviceTypeAddrVector remainedDevices;
+    for (const auto& device : devices) {
+        if (devicesToExcludeSet.count(device) == 0) {
+            remainedDevices.push_back(device);
+        }
+    }
+    return remainedDevices;
+}
+
 std::string dumpAudioDeviceTypeAddrVector(const AudioDeviceTypeAddrVector& deviceTypeAddrs,
                                           bool includeSensitiveInfo) {
     std::stringstream stream;
diff --git a/media/libaudiofoundation/include/media/AudioDeviceTypeAddr.h b/media/libaudiofoundation/include/media/AudioDeviceTypeAddr.h
index 3e03df7..7497faf 100644
--- a/media/libaudiofoundation/include/media/AudioDeviceTypeAddr.h
+++ b/media/libaudiofoundation/include/media/AudioDeviceTypeAddr.h
@@ -47,6 +47,10 @@
 
     bool operator<(const AudioDeviceTypeAddr& other) const;
 
+    bool operator==(const AudioDeviceTypeAddr& rhs) const;
+
+    bool operator!=(const AudioDeviceTypeAddr& rhs) const;
+
     void reset();
 
     std::string toString(bool includeSensitiveInfo=false) const;
@@ -69,6 +73,14 @@
  */
 DeviceTypeSet getAudioDeviceTypes(const AudioDeviceTypeAddrVector& deviceTypeAddrs);
 
+/**
+ * Return a collection of AudioDeviceTypeAddrs that are shown in `devices` but not
+ * in `devicesToExclude`
+ */
+AudioDeviceTypeAddrVector excludeDeviceTypeAddrsFrom(
+        const AudioDeviceTypeAddrVector& devices,
+        const AudioDeviceTypeAddrVector& devicesToExclude);
+
 std::string dumpAudioDeviceTypeAddrVector(const AudioDeviceTypeAddrVector& deviceTypeAddrs,
                                           bool includeSensitiveInfo=false);
 
diff --git a/media/libeffects/lvm/lib/Android.bp b/media/libeffects/lvm/lib/Android.bp
index 1f2a5e1..ee69cfb 100644
--- a/media/libeffects/lvm/lib/Android.bp
+++ b/media/libeffects/lvm/lib/Android.bp
@@ -30,7 +30,6 @@
         "Bundle/src/LVM_Control.cpp",
         "SpectrumAnalyzer/src/LVPSA_Control.cpp",
         "SpectrumAnalyzer/src/LVPSA_Init.cpp",
-        "SpectrumAnalyzer/src/LVPSA_Memory.cpp",
         "SpectrumAnalyzer/src/LVPSA_Process.cpp",
         "SpectrumAnalyzer/src/LVPSA_QPD_Init.cpp",
         "SpectrumAnalyzer/src/LVPSA_QPD_Process.cpp",
@@ -137,7 +136,6 @@
     ],
     cppflags: [
         "-fvisibility=hidden",
-        "-DSUPPORT_MC",
 
         "-Wall",
         "-Werror",
diff --git a/media/libeffects/lvm/lib/Bass/lib/LVDBE.h b/media/libeffects/lvm/lib/Bass/lib/LVDBE.h
index 948d79c..cb69c88 100644
--- a/media/libeffects/lvm/lib/Bass/lib/LVDBE.h
+++ b/media/libeffects/lvm/lib/Bass/lib/LVDBE.h
@@ -69,9 +69,6 @@
 /*                                                                                      */
 /****************************************************************************************/
 
-/* Memory table*/
-#define LVDBE_NR_MEMORY_REGIONS        4                            /* Number of memory regions */
-
 /* Bass Enhancement effect level */
 #define LVDBE_EFFECT_03DB            3                              /* Effect defines for backwards compatibility */
 #define LVDBE_EFFECT_06DB            6
@@ -112,25 +109,12 @@
     LVDBE_VOLUME_MAX = LVM_MAXINT_32
 } LVDBE_Volume_en;
 
-/* Memory Types */
-typedef enum
-{
-    LVDBE_PERSISTENT      = 0,
-    LVDBE_PERSISTENT_DATA = 1,
-    LVDBE_PERSISTENT_COEF = 2,
-    LVDBE_SCRATCH         = 3,
-    LVDBE_MEMORY_MAX      = LVM_MAXINT_32
-
-} LVDBE_MemoryTypes_en;
-
 /* Function return status */
 typedef enum
 {
     LVDBE_SUCCESS        = 0,                        /* Successful return from a routine */
-    LVDBE_ALIGNMENTERROR = 1,                        /* Memory alignment error */
-    LVDBE_NULLADDRESS    = 2,                        /* NULL allocation address */
-    LVDBE_TOOMANYSAMPLES = 3,                        /* Maximum block size exceeded */
-    LVDBE_SIZEERROR      = 4,                        /* Incorrect structure size */
+    LVDBE_NULLADDRESS    = 1,                        /* NULL allocation address */
+    LVDBE_TOOMANYSAMPLES = 2,                        /* Maximum block size exceeded */
     LVDBE_STATUS_MAX     = LVM_MAXINT_32
 } LVDBE_ReturnStatus_en;
 
@@ -213,21 +197,6 @@
 /*                                                                                      */
 /****************************************************************************************/
 
-/* Memory region definition */
-typedef struct
-{
-    LVM_UINT32                Size;                        /* Region size in bytes */
-    LVM_UINT16                Alignment;                  /* Region alignment in bytes */
-    LVDBE_MemoryTypes_en      Type;                       /* Region type */
-    void                      *pBaseAddress;              /* Pointer to the region base address */
-} LVDBE_MemoryRegion_t;
-
-/* Memory table containing the region definitions */
-typedef struct
-{
-    LVDBE_MemoryRegion_t    Region[LVDBE_NR_MEMORY_REGIONS];  /* One definition for each region */
-} LVDBE_MemTab_t;
-
 /* Parameter structure */
 typedef struct
 {
@@ -239,9 +208,7 @@
     LVDBE_Volume_en         VolumeControl;
     LVM_INT16               VolumedB;
     LVM_INT16               HeadroomdB;
-#ifdef SUPPORT_MC
     LVM_INT16               NrChannels;
-#endif
 
 } LVDBE_Params_t;
 
@@ -261,75 +228,40 @@
 
 /****************************************************************************************/
 /*                                                                                      */
-/* FUNCTION:                 LVDBE_Memory                                               */
-/*                                                                                      */
-/* DESCRIPTION:                                                                         */
-/*    This function is used for memory allocation and free. It can be called in         */
-/*    two ways:                                                                         */
-/*                                                                                      */
-/*        hInstance = NULL                Returns the memory requirements               */
-/*        hInstance = Instance handle        Returns the memory requirements and        */
-/*                                        allocated base addresses for the instance     */
-/*                                                                                      */
-/*    When this function is called for memory allocation (hInstance=NULL) the memory    */
-/*  base address pointers are NULL on return.                                           */
-/*                                                                                      */
-/*    When the function is called for free (hInstance = Instance Handle) the memory     */
-/*  table returns the allocated memory and base addresses used during initialisation.   */
-/*                                                                                      */
-/* PARAMETERS:                                                                          */
-/*  hInstance                Instance Handle                                            */
-/*  pMemoryTable             Pointer to an empty memory definition table                */
-/*    pCapabilities            Pointer to the default capabilites                       */
-/*                                                                                      */
-/* RETURNS:                                                                             */
-/*  LVDBE_SUCCESS            Succeeded                                                  */
-/*                                                                                      */
-/* NOTES:                                                                               */
-/*    1.    This function may be interrupted by the LVDBE_Process function              */
-/*                                                                                      */
-/****************************************************************************************/
-
-LVDBE_ReturnStatus_en LVDBE_Memory(LVDBE_Handle_t           hInstance,
-                                   LVDBE_MemTab_t           *pMemoryTable,
-                                   LVDBE_Capabilities_t     *pCapabilities);
-
-/****************************************************************************************/
-/*                                                                                      */
 /* FUNCTION:                 LVDBE_Init                                                 */
 /*                                                                                      */
 /* DESCRIPTION:                                                                         */
 /*    Create and initialisation function for the Bass Enhancement module                */
 /*                                                                                      */
-/*    This function can be used to create an algorithm instance by calling with         */
-/*    hInstance set to NULL. In this case the algorithm returns the new instance        */
-/*    handle.                                                                           */
-/*                                                                                      */
-/*    This function can be used to force a full re-initialisation of the algorithm      */
-/*    by calling with hInstance = Instance Handle. In this case the memory table        */
-/*    should be correct for the instance, this can be ensured by calling the function   */
-/*    LVDBE_Memory before calling this function.                                        */
-/*                                                                                      */
 /* PARAMETERS:                                                                          */
-/*  hInstance                  Instance handle                                          */
-/*  pMemoryTable             Pointer to the memory definition table                     */
+/*  phInstance               Pointer to instance handle                                 */
 /*  pCapabilities            Pointer to the initialisation capabilities                 */
+/*  pScratch                 Pointer to the bundle scratch buffer                       */
 /*                                                                                      */
 /* RETURNS:                                                                             */
-/*  LVDBE_SUCCESS                Initialisation succeeded                               */
-/*  LVDBE_ALIGNMENTERROR        Instance or scratch memory on incorrect alignment       */
-/*    LVDBE_NULLADDRESS            One or more memory has a NULL pointer                */
+/*  LVDBE_SUCCESS            Initialisation succeeded                                   */
+/*  LVDBE_NULLADDRESS        One or more memory has a NULL pointer - malloc failure     */
 /*                                                                                      */
 /* NOTES:                                                                               */
-/*  1.     The instance handle is the pointer to the base address of the first memory   */
-/*        region.                                                                       */
-/*    2.    This function must not be interrupted by the LVDBE_Process function         */
+/*  1.    This function must not be interrupted by the LVDBE_Process function           */
 /*                                                                                      */
 /****************************************************************************************/
+LVDBE_ReturnStatus_en LVDBE_Init(LVDBE_Handle_t           *phInstance,
+                                 LVDBE_Capabilities_t     *pCapabilities,
+                                 void                     *pScratch);
 
-LVDBE_ReturnStatus_en LVDBE_Init(LVDBE_Handle_t             *phInstance,
-                                   LVDBE_MemTab_t           *pMemoryTable,
-                                   LVDBE_Capabilities_t     *pCapabilities);
+/****************************************************************************************/
+/*                                                                                      */
+/* FUNCTION:                 LVDBE_DeInit                                               */
+/*                                                                                      */
+/* DESCRIPTION:                                                                         */
+/*    Free the memories created during LVDBE_Init including instance handle             */
+/*                                                                                      */
+/* PARAMETERS:                                                                          */
+/*  phInstance               Pointer to instance handle                                 */
+/*                                                                                      */
+/****************************************************************************************/
+void LVDBE_DeInit(LVDBE_Handle_t         *phInstance);
 
 /****************************************************************************************/
 /*                                                                                      */
diff --git a/media/libeffects/lvm/lib/Bass/src/LVDBE_Init.cpp b/media/libeffects/lvm/lib/Bass/src/LVDBE_Init.cpp
index ad77696..bd03dd3 100644
--- a/media/libeffects/lvm/lib/Bass/src/LVDBE_Init.cpp
+++ b/media/libeffects/lvm/lib/Bass/src/LVDBE_Init.cpp
@@ -20,176 +20,60 @@
 /*    Includes                                                                          */
 /*                                                                                      */
 /****************************************************************************************/
+#include <stdlib.h>
 
 #include "LVDBE.h"
 #include "LVDBE_Private.h"
 
 /****************************************************************************************/
 /*                                                                                      */
-/* FUNCTION:                 LVDBE_Memory                                               */
-/*                                                                                      */
-/* DESCRIPTION:                                                                         */
-/*    This function is used for memory allocation and free. It can be called in         */
-/*    two ways:                                                                         */
-/*                                                                                      */
-/*        hInstance = NULL                Returns the memory requirements               */
-/*        hInstance = Instance handle        Returns the memory requirements and        */
-/*                                        allocated base addresses for the instance     */
-/*                                                                                      */
-/*    When this function is called for memory allocation (hInstance=NULL) the memory    */
-/*  base address pointers are NULL on return.                                           */
-/*                                                                                      */
-/*    When the function is called for free (hInstance = Instance Handle) the memory     */
-/*  table returns the allocated memory and base addresses used during initialisation.   */
-/*                                                                                      */
-/* PARAMETERS:                                                                          */
-/*  hInstance                Instance Handle                                            */
-/*  pMemoryTable             Pointer to an empty memory definition table                */
-/*    pCapabilities           Pointer to the instance capabilities                      */
-/*                                                                                      */
-/* RETURNS:                                                                             */
-/*  LVDBE_SUCCESS            Succeeded                                                  */
-/*                                                                                      */
-/* NOTES:                                                                               */
-/*    1.    This function may be interrupted by the LVDBE_Process function              */
-/*                                                                                      */
-/****************************************************************************************/
-
-LVDBE_ReturnStatus_en LVDBE_Memory(LVDBE_Handle_t            hInstance,
-                                   LVDBE_MemTab_t            *pMemoryTable,
-                                   LVDBE_Capabilities_t      *pCapabilities)
-{
-
-    LVM_UINT32          ScratchSize;
-    LVDBE_Instance_t    *pInstance = (LVDBE_Instance_t *)hInstance;
-
-    /*
-     * Fill in the memory table
-     */
-    if (hInstance == LVM_NULL)
-    {
-        /*
-         * Instance memory
-         */
-        pMemoryTable->Region[LVDBE_MEMREGION_INSTANCE].Size         = sizeof(LVDBE_Instance_t);
-        pMemoryTable->Region[LVDBE_MEMREGION_INSTANCE].Alignment    = LVDBE_INSTANCE_ALIGN;
-        pMemoryTable->Region[LVDBE_MEMREGION_INSTANCE].Type         = LVDBE_PERSISTENT;
-        pMemoryTable->Region[LVDBE_MEMREGION_INSTANCE].pBaseAddress = LVM_NULL;
-
-        /*
-         * Data memory
-         */
-        pMemoryTable->Region[LVDBE_MEMREGION_PERSISTENT_DATA].Size   = sizeof(LVDBE_Data_FLOAT_t);
-        pMemoryTable->Region[LVDBE_MEMREGION_PERSISTENT_DATA].Alignment    = LVDBE_PERSISTENT_DATA_ALIGN;
-        pMemoryTable->Region[LVDBE_MEMREGION_PERSISTENT_DATA].Type         = LVDBE_PERSISTENT_DATA;
-        pMemoryTable->Region[LVDBE_MEMREGION_PERSISTENT_DATA].pBaseAddress = LVM_NULL;
-
-        /*
-         * Coef memory
-         */
-        pMemoryTable->Region[LVDBE_MEMREGION_PERSISTENT_COEF].Size   = sizeof(LVDBE_Coef_FLOAT_t);
-        pMemoryTable->Region[LVDBE_MEMREGION_PERSISTENT_COEF].Alignment    = LVDBE_PERSISTENT_COEF_ALIGN;
-        pMemoryTable->Region[LVDBE_MEMREGION_PERSISTENT_COEF].Type         = LVDBE_PERSISTENT_COEF;
-        pMemoryTable->Region[LVDBE_MEMREGION_PERSISTENT_COEF].pBaseAddress = LVM_NULL;
-
-        /*
-         * Scratch memory
-         */
-        ScratchSize = (LVM_UINT32)(LVDBE_SCRATCHBUFFERS_INPLACE*sizeof(LVM_FLOAT) * \
-                                        pCapabilities->MaxBlockSize);
-        pMemoryTable->Region[LVDBE_MEMREGION_SCRATCH].Size         = ScratchSize;
-        pMemoryTable->Region[LVDBE_MEMREGION_SCRATCH].Alignment    = LVDBE_SCRATCH_ALIGN;
-        pMemoryTable->Region[LVDBE_MEMREGION_SCRATCH].Type         = LVDBE_SCRATCH;
-        pMemoryTable->Region[LVDBE_MEMREGION_SCRATCH].pBaseAddress = LVM_NULL;
-    }
-    else
-    {
-        /* Read back memory allocation table */
-        *pMemoryTable = pInstance->MemoryTable;
-    }
-
-    return(LVDBE_SUCCESS);
-}
-
-/****************************************************************************************/
-/*                                                                                      */
 /* FUNCTION:                 LVDBE_Init                                                 */
 /*                                                                                      */
 /* DESCRIPTION:                                                                         */
-/*    Create and initialisation function for the Dynamic Bass Enhancement module        */
-/*                                                                                      */
-/*    This function can be used to create an algorithm instance by calling with         */
-/*    hInstance set to NULL. In this case the algorithm returns the new instance        */
-/*    handle.                                                                           */
-/*                                                                                      */
-/*    This function can be used to force a full re-initialisation of the algorithm      */
-/*    by calling with hInstance = Instance Handle. In this case the memory table        */
-/*    should be correct for the instance, this can be ensured by calling the function   */
-/*    DBE_Memory before calling this function.                                          */
+/*    Create and initialisation function for the Bass Enhancement module                */
 /*                                                                                      */
 /* PARAMETERS:                                                                          */
-/*  hInstance                  Instance handle                                          */
-/*  pMemoryTable             Pointer to the memory definition table                     */
-/*  pCapabilities              Pointer to the instance capabilities                     */
+/*  phInstance               Pointer to instance handle                                 */
+/*  pCapabilities            Pointer to the initialisation capabilities                 */
+/*  pScratch                 Pointer to the bundle scratch buffer                       */
 /*                                                                                      */
 /* RETURNS:                                                                             */
 /*  LVDBE_SUCCESS            Initialisation succeeded                                   */
-/*  LVDBE_ALIGNMENTERROR    Instance or scratch memory on incorrect alignment           */
-/*    LVDBE_NULLADDRESS        Instance or scratch memory has a NULL pointer            */
+/*  LVDBE_NULLADDRESS        One or more memory has a NULL pointer - malloc failure     */
 /*                                                                                      */
 /* NOTES:                                                                               */
-/*  1.     The instance handle is the pointer to the base address of the first memory   */
-/*        region.                                                                       */
-/*    2.    This function must not be interrupted by the LVDBE_Process function         */
+/*  1.    This function must not be interrupted by the LVDBE_Process function           */
 /*                                                                                      */
 /****************************************************************************************/
-
-LVDBE_ReturnStatus_en LVDBE_Init(LVDBE_Handle_t         *phInstance,
-                                   LVDBE_MemTab_t       *pMemoryTable,
-                                   LVDBE_Capabilities_t *pCapabilities)
+LVDBE_ReturnStatus_en LVDBE_Init(LVDBE_Handle_t       *phInstance,
+                                 LVDBE_Capabilities_t *pCapabilities,
+                                 void                 *pScratch)
 {
 
     LVDBE_Instance_t      *pInstance;
-    LVMixer3_1St_FLOAT_st       *pMixer_Instance;
-    LVMixer3_2St_FLOAT_st       *pBypassMixer_Instance;
+    LVMixer3_1St_FLOAT_st *pMixer_Instance;
+    LVMixer3_2St_FLOAT_st *pBypassMixer_Instance;
     LVM_FLOAT             MixGain;
-    LVM_INT16             i;
 
     /*
-     * Set the instance handle if not already initialised
+     * Create the instance handle if not already initialised
      */
     if (*phInstance == LVM_NULL)
     {
-        *phInstance = (LVDBE_Handle_t)pMemoryTable->Region[LVDBE_MEMREGION_INSTANCE].pBaseAddress;
+        *phInstance = calloc(1, sizeof(*pInstance));
+    }
+    if (*phInstance == LVM_NULL)
+    {
+        return LVDBE_NULLADDRESS;
     }
     pInstance =(LVDBE_Instance_t  *)*phInstance;
 
     /*
-     * Check the memory table for NULL pointers and incorrectly aligned data
-     */
-    for (i=0; i<LVDBE_NR_MEMORY_REGIONS; i++)
-    {
-        if (pMemoryTable->Region[i].Size!=0)
-        {
-            if (pMemoryTable->Region[i].pBaseAddress==LVM_NULL)
-            {
-                return(LVDBE_NULLADDRESS);
-            }
-            if (((uintptr_t)pMemoryTable->Region[i].pBaseAddress % pMemoryTable->Region[i].Alignment)!=0){
-                return(LVDBE_ALIGNMENTERROR);
-            }
-        }
-    }
-
-    /*
      * Save the memory table in the instance structure
      */
     pInstance->Capabilities = *pCapabilities;
 
-    /*
-     * Save the memory table in the instance structure
-     */
-    pInstance->MemoryTable = *pMemoryTable;
+    pInstance->pScratch = pScratch;
 
     /*
      * Set the default instance parameters
@@ -204,12 +88,18 @@
     pInstance->Params.VolumedB          =    0;
 
     /*
-     * Set pointer to data and coef memory
+     * Create pointer to data and coef memory
      */
-    pInstance->pData =
-         (LVDBE_Data_FLOAT_t *)pMemoryTable->Region[LVDBE_MEMREGION_PERSISTENT_DATA].pBaseAddress;
-    pInstance->pCoef =
-         (LVDBE_Coef_FLOAT_t *)pMemoryTable->Region[LVDBE_MEMREGION_PERSISTENT_COEF].pBaseAddress;
+    pInstance->pData = (LVDBE_Data_FLOAT_t *)calloc(1, sizeof(*(pInstance->pData)));
+    if (pInstance->pData == NULL)
+    {
+        return LVDBE_NULLADDRESS;
+    }
+    pInstance->pCoef = (LVDBE_Coef_FLOAT_t *)calloc(1, sizeof(*(pInstance->pCoef)));
+    if (pInstance->pCoef == NULL)
+    {
+        return LVDBE_NULLADDRESS;
+    }
 
     /*
      * Initialise the filters
@@ -278,3 +168,32 @@
 
     return(LVDBE_SUCCESS);
 }
+
+/****************************************************************************************/
+/*                                                                                      */
+/* FUNCTION:                 LVDBE_DeInit                                               */
+/*                                                                                      */
+/* DESCRIPTION:                                                                         */
+/*    Free the memories created during LVDBE_Init including instance handle             */
+/*                                                                                      */
+/* PARAMETERS:                                                                          */
+/*  phInstance               Pointer to instance handle                                 */
+/*                                                                                      */
+/****************************************************************************************/
+void LVDBE_DeInit(LVDBE_Handle_t *phInstance)
+{
+    LVDBE_Instance_t *pInstance = (LVDBE_Instance_t *)*phInstance;
+    if (pInstance == LVM_NULL) {
+        return;
+    }
+    if (pInstance->pData != LVM_NULL) {
+        free(pInstance->pData);
+        pInstance->pData = LVM_NULL;
+    }
+    if (pInstance->pCoef != LVM_NULL) {
+        free(pInstance->pCoef);
+        pInstance->pCoef = LVM_NULL;
+    }
+    free(pInstance);
+    *phInstance = LVM_NULL;
+}
diff --git a/media/libeffects/lvm/lib/Bass/src/LVDBE_Private.h b/media/libeffects/lvm/lib/Bass/src/LVDBE_Private.h
index f3faaed..377d20e 100644
--- a/media/libeffects/lvm/lib/Bass/src/LVDBE_Private.h
+++ b/media/libeffects/lvm/lib/Bass/src/LVDBE_Private.h
@@ -47,24 +47,6 @@
 /* General */
 #define    LVDBE_INVALID            0xFFFF        /* Invalid init parameter */
 
-/* Memory */
-#define LVDBE_MEMREGION_INSTANCE         0       /* Offset to the instance memory region */
-#define LVDBE_MEMREGION_PERSISTENT_DATA  1       /* Offset to persistent data memory region */
-#define LVDBE_MEMREGION_PERSISTENT_COEF  2       /* Offset to persistent coefficient region */
-#define LVDBE_MEMREGION_SCRATCH          3       /* Offset to data scratch memory region */
-
-#define LVDBE_INSTANCE_ALIGN             4       /* 32-bit alignment for structures */
-#define LVDBE_PERSISTENT_DATA_ALIGN      4       /* 32-bit alignment for data */
-#define LVDBE_PERSISTENT_COEF_ALIGN      4       /* 32-bit alignment for coef */
-#define LVDBE_SCRATCH_ALIGN              4       /* 32-bit alignment for long data */
-
-#ifdef SUPPORT_MC
-/* Number of buffers required for inplace processing */
-#define LVDBE_SCRATCHBUFFERS_INPLACE     (LVM_MAX_CHANNELS * 3)
-#else
-#define LVDBE_SCRATCHBUFFERS_INPLACE     6       /* Number of buffers required for inplace processing */
-#endif
-
 #define LVDBE_MIXER_TC                   5       /* Mixer time  */
 #define LVDBE_BYPASS_MIXER_TC            100     /* Bypass mixer time */
 
@@ -100,13 +82,13 @@
 typedef struct
 {
     /* Public parameters */
-    LVDBE_MemTab_t                MemoryTable;        /* Instance memory allocation table */
     LVDBE_Params_t                Params;             /* Instance parameters */
     LVDBE_Capabilities_t        Capabilities;         /* Instance capabilities */
 
     /* Data and coefficient pointers */
     LVDBE_Data_FLOAT_t                *pData;                /* Instance data */
     LVDBE_Coef_FLOAT_t                *pCoef;                /* Instance coefficients */
+    void                        *pScratch;             /* scratch pointer */
 } LVDBE_Instance_t;
 
 /****************************************************************************************/
diff --git a/media/libeffects/lvm/lib/Bass/src/LVDBE_Process.cpp b/media/libeffects/lvm/lib/Bass/src/LVDBE_Process.cpp
index b4a71c7..088de9f 100644
--- a/media/libeffects/lvm/lib/Bass/src/LVDBE_Process.cpp
+++ b/media/libeffects/lvm/lib/Bass/src/LVDBE_Process.cpp
@@ -81,18 +81,13 @@
   LVDBE_Instance_t *pInstance =(LVDBE_Instance_t *)hInstance;
 
   /*Extract number of Channels info*/
-#ifdef SUPPORT_MC
   // Mono passed in as stereo
   const LVM_INT32 NrChannels = pInstance->Params.NrChannels == 1
       ? 2 : pInstance->Params.NrChannels;
-#else
-  const LVM_INT32 NrChannels = 2; // FCC_2
-#endif
   const LVM_INT32 NrSamples = NrChannels * NrFrames;
 
   /* Space to store DBE path computation */
-  LVM_FLOAT * const pScratch =
-          (LVM_FLOAT *)pInstance->MemoryTable.Region[LVDBE_MEMREGION_SCRATCH].pBaseAddress;
+  LVM_FLOAT * const pScratch = (LVM_FLOAT *)pInstance->pScratch;
 
   /*
    * Scratch for Mono path starts at offset of
@@ -136,33 +131,20 @@
      */
     if (pInstance->Params.HPFSelect == LVDBE_HPF_ON)
     {
-#ifdef SUPPORT_MC
       BQ_MC_D32F32C30_TRC_WRA_01(&pInstance->pCoef->HPFInstance, /* Filter instance      */
           pScratch, /* Source               */
           pScratch, /* Destination          */
           (LVM_INT16)NrFrames,
           (LVM_INT16)NrChannels);
-#else
-      BQ_2I_D32F32C30_TRC_WRA_01(&pInstance->pCoef->HPFInstance,/* Filter instance      */
-          pScratch, /* Source               */
-          pScratch, /* Destination          */
-          (LVM_INT16)NrFrames);
-#endif
     }
 
     /*
      * Create the mono stream
      */
-#ifdef SUPPORT_MC
     FromMcToMono_Float(pScratch, /* Source */
         pMono, /* Mono destination */
         (LVM_INT16)NrFrames,  /* Number of frames */
         (LVM_INT16)NrChannels);
-#else
-    From2iToMono_Float(pScratch, /* Stereo source         */
-        pMono, /* Mono destination      */
-        (LVM_INT16)NrFrames);
-#endif
 
     /*
      * Apply the band pass filter
@@ -175,20 +157,12 @@
     /*
      * Apply the AGC and mix
      */
-#ifdef SUPPORT_MC
     AGC_MIX_VOL_Mc1Mon_D32_WRA(&pInstance->pData->AGCInstance, /* Instance pointer      */
         pScratch, /* Source         */
         pMono, /* Mono band pass source */
         pScratch, /* Destination    */
         NrFrames, /* Number of frames     */
         NrChannels); /* Number of channels     */
-#else
-    AGC_MIX_VOL_2St1Mon_D32_WRA(&pInstance->pData->AGCInstance, /* Instance pointer      */
-        pScratch, /* Stereo source         */
-        pMono, /* Mono band pass source */
-        pScratch, /* Stereo destination    */
-        NrFrames);
-#endif
 
     for (LVM_INT32 ii = 0; ii < NrSamples; ++ii) {
       //TODO: replace with existing clamping function
@@ -213,18 +187,11 @@
      * The algorithm is disabled but volume management is required to compensate for
      * headroom and volume (if enabled)
      */
-#ifdef SUPPORT_MC
     LVC_MixSoft_Mc_D16C31_SAT(&pInstance->pData->BypassVolume,
         pInData,
         pScratchVol,
         (LVM_INT16)NrFrames,
         (LVM_INT16)NrChannels);
-#else
-    LVC_MixSoft_1St_D16C31_SAT(&pInstance->pData->BypassVolume,
-        pInData,
-        pScratchVol,
-        (LVM_INT16)NrSamples); /* Left and right, really # samples */
-#endif
   } else {
     // clear bypass volume path
     memset(pScratchVol, 0, sizeof(*pScratchVol) * NrSamples);
@@ -233,19 +200,11 @@
   /*
    * Mix DBE processed path and bypass volume path
    */
-#ifdef SUPPORT_MC
   LVC_MixSoft_2Mc_D16C31_SAT(&pInstance->pData->BypassMixer,
       pScratch,
       pScratchVol,
       pOutData,
       (LVM_INT16)NrFrames,
       (LVM_INT16)NrChannels);
-#else
-  LVC_MixSoft_2St_D16C31_SAT(&pInstance->pData->BypassMixer,
-      pScratch,
-      pScratchVol,
-      pOutData,
-      (LVM_INT16)NrSamples);
-#endif
   return LVDBE_SUCCESS;
 }
diff --git a/media/libeffects/lvm/lib/Bundle/lib/LVM.h b/media/libeffects/lvm/lib/Bundle/lib/LVM.h
index e4e8450..783c3a0 100644
--- a/media/libeffects/lvm/lib/Bundle/lib/LVM.h
+++ b/media/libeffects/lvm/lib/Bundle/lib/LVM.h
@@ -67,9 +67,6 @@
 /*                                                                                      */
 /****************************************************************************************/
 
-/* Memory table*/
-#define LVM_NR_MEMORY_REGIONS                 4     /* Number of memory regions */
-
 /* Concert Sound effect level presets */
 #define LVM_CS_EFFECT_NONE                    0     /* 0% effect, minimum value */
 #define LVM_CS_EFFECT_LOW                 16384     /* 50% effect */
@@ -225,12 +222,6 @@
 /*                                                                                      */
 /****************************************************************************************/
 
-/* Memory table containing the region definitions */
-typedef struct
-{
-    LVM_MemoryRegion_st         Region[LVM_NR_MEMORY_REGIONS];  /* One definition for each region */
-} LVM_MemTab_t;
-
 /* N-Band equaliser band definition */
 typedef struct
 {
@@ -285,10 +276,8 @@
     /* Spectrum Analyzer parameters Control */
     LVM_PSA_Mode_en             PSA_Enable;
     LVM_PSA_DecaySpeed_en       PSA_PeakDecayRate;      /* Peak value decay rate*/
-#ifdef SUPPORT_MC
     LVM_INT32                   NrChannels;
     LVM_INT32                   ChMask;
-#endif
 
 } LVM_ControlParams_t;
 
@@ -343,51 +332,14 @@
 
 /****************************************************************************************/
 /*                                                                                      */
-/* FUNCTION:                LVM_GetMemoryTable                                          */
-/*                                                                                      */
-/* DESCRIPTION:                                                                         */
-/*  This function is used for memory allocation and free. It can be called in           */
-/*  two ways:                                                                           */
-/*                                                                                      */
-/*      hInstance = NULL                Returns the memory requirements                 */
-/*      hInstance = Instance handle     Returns the memory requirements and             */
-/*                                      allocated base addresses for the instance       */
-/*                                                                                      */
-/*  When this function is called for memory allocation (hInstance=NULL) the memory      */
-/*  base address pointers are NULL on return.                                           */
-/*                                                                                      */
-/*  When the function is called for free (hInstance = Instance Handle) the memory       */
-/*  table returns the allocated memory and base addresses used during initialisation.   */
-/*                                                                                      */
-/* PARAMETERS:                                                                          */
-/*  hInstance               Instance Handle                                             */
-/*  pMemoryTable            Pointer to an empty memory definition table                 */
-/*  pInstParams             Pointer to the instance parameters                          */
-/*                                                                                      */
-/* RETURNS:                                                                             */
-/*  LVM_SUCCESS             Succeeded                                                   */
-/*  LVM_NULLADDRESS         When one of pMemoryTable or pInstParams is NULL             */
-/*  LVM_OUTOFRANGE          When any of the Instance parameters are out of range        */
-/*                                                                                      */
-/* NOTES:                                                                               */
-/*  1.  This function may be interrupted by the LVM_Process function                    */
-/*                                                                                      */
-/****************************************************************************************/
-LVM_ReturnStatus_en LVM_GetMemoryTable(LVM_Handle_t         hInstance,
-                                       LVM_MemTab_t         *pMemoryTable,
-                                       LVM_InstParams_t     *pInstParams);
-
-/****************************************************************************************/
-/*                                                                                      */
 /* FUNCTION:                LVM_GetInstanceHandle                                       */
 /*                                                                                      */
 /* DESCRIPTION:                                                                         */
-/*  This function is used to create a bundle instance. It returns the created instance  */
-/*  handle through phInstance. All parameters are set to their default, inactive state. */
+/*  This function is used to create a bundle instance.                                  */
+/*  All parameters are set to their default, inactive state.                            */
 /*                                                                                      */
 /* PARAMETERS:                                                                          */
-/*  phInstance              pointer to the instance handle                              */
-/*  pMemoryTable            Pointer to the memory definition table                      */
+/*  phInstance              Pointer to the instance handle                              */
 /*  pInstParams             Pointer to the instance parameters                          */
 /*                                                                                      */
 /* RETURNS:                                                                             */
@@ -400,11 +352,27 @@
 /*                                                                                      */
 /****************************************************************************************/
 LVM_ReturnStatus_en LVM_GetInstanceHandle(LVM_Handle_t        *phInstance,
-                                          LVM_MemTab_t        *pMemoryTable,
                                           LVM_InstParams_t    *pInstParams);
 
 /****************************************************************************************/
 /*                                                                                      */
+/* FUNCTION:                LVM_DelInstanceHandle                                       */
+/*                                                                                      */
+/* DESCRIPTION:                                                                         */
+/*  This function is used to create a bundle instance. It returns the created instance  */
+/*  handle through phInstance. All parameters are set to their default, inactive state. */
+/*                                                                                      */
+/* PARAMETERS:                                                                          */
+/*  phInstance              Pointer to the instance handle                              */
+/*                                                                                      */
+/* NOTES:                                                                               */
+/*  1. This function must not be interrupted by the LVM_Process function                */
+/*                                                                                      */
+/****************************************************************************************/
+void LVM_DelInstanceHandle(LVM_Handle_t        *phInstance);
+
+/****************************************************************************************/
+/*                                                                                      */
 /* FUNCTION:                LVM_ClearAudioBuffers                                       */
 /*                                                                                      */
 /* DESCRIPTION:                                                                         */
diff --git a/media/libeffects/lvm/lib/Bundle/src/LVM_Buffers.cpp b/media/libeffects/lvm/lib/Bundle/src/LVM_Buffers.cpp
index 3aeddbb..4c25ce0 100644
--- a/media/libeffects/lvm/lib/Bundle/src/LVM_Buffers.cpp
+++ b/media/libeffects/lvm/lib/Bundle/src/LVM_Buffers.cpp
@@ -62,11 +62,7 @@
     LVM_Instance_t   *pInstance = (LVM_Instance_t  *)hInstance;
     LVM_Buffer_t     *pBuffer;
     LVM_FLOAT        *pDest;
-#ifdef SUPPORT_MC
     LVM_INT16        NumChannels = pInstance->NrChannels;
-#else
-    LVM_INT16        NumChannels = 2;
-#endif
 
     /*
      * Set the processing address pointers
@@ -388,11 +384,9 @@
     LVM_INT16       NumSamples;
     LVM_FLOAT       *pStart;
     LVM_FLOAT       *pDest;
-#ifdef SUPPORT_MC
     LVM_INT32       NrChannels = pInstance->NrChannels;
 #define NrFrames NumSamples  // alias for clarity
 #define FrameCount SampleCount
-#endif
 
     /*
      * Set the pointers
@@ -426,25 +420,15 @@
             /*
              * Copy all output delay samples to the output
              */
-#ifdef SUPPORT_MC
             Copy_Float(&pBuffer->OutDelayBuffer[0],                /* Source */
                        pDest,                                      /* Destination */
                        /* Number of delay samples */
                        (LVM_INT16)(NrChannels * pBuffer->OutDelaySamples));
-#else
-            Copy_Float(&pBuffer->OutDelayBuffer[0],                /* Source */
-                       pDest,                                      /* Destination */
-                       (LVM_INT16)(2 * pBuffer->OutDelaySamples)); /* Number of delay samples */
-#endif
 
             /*
              * Update the pointer and sample counts
              */
-#ifdef SUPPORT_MC
             pDest += NrChannels * pBuffer->OutDelaySamples; /* Output sample pointer */
-#else
-            pDest += 2 * pBuffer->OutDelaySamples; /* Output sample pointer */
-#endif
             NumSamples = (LVM_INT16)(NumSamples - pBuffer->OutDelaySamples); /* Samples left \
                                                                                 to send */
             pBuffer->OutDelaySamples = 0; /* No samples left in the buffer */
@@ -454,40 +438,24 @@
             /*
              * Copy only some of the ouput delay samples to the output
              */
-#ifdef SUPPORT_MC
             Copy_Float(&pBuffer->OutDelayBuffer[0],                    /* Source */
                        pDest,                                          /* Destination */
                        (LVM_INT16)(NrChannels * NrFrames));       /* Number of delay samples */
-#else
-            Copy_Float(&pBuffer->OutDelayBuffer[0],                    /* Source */
-                       pDest,                                          /* Destination */
-                       (LVM_INT16)(2 * NumSamples));       /* Number of delay samples */
-#endif
 
             /*
              * Update the pointer and sample counts
              */
-#ifdef SUPPORT_MC
             pDest += NrChannels * NrFrames; /* Output sample pointer */
-#else
-            pDest += 2 * NumSamples; /* Output sample pointer */
-#endif
             /* No samples left in the buffer */
             pBuffer->OutDelaySamples = (LVM_INT16)(pBuffer->OutDelaySamples - NumSamples);
 
             /*
              * Realign the delay buffer data to avoid using circular buffer management
              */
-#ifdef SUPPORT_MC
             Copy_Float(&pBuffer->OutDelayBuffer[NrChannels * NrFrames],         /* Source */
                        &pBuffer->OutDelayBuffer[0],                    /* Destination */
                        /* Number of samples to move */
                        (LVM_INT16)(NrChannels * pBuffer->OutDelaySamples));
-#else
-            Copy_Float(&pBuffer->OutDelayBuffer[2 * NumSamples],         /* Source */
-                       &pBuffer->OutDelayBuffer[0],                    /* Destination */
-                       (LVM_INT16)(2 * pBuffer->OutDelaySamples)); /* Number of samples to move */
-#endif
             NumSamples = 0;                                /* Samples left to send */
         }
     }
@@ -503,23 +471,13 @@
             /*
              * Copy all processed samples to the output
              */
-#ifdef SUPPORT_MC
             Copy_Float(pStart,                                      /* Source */
                        pDest,                                       /* Destination */
                        (LVM_INT16)(NrChannels * FrameCount)); /* Number of processed samples */
-#else
-            Copy_Float(pStart,                                      /* Source */
-                       pDest,                                       /* Destination */
-                       (LVM_INT16)(2 * SampleCount)); /* Number of processed samples */
-#endif
             /*
              * Update the pointer and sample counts
              */
-#ifdef SUPPORT_MC
             pDest      += NrChannels * FrameCount;                 /* Output sample pointer */
-#else
-            pDest      += 2 * SampleCount;                          /* Output sample pointer */
-#endif
             NumSamples  = (LVM_INT16)(NumSamples - SampleCount);    /* Samples left to send */
             SampleCount = 0; /* No samples left in the buffer */
         }
@@ -528,25 +486,14 @@
             /*
              * Copy only some processed samples to the output
              */
-#ifdef SUPPORT_MC
             Copy_Float(pStart,                                         /* Source */
                        pDest,                                          /* Destination */
                        (LVM_INT16)(NrChannels * NrFrames));  /* Number of processed samples */
-#else
-            Copy_Float(pStart,                                         /* Source */
-                       pDest,                                          /* Destination */
-                       (LVM_INT16)(2 * NumSamples));     /* Number of processed samples */
-#endif
             /*
              * Update the pointers and sample counts
                */
-#ifdef SUPPORT_MC
             pStart      += NrChannels * NrFrames;               /* Processed sample pointer */
             pDest       += NrChannels * NrFrames;               /* Output sample pointer */
-#else
-            pStart      += 2 * NumSamples;                        /* Processed sample pointer */
-            pDest       += 2 * NumSamples;                        /* Output sample pointer */
-#endif
             SampleCount  = (LVM_INT16)(SampleCount - NumSamples); /* Processed samples left */
             NumSamples   = 0;                                     /* Clear the sample count */
         }
@@ -557,16 +504,10 @@
      */
     if (SampleCount != 0)
     {
-#ifdef SUPPORT_MC
         Copy_Float(pStart,                                                 /* Source */
                    /* Destination */
                    &pBuffer->OutDelayBuffer[NrChannels * pBuffer->OutDelaySamples],
                    (LVM_INT16)(NrChannels * FrameCount));      /* Number of processed samples */
-#else
-        Copy_Float(pStart,                                                 /* Source */
-                   &pBuffer->OutDelayBuffer[2 * pBuffer->OutDelaySamples], /* Destination */
-                   (LVM_INT16)(2 * SampleCount));               /* Number of processed samples */
-#endif
         /* Update the buffer count */
         pBuffer->OutDelaySamples = (LVM_INT16)(pBuffer->OutDelaySamples + SampleCount);
     }
@@ -606,7 +547,6 @@
 {
 
     LVM_Instance_t      *pInstance  = (LVM_Instance_t  *)hInstance;
-#ifdef SUPPORT_MC
     LVM_INT16           NumChannels = pInstance->NrChannels;
     if (NumChannels == 1)
     {
@@ -615,19 +555,12 @@
     }
 #undef NrFrames
 #define NrFrames (*pNumSamples) // alias for clarity
-#else
-    LVM_INT16           NumChannels = 2;
-#endif
 
     /*
      * Update sample counts
      */
     pInstance->pInputSamples    += (LVM_INT16)(*pNumSamples * NumChannels); /* Update the I/O pointers */
-#ifdef SUPPORT_MC
     pInstance->pOutputSamples   += (LVM_INT16)(NrFrames * NumChannels);
-#else
-    pInstance->pOutputSamples   += (LVM_INT16)(*pNumSamples * 2);
-#endif
     pInstance->SamplesToProcess  = (LVM_INT16)(pInstance->SamplesToProcess - *pNumSamples); /* Update the sample count */
 
     /*
diff --git a/media/libeffects/lvm/lib/Bundle/src/LVM_Control.cpp b/media/libeffects/lvm/lib/Bundle/src/LVM_Control.cpp
index ff2c90a..bb3652e 100644
--- a/media/libeffects/lvm/lib/Bundle/src/LVM_Control.cpp
+++ b/media/libeffects/lvm/lib/Bundle/src/LVM_Control.cpp
@@ -70,23 +70,17 @@
      (pParams->SampleRate != LVM_FS_32000) && (pParams->SampleRate != LVM_FS_44100) && (pParams->SampleRate != LVM_FS_48000)      &&
      (pParams->SampleRate != LVM_FS_88200) && (pParams->SampleRate != LVM_FS_96000) &&
      (pParams->SampleRate != LVM_FS_176400) && (pParams->SampleRate != LVM_FS_192000))      ||
-#ifdef SUPPORT_MC
         ((pParams->SourceFormat != LVM_STEREO) &&
          (pParams->SourceFormat != LVM_MONOINSTEREO) &&
          (pParams->SourceFormat != LVM_MONO) &&
          (pParams->SourceFormat != LVM_MULTICHANNEL)) ||
-#else
-        ((pParams->SourceFormat != LVM_STEREO) && (pParams->SourceFormat != LVM_MONOINSTEREO) && (pParams->SourceFormat != LVM_MONO)) ||
-#endif
         (pParams->SpeakerType > LVM_EX_HEADPHONES))
     {
         return (LVM_OUTOFRANGE);
     }
 
-#ifdef SUPPORT_MC
     pInstance->Params.NrChannels = pParams->NrChannels;
     pInstance->Params.ChMask     = pParams->ChMask;
-#endif
     /*
      * Cinema Sound parameters
      */
@@ -528,10 +522,8 @@
     } while ((pInstance->ControlPending != LVM_FALSE) &&
              (Count > 0));
 
-#ifdef SUPPORT_MC
     pInstance->NrChannels = LocalParams.NrChannels;
     pInstance->ChMask = LocalParams.ChMask;
-#endif
 
     /* Clear all internal data if format change*/
     if(LocalParams.SourceFormat != pInstance->Params.SourceFormat)
@@ -638,9 +630,7 @@
         DBE_Params.HeadroomdB       = 0;
         DBE_Params.VolumeControl    = LVDBE_VOLUME_OFF;
         DBE_Params.VolumedB         = 0;
-#ifdef SUPPORT_MC
         DBE_Params.NrChannels         = LocalParams.NrChannels;
-#endif
 
         /*
          * Make the changes
@@ -690,7 +680,6 @@
         {
             EQNB_Params.SourceFormat = LVEQNB_STEREO;
         }
-#ifdef SUPPORT_MC
         /* Note: Currently SourceFormat field of EQNB is not been
          *       used by the module.
          */
@@ -698,14 +687,11 @@
         {
             EQNB_Params.SourceFormat = LVEQNB_MULTICHANNEL;
         }
-#endif
         else
         {
             EQNB_Params.SourceFormat = LVEQNB_MONOINSTEREO;     /* Force to Mono-in-Stereo mode */
         }
-#ifdef SUPPORT_MC
         EQNB_Params.NrChannels         = LocalParams.NrChannels;
-#endif
 
         /*
          * Set the control flag
@@ -766,16 +752,12 @@
             CS_Params.SpeakerType  = LVCS_HEADPHONES;
         }
 
-#ifdef SUPPORT_MC
         /* Concert sound module processes only the left and right channels
          * data. So the Source Format is set to LVCS_STEREO for multichannel
          * input also.
          */
         if (LocalParams.SourceFormat == LVM_STEREO ||
             LocalParams.SourceFormat == LVM_MULTICHANNEL)
-#else
-        if (LocalParams.SourceFormat == LVM_STEREO)    /* Mono format not supported */
-#endif
         {
             CS_Params.SourceFormat = LVCS_STEREO;
         }
@@ -786,9 +768,7 @@
         CS_Params.SampleRate  = LocalParams.SampleRate;
         CS_Params.ReverbLevel = LocalParams.VirtualizerReverbLevel;
         CS_Params.EffectLevel = LocalParams.CS_EffectLevel;
-#ifdef SUPPORT_MC
         CS_Params.NrChannels  = LocalParams.NrChannels;
-#endif
 
         /*
          * Set the control flag
diff --git a/media/libeffects/lvm/lib/Bundle/src/LVM_Init.cpp b/media/libeffects/lvm/lib/Bundle/src/LVM_Init.cpp
index 5620529..58c18dd 100644
--- a/media/libeffects/lvm/lib/Bundle/src/LVM_Init.cpp
+++ b/media/libeffects/lvm/lib/Bundle/src/LVM_Init.cpp
@@ -20,6 +20,7 @@
 /*  Includes                                                                        */
 /*                                                                                  */
 /************************************************************************************/
+#include <stdlib.h>
 
 #include "LVM_Private.h"
 #include "LVM_Tables.h"
@@ -28,479 +29,31 @@
 
 /****************************************************************************************/
 /*                                                                                      */
-/* FUNCTION:                LVM_GetMemoryTable                                          */
-/*                                                                                      */
-/* DESCRIPTION:                                                                         */
-/*  This function is used for memory allocation and free. It can be called in           */
-/*  two ways:                                                                           */
-/*                                                                                      */
-/*      hInstance = NULL                Returns the memory requirements                 */
-/*      hInstance = Instance handle     Returns the memory requirements and             */
-/*                                      allocated base addresses for the instance       */
-/*                                                                                      */
-/*  When this function is called for memory allocation (hInstance=NULL) the memory      */
-/*  base address pointers are NULL on return.                                           */
-/*                                                                                      */
-/*  When the function is called for free (hInstance = Instance Handle) the memory       */
-/*  table returns the allocated memory and base addresses used during initialisation.   */
-/*                                                                                      */
-/* PARAMETERS:                                                                          */
-/*  hInstance               Instance Handle                                             */
-/*  pMemoryTable            Pointer to an empty memory definition table                 */
-/*  pCapabilities           Pointer to the default capabilities                         */
-/*                                                                                      */
-/* RETURNS:                                                                             */
-/*  LVM_SUCCESS             Succeeded                                                   */
-/*  LVM_NULLADDRESS         When one of pMemoryTable or pInstParams is NULL             */
-/*  LVM_OUTOFRANGE          When any of the Instance parameters are out of range        */
-/*                                                                                      */
-/* NOTES:                                                                               */
-/*  1.  This function may be interrupted by the LVM_Process function                    */
-/*  2.  The scratch memory is the largest required by any of the sub-modules plus any   */
-/*      additional scratch requirements of the bundle                                   */
-/*                                                                                      */
-/****************************************************************************************/
-
-/*
- * 4 Types of Memory Regions of LVM
- * TODO: Allocate on the fly.
- * i)   LVM_MEMREGION_PERSISTENT_SLOW_DATA - For Instance Handles
- * ii)  LVM_MEMREGION_PERSISTENT_FAST_DATA - Persistent Buffers
- * iii) LVM_MEMREGION_PERSISTENT_FAST_COEF - For Holding Structure values
- * iv)  LVM_MEMREGION_TEMPORARY_FAST       - For Holding Structure values
- *
- * LVM_MEMREGION_PERSISTENT_SLOW_DATA:
- *   Total Memory size:
- *     sizeof(LVM_Instance_t) + \
- *     sizeof(LVM_Buffer_t) + \
- *     sizeof(LVPSA_InstancePr_t) + \
- *     sizeof(LVM_Buffer_t) - needed if buffer mode is LVM_MANAGED_BUFFER
- *
- * LVM_MEMREGION_PERSISTENT_FAST_DATA:
- *   Total Memory size:
- *     sizeof(LVM_TE_Data_t) + \
- *     2 * pInstParams->EQNB_NumBands * sizeof(LVM_EQNB_BandDef_t) + \
- *     sizeof(LVCS_Data_t) + \
- *     sizeof(LVDBE_Data_FLOAT_t) + \
- *     sizeof(Biquad_2I_Order2_FLOAT_Taps_t) + \
- *     sizeof(Biquad_2I_Order2_FLOAT_Taps_t) + \
- *     pInstParams->EQNB_NumBands * sizeof(Biquad_2I_Order2_FLOAT_Taps_t) + \
- *     pInstParams->EQNB_NumBands * sizeof(LVEQNB_BandDef_t) + \
- *     pInstParams->EQNB_NumBands * sizeof(LVEQNB_BiquadType_en) + \
- *     2 * LVM_HEADROOM_MAX_NBANDS * sizeof(LVM_HeadroomBandDef_t) + \
- *     PSA_InitParams.nBands * sizeof(Biquad_1I_Order2_Taps_t) + \
- *     PSA_InitParams.nBands * sizeof(QPD_Taps_t)
- *
- * LVM_MEMREGION_PERSISTENT_FAST_COEF:
- *   Total Memory size:
- *     sizeof(LVM_TE_Coefs_t) + \
- *     sizeof(LVCS_Coefficient_t) + \
- *     sizeof(LVDBE_Coef_FLOAT_t) + \
- *     sizeof(Biquad_FLOAT_Instance_t) + \
- *     sizeof(Biquad_FLOAT_Instance_t) + \
- *     pInstParams->EQNB_NumBands * sizeof(Biquad_FLOAT_Instance_t) + \
- *     PSA_InitParams.nBands * sizeof(Biquad_Instance_t) + \
- *     PSA_InitParams.nBands * sizeof(QPD_State_t)
- *
- * LVM_MEMREGION_TEMPORARY_FAST (Scratch):
- *   Total Memory Size:
- *     BundleScratchSize + \
- *     MAX_INTERNAL_BLOCKSIZE * sizeof(LVM_FLOAT) + \
- *     MaxScratchOf (CS, EQNB, DBE, PSA)
- *
- *     a)BundleScratchSize:
- *         3 * LVM_MAX_CHANNELS \
- *         * (MIN_INTERNAL_BLOCKSIZE + InternalBlockSize) * sizeof(LVM_FLOAT)
- *       This Memory is allocated only when Buffer mode is LVM_MANAGED_BUFFER.
- *     b)MaxScratchOf (CS, EQNB, DBE, PSA)
- *       This Memory is needed for scratch usage for CS, EQNB, DBE, PSA.
- *       CS   = (LVCS_SCRATCHBUFFERS * sizeof(LVM_FLOAT)
- *               * pCapabilities->MaxBlockSize)
- *       EQNB = (LVEQNB_SCRATCHBUFFERS * sizeof(LVM_FLOAT)
- *               * pCapabilities->MaxBlockSize)
- *       DBE  = (LVDBE_SCRATCHBUFFERS_INPLACE*sizeof(LVM_FLOAT)
- *               * pCapabilities->MaxBlockSize)
- *       PSA  = (2 * pInitParams->MaxInputBlockSize * sizeof(LVM_FLOAT))
- *              one MaxInputBlockSize for input and another for filter output
- *     c)MAX_INTERNAL_BLOCKSIZE
- *       This Memory is needed for PSAInput - Temp memory to store output
- *       from McToMono block and given as input to PSA block
- */
-
-LVM_ReturnStatus_en LVM_GetMemoryTable(LVM_Handle_t         hInstance,
-                                       LVM_MemTab_t         *pMemoryTable,
-                                       LVM_InstParams_t     *pInstParams)
-{
-
-    LVM_Instance_t      *pInstance = (LVM_Instance_t *)hInstance;
-    LVM_UINT32          AlgScratchSize;
-    LVM_UINT32          BundleScratchSize;
-    LVM_UINT16          InternalBlockSize;
-    INST_ALLOC          AllocMem[LVM_NR_MEMORY_REGIONS];
-    LVM_INT16           i;
-
-    /*
-     * Check parameters
-     */
-    if(pMemoryTable == LVM_NULL)
-    {
-        return LVM_NULLADDRESS;
-    }
-
-    /*
-     * Return memory table if the instance has already been created
-     */
-    if (hInstance != LVM_NULL)
-    {
-       /* Read back memory allocation table */
-        *pMemoryTable = pInstance->MemoryTable;
-        return(LVM_SUCCESS);
-    }
-
-    if(pInstParams == LVM_NULL)
-    {
-        return LVM_NULLADDRESS;
-    }
-
-    /*
-     *  Power Spectrum Analyser
-     */
-    if(pInstParams->PSA_Included > LVM_PSA_ON)
-    {
-        return (LVM_OUTOFRANGE);
-    }
-
-    /*
-     * Check the instance parameters
-     */
-    if( (pInstParams->BufferMode != LVM_MANAGED_BUFFERS) && (pInstParams->BufferMode != LVM_UNMANAGED_BUFFERS) )
-    {
-        return (LVM_OUTOFRANGE);
-    }
-
-    /* N-Band Equalizer */
-    if( pInstParams->EQNB_NumBands > 32 )
-    {
-        return (LVM_OUTOFRANGE);
-    }
-
-    if(pInstParams->BufferMode == LVM_MANAGED_BUFFERS)
-    {
-        if( (pInstParams->MaxBlockSize < LVM_MIN_MAXBLOCKSIZE ) || (pInstParams->MaxBlockSize > LVM_MANAGED_MAX_MAXBLOCKSIZE ) )
-        {
-            return (LVM_OUTOFRANGE);
-        }
-    }
-    else
-    {
-        if( (pInstParams->MaxBlockSize < LVM_MIN_MAXBLOCKSIZE ) || (pInstParams->MaxBlockSize > LVM_UNMANAGED_MAX_MAXBLOCKSIZE) )
-        {
-            return (LVM_OUTOFRANGE);
-        }
-    }
-
-    /*
-    * Initialise the AllocMem structures
-    */
-    for (i=0; i<LVM_NR_MEMORY_REGIONS; i++)
-    {
-        InstAlloc_Init(&AllocMem[i], LVM_NULL);
-    }
-    InternalBlockSize = (LVM_UINT16)((pInstParams->MaxBlockSize) & MIN_INTERNAL_BLOCKMASK); /* Force to a multiple of MIN_INTERNAL_BLOCKSIZE */
-
-    if (InternalBlockSize < MIN_INTERNAL_BLOCKSIZE)
-    {
-        InternalBlockSize = MIN_INTERNAL_BLOCKSIZE;
-    }
-
-    /* Maximum Internal Black Size should not be more than MAX_INTERNAL_BLOCKSIZE*/
-    if(InternalBlockSize > MAX_INTERNAL_BLOCKSIZE)
-    {
-        InternalBlockSize = MAX_INTERNAL_BLOCKSIZE;
-    }
-
-    /*
-    * Bundle requirements
-    */
-    InstAlloc_AddMember(&AllocMem[LVM_MEMREGION_PERSISTENT_SLOW_DATA],
-        sizeof(LVM_Instance_t));
-
-    /*
-     * Set the algorithm and bundle scratch requirements
-     */
-    AlgScratchSize    = 0;
-    if (pInstParams->BufferMode == LVM_MANAGED_BUFFERS)
-    {
-        BundleScratchSize = 3 * LVM_MAX_CHANNELS \
-                            * (MIN_INTERNAL_BLOCKSIZE + InternalBlockSize) \
-                            * sizeof(LVM_FLOAT);
-        InstAlloc_AddMember(&AllocMem[LVM_MEMREGION_TEMPORARY_FAST],        /* Scratch buffer */
-                            BundleScratchSize);
-        InstAlloc_AddMember(&AllocMem[LVM_MEMREGION_PERSISTENT_SLOW_DATA],
-                            sizeof(LVM_Buffer_t));
-    }
-
-    /*
-     * Treble Enhancement requirements
-     */
-    InstAlloc_AddMember(&AllocMem[LVM_MEMREGION_PERSISTENT_FAST_DATA],
-                        sizeof(LVM_TE_Data_t));
-    InstAlloc_AddMember(&AllocMem[LVM_MEMREGION_PERSISTENT_FAST_COEF],
-                        sizeof(LVM_TE_Coefs_t));
-
-    /*
-     * N-Band Equalizer requirements
-     */
-    InstAlloc_AddMember(&AllocMem[LVM_MEMREGION_PERSISTENT_FAST_DATA],      /* Local storage */
-                        (pInstParams->EQNB_NumBands * sizeof(LVM_EQNB_BandDef_t)));
-    InstAlloc_AddMember(&AllocMem[LVM_MEMREGION_PERSISTENT_FAST_DATA],      /* User storage */
-                        (pInstParams->EQNB_NumBands * sizeof(LVM_EQNB_BandDef_t)));
-
-    /*
-     * Concert Sound requirements
-     */
-    {
-        LVCS_MemTab_t           CS_MemTab;
-        LVCS_Capabilities_t     CS_Capabilities;
-
-        /*
-         * Set the capabilities
-         */
-        CS_Capabilities.MaxBlockSize     = InternalBlockSize;
-
-        /*
-         * Get the memory requirements
-         */
-        LVCS_Memory(LVM_NULL,
-                    &CS_MemTab,
-                    &CS_Capabilities);
-
-        /*
-         * Update the memory allocation structures
-         */
-        InstAlloc_AddMember(&AllocMem[LVM_MEMREGION_PERSISTENT_FAST_DATA],
-                            CS_MemTab.Region[LVM_MEMREGION_PERSISTENT_FAST_DATA].Size);
-        InstAlloc_AddMember(&AllocMem[LVM_MEMREGION_PERSISTENT_FAST_COEF],
-                            CS_MemTab.Region[LVM_MEMREGION_PERSISTENT_FAST_COEF].Size);
-        if (CS_MemTab.Region[LVM_MEMREGION_TEMPORARY_FAST].Size > AlgScratchSize) AlgScratchSize = CS_MemTab.Region[LVM_MEMREGION_TEMPORARY_FAST].Size;
-
-    }
-
-    /*
-     * Dynamic Bass Enhancement requirements
-     */
-    {
-        LVDBE_MemTab_t          DBE_MemTab;
-        LVDBE_Capabilities_t    DBE_Capabilities;
-
-        /*
-         * Set the capabilities
-         */
-        DBE_Capabilities.SampleRate      = LVDBE_CAP_FS_8000 | LVDBE_CAP_FS_11025 |
-                                           LVDBE_CAP_FS_12000 | LVDBE_CAP_FS_16000 |
-                                           LVDBE_CAP_FS_22050 | LVDBE_CAP_FS_24000 |
-                                           LVDBE_CAP_FS_32000 | LVDBE_CAP_FS_44100 |
-                                           LVDBE_CAP_FS_48000 | LVDBE_CAP_FS_88200 |
-                                           LVDBE_CAP_FS_96000 | LVDBE_CAP_FS_176400 |
-                                           LVDBE_CAP_FS_192000;
-        DBE_Capabilities.CentreFrequency = LVDBE_CAP_CENTRE_55Hz | LVDBE_CAP_CENTRE_55Hz | LVDBE_CAP_CENTRE_66Hz | LVDBE_CAP_CENTRE_78Hz | LVDBE_CAP_CENTRE_90Hz;
-        DBE_Capabilities.MaxBlockSize    = InternalBlockSize;
-
-        /*
-         * Get the memory requirements
-         */
-        LVDBE_Memory(LVM_NULL,
-                    &DBE_MemTab,
-
-                    &DBE_Capabilities);
-        /*
-         * Update the bundle table
-         */
-        InstAlloc_AddMember(&AllocMem[LVM_MEMREGION_PERSISTENT_FAST_DATA],
-                            DBE_MemTab.Region[LVM_MEMREGION_PERSISTENT_FAST_DATA].Size);
-        InstAlloc_AddMember(&AllocMem[LVM_MEMREGION_PERSISTENT_FAST_COEF],
-                            DBE_MemTab.Region[LVM_MEMREGION_PERSISTENT_FAST_COEF].Size);
-        if (DBE_MemTab.Region[LVM_MEMREGION_TEMPORARY_FAST].Size > AlgScratchSize) AlgScratchSize = DBE_MemTab.Region[LVM_MEMREGION_TEMPORARY_FAST].Size;
-
-    }
-
-    /*
-     * N-Band equaliser requirements
-     */
-    {
-        LVEQNB_MemTab_t         EQNB_MemTab;            /* For N-Band Equaliser */
-        LVEQNB_Capabilities_t   EQNB_Capabilities;
-
-        /*
-         * Set the capabilities
-         */
-        EQNB_Capabilities.SampleRate   = LVEQNB_CAP_FS_8000 | LVEQNB_CAP_FS_11025 |
-                                         LVEQNB_CAP_FS_12000 | LVEQNB_CAP_FS_16000 |
-                                         LVEQNB_CAP_FS_22050 | LVEQNB_CAP_FS_24000 |
-                                         LVEQNB_CAP_FS_32000 | LVEQNB_CAP_FS_44100 |
-                                         LVEQNB_CAP_FS_48000 | LVEQNB_CAP_FS_88200 |
-                                         LVEQNB_CAP_FS_96000 | LVEQNB_CAP_FS_176400 |
-                                         LVEQNB_CAP_FS_192000;
-        EQNB_Capabilities.SourceFormat = LVEQNB_CAP_STEREO | LVEQNB_CAP_MONOINSTEREO;
-        EQNB_Capabilities.MaxBlockSize = InternalBlockSize;
-        EQNB_Capabilities.MaxBands     = pInstParams->EQNB_NumBands;
-
-        /*
-         * Get the memory requirements
-         */
-        LVEQNB_Memory(LVM_NULL,
-                      &EQNB_MemTab,
-                      &EQNB_Capabilities);
-
-        /*
-         * Update the bundle table
-         */
-        InstAlloc_AddMember(&AllocMem[LVM_MEMREGION_PERSISTENT_FAST_DATA],
-                            EQNB_MemTab.Region[LVM_MEMREGION_PERSISTENT_FAST_DATA].Size);
-        InstAlloc_AddMember(&AllocMem[LVM_MEMREGION_PERSISTENT_FAST_COEF],
-                            EQNB_MemTab.Region[LVM_MEMREGION_PERSISTENT_FAST_COEF].Size);
-        if (EQNB_MemTab.Region[LVM_MEMREGION_TEMPORARY_FAST].Size > AlgScratchSize) AlgScratchSize = EQNB_MemTab.Region[LVM_MEMREGION_TEMPORARY_FAST].Size;
-
-    }
-
-    /*
-     * Headroom management memory allocation
-     */
-    InstAlloc_AddMember(&AllocMem[LVM_MEMREGION_PERSISTENT_FAST_DATA],
-                       (LVM_HEADROOM_MAX_NBANDS * sizeof(LVM_HeadroomBandDef_t)));
-    InstAlloc_AddMember(&AllocMem[LVM_MEMREGION_PERSISTENT_FAST_DATA],
-                       (LVM_HEADROOM_MAX_NBANDS * sizeof(LVM_HeadroomBandDef_t)));
-
-    /*
-     * Spectrum Analyzer memory requirements
-     */
-    {
-        pLVPSA_Handle_t     hPSAInst = LVM_NULL;
-        LVPSA_MemTab_t      PSA_MemTab;
-        LVPSA_InitParams_t  PSA_InitParams;
-        LVPSA_FilterParam_t FiltersParams[9];
-        LVPSA_RETURN        PSA_Status;
-
-        if(pInstParams->PSA_Included == LVM_PSA_ON)
-        {
-            PSA_InitParams.SpectralDataBufferDuration   = (LVM_UINT16) 500;
-            PSA_InitParams.MaxInputBlockSize            = (LVM_UINT16) 1000;
-            PSA_InitParams.nBands                       = (LVM_UINT16) 9;
-
-            PSA_InitParams.pFiltersParams = &FiltersParams[0];
-            for(i = 0; i < PSA_InitParams.nBands; i++)
-            {
-                FiltersParams[i].CenterFrequency    = (LVM_UINT16) 1000;
-                FiltersParams[i].QFactor            = (LVM_UINT16) 25;
-                FiltersParams[i].PostGain           = (LVM_INT16)  0;
-            }
-
-            /*
-            * Get the memory requirements
-            */
-            PSA_Status = LVPSA_Memory (hPSAInst,
-                                        &PSA_MemTab,
-                                        &PSA_InitParams);
-
-            if (PSA_Status != LVPSA_OK)
-            {
-                return((LVM_ReturnStatus_en) LVM_ALGORITHMPSA);
-            }
-
-            /*
-            * Update the bundle table
-            */
-            /* Slow Data */
-            InstAlloc_AddMember(&AllocMem[LVM_MEMREGION_PERSISTENT_SLOW_DATA],
-                PSA_MemTab.Region[LVM_PERSISTENT_SLOW_DATA].Size);
-
-            /* Fast Data */
-            InstAlloc_AddMember(&AllocMem[LVM_MEMREGION_PERSISTENT_FAST_DATA],
-                PSA_MemTab.Region[LVM_PERSISTENT_FAST_DATA].Size);
-
-            /* Fast Coef */
-            InstAlloc_AddMember(&AllocMem[LVM_MEMREGION_PERSISTENT_FAST_COEF],
-                PSA_MemTab.Region[LVM_PERSISTENT_FAST_COEF].Size);
-
-            /* Fast Temporary */
-            InstAlloc_AddMember(&AllocMem[LVM_TEMPORARY_FAST],
-                                MAX_INTERNAL_BLOCKSIZE * sizeof(LVM_FLOAT));
-
-            if (PSA_MemTab.Region[LVM_TEMPORARY_FAST].Size > AlgScratchSize)
-            {
-                AlgScratchSize = PSA_MemTab.Region[LVM_TEMPORARY_FAST].Size;
-            }
-        }
-    }
-
-    /*
-     * Return the memory table
-     */
-    pMemoryTable->Region[LVM_MEMREGION_PERSISTENT_SLOW_DATA].Size         = InstAlloc_GetTotal(&AllocMem[LVM_MEMREGION_PERSISTENT_SLOW_DATA]);
-    pMemoryTable->Region[LVM_MEMREGION_PERSISTENT_SLOW_DATA].Type         = LVM_PERSISTENT_SLOW_DATA;
-    pMemoryTable->Region[LVM_MEMREGION_PERSISTENT_SLOW_DATA].pBaseAddress = LVM_NULL;
-
-    pMemoryTable->Region[LVM_MEMREGION_PERSISTENT_FAST_DATA].Size         = InstAlloc_GetTotal(&AllocMem[LVM_MEMREGION_PERSISTENT_FAST_DATA]);
-    pMemoryTable->Region[LVM_MEMREGION_PERSISTENT_FAST_DATA].Type         = LVM_PERSISTENT_FAST_DATA;
-    pMemoryTable->Region[LVM_MEMREGION_PERSISTENT_FAST_DATA].pBaseAddress = LVM_NULL;
-    if (pMemoryTable->Region[LVM_MEMREGION_PERSISTENT_FAST_DATA].Size < 4)
-    {
-        pMemoryTable->Region[LVM_MEMREGION_PERSISTENT_FAST_DATA].Size = 0;
-    }
-
-    pMemoryTable->Region[LVM_MEMREGION_PERSISTENT_FAST_COEF].Size         = InstAlloc_GetTotal(&AllocMem[LVM_MEMREGION_PERSISTENT_FAST_COEF]);
-    pMemoryTable->Region[LVM_MEMREGION_PERSISTENT_FAST_COEF].Type         = LVM_PERSISTENT_FAST_COEF;
-    pMemoryTable->Region[LVM_MEMREGION_PERSISTENT_FAST_COEF].pBaseAddress = LVM_NULL;
-    if (pMemoryTable->Region[LVM_MEMREGION_PERSISTENT_FAST_COEF].Size < 4)
-    {
-        pMemoryTable->Region[LVM_MEMREGION_PERSISTENT_FAST_COEF].Size = 0;
-    }
-
-    InstAlloc_AddMember(&AllocMem[LVM_MEMREGION_TEMPORARY_FAST],
-                        AlgScratchSize);
-    pMemoryTable->Region[LVM_MEMREGION_TEMPORARY_FAST].Size             = InstAlloc_GetTotal(&AllocMem[LVM_MEMREGION_TEMPORARY_FAST]);
-    pMemoryTable->Region[LVM_MEMREGION_TEMPORARY_FAST].Type             = LVM_TEMPORARY_FAST;
-    pMemoryTable->Region[LVM_MEMREGION_TEMPORARY_FAST].pBaseAddress     = LVM_NULL;
-    if (pMemoryTable->Region[LVM_MEMREGION_TEMPORARY_FAST].Size < 4)
-    {
-        pMemoryTable->Region[LVM_MEMREGION_TEMPORARY_FAST].Size = 0;
-    }
-
-    return(LVM_SUCCESS);
-
-}
-
-/****************************************************************************************/
-/*                                                                                      */
 /* FUNCTION:                LVM_GetInstanceHandle                                       */
 /*                                                                                      */
 /* DESCRIPTION:                                                                         */
-/*  This function is used to create a bundle instance. It returns the created instance  */
-/*  handle through phInstance. All parameters are set to their default, inactive state. */
+/*  This function is used to create a bundle instance.                                  */
+/*  All parameters are set to their default, inactive state.                            */
 /*                                                                                      */
 /* PARAMETERS:                                                                          */
-/*  phInstance              pointer to the instance handle                              */
-/*  pMemoryTable            Pointer to the memory definition table                      */
-/*  pInstParams             Pointer to the initialisation capabilities                  */
+/*  phInstance              Pointer to the instance handle                              */
+/*  pInstParams             Pointer to the instance parameters                          */
 /*                                                                                      */
 /* RETURNS:                                                                             */
 /*  LVM_SUCCESS             Initialisation succeeded                                    */
+/*  LVM_NULLADDRESS         One or more memory has a NULL pointer                       */
 /*  LVM_OUTOFRANGE          When any of the Instance parameters are out of range        */
-/*  LVM_NULLADDRESS         When one of phInstance, pMemoryTable or pInstParams are NULL*/
 /*                                                                                      */
 /* NOTES:                                                                               */
 /*  1. This function must not be interrupted by the LVM_Process function                */
 /*                                                                                      */
 /****************************************************************************************/
-
 LVM_ReturnStatus_en LVM_GetInstanceHandle(LVM_Handle_t           *phInstance,
-                                          LVM_MemTab_t           *pMemoryTable,
                                           LVM_InstParams_t       *pInstParams)
 {
 
     LVM_ReturnStatus_en     Status = LVM_SUCCESS;
     LVM_Instance_t          *pInstance;
-    INST_ALLOC              AllocMem[LVM_NR_MEMORY_REGIONS];
     LVM_INT16               i;
     LVM_UINT16              InternalBlockSize;
     LVM_INT32               BundleScratchSize;
@@ -508,24 +61,12 @@
     /*
      * Check valid points have been given
      */
-    if ((phInstance == LVM_NULL) || (pMemoryTable == LVM_NULL) || (pInstParams == LVM_NULL))
+    if ((phInstance == LVM_NULL) || (pInstParams == LVM_NULL))
     {
         return (LVM_NULLADDRESS);
     }
 
     /*
-     * Check the memory table for NULL pointers
-     */
-    for (i=0; i<LVM_NR_MEMORY_REGIONS; i++)
-    {
-        if ((pMemoryTable->Region[i].Size != 0) &&
-            (pMemoryTable->Region[i].pBaseAddress==LVM_NULL))
-        {
-            return(LVM_NULLADDRESS);
-        }
-    }
-
-    /*
      * Check the instance parameters
      */
     if( (pInstParams->BufferMode != LVM_MANAGED_BUFFERS) && (pInstParams->BufferMode != LVM_UNMANAGED_BUFFERS) )
@@ -559,29 +100,19 @@
     }
 
     /*
-     * Initialise the AllocMem structures
+     * Create the instance handle
      */
-    for (i=0; i<LVM_NR_MEMORY_REGIONS; i++)
+    *phInstance  = (LVM_Handle_t)calloc(1, sizeof(*pInstance));
+    if (*phInstance == LVM_NULL)
     {
-        InstAlloc_Init(&AllocMem[i],
-                       pMemoryTable->Region[i].pBaseAddress);
+        return LVM_NULLADDRESS;
     }
+    pInstance = (LVM_Instance_t  *)*phInstance;
+
+    pInstance->InstParams = *pInstParams;
 
     /*
-     * Set the instance handle
-     */
-    *phInstance  = (LVM_Handle_t)InstAlloc_AddMember(&AllocMem[LVM_MEMREGION_PERSISTENT_SLOW_DATA],
-                                                     sizeof(LVM_Instance_t));
-    pInstance =(LVM_Instance_t  *)*phInstance;
-
-    /*
-     * Save the memory table, parameters and capabilities
-     */
-    pInstance->MemoryTable    = *pMemoryTable;
-    pInstance->InstParams     = *pInstParams;
-
-    /*
-     * Set the bundle scratch memory and initialse the buffer management
+     * Create the bundle scratch memory and initialse the buffer management
      */
     InternalBlockSize = (LVM_UINT16)((pInstParams->MaxBlockSize) & MIN_INTERNAL_BLOCKMASK); /* Force to a multiple of MIN_INTERNAL_BLOCKSIZE */
     if (InternalBlockSize < MIN_INTERNAL_BLOCKSIZE)
@@ -600,23 +131,31 @@
      * Common settings for managed and unmanaged buffers
      */
     pInstance->SamplesToProcess = 0;                /* No samples left to process */
+    BundleScratchSize = (LVM_INT32)
+                        (3 * LVM_MAX_CHANNELS \
+                         * (MIN_INTERNAL_BLOCKSIZE + InternalBlockSize) \
+                         * sizeof(LVM_FLOAT));
+    pInstance->pScratch = calloc(1, BundleScratchSize);
+    if (pInstance->pScratch == LVM_NULL)
+    {
+        return LVM_NULLADDRESS;
+    }
+
     if (pInstParams->BufferMode == LVM_MANAGED_BUFFERS)
     {
         /*
          * Managed buffers required
          */
         pInstance->pBufferManagement = (LVM_Buffer_t *)
-            InstAlloc_AddMember(&AllocMem[LVM_MEMREGION_PERSISTENT_SLOW_DATA],
-                                                           sizeof(LVM_Buffer_t));
-        BundleScratchSize = (LVM_INT32)
-                            (3 * LVM_MAX_CHANNELS \
-                             * (MIN_INTERNAL_BLOCKSIZE + InternalBlockSize) \
-                             * sizeof(LVM_FLOAT));
-        pInstance->pBufferManagement->pScratch = (LVM_FLOAT *)
-            InstAlloc_AddMember(
-                         &AllocMem[LVM_MEMREGION_TEMPORARY_FAST], /* Scratch 1 buffer */
-                                                  (LVM_UINT32)BundleScratchSize);
-        LoadConst_Float(0,                                   /* Clear the input delay buffer */
+                    calloc(1, sizeof(*(pInstance->pBufferManagement)));
+        if (pInstance->pBufferManagement == LVM_NULL)
+        {
+            return LVM_NULLADDRESS;
+        }
+
+        pInstance->pBufferManagement->pScratch = (LVM_FLOAT *)pInstance->pScratch;
+
+        LoadConst_Float(0, /* Clear the input delay buffer */
                         (LVM_FLOAT *)&pInstance->pBufferManagement->InDelayBuffer,
                         (LVM_INT16)(LVM_MAX_CHANNELS * MIN_INTERNAL_BLOCKSIZE));
         pInstance->pBufferManagement->InDelaySamples = MIN_INTERNAL_BLOCKSIZE; /* Set the number of delay samples */
@@ -642,20 +181,21 @@
     /*
      * DC removal filter
      */
-#ifdef SUPPORT_MC
     DC_Mc_D16_TRC_WRA_01_Init(&pInstance->DC_RemovalInstance);
-#else
-    DC_2I_D16_TRC_WRA_01_Init(&pInstance->DC_RemovalInstance);
-#endif
 
     /*
      * Treble Enhancement
      */
-    pInstance->pTE_Taps  = (LVM_TE_Data_t *)InstAlloc_AddMember(&AllocMem[LVM_MEMREGION_PERSISTENT_FAST_DATA],
-                                                                sizeof(LVM_TE_Data_t));
-
-    pInstance->pTE_State = (LVM_TE_Coefs_t *)InstAlloc_AddMember(&AllocMem[LVM_MEMREGION_PERSISTENT_FAST_COEF],
-                                                                 sizeof(LVM_TE_Coefs_t));
+    pInstance->pTE_Taps  = (LVM_TE_Data_t *)calloc(1, sizeof(*(pInstance->pTE_Taps)));
+    if (pInstance->pTE_Taps == LVM_NULL)
+    {
+        return LVM_NULLADDRESS;
+    }
+    pInstance->pTE_State = (LVM_TE_Coefs_t *)calloc(1, sizeof(*(pInstance->pTE_State)));
+    if (pInstance->pTE_State == LVM_NULL)
+    {
+        return LVM_NULLADDRESS;
+    }
     pInstance->Params.TE_OperatingMode = LVM_TE_OFF;
     pInstance->Params.TE_EffectLevel   = 0;
     pInstance->TE_Active               = LVM_FALSE;
@@ -699,21 +239,26 @@
     LVC_Mixer_VarSlope_SetTimeConstant(&pInstance->VC_BalanceMix.MixerStream[1],LVM_VC_MIXER_TIME,LVM_FS_8000,2);
 
     /*
-     * Set the default EQNB pre-gain and pointer to the band definitions
+     * Create the default EQNB pre-gain and pointer to the band definitions
      */
-    pInstance->pEQNB_BandDefs =
-        (LVM_EQNB_BandDef_t *)InstAlloc_AddMember(&AllocMem[LVM_MEMREGION_PERSISTENT_FAST_DATA],
-                                   (pInstParams->EQNB_NumBands * sizeof(LVM_EQNB_BandDef_t)));
-    pInstance->pEQNB_UserDefs =
-        (LVM_EQNB_BandDef_t *)InstAlloc_AddMember(&AllocMem[LVM_MEMREGION_PERSISTENT_FAST_DATA],
-                                   (pInstParams->EQNB_NumBands * sizeof(LVM_EQNB_BandDef_t)));
+    pInstance->pEQNB_BandDefs = (LVM_EQNB_BandDef_t *)
+        calloc(pInstParams->EQNB_NumBands, sizeof(*(pInstance->pEQNB_BandDefs)));
+    if (pInstance->pEQNB_BandDefs == LVM_NULL)
+    {
+        return LVM_NULLADDRESS;
+    }
+    pInstance->pEQNB_UserDefs = (LVM_EQNB_BandDef_t *)
+         calloc(pInstParams->EQNB_NumBands, sizeof(*(pInstance->pEQNB_UserDefs)));
+    if (pInstance->pEQNB_UserDefs == LVM_NULL)
+    {
+        return LVM_NULLADDRESS;
+    }
 
     /*
      * Initialise the Concert Sound module
      */
     {
         LVCS_Handle_t           hCSInstance;                /* Instance handle */
-        LVCS_MemTab_t           CS_MemTab;                  /* Memory table */
         LVCS_Capabilities_t     CS_Capabilities;            /* Initial capabilities */
         LVCS_ReturnStatus_en    LVCS_Status;                /* Function call status */
 
@@ -733,26 +278,12 @@
         CS_Capabilities.pBundleInstance = (void*)pInstance;
 
         /*
-         * Get the memory requirements and then set the address pointers, forcing alignment
-         */
-        LVCS_Status = LVCS_Memory(LVM_NULL,                /* Get the memory requirements */
-                                  &CS_MemTab,
-                                  &CS_Capabilities);
-        CS_MemTab.Region[LVCS_MEMREGION_PERSISTENT_SLOW_DATA].pBaseAddress = &pInstance->CS_Instance;
-        CS_MemTab.Region[LVCS_MEMREGION_PERSISTENT_FAST_DATA].pBaseAddress = (void *)InstAlloc_AddMember(&AllocMem[LVM_MEMREGION_PERSISTENT_FAST_DATA],
-                                                                                                         CS_MemTab.Region[LVCS_MEMREGION_PERSISTENT_FAST_DATA].Size);
-        CS_MemTab.Region[LVCS_MEMREGION_PERSISTENT_FAST_COEF].pBaseAddress = (void *)InstAlloc_AddMember(&AllocMem[LVM_MEMREGION_PERSISTENT_FAST_COEF],
-                                                                                                         CS_MemTab.Region[LVCS_MEMREGION_PERSISTENT_FAST_COEF].Size);
-        CS_MemTab.Region[LVCS_MEMREGION_TEMPORARY_FAST].pBaseAddress       = (void *)InstAlloc_AddMember(&AllocMem[LVM_MEMREGION_TEMPORARY_FAST],
-                                                                                                         0);
-
-        /*
          * Initialise the Concert Sound instance and save the instance handle
          */
         hCSInstance = LVM_NULL;                            /* Set to NULL to return handle */
-        LVCS_Status = LVCS_Init(&hCSInstance,              /* Initiailse */
-                                &CS_MemTab,
-                                &CS_Capabilities);
+        LVCS_Status = LVCS_Init(&hCSInstance,              /* Create and initiailse */
+                                &CS_Capabilities,
+                                pInstance->pScratch);
         if (LVCS_Status != LVCS_SUCCESS) return((LVM_ReturnStatus_en)LVCS_Status);
         pInstance->hCSInstance = hCSInstance;              /* Save the instance handle */
 
@@ -763,7 +294,6 @@
      */
     {
         LVDBE_Handle_t          hDBEInstance;               /* Instance handle */
-        LVDBE_MemTab_t          DBE_MemTab;                 /* Memory table */
         LVDBE_Capabilities_t    DBE_Capabilities;           /* Initial capabilities */
         LVDBE_ReturnStatus_en   LVDBE_Status;               /* Function call status */
 
@@ -787,30 +317,19 @@
                                            LVDBE_CAP_FS_48000 | LVDBE_CAP_FS_88200 |
                                            LVDBE_CAP_FS_96000 | LVDBE_CAP_FS_176400 |
                                            LVDBE_CAP_FS_192000;
-        DBE_Capabilities.CentreFrequency = LVDBE_CAP_CENTRE_55Hz | LVDBE_CAP_CENTRE_55Hz | LVDBE_CAP_CENTRE_66Hz | LVDBE_CAP_CENTRE_78Hz | LVDBE_CAP_CENTRE_90Hz;
-        DBE_Capabilities.MaxBlockSize    = (LVM_UINT16)InternalBlockSize;
 
-        /*
-         * Get the memory requirements and then set the address pointers
-         */
-        LVDBE_Status = LVDBE_Memory(LVM_NULL,               /* Get the memory requirements */
-                                    &DBE_MemTab,
-                                    &DBE_Capabilities);
-        DBE_MemTab.Region[LVDBE_MEMREGION_INSTANCE].pBaseAddress        = &pInstance->DBE_Instance;
-        DBE_MemTab.Region[LVDBE_MEMREGION_PERSISTENT_DATA].pBaseAddress = (void *)InstAlloc_AddMember(&AllocMem[LVM_MEMREGION_PERSISTENT_FAST_DATA],
-                                                                                                      DBE_MemTab.Region[LVDBE_MEMREGION_PERSISTENT_DATA].Size);
-        DBE_MemTab.Region[LVDBE_MEMREGION_PERSISTENT_COEF].pBaseAddress = (void *)InstAlloc_AddMember(&AllocMem[LVM_MEMREGION_PERSISTENT_FAST_COEF],
-                                                                                                      DBE_MemTab.Region[LVDBE_MEMREGION_PERSISTENT_COEF].Size);
-        DBE_MemTab.Region[LVDBE_MEMREGION_SCRATCH].pBaseAddress         = (void *)InstAlloc_AddMember(&AllocMem[LVM_MEMREGION_TEMPORARY_FAST],
-                                                                                                      0);
+        DBE_Capabilities.CentreFrequency = LVDBE_CAP_CENTRE_55Hz | LVDBE_CAP_CENTRE_55Hz |
+                                            LVDBE_CAP_CENTRE_66Hz | LVDBE_CAP_CENTRE_78Hz |
+                                            LVDBE_CAP_CENTRE_90Hz;
+        DBE_Capabilities.MaxBlockSize    = (LVM_UINT16)InternalBlockSize;
 
         /*
          * Initialise the Dynamic Bass Enhancement instance and save the instance handle
          */
         hDBEInstance = LVM_NULL;                            /* Set to NULL to return handle */
-        LVDBE_Status = LVDBE_Init(&hDBEInstance,            /* Initiailse */
-                                  &DBE_MemTab,
-                                  &DBE_Capabilities);
+        LVDBE_Status = LVDBE_Init(&hDBEInstance,            /* Create and initiailse */
+                                  &DBE_Capabilities,
+                                  pInstance->pScratch);
         if (LVDBE_Status != LVDBE_SUCCESS) return((LVM_ReturnStatus_en)LVDBE_Status);
         pInstance->hDBEInstance = hDBEInstance;             /* Save the instance handle */
     }
@@ -820,7 +339,6 @@
      */
     {
         LVEQNB_Handle_t          hEQNBInstance;             /* Instance handle */
-        LVEQNB_MemTab_t          EQNB_MemTab;               /* Memory table */
         LVEQNB_Capabilities_t    EQNB_Capabilities;         /* Initial capabilities */
         LVEQNB_ReturnStatus_en   LVEQNB_Status;             /* Function call status */
 
@@ -842,6 +360,7 @@
                                             LVEQNB_CAP_FS_48000 | LVEQNB_CAP_FS_88200 |
                                             LVEQNB_CAP_FS_96000 | LVEQNB_CAP_FS_176400 |
                                             LVEQNB_CAP_FS_192000;
+
         EQNB_Capabilities.MaxBlockSize    = (LVM_UINT16)InternalBlockSize;
         EQNB_Capabilities.MaxBands        = pInstParams->EQNB_NumBands;
         EQNB_Capabilities.SourceFormat    = LVEQNB_CAP_STEREO | LVEQNB_CAP_MONOINSTEREO;
@@ -849,26 +368,12 @@
         EQNB_Capabilities.pBundleInstance  = (void*)pInstance;
 
         /*
-         * Get the memory requirements and then set the address pointers, forcing alignment
-         */
-        LVEQNB_Status = LVEQNB_Memory(LVM_NULL,             /* Get the memory requirements */
-                                      &EQNB_MemTab,
-                                      &EQNB_Capabilities);
-        EQNB_MemTab.Region[LVEQNB_MEMREGION_INSTANCE].pBaseAddress        = &pInstance->EQNB_Instance;
-        EQNB_MemTab.Region[LVEQNB_MEMREGION_PERSISTENT_DATA].pBaseAddress = (void *)InstAlloc_AddMember(&AllocMem[LVM_MEMREGION_PERSISTENT_FAST_DATA],
-                                                                                                        EQNB_MemTab.Region[LVEQNB_MEMREGION_PERSISTENT_DATA].Size);
-        EQNB_MemTab.Region[LVEQNB_MEMREGION_PERSISTENT_COEF].pBaseAddress = (void *)InstAlloc_AddMember(&AllocMem[LVM_MEMREGION_PERSISTENT_FAST_COEF],
-                                                                                                        EQNB_MemTab.Region[LVEQNB_MEMREGION_PERSISTENT_COEF].Size);
-        EQNB_MemTab.Region[LVEQNB_MEMREGION_SCRATCH].pBaseAddress         = (void *)InstAlloc_AddMember(&AllocMem[LVM_MEMREGION_TEMPORARY_FAST],
-                                                                                                        0);
-
-        /*
          * Initialise the Dynamic Bass Enhancement instance and save the instance handle
          */
         hEQNBInstance = LVM_NULL;                           /* Set to NULL to return handle */
-        LVEQNB_Status = LVEQNB_Init(&hEQNBInstance,         /* Initiailse */
-                                    &EQNB_MemTab,
-                                    &EQNB_Capabilities);
+        LVEQNB_Status = LVEQNB_Init(&hEQNBInstance,         /* Create and initiailse */
+                                    &EQNB_Capabilities,
+                                    pInstance->pScratch);
         if (LVEQNB_Status != LVEQNB_SUCCESS) return((LVM_ReturnStatus_en)LVEQNB_Status);
         pInstance->hEQNBInstance = hEQNBInstance;           /* Save the instance handle */
     }
@@ -878,11 +383,17 @@
      */
     {
         pInstance->pHeadroom_BandDefs = (LVM_HeadroomBandDef_t *)
-              InstAlloc_AddMember(&AllocMem[LVM_MEMREGION_PERSISTENT_FAST_DATA],
-                                       (LVM_HEADROOM_MAX_NBANDS * sizeof(LVM_HeadroomBandDef_t)));
+            calloc(LVM_HEADROOM_MAX_NBANDS, sizeof(*(pInstance->pHeadroom_BandDefs)));
+        if (pInstance->pHeadroom_BandDefs == LVM_NULL)
+        {
+            return LVM_NULLADDRESS;
+        }
         pInstance->pHeadroom_UserDefs = (LVM_HeadroomBandDef_t *)
-              InstAlloc_AddMember(&AllocMem[LVM_MEMREGION_PERSISTENT_FAST_DATA],
-                                       (LVM_HEADROOM_MAX_NBANDS * sizeof(LVM_HeadroomBandDef_t)));
+            calloc(LVM_HEADROOM_MAX_NBANDS, sizeof(*(pInstance->pHeadroom_UserDefs)));
+        if (pInstance->pHeadroom_UserDefs == LVM_NULL)
+        {
+            return LVM_NULLADDRESS;
+        }
 
         /* Headroom management parameters initialisation */
         pInstance->NewHeadroomParams.NHeadroomBands = 2;
@@ -903,7 +414,6 @@
      */
     {
         pLVPSA_Handle_t     hPSAInstance = LVM_NULL;   /* Instance handle */
-        LVPSA_MemTab_t      PSA_MemTab;
         LVPSA_RETURN        PSA_Status;                 /* Function call status */
         LVPSA_FilterParam_t FiltersParams[9];
 
@@ -920,41 +430,18 @@
                 FiltersParams[i].PostGain           = (LVM_INT16)  0;
             }
 
-            /*Get the memory requirements and then set the address pointers*/
-            PSA_Status = LVPSA_Memory (hPSAInstance,
-                                          &PSA_MemTab,
-                                          &pInstance->PSA_InitParams);
-
-            if (PSA_Status != LVPSA_OK)
-            {
-                return((LVM_ReturnStatus_en) LVM_ALGORITHMPSA);
-            }
-
-            /* Slow Data */
-            PSA_MemTab.Region[LVM_PERSISTENT_SLOW_DATA].pBaseAddress = (void *)InstAlloc_AddMember(&AllocMem[LVM_MEMREGION_PERSISTENT_SLOW_DATA],
-                PSA_MemTab.Region[LVM_PERSISTENT_SLOW_DATA].Size);
-
-            /* Fast Data */
-            PSA_MemTab.Region[LVM_PERSISTENT_FAST_DATA].pBaseAddress = (void *)InstAlloc_AddMember(&AllocMem[LVM_MEMREGION_PERSISTENT_FAST_DATA],
-                PSA_MemTab.Region[LVM_PERSISTENT_FAST_DATA].Size);
-
-            /* Fast Coef */
-            PSA_MemTab.Region[LVM_PERSISTENT_FAST_COEF].pBaseAddress = (void *)InstAlloc_AddMember(&AllocMem[LVM_MEMREGION_PERSISTENT_FAST_COEF],
-                PSA_MemTab.Region[LVM_PERSISTENT_FAST_COEF].Size);
-
-            /* Fast Temporary */
-            pInstance->pPSAInput = (LVM_FLOAT *)InstAlloc_AddMember(&AllocMem[LVM_TEMPORARY_FAST],
-                                                       (LVM_UINT32) MAX_INTERNAL_BLOCKSIZE * \
-                                                       sizeof(LVM_FLOAT));
-            PSA_MemTab.Region[LVM_TEMPORARY_FAST].pBaseAddress       = (void *)InstAlloc_AddMember(&AllocMem[LVM_MEMREGION_TEMPORARY_FAST],0);
-
             /*Initialise PSA instance and save the instance handle*/
             pInstance->PSA_ControlParams.Fs = LVM_FS_48000;
             pInstance->PSA_ControlParams.LevelDetectionSpeed  = LVPSA_SPEED_MEDIUM;
+            pInstance->pPSAInput = (LVM_FLOAT *)calloc(MAX_INTERNAL_BLOCKSIZE, sizeof(LVM_FLOAT));
+            if (pInstance->pPSAInput == LVM_NULL)
+            {
+                return LVM_NULLADDRESS;
+            }
             PSA_Status = LVPSA_Init (&hPSAInstance,
                                     &pInstance->PSA_InitParams,
                                     &pInstance->PSA_ControlParams,
-                                    &PSA_MemTab);
+                                    pInstance->pScratch);
 
             if (PSA_Status != LVPSA_OK)
             {
@@ -1007,6 +494,111 @@
 
     return(Status);
 }
+/****************************************************************************************/
+/*                                                                                      */
+/* FUNCTION:                LVM_DelInstanceHandle                                       */
+/*                                                                                      */
+/* DESCRIPTION:                                                                         */
+/*  This function is used to create a bundle instance. It returns the created instance  */
+/*  handle through phInstance. All parameters are set to their default, inactive state. */
+/*                                                                                      */
+/* PARAMETERS:                                                                          */
+/*  phInstance              Pointer to the instance handle                              */
+/*                                                                                      */
+/* NOTES:                                                                               */
+/*  1. This function must not be interrupted by the LVM_Process function                */
+/*                                                                                      */
+/****************************************************************************************/
+void LVM_DelInstanceHandle(LVM_Handle_t *phInstance)
+{
+    LVM_Instance_t *pInstance = (LVM_Instance_t *)*phInstance;
+
+    if (pInstance->pScratch != LVM_NULL) {
+        free(pInstance->pScratch);
+        pInstance->pScratch = LVM_NULL;
+    }
+
+    if (pInstance->InstParams.BufferMode == LVM_MANAGED_BUFFERS) {
+        /*
+         * Managed buffers required
+         */
+        if (pInstance->pBufferManagement != LVM_NULL) {
+            free(pInstance->pBufferManagement);
+            pInstance->pBufferManagement = LVM_NULL;
+        }
+    }
+
+    /*
+     * Treble Enhancement
+     */
+    if (pInstance->pTE_Taps != LVM_NULL) {
+        free(pInstance->pTE_Taps);
+        pInstance->pTE_Taps = LVM_NULL;
+    }
+    if (pInstance->pTE_State != LVM_NULL) {
+        free(pInstance->pTE_State);
+        pInstance->pTE_State = LVM_NULL;
+    }
+
+    /*
+     * Free the default EQNB pre-gain and pointer to the band definitions
+     */
+    if (pInstance->pEQNB_BandDefs != LVM_NULL) {
+        free(pInstance->pEQNB_BandDefs);
+        pInstance->pEQNB_BandDefs = LVM_NULL;
+    }
+    if (pInstance->pEQNB_UserDefs != LVM_NULL) {
+        free(pInstance->pEQNB_UserDefs);
+        pInstance->pEQNB_UserDefs = LVM_NULL;
+    }
+
+    /*
+     * De-initialise the Concert Sound module
+     */
+    if (pInstance->hCSInstance != LVM_NULL) {
+        LVCS_DeInit(&pInstance->hCSInstance);
+    }
+
+    /*
+     * De-initialise the Bass Enhancement module
+     */
+    if (pInstance->hDBEInstance != LVM_NULL) {
+        LVDBE_DeInit(&pInstance->hDBEInstance);
+    }
+
+    /*
+     * De-initialise the N-Band Equaliser module
+     */
+    if (pInstance->hEQNBInstance != LVM_NULL) {
+        LVEQNB_DeInit(&pInstance->hEQNBInstance);
+    }
+
+    /*
+     * Free Headroom management memory.
+     */
+    if (pInstance->pHeadroom_BandDefs != LVM_NULL) {
+        free(pInstance->pHeadroom_BandDefs);
+        pInstance->pHeadroom_BandDefs = LVM_NULL;
+    }
+    if (pInstance->pHeadroom_UserDefs != LVM_NULL) {
+        free(pInstance->pHeadroom_UserDefs);
+        pInstance->pHeadroom_UserDefs = LVM_NULL;
+    }
+
+    /*
+     * De-initialise the PSA module
+     */
+    if (pInstance->hPSAInstance != LVM_NULL) {
+        LVPSA_DeInit(&pInstance->hPSAInstance);
+    }
+    if (pInstance->pPSAInput != LVM_NULL) {
+        free(pInstance->pPSAInput);
+        pInstance->pPSAInput = LVM_NULL;
+    }
+
+    free(*phInstance);
+    return;
+}
 
 /****************************************************************************************/
 /*                                                                                      */
@@ -1029,7 +621,6 @@
 
 LVM_ReturnStatus_en LVM_ClearAudioBuffers(LVM_Handle_t  hInstance)
 {
-    LVM_MemTab_t            MemTab;                                     /* Memory table */
     LVM_InstParams_t        InstParams;                                 /* Instance parameters */
     LVM_ControlParams_t     Params;                                     /* Control Parameters */
     LVM_Instance_t          *pInstance  = (LVM_Instance_t  *)hInstance; /* Pointer to Instance */
@@ -1045,17 +636,11 @@
     /*Save the headroom parameters*/
     LVM_GetHeadroomParams(hInstance, &HeadroomParams);
 
-    /*  Retrieve allocated buffers in memtab */
-    LVM_GetMemoryTable(hInstance, &MemTab,  LVM_NULL);
 
     /*  Save the instance parameters */
     InstParams = pInstance->InstParams;
 
     /*  Call  LVM_GetInstanceHandle to re-initialise the bundle */
-    LVM_GetInstanceHandle( &hInstance,
-                           &MemTab,
-                           &InstParams);
-
     /* Restore control parameters */ /* coverity[unchecked_value] */ /* Do not check return value internal function calls */
     LVM_SetControlParameters(hInstance, &Params);
 
@@ -1063,11 +648,7 @@
     LVM_SetHeadroomParams(hInstance, &HeadroomParams);
 
     /* DC removal filter */
-#ifdef SUPPORT_MC
     DC_Mc_D16_TRC_WRA_01_Init(&pInstance->DC_RemovalInstance);
-#else
-    DC_2I_D16_TRC_WRA_01_Init(&pInstance->DC_RemovalInstance);
-#endif
 
     return LVM_SUCCESS;
 }
diff --git a/media/libeffects/lvm/lib/Bundle/src/LVM_Private.h b/media/libeffects/lvm/lib/Bundle/src/LVM_Private.h
index ddaac99..a9492a1 100644
--- a/media/libeffects/lvm/lib/Bundle/src/LVM_Private.h
+++ b/media/libeffects/lvm/lib/Bundle/src/LVM_Private.h
@@ -113,40 +113,15 @@
 /*                                                                                  */
 /************************************************************************************/
 
-/* Memory region definition */
-typedef struct
-{
-    LVM_UINT32              Size;               /* Region size in bytes */
-    LVM_UINT16              Alignment;          /* Byte alignment */
-    LVM_MemoryTypes_en      Type;               /* Region type */
-    void                    *pBaseAddress;      /* Pointer to the region base address */
-} LVM_IntMemoryRegion_t;
-
-/* Memory table containing the region definitions */
-typedef struct
-{
-    LVM_IntMemoryRegion_t   Region[LVM_NR_MEMORY_REGIONS];  /* One definition for each region */
-} LVM_IntMemTab_t;
-
 /* Buffer Management */
 typedef struct
 {
     LVM_FLOAT               *pScratch;          /* Bundle scratch buffer */
 
     LVM_INT16               BufferState;        /* Buffer status */
-#ifdef SUPPORT_MC
     LVM_FLOAT               InDelayBuffer[3 * LVM_MAX_CHANNELS * MIN_INTERNAL_BLOCKSIZE];
-#else
-    LVM_FLOAT               InDelayBuffer[6 * MIN_INTERNAL_BLOCKSIZE]; /* Input buffer delay line, \
-                                                                           left and right */
-#endif
     LVM_INT16               InDelaySamples;     /* Number of samples in the input delay buffer */
-#ifdef SUPPORT_MC
     LVM_FLOAT               OutDelayBuffer[LVM_MAX_CHANNELS * MIN_INTERNAL_BLOCKSIZE];
-#else
-    LVM_FLOAT               OutDelayBuffer[2 * MIN_INTERNAL_BLOCKSIZE]; /* Output buffer delay \
-                                                                                      line */
-#endif
     LVM_INT16               OutDelaySamples;    /* Number of samples in the output delay buffer, \
                                                                              left and right */
     LVM_INT16               SamplesToOutput;    /* Samples to write to the output */
@@ -167,7 +142,6 @@
 typedef struct
 {
     /* Public parameters */
-    LVM_MemTab_t            MemoryTable;        /* Instance memory allocation table */
     LVM_ControlParams_t     Params;             /* Control parameters */
     LVM_InstParams_t        InstParams;         /* Instance parameters */
 
@@ -236,10 +210,9 @@
 
     LVM_INT16              NoSmoothVolume;      /* Enable or disable smooth volume changes*/
 
-#ifdef SUPPORT_MC
     LVM_INT16              NrChannels;
     LVM_INT32              ChMask;
-#endif
+    void                   *pScratch;           /* Pointer to bundle scratch buffer*/
 
 } LVM_Instance_t;
 
diff --git a/media/libeffects/lvm/lib/Bundle/src/LVM_Process.cpp b/media/libeffects/lvm/lib/Bundle/src/LVM_Process.cpp
index dc86cfd..3af2327 100644
--- a/media/libeffects/lvm/lib/Bundle/src/LVM_Process.cpp
+++ b/media/libeffects/lvm/lib/Bundle/src/LVM_Process.cpp
@@ -64,11 +64,9 @@
     LVM_FLOAT           *pToProcess = (LVM_FLOAT *)pInData;
     LVM_FLOAT           *pProcessed = pOutData;
     LVM_ReturnStatus_en  Status;
-#ifdef SUPPORT_MC
     LVM_INT32           NrChannels  = pInstance->NrChannels;
     LVM_INT32           ChMask      = pInstance->ChMask;
 #define NrFrames SampleCount  // alias for clarity
-#endif
 
     /*
      * Check if the number of samples is zero
@@ -114,11 +112,9 @@
     if (pInstance->ControlPending == LVM_TRUE)
     {
         Status = LVM_ApplyNewSettings(hInstance);
-#ifdef SUPPORT_MC
         /* Update the local variable NrChannels from pInstance->NrChannels value */
         NrChannels = pInstance->NrChannels;
         ChMask     = pInstance->ChMask;
-#endif
 
         if(Status != LVM_SUCCESS)
         {
@@ -136,10 +132,8 @@
                        (LVM_INT16)NumSamples);                 /* Number of input samples */
         pInput     = pOutData;
         pToProcess = pOutData;
-#ifdef SUPPORT_MC
         NrChannels = 2;
         ChMask     = AUDIO_CHANNEL_OUT_STEREO;
-#endif
     }
 
     /*
@@ -179,18 +173,11 @@
              */
             if (pInstance->VC_Active!=0)
             {
-#ifdef SUPPORT_MC
                 LVC_MixSoft_Mc_D16C31_SAT(&pInstance->VC_Volume,
                                        pToProcess,
                                        pProcessed,
                                        (LVM_INT16)(NrFrames),
                                        NrChannels);
-#else
-                LVC_MixSoft_1St_D16C31_SAT(&pInstance->VC_Volume,
-                                       pToProcess,
-                                       pProcessed,
-                                       (LVM_INT16)(2 * SampleCount));     /* Left and right*/
-#endif
                 pToProcess = pProcessed;
             }
 
@@ -224,15 +211,9 @@
              */
             if (pToProcess != pProcessed)
             {
-#ifdef SUPPORT_MC
                 Copy_Float(pToProcess,                             /* Source */
                            pProcessed,                             /* Destination */
                            (LVM_INT16)(NrChannels * NrFrames));    /* Copy all samples */
-#else
-                Copy_Float(pToProcess,                             /* Source */
-                           pProcessed,                             /* Destination */
-                           (LVM_INT16)(2 * SampleCount));          /* Left and right */
-#endif
             }
 
             /*
@@ -243,21 +224,13 @@
                 /*
                  * Apply the filter
                  */
-#ifdef SUPPORT_MC
                 FO_Mc_D16F32C15_LShx_TRC_WRA_01(&pInstance->pTE_State->TrebleBoost_State,
                                            pProcessed,
                                            pProcessed,
                                            (LVM_INT16)NrFrames,
                                            (LVM_INT16)NrChannels);
-#else
-                FO_2I_D16F32C15_LShx_TRC_WRA_01(&pInstance->pTE_State->TrebleBoost_State,
-                                           pProcessed,
-                                           pProcessed,
-                                           (LVM_INT16)SampleCount);
-#endif
 
             }
-#ifdef SUPPORT_MC
             /*
              * Volume balance
              */
@@ -267,15 +240,6 @@
                                           NrFrames,
                                           NrChannels,
                                           ChMask);
-#else
-            /*
-             * Volume balance
-             */
-            LVC_MixSoft_1St_2i_D16C31_SAT(&pInstance->VC_BalanceMix,
-                                          pProcessed,
-                                          pProcessed,
-                                          SampleCount);
-#endif
 
             /*
              * Perform Parametric Spectum Analysis
@@ -283,16 +247,10 @@
             if ((pInstance->Params.PSA_Enable == LVM_PSA_ON) &&
                                             (pInstance->InstParams.PSA_Included == LVM_PSA_ON))
             {
-#ifdef SUPPORT_MC
                 FromMcToMono_Float(pProcessed,
                                    pInstance->pPSAInput,
                                    (LVM_INT16)(NrFrames),
                                    NrChannels);
-#else
-                From2iToMono_Float(pProcessed,
-                                   pInstance->pPSAInput,
-                                   (LVM_INT16)(SampleCount));
-#endif
 
                 LVPSA_Process(pInstance->hPSAInstance,
                         pInstance->pPSAInput,
@@ -303,18 +261,11 @@
             /*
              * DC removal
              */
-#ifdef SUPPORT_MC
             DC_Mc_D16_TRC_WRA_01(&pInstance->DC_RemovalInstance,
                                  pProcessed,
                                  pProcessed,
                                  (LVM_INT16)NrFrames,
                                  NrChannels);
-#else
-            DC_2I_D16_TRC_WRA_01(&pInstance->DC_RemovalInstance,
-                                 pProcessed,
-                                 pProcessed,
-                                 (LVM_INT16)SampleCount);
-#endif
         }
         /*
          * Manage the output buffer
diff --git a/media/libeffects/lvm/lib/Common/lib/AGC.h b/media/libeffects/lvm/lib/Common/lib/AGC.h
index bef7fa1..6160452 100644
--- a/media/libeffects/lvm/lib/Common/lib/AGC.h
+++ b/media/libeffects/lvm/lib/Common/lib/AGC.h
@@ -54,14 +54,12 @@
                                  const LVM_FLOAT            *pMonoSrc,      /* Mono source */
                                  LVM_FLOAT                  *pDst,          /* Stereo destination */
                                  LVM_UINT16                 n);             /* Number of samples */
-#ifdef SUPPORT_MC
 void AGC_MIX_VOL_Mc1Mon_D32_WRA(AGC_MIX_VOL_2St1Mon_FLOAT_t  *pInstance,  /* Instance pointer */
                                  const LVM_FLOAT            *pStSrc,      /* Source */
                                  const LVM_FLOAT            *pMonoSrc,    /* Mono source */
                                  LVM_FLOAT                  *pDst,        /* Destination */
                                  LVM_UINT16                 NrFrames,     /* Number of frames */
                                  LVM_UINT16                 NrChannels);  /* Number of channels */
-#endif
 
 #endif  /* __AGC_H__ */
 
diff --git a/media/libeffects/lvm/lib/Common/lib/BIQUAD.h b/media/libeffects/lvm/lib/Common/lib/BIQUAD.h
index c050cd0..b1eefb1 100644
--- a/media/libeffects/lvm/lib/Common/lib/BIQUAD.h
+++ b/media/libeffects/lvm/lib/Common/lib/BIQUAD.h
@@ -24,7 +24,6 @@
 ***********************************************************************************/
 typedef struct
 {
-#ifdef SUPPORT_MC
     /* The memory region created by this structure instance is typecast
      * into another structure containing a pointer and an array of filter
      * coefficients. In one case this memory region is used for storing
@@ -32,9 +31,6 @@
      */
     LVM_FLOAT *pStorage;
     LVM_FLOAT Storage[LVM_MAX_CHANNELS];
-#else
-    LVM_FLOAT Storage[6];
-#endif
 } Biquad_FLOAT_Instance_t;
 /**********************************************************************************
    COEFFICIENT TYPE DEFINITIONS
@@ -94,12 +90,8 @@
 
 typedef struct
 {
-#ifdef SUPPORT_MC
     /* LVM_MAX_CHANNELS channels, two taps of size LVM_FLOAT */
     LVM_FLOAT Storage[ (LVM_MAX_CHANNELS * 2) ];
-#else
-    LVM_FLOAT Storage[ (2 * 2) ];  /* Two channels, two taps of size LVM_FLOAT */
-#endif
 } Biquad_2I_Order1_FLOAT_Taps_t;
 
 /*** Types used for biquad, band pass and peaking filter **************************/
@@ -110,12 +102,8 @@
 
 typedef struct
 {
-#ifdef SUPPORT_MC
     /* LVM_MAX_CHANNELS, four taps of size LVM_FLOAT */
     LVM_FLOAT Storage[ (LVM_MAX_CHANNELS * 4) ];
-#else
-    LVM_FLOAT Storage[ (2 * 4) ];  /* Two channels, four taps of size LVM_FLOAT */
-#endif
 } Biquad_2I_Order2_FLOAT_Taps_t;
 /* The names of the functions are changed to satisfy QAC rules: Name should be Unique withing 16 characters*/
 #define BQ_2I_D32F32Cll_TRC_WRA_01_Init  Init_BQ_2I_D32F32Cll_TRC_WRA_01
@@ -185,13 +173,11 @@
                                             LVM_FLOAT                    *pDataIn,
                                             LVM_FLOAT                    *pDataOut,
                                             LVM_INT16                 NrSamples);
-#ifdef SUPPORT_MC
 void BQ_MC_D32F32C30_TRC_WRA_01 (           Biquad_FLOAT_Instance_t      *pInstance,
                                             LVM_FLOAT                    *pDataIn,
                                             LVM_FLOAT                    *pDataOut,
                                             LVM_INT16                    NrFrames,
                                             LVM_INT16                    NrChannels);
-#endif
 
 /**********************************************************************************
    FUNCTION PROTOTYPES: FIRST ORDER FILTERS
@@ -223,13 +209,11 @@
                                  LVM_FLOAT                     *pDataIn,
                                  LVM_FLOAT                     *pDataOut,
                                  LVM_INT16                     NrSamples);
-#ifdef SUPPORT_MC
 void FO_Mc_D16F32C15_LShx_TRC_WRA_01(Biquad_FLOAT_Instance_t  *pInstance,
                                      LVM_FLOAT                *pDataIn,
                                      LVM_FLOAT                *pDataOut,
                                      LVM_INT16                NrFrames,
                                      LVM_INT16                NrChannels);
-#endif
 /**********************************************************************************
    FUNCTION PROTOTYPES: BAND PASS FILTERS
 ***********************************************************************************/
@@ -266,20 +250,17 @@
                                     LVM_FLOAT               *pDataIn,
                                     LVM_FLOAT               *pDataOut,
                                     LVM_INT16               NrSamples);
-#ifdef SUPPORT_MC
 void PK_Mc_D32F32C14G11_TRC_WRA_01(Biquad_FLOAT_Instance_t       *pInstance,
                                    LVM_FLOAT               *pDataIn,
                                    LVM_FLOAT               *pDataOut,
                                    LVM_INT16               NrFrames,
                                    LVM_INT16               NrChannels);
-#endif
 
 /**********************************************************************************
    FUNCTION PROTOTYPES: DC REMOVAL FILTERS
 ***********************************************************************************/
 
 /*** 16 bit data path STEREO ******************************************************/
-#ifdef SUPPORT_MC
 void DC_Mc_D16_TRC_WRA_01_Init     (        Biquad_FLOAT_Instance_t       *pInstance);
 
 void DC_Mc_D16_TRC_WRA_01          (        Biquad_FLOAT_Instance_t       *pInstance,
@@ -287,14 +268,6 @@
                                             LVM_FLOAT               *pDataOut,
                                             LVM_INT16               NrFrames,
                                             LVM_INT16               NrChannels);
-#else
-void DC_2I_D16_TRC_WRA_01_Init     (        Biquad_FLOAT_Instance_t       *pInstance);
-
-void DC_2I_D16_TRC_WRA_01          (        Biquad_FLOAT_Instance_t       *pInstance,
-                                            LVM_FLOAT               *pDataIn,
-                                            LVM_FLOAT               *pDataOut,
-                                            LVM_INT16               NrSamples);
-#endif
 
 /**********************************************************************************/
 
diff --git a/media/libeffects/lvm/lib/Common/lib/LVM_Types.h b/media/libeffects/lvm/lib/Common/lib/LVM_Types.h
index 8b687f6..008d192 100644
--- a/media/libeffects/lvm/lib/Common/lib/LVM_Types.h
+++ b/media/libeffects/lvm/lib/Common/lib/LVM_Types.h
@@ -54,26 +54,6 @@
 
 #define LVM_NR_MEMORY_REGIONS                   4   /* Number of memory regions */
 
-/* Memory partition type */
-#define LVM_MEM_PARTITION0      0                   /* 1st memory partition */
-#define LVM_MEM_PARTITION1      1                   /* 2nd memory partition */
-#define LVM_MEM_PARTITION2      2                   /* 3rd memory partition */
-#define LVM_MEM_PARTITION3      3                   /* 4th memory partition */
-
-/* Use type */
-#define LVM_MEM_PERSISTENT      0                   /* Persistent memory type */
-#define LVM_MEM_SCRATCH         4                   /* Scratch  memory type */
-
-/* Access type */
-#define LVM_MEM_INTERNAL        0                   /* Internal (fast) access memory */
-#define LVM_MEM_EXTERNAL        8                   /* External (slow) access memory */
-
-/* Platform specific */
-#define LVM_PERSISTENT          (LVM_MEM_PARTITION0+LVM_MEM_PERSISTENT+LVM_MEM_INTERNAL)
-#define LVM_PERSISTENT_DATA     (LVM_MEM_PARTITION1+LVM_MEM_PERSISTENT+LVM_MEM_INTERNAL)
-#define LVM_PERSISTENT_COEF     (LVM_MEM_PARTITION2+LVM_MEM_PERSISTENT+LVM_MEM_INTERNAL)
-#define LVM_SCRATCH             (LVM_MEM_PARTITION3+LVM_MEM_SCRATCH+LVM_MEM_INTERNAL)
-
 /****************************************************************************************/
 /*                                                                                      */
 /*  Basic types                                                                         */
@@ -102,11 +82,7 @@
 typedef     float               effect_buffer_t;
 
 
-#ifdef SUPPORT_MC
 #define LVM_MAX_CHANNELS 8 // FCC_8
-#else
-#define LVM_MAX_CHANNELS 2 // FCC_2
-#endif
 
 /****************************************************************************************/
 /*                                                                                      */
@@ -128,9 +104,7 @@
     LVM_STEREO          = 0,
     LVM_MONOINSTEREO    = 1,
     LVM_MONO            = 2,
-#ifdef SUPPORT_MC
     LVM_MULTICHANNEL    = 3,
-#endif
     LVM_SOURCE_DUMMY    = LVM_MAXENUM
 } LVM_Format_en;
 
diff --git a/media/libeffects/lvm/lib/Common/lib/VectorArithmetic.h b/media/libeffects/lvm/lib/Common/lib/VectorArithmetic.h
index b27bac5..cbde91d 100644
--- a/media/libeffects/lvm/lib/Common/lib/VectorArithmetic.h
+++ b/media/libeffects/lvm/lib/Common/lib/VectorArithmetic.h
@@ -31,7 +31,6 @@
 void Copy_Float(                 const LVM_FLOAT *src,
                                  LVM_FLOAT *dst,
                                  LVM_INT16 n );
-#ifdef SUPPORT_MC
 void Copy_Float_Mc_Stereo(       const LVM_FLOAT *src,
                                  LVM_FLOAT *dst,
                                  LVM_INT16 NrFrames,
@@ -41,7 +40,6 @@
                                  LVM_FLOAT *dst,
                                  LVM_INT16 NrFrames,
                                  LVM_INT32 NrChannels);
-#endif
 
 /*********************************************************************************
  * note: In Mult3s_16x16() saturation of result is not taken care when           *
@@ -110,12 +108,10 @@
 void From2iToMono_Float(         const LVM_FLOAT  *src,
                                  LVM_FLOAT  *dst,
                                  LVM_INT16 n);
-#ifdef SUPPORT_MC
 void FromMcToMono_Float(const LVM_FLOAT *src,
                         LVM_FLOAT *dst,
                         LVM_INT16 NrFrames,
                         LVM_INT16 NrChannels);
-#endif
 void MSTo2i_Sat_Float(        const LVM_FLOAT *srcM,
                               const LVM_FLOAT *srcS,
                               LVM_FLOAT *dst,
diff --git a/media/libeffects/lvm/lib/Common/src/AGC_MIX_VOL_2St1Mon_D32_WRA.cpp b/media/libeffects/lvm/lib/Common/src/AGC_MIX_VOL_2St1Mon_D32_WRA.cpp
index e18aa78..07fc0d1 100644
--- a/media/libeffects/lvm/lib/Common/src/AGC_MIX_VOL_2St1Mon_D32_WRA.cpp
+++ b/media/libeffects/lvm/lib/Common/src/AGC_MIX_VOL_2St1Mon_D32_WRA.cpp
@@ -172,7 +172,6 @@
 
     return;
 }
-#ifdef SUPPORT_MC
 /****************************************************************************************/
 /*                                                                                      */
 /* FUNCTION:                  AGC_MIX_VOL_Mc1Mon_D32_WRA                                */
@@ -314,4 +313,3 @@
 
     return;
 }
-#endif /*SUPPORT_MC*/
diff --git a/media/libeffects/lvm/lib/Common/src/BQ_2I_D32F32C30_TRC_WRA_01.cpp b/media/libeffects/lvm/lib/Common/src/BQ_2I_D32F32C30_TRC_WRA_01.cpp
index 78d1ba1..189fb9e 100644
--- a/media/libeffects/lvm/lib/Common/src/BQ_2I_D32F32C30_TRC_WRA_01.cpp
+++ b/media/libeffects/lvm/lib/Common/src/BQ_2I_D32F32C30_TRC_WRA_01.cpp
@@ -120,7 +120,6 @@
 
     }
 
-#ifdef SUPPORT_MC
 /**************************************************************************
  ASSUMPTIONS:
  COEFS-
@@ -197,5 +196,4 @@
         }
 
     }
-#endif /*SUPPORT_MC*/
 
diff --git a/media/libeffects/lvm/lib/Common/src/Copy_16.cpp b/media/libeffects/lvm/lib/Common/src/Copy_16.cpp
index 3a50554..4b44f28 100644
--- a/media/libeffects/lvm/lib/Common/src/Copy_16.cpp
+++ b/media/libeffects/lvm/lib/Common/src/Copy_16.cpp
@@ -83,7 +83,6 @@
 
     return;
 }
-#ifdef SUPPORT_MC
 // Extract out the stereo channel pair from multichannel source.
 void Copy_Float_Mc_Stereo(const LVM_FLOAT *src,
                  LVM_FLOAT *dst,
@@ -143,5 +142,4 @@
         StereoOut -= 2;
     }
 }
-#endif
 /**********************************************************************************/
diff --git a/media/libeffects/lvm/lib/Common/src/DC_2I_D16_TRC_WRA_01.cpp b/media/libeffects/lvm/lib/Common/src/DC_2I_D16_TRC_WRA_01.cpp
index a7ce4d3..f2b5813 100644
--- a/media/libeffects/lvm/lib/Common/src/DC_2I_D16_TRC_WRA_01.cpp
+++ b/media/libeffects/lvm/lib/Common/src/DC_2I_D16_TRC_WRA_01.cpp
@@ -61,7 +61,6 @@
         pBiquadState->RightDC = RightDC;
 
     }
-#ifdef SUPPORT_MC
 /*
  * FUNCTION:       DC_Mc_D16_TRC_WRA_01
  *
@@ -112,4 +111,3 @@
         }
 
     }
-#endif
diff --git a/media/libeffects/lvm/lib/Common/src/DC_2I_D16_TRC_WRA_01_Init.cpp b/media/libeffects/lvm/lib/Common/src/DC_2I_D16_TRC_WRA_01_Init.cpp
index beee112..42d98f2 100644
--- a/media/libeffects/lvm/lib/Common/src/DC_2I_D16_TRC_WRA_01_Init.cpp
+++ b/media/libeffects/lvm/lib/Common/src/DC_2I_D16_TRC_WRA_01_Init.cpp
@@ -23,7 +23,6 @@
     pBiquadState->LeftDC        = 0.0f;
     pBiquadState->RightDC       = 0.0f;
 }
-#ifdef SUPPORT_MC
 void  DC_Mc_D16_TRC_WRA_01_Init(Biquad_FLOAT_Instance_t   *pInstance)
 {
     PFilter_FLOAT_State_Mc pBiquadState  = (PFilter_FLOAT_State_Mc) pInstance;
@@ -33,4 +32,3 @@
         pBiquadState->ChDC[i] = 0.0f;
     }
 }
-#endif
diff --git a/media/libeffects/lvm/lib/Common/src/DC_2I_D16_TRC_WRA_01_Private.h b/media/libeffects/lvm/lib/Common/src/DC_2I_D16_TRC_WRA_01_Private.h
index 4170b3c..999abea 100644
--- a/media/libeffects/lvm/lib/Common/src/DC_2I_D16_TRC_WRA_01_Private.h
+++ b/media/libeffects/lvm/lib/Common/src/DC_2I_D16_TRC_WRA_01_Private.h
@@ -28,11 +28,9 @@
     LVM_FLOAT  RightDC;    /* RightDC  */
 }Filter_FLOAT_State;
 typedef Filter_FLOAT_State * PFilter_FLOAT_State ;
-#ifdef SUPPORT_MC
 typedef struct _Filter_FLOAT_State_Mc_
 {
     LVM_FLOAT  ChDC[LVM_MAX_CHANNELS];     /* ChannelDC  */
 } Filter_FLOAT_State_Mc;
 typedef Filter_FLOAT_State_Mc * PFilter_FLOAT_State_Mc ;
-#endif
 #endif /* _DC_2I_D16_TRC_WRA_01_PRIVATE_H_ */
diff --git a/media/libeffects/lvm/lib/Common/src/FO_2I_D16F32C15_LShx_TRC_WRA_01.cpp b/media/libeffects/lvm/lib/Common/src/FO_2I_D16F32C15_LShx_TRC_WRA_01.cpp
index 6ca819a..605932d 100644
--- a/media/libeffects/lvm/lib/Common/src/FO_2I_D16F32C15_LShx_TRC_WRA_01.cpp
+++ b/media/libeffects/lvm/lib/Common/src/FO_2I_D16F32C15_LShx_TRC_WRA_01.cpp
@@ -113,7 +113,6 @@
         }
 
     }
-#ifdef SUPPORT_MC
 /**************************************************************************
 ASSUMPTIONS:
 COEFS-
@@ -195,4 +194,3 @@
             pDelays -= NrChannels * 2;
         }
     }
-#endif
diff --git a/media/libeffects/lvm/lib/Common/src/From2iToMono_32.cpp b/media/libeffects/lvm/lib/Common/src/From2iToMono_32.cpp
index a8688b4..6b52feb 100644
--- a/media/libeffects/lvm/lib/Common/src/From2iToMono_32.cpp
+++ b/media/libeffects/lvm/lib/Common/src/From2iToMono_32.cpp
@@ -67,7 +67,6 @@
 
     return;
 }
-#ifdef SUPPORT_MC
 /*
  * FUNCTION:       FromMcToMono_Float
  *
@@ -107,6 +106,5 @@
 
     return;
 }
-#endif
 
 /**********************************************************************************/
diff --git a/media/libeffects/lvm/lib/Common/src/LVC_Core_MixHard_1St_2i_D16C31_SAT.cpp b/media/libeffects/lvm/lib/Common/src/LVC_Core_MixHard_1St_2i_D16C31_SAT.cpp
index 14d61bd..d4f42de 100644
--- a/media/libeffects/lvm/lib/Common/src/LVC_Core_MixHard_1St_2i_D16C31_SAT.cpp
+++ b/media/libeffects/lvm/lib/Common/src/LVC_Core_MixHard_1St_2i_D16C31_SAT.cpp
@@ -56,7 +56,6 @@
     }
 
 }
-#ifdef SUPPORT_MC
 void LVC_Core_MixHard_1St_MC_float_SAT (Mix_Private_FLOAT_st **ptrInstance,
                                          const LVM_FLOAT      *src,
                                          LVM_FLOAT            *dst,
@@ -80,5 +79,4 @@
         }
     }
 }
-#endif
 /**********************************************************************************/
diff --git a/media/libeffects/lvm/lib/Common/src/LVC_Core_MixInSoft_D16C31_SAT.cpp b/media/libeffects/lvm/lib/Common/src/LVC_Core_MixInSoft_D16C31_SAT.cpp
index 318138d..7d13d5c 100644
--- a/media/libeffects/lvm/lib/Common/src/LVC_Core_MixInSoft_D16C31_SAT.cpp
+++ b/media/libeffects/lvm/lib/Common/src/LVC_Core_MixInSoft_D16C31_SAT.cpp
@@ -113,7 +113,6 @@
     }
     pInstance->Current = Current;
 }
-#ifdef SUPPORT_MC
 /*
  * FUNCTION:       LVC_Core_MixInSoft_Mc_D16C31_SAT
  *
@@ -245,5 +244,4 @@
     pInstance->Current = Current;
 }
 
-#endif
 /**********************************************************************************/
diff --git a/media/libeffects/lvm/lib/Common/src/LVC_Core_MixSoft_1St_2i_D16C31_WRA.cpp b/media/libeffects/lvm/lib/Common/src/LVC_Core_MixSoft_1St_2i_D16C31_WRA.cpp
index 1f4b08a..784f339 100644
--- a/media/libeffects/lvm/lib/Common/src/LVC_Core_MixSoft_1St_2i_D16C31_WRA.cpp
+++ b/media/libeffects/lvm/lib/Common/src/LVC_Core_MixSoft_1St_2i_D16C31_WRA.cpp
@@ -145,7 +145,6 @@
     pInstanceR->Current = CurrentR;
 
 }
-#ifdef SUPPORT_MC
 void LVC_Core_MixSoft_1St_MC_float_WRA (Mix_Private_FLOAT_st **ptrInstance,
                                          const LVM_FLOAT      *src,
                                          LVM_FLOAT            *dst,
@@ -189,5 +188,4 @@
         ptrInstance[ch]->Current = tempCurrent[ch];
     }
 }
-#endif
 /**********************************************************************************/
diff --git a/media/libeffects/lvm/lib/Common/src/LVC_Core_MixSoft_1St_D16C31_WRA.cpp b/media/libeffects/lvm/lib/Common/src/LVC_Core_MixSoft_1St_D16C31_WRA.cpp
index 5d8aadc..57f037e 100644
--- a/media/libeffects/lvm/lib/Common/src/LVC_Core_MixSoft_1St_D16C31_WRA.cpp
+++ b/media/libeffects/lvm/lib/Common/src/LVC_Core_MixSoft_1St_D16C31_WRA.cpp
@@ -105,7 +105,6 @@
     pInstance->Current=Current;
 }
 
-#ifdef SUPPORT_MC
 /*
  * FUNCTION:       LVC_Core_MixSoft_Mc_D16C31_WRA
  *
@@ -214,6 +213,5 @@
     }
     pInstance->Current=Current;
 }
-#endif
 
 /**********************************************************************************/
diff --git a/media/libeffects/lvm/lib/Common/src/LVC_MixInSoft_D16C31_SAT.cpp b/media/libeffects/lvm/lib/Common/src/LVC_MixInSoft_D16C31_SAT.cpp
index 2bec3be..ede6dee 100644
--- a/media/libeffects/lvm/lib/Common/src/LVC_MixInSoft_D16C31_SAT.cpp
+++ b/media/libeffects/lvm/lib/Common/src/LVC_MixInSoft_D16C31_SAT.cpp
@@ -105,7 +105,6 @@
 
 }
 
-#ifdef SUPPORT_MC
 /*
  * FUNCTION:       LVC_MixInSoft_Mc_D16C31_SAT
  *
@@ -202,6 +201,5 @@
     }
 
 }
-#endif
 
 /**********************************************************************************/
diff --git a/media/libeffects/lvm/lib/Common/src/LVC_MixSoft_1St_2i_D16C31_SAT.cpp b/media/libeffects/lvm/lib/Common/src/LVC_MixSoft_1St_2i_D16C31_SAT.cpp
index 3153ada..8fced60 100644
--- a/media/libeffects/lvm/lib/Common/src/LVC_MixSoft_1St_2i_D16C31_SAT.cpp
+++ b/media/libeffects/lvm/lib/Common/src/LVC_MixSoft_1St_2i_D16C31_SAT.cpp
@@ -37,7 +37,6 @@
 /**********************************************************************************
    FUNCTION LVC_MixSoft_1St_2i_D16C31_SAT
 ***********************************************************************************/
-#ifdef SUPPORT_MC
 /* This threshold is used to decide on the processing to be applied on
  * front center and back center channels
  */
@@ -231,7 +230,6 @@
         }
     }
 }
-#endif
 void LVC_MixSoft_1St_2i_D16C31_SAT( LVMixer3_2St_FLOAT_st *ptrInstance,
                                     const LVM_FLOAT             *src,
                                     LVM_FLOAT             *dst,
diff --git a/media/libeffects/lvm/lib/Common/src/LVC_MixSoft_1St_D16C31_SAT.cpp b/media/libeffects/lvm/lib/Common/src/LVC_MixSoft_1St_D16C31_SAT.cpp
index 4d229da..f893919 100644
--- a/media/libeffects/lvm/lib/Common/src/LVC_MixSoft_1St_D16C31_SAT.cpp
+++ b/media/libeffects/lvm/lib/Common/src/LVC_MixSoft_1St_D16C31_SAT.cpp
@@ -102,7 +102,6 @@
         }
     }
 }
-#ifdef SUPPORT_MC
 /*
  * FUNCTION:       LVC_MixSoft_Mc_D16C31_SAT
  *
@@ -195,6 +194,5 @@
     }
 }
 
-#endif
 
 /**********************************************************************************/
diff --git a/media/libeffects/lvm/lib/Common/src/LVC_MixSoft_2St_D16C31_SAT.cpp b/media/libeffects/lvm/lib/Common/src/LVC_MixSoft_2St_D16C31_SAT.cpp
index 54ab79d..2958637 100644
--- a/media/libeffects/lvm/lib/Common/src/LVC_MixSoft_2St_D16C31_SAT.cpp
+++ b/media/libeffects/lvm/lib/Common/src/LVC_MixSoft_2St_D16C31_SAT.cpp
@@ -67,7 +67,6 @@
     }
 }
 
-#ifdef SUPPORT_MC
 /*
  * FUNCTION:       LVC_MixSoft_2Mc_D16C31_SAT
  *
@@ -128,6 +127,5 @@
                                         src1, src2, dst, NrFrames * NrChannels);
     }
 }
-#endif
 
 /**********************************************************************************/
diff --git a/media/libeffects/lvm/lib/Common/src/LVC_Mixer.h b/media/libeffects/lvm/lib/Common/src/LVC_Mixer.h
index ce42d2e..6206273 100644
--- a/media/libeffects/lvm/lib/Common/src/LVC_Mixer.h
+++ b/media/libeffects/lvm/lib/Common/src/LVC_Mixer.h
@@ -88,53 +88,45 @@
                                 const LVM_FLOAT       *src,
                                       LVM_FLOAT       *dst,
                                       LVM_INT16       n);
-#ifdef SUPPORT_MC
 void LVC_MixSoft_Mc_D16C31_SAT(LVMixer3_1St_FLOAT_st *pInstance,
                                const LVM_FLOAT       *src,
                                      LVM_FLOAT       *dst,
                                      LVM_INT16       NrFrames,
                                      LVM_INT16       NrChannels);
-#endif
 
 void LVC_MixInSoft_D16C31_SAT(LVMixer3_1St_FLOAT_st *pInstance,
                               const LVM_FLOAT       *src,
                                     LVM_FLOAT       *dst,
                                     LVM_INT16       n);
-#ifdef SUPPORT_MC
 void LVC_MixInSoft_Mc_D16C31_SAT(LVMixer3_1St_FLOAT_st *pInstance,
                                  const LVM_FLOAT       *src,
                                        LVM_FLOAT       *dst,
                                        LVM_INT16       NrFrames,
                                        LVM_INT16       NrChannels);
-#endif
 
 void LVC_MixSoft_2St_D16C31_SAT(LVMixer3_2St_FLOAT_st *pInstance,
                                 const LVM_FLOAT       *src1,
                                 const LVM_FLOAT       *src2,
                                 LVM_FLOAT             *dst,  /* dst cannot be equal to src2 */
                                 LVM_INT16             n);
-#ifdef SUPPORT_MC
 void LVC_MixSoft_2Mc_D16C31_SAT(LVMixer3_2St_FLOAT_st *pInstance,
                                 const LVM_FLOAT       *src1,
                                 const LVM_FLOAT       *src2,
                                 LVM_FLOAT             *dst,  /* dst cannot be equal to src2 */
                                 LVM_INT16             NrFrames,
                                 LVM_INT16             NrChannels);
-#endif
 /**********************************************************************************/
 /* For applying different gains to Left and right chennals                        */
 /* MixerStream[0] applies to Left channel                                         */
 /* MixerStream[1] applies to Right channel                                        */
 /* Gain values should not be more that 1.0                                        */
 /**********************************************************************************/
-#ifdef SUPPORT_MC
 void LVC_MixSoft_1St_MC_float_SAT(LVMixer3_2St_FLOAT_st *pInstance,
                                    const   LVM_FLOAT     *src,
                                    LVM_FLOAT             *dst,   /* dst can be equal to src */
                                    LVM_INT16             NrFrames,
                                    LVM_INT32             NrChannels,
                                    LVM_INT32             ChMask);
-#endif
 void LVC_MixSoft_1St_2i_D16C31_SAT(LVMixer3_2St_FLOAT_st *pInstance,
                                    const   LVM_FLOAT     *src,
                                    LVM_FLOAT             *dst,   /* dst can be equal to src */
diff --git a/media/libeffects/lvm/lib/Common/src/LVC_Mixer_Private.h b/media/libeffects/lvm/lib/Common/src/LVC_Mixer_Private.h
index 123d22b..7cba671 100644
--- a/media/libeffects/lvm/lib/Common/src/LVC_Mixer_Private.h
+++ b/media/libeffects/lvm/lib/Common/src/LVC_Mixer_Private.h
@@ -50,24 +50,20 @@
                                     const LVM_FLOAT     *src,
                                     LVM_FLOAT     *dst,
                                     LVM_INT16     n);
-#ifdef SUPPORT_MC
 void LVC_Core_MixInSoft_Mc_D16C31_SAT(LVMixer3_FLOAT_st *ptrInstance,
                                     const LVM_FLOAT     *src,
                                           LVM_FLOAT     *dst,
                                           LVM_INT16     NrFrames,
                                           LVM_INT16     NrChannels);
-#endif
 void LVC_Core_MixSoft_1St_D16C31_WRA( LVMixer3_FLOAT_st *ptrInstance,
                                       const LVM_FLOAT     *src,
                                       LVM_FLOAT     *dst,
                                       LVM_INT16     n);
-#ifdef SUPPORT_MC
 void LVC_Core_MixSoft_Mc_D16C31_WRA(LVMixer3_FLOAT_st *ptrInstance,
                                     const LVM_FLOAT     *src,
                                           LVM_FLOAT     *dst,
                                           LVM_INT16     NrFrames,
                                           LVM_INT16     NrChannels);
-#endif
 void LVC_Core_MixHard_2St_D16C31_SAT( LVMixer3_FLOAT_st *pInstance1,
                                       LVMixer3_FLOAT_st         *pInstance2,
                                       const LVM_FLOAT     *src1,
@@ -81,13 +77,11 @@
 /* ptrInstance2 applies to Right channel                                          */
 /* Gain values should not be more that 1.0                                        */
 /**********************************************************************************/
-#ifdef SUPPORT_MC
 void LVC_Core_MixSoft_1St_MC_float_WRA(Mix_Private_FLOAT_st **ptrInstance,
                                          const LVM_FLOAT      *src,
                                          LVM_FLOAT            *dst,
                                          LVM_INT16            NrFrames,
                                          LVM_INT16            NrChannels);
-#endif
 void LVC_Core_MixSoft_1St_2i_D16C31_WRA( LVMixer3_FLOAT_st        *ptrInstance1,
                                          LVMixer3_FLOAT_st        *ptrInstance2,
                                          const LVM_FLOAT    *src,
@@ -100,13 +94,11 @@
 /* ptrInstance2 applies to Right channel                                          */
 /* Gain values should not be more that 1.0                                        */
 /**********************************************************************************/
-#ifdef SUPPORT_MC
 void LVC_Core_MixHard_1St_MC_float_SAT(Mix_Private_FLOAT_st **ptrInstance,
                                          const LVM_FLOAT      *src,
                                          LVM_FLOAT            *dst,
                                          LVM_INT16            NrFrames,
                                          LVM_INT16            NrChannels);
-#endif
 void LVC_Core_MixHard_1St_2i_D16C31_SAT( LVMixer3_FLOAT_st        *ptrInstance1,
                                          LVMixer3_FLOAT_st        *ptrInstance2,
                                          const LVM_FLOAT    *src,
diff --git a/media/libeffects/lvm/lib/Common/src/PK_2I_D32F32C14G11_TRC_WRA_01.cpp b/media/libeffects/lvm/lib/Common/src/PK_2I_D32F32C14G11_TRC_WRA_01.cpp
index 3f62f99..23b4fae 100644
--- a/media/libeffects/lvm/lib/Common/src/PK_2I_D32F32C14G11_TRC_WRA_01.cpp
+++ b/media/libeffects/lvm/lib/Common/src/PK_2I_D32F32C14G11_TRC_WRA_01.cpp
@@ -117,7 +117,6 @@
 
     }
 
-#ifdef SUPPORT_MC
 /**************************************************************************
 DELAYS-
 pBiquadState->pDelays[0] to
@@ -189,4 +188,3 @@
         }
 
     }
-#endif
diff --git a/media/libeffects/lvm/lib/Eq/lib/LVEQNB.h b/media/libeffects/lvm/lib/Eq/lib/LVEQNB.h
index c5ddf77..41e2bb5 100644
--- a/media/libeffects/lvm/lib/Eq/lib/LVEQNB.h
+++ b/media/libeffects/lvm/lib/Eq/lib/LVEQNB.h
@@ -86,13 +86,6 @@
 /*                                                                                      */
 /****************************************************************************************/
 
-/* Memory table */
-#define LVEQNB_MEMREGION_INSTANCE          0   /* Offset to the instance memory region */
-#define LVEQNB_MEMREGION_PERSISTENT_DATA   1   /* Offset to persistent data memory region */
-#define LVEQNB_MEMREGION_PERSISTENT_COEF   2   /* Offset to persistent coefficient region */
-#define LVEQNB_MEMREGION_SCRATCH           3   /* Offset to data scratch memory region */
-#define LVEQNB_NR_MEMORY_REGIONS           4   /* Number of memory regions */
-
 /* Callback events */
 #define LVEQNB_EVENT_NONE                   0x0000    /* Not a valid event */
 #define LVEQNB_EVENT_ALGOFF                 0x0001    /* EQNB has completed switch off */
@@ -122,16 +115,6 @@
     LVEQNB_FILTER_DUMMY = LVM_MAXINT_32
 } LVEQNB_FilterMode_en;
 
-/* Memory Types */
-typedef enum
-{
-    LVEQNB_PERSISTENT      = 0,
-    LVEQNB_PERSISTENT_DATA = 1,
-    LVEQNB_PERSISTENT_COEF = 2,
-    LVEQNB_SCRATCH         = 3,
-    LVEQNB_MEMORY_MAX      = LVM_MAXINT_32
-} LVEQNB_MemoryTypes_en;
-
 /* Function return status */
 typedef enum
 {
@@ -173,9 +156,7 @@
 {
     LVEQNB_STEREO       = 0,
     LVEQNB_MONOINSTEREO = 1,
-#ifdef SUPPORT_MC
     LVEQNB_MULTICHANNEL = 2,
-#endif
     LVEQNB_SOURCE_MAX   = LVM_MAXINT_32
 } LVEQNB_SourceFormat_en;
 
@@ -220,21 +201,6 @@
 /*                                                                                      */
 /****************************************************************************************/
 
-/* Memory region definition */
-typedef struct
-{
-    LVM_UINT32                  Size;                   /* Region size in bytes */
-    LVM_UINT16                  Alignment;              /* Region alignment in bytes */
-    LVEQNB_MemoryTypes_en       Type;                   /* Region type */
-    void                        *pBaseAddress;          /* Pointer to the region base address */
-} LVEQNB_MemoryRegion_t;
-
-/* Memory table containing the region definitions */
-typedef struct
-{
-    LVEQNB_MemoryRegion_t       Region[LVEQNB_NR_MEMORY_REGIONS];  /* One definition for each region */
-} LVEQNB_MemTab_t;
-
 /* Equaliser band definition */
 typedef struct
 {
@@ -254,9 +220,7 @@
     /* Equaliser parameters */
     LVM_UINT16                  NBands;                 /* Number of bands */
     LVEQNB_BandDef_t            *pBandDefinition;       /* Pointer to equaliser definitions */
-#ifdef SUPPORT_MC
     LVM_INT16                   NrChannels;
-#endif
 } LVEQNB_Params_t;
 
 /* Capability structure */
@@ -283,78 +247,44 @@
 
 /****************************************************************************************/
 /*                                                                                      */
-/* FUNCTION:                LVEQNB_Memory                                               */
-/*                                                                                      */
-/* DESCRIPTION:                                                                         */
-/*  This function is used for memory allocation and free. It can be called in           */
-/*  two ways:                                                                           */
-/*                                                                                      */
-/*      hInstance = NULL                Returns the memory requirements                 */
-/*      hInstance = Instance handle     Returns the memory requirements and             */
-/*                                      allocated base addresses for the instance       */
-/*                                                                                      */
-/*  When this function is called for memory allocation (hInstance=NULL) the memory      */
-/*  base address pointers are NULL on return.                                           */
-/*                                                                                      */
-/*  When the function is called for free (hInstance = Instance Handle) the memory       */
-/*  table returns the allocated memory and base addresses used during initialisation.   */
-/*                                                                                      */
-/* PARAMETERS:                                                                          */
-/*  hInstance               Instance Handle                                             */
-/*  pMemoryTable            Pointer to an empty memory definition table                 */
-/*  pCapabilities           Pointer to the default capabilities                         */
-/*                                                                                      */
-/* RETURNS:                                                                             */
-/*  LVEQNB_SUCCESS          Succeeded                                                   */
-/*  LVEQNB_NULLADDRESS      When any of pMemoryTable and pCapabilities is NULL address  */
-/*                                                                                      */
-/* NOTES:                                                                               */
-/*  1.  This function may be interrupted by the LVEQNB_Process function                 */
-/*                                                                                      */
-/****************************************************************************************/
-
-LVEQNB_ReturnStatus_en LVEQNB_Memory(LVEQNB_Handle_t            hInstance,
-                                     LVEQNB_MemTab_t            *pMemoryTable,
-                                     LVEQNB_Capabilities_t      *pCapabilities);
-
-/****************************************************************************************/
-/*                                                                                      */
 /* FUNCTION:                LVEQNB_Init                                                 */
 /*                                                                                      */
 /* DESCRIPTION:                                                                         */
-/*  Create and initialisation function for the N-Band equalliser module                 */
-/*                                                                                      */
-/*  This function can be used to create an algorithm instance by calling with           */
-/*  hInstance set to NULL. In this case the algorithm returns the new instance          */
-/*  handle.                                                                             */
-/*                                                                                      */
-/*  This function can be used to force a full re-initialisation of the algorithm        */
-/*  by calling with hInstance = Instance Handle. In this case the memory table          */
-/*  should be correct for the instance, this can be ensured by calling the function     */
-/*  LVEQNB_Memory before calling this function.                                         */
+/*  Create and initialisation function for the N-Band equaliser module.                 */
 /*                                                                                      */
 /* PARAMETERS:                                                                          */
-/*  hInstance               Instance handle                                             */
-/*  pMemoryTable            Pointer to the memory definition table                      */
+/*  phInstance              Pointer to instance handle                                  */
 /*  pCapabilities           Pointer to the initialisation capabilities                  */
+/*  pScratch                Pointer to bundle scratch buffer                            */
 /*                                                                                      */
 /* RETURNS:                                                                             */
 /*  LVEQNB_SUCCESS          Initialisation succeeded                                    */
-/*  LVEQNB_NULLADDRESS        When pCapabilities or pMemoryTableis or phInstance are NULL */
-/*  LVEQNB_NULLADDRESS        One or more of the memory regions has a NULL base address   */
-/*                          pointer for a memory region with a non-zero size.           */
-/*                                                                                      */
+/*  LVEQNB_NULLADDRESS      When pCapabilities or phInstance are NULL                   */
+/*  LVEQNB_NULLADDRESS      When allocated memory has a NULL base address               */
 /*                                                                                      */
 /* NOTES:                                                                               */
-/*  1.  The instance handle is the pointer to the base address of the first memory      */
-/*      region.                                                                         */
-/*  2.  This function must not be interrupted by the LVEQNB_Process function            */
+/*  1.  This function must not be interrupted by the LVEQNB_Process function            */
 /*                                                                                      */
 /****************************************************************************************/
-
 LVEQNB_ReturnStatus_en LVEQNB_Init(LVEQNB_Handle_t          *phInstance,
-                                   LVEQNB_MemTab_t          *pMemoryTable,
-                                   LVEQNB_Capabilities_t    *pCapabilities);
+                                   LVEQNB_Capabilities_t    *pCapabilities,
+                                   void                     *pScratch);
+
+/****************************************************************************************/
+/*                                                                                      */
+/* FUNCTION:                LVEQNB_DeInit                                               */
+/*                                                                                      */
+/* DESCRIPTION:                                                                         */
+/*    Free the memories created during LVEQNB_Init including instance handle            */
+/*                                                                                      */
+/* PARAMETERS:                                                                          */
+/*  phInstance              Pointer to instance handle                                  */
+/*                                                                                      */
+/* NOTES:                                                                               */
+/*  1.  This function must not be interrupted by the LVEQNB_Process function            */
+/*                                                                                      */
+/****************************************************************************************/
+void LVEQNB_DeInit(LVEQNB_Handle_t        *phInstance);
 
 /****************************************************************************************/
 /*                                                                                      */
diff --git a/media/libeffects/lvm/lib/Eq/src/LVEQNB_Init.cpp b/media/libeffects/lvm/lib/Eq/src/LVEQNB_Init.cpp
index 271a914..932af71 100644
--- a/media/libeffects/lvm/lib/Eq/src/LVEQNB_Init.cpp
+++ b/media/libeffects/lvm/lib/Eq/src/LVEQNB_Init.cpp
@@ -21,6 +21,7 @@
 /*                                                                                      */
 /****************************************************************************************/
 
+#include <stdlib.h>
 #include "LVEQNB.h"
 #include "LVEQNB_Private.h"
 #include "InstAlloc.h"
@@ -28,255 +29,75 @@
 
 /****************************************************************************************/
 /*                                                                                      */
-/* FUNCTION:                LVEQNB_Memory                                               */
-/*                                                                                      */
-/* DESCRIPTION:                                                                         */
-/*  This function is used for memory allocation and free. It can be called in           */
-/*  two ways:                                                                           */
-/*                                                                                      */
-/*      hInstance = NULL                Returns the memory requirements                 */
-/*      hInstance = Instance handle     Returns the memory requirements and             */
-/*                                      allocated base addresses for the instance       */
-/*                                                                                      */
-/*  When this function is called for memory allocation (hInstance=NULL) the memory      */
-/*  base address pointers are NULL on return.                                           */
-/*                                                                                      */
-/*  When the function is called for free (hInstance = Instance Handle) the memory       */
-/*  table returns the allocated memory and base addresses used during initialisation.   */
-/*                                                                                      */
-/* PARAMETERS:                                                                          */
-/*  hInstance               Instance Handle                                             */
-/*  pMemoryTable            Pointer to an empty memory definition table                 */
-/*  pCapabilities           Pointer to the instance capabilities                        */
-/*                                                                                      */
-/* RETURNS:                                                                             */
-/*  LVEQNB_SUCCESS          Succeeded                                                   */
-/*  LVEQNB_NULLADDRESS      When any of pMemoryTable and pCapabilities is NULL address  */
-/*                                                                                      */
-/* NOTES:                                                                               */
-/*  1.  This function may be interrupted by the LVEQNB_Process function                 */
-/*                                                                                      */
-/****************************************************************************************/
-
-LVEQNB_ReturnStatus_en LVEQNB_Memory(LVEQNB_Handle_t            hInstance,
-                                     LVEQNB_MemTab_t            *pMemoryTable,
-                                     LVEQNB_Capabilities_t      *pCapabilities)
-{
-
-    INST_ALLOC          AllocMem;
-    LVEQNB_Instance_t   *pInstance = (LVEQNB_Instance_t *)hInstance;
-
-    if((pMemoryTable == LVM_NULL)|| (pCapabilities == LVM_NULL))
-    {
-        return LVEQNB_NULLADDRESS;
-    }
-
-    /*
-     * Fill in the memory table
-     */
-    if (hInstance == LVM_NULL)
-    {
-        /*
-         * Instance memory
-         */
-        InstAlloc_Init(&AllocMem,
-                       LVM_NULL);
-        InstAlloc_AddMember(&AllocMem,                              /* Low pass filter */
-                            sizeof(LVEQNB_Instance_t));
-        pMemoryTable->Region[LVEQNB_MEMREGION_INSTANCE].Size         = InstAlloc_GetTotal(&AllocMem);
-        pMemoryTable->Region[LVEQNB_MEMREGION_INSTANCE].Alignment    = LVEQNB_INSTANCE_ALIGN;
-        pMemoryTable->Region[LVEQNB_MEMREGION_INSTANCE].Type         = LVEQNB_PERSISTENT;
-        pMemoryTable->Region[LVEQNB_MEMREGION_INSTANCE].pBaseAddress = LVM_NULL;
-
-        /*
-         * Persistant data memory
-         */
-        InstAlloc_Init(&AllocMem,
-                       LVM_NULL);
-        InstAlloc_AddMember(&AllocMem,                              /* Low pass filter */
-                            sizeof(Biquad_2I_Order2_FLOAT_Taps_t));
-        InstAlloc_AddMember(&AllocMem,                              /* High pass filter */
-                            sizeof(Biquad_2I_Order2_FLOAT_Taps_t));
-        /* Equaliser Biquad Taps */
-        InstAlloc_AddMember(&AllocMem,
-                            (pCapabilities->MaxBands * sizeof(Biquad_2I_Order2_FLOAT_Taps_t)));
-        /* Filter definitions */
-        InstAlloc_AddMember(&AllocMem,
-                            (pCapabilities->MaxBands * sizeof(LVEQNB_BandDef_t)));
-        /* Biquad types */
-        InstAlloc_AddMember(&AllocMem,
-                            (pCapabilities->MaxBands * sizeof(LVEQNB_BiquadType_en)));
-        pMemoryTable->Region[LVEQNB_MEMREGION_PERSISTENT_DATA].Size         = InstAlloc_GetTotal(&AllocMem);
-        pMemoryTable->Region[LVEQNB_MEMREGION_PERSISTENT_DATA].Alignment    = LVEQNB_DATA_ALIGN;
-        pMemoryTable->Region[LVEQNB_MEMREGION_PERSISTENT_DATA].Type         = LVEQNB_PERSISTENT_DATA;
-        pMemoryTable->Region[LVEQNB_MEMREGION_PERSISTENT_DATA].pBaseAddress = LVM_NULL;
-
-        /*
-         * Persistant coefficient memory
-         */
-        InstAlloc_Init(&AllocMem,
-                       LVM_NULL);
-        InstAlloc_AddMember(&AllocMem,                              /* Low pass filter */
-                            sizeof(Biquad_FLOAT_Instance_t));
-        InstAlloc_AddMember(&AllocMem,                              /* High pass filter */
-                            sizeof(Biquad_FLOAT_Instance_t));
-        /* Equaliser Biquad Instance */
-        InstAlloc_AddMember(&AllocMem,
-                            pCapabilities->MaxBands * sizeof(Biquad_FLOAT_Instance_t));
-        pMemoryTable->Region[LVEQNB_MEMREGION_PERSISTENT_COEF].Size         = InstAlloc_GetTotal(&AllocMem);
-        pMemoryTable->Region[LVEQNB_MEMREGION_PERSISTENT_COEF].Alignment    = LVEQNB_COEF_ALIGN;
-        pMemoryTable->Region[LVEQNB_MEMREGION_PERSISTENT_COEF].Type         = LVEQNB_PERSISTENT_COEF;
-        pMemoryTable->Region[LVEQNB_MEMREGION_PERSISTENT_COEF].pBaseAddress = LVM_NULL;
-
-        /*
-         * Scratch memory
-         */
-        InstAlloc_Init(&AllocMem,
-                       LVM_NULL);
-        InstAlloc_AddMember(&AllocMem,                              /* Low pass filter */
-                            LVEQNB_SCRATCHBUFFERS * sizeof(LVM_FLOAT) * \
-                                             pCapabilities->MaxBlockSize);
-        pMemoryTable->Region[LVEQNB_MEMREGION_SCRATCH].Size              = InstAlloc_GetTotal(&AllocMem);
-        pMemoryTable->Region[LVEQNB_MEMREGION_SCRATCH].Alignment         = LVEQNB_SCRATCH_ALIGN;
-        pMemoryTable->Region[LVEQNB_MEMREGION_SCRATCH].Type              = LVEQNB_SCRATCH;
-        pMemoryTable->Region[LVEQNB_MEMREGION_SCRATCH].pBaseAddress      = LVM_NULL;
-    }
-    else
-    {
-        /* Read back memory allocation table */
-        *pMemoryTable = pInstance->MemoryTable;
-    }
-
-    return(LVEQNB_SUCCESS);
-}
-
-/****************************************************************************************/
-/*                                                                                      */
 /* FUNCTION:                LVEQNB_Init                                                 */
 /*                                                                                      */
 /* DESCRIPTION:                                                                         */
-/*  Create and initialisation function for the N-Band equaliser module                  */
-/*                                                                                      */
-/*  This function can be used to create an algorithm instance by calling with           */
-/*  hInstance set to NULL. In this case the algorithm returns the new instance          */
-/*  handle.                                                                             */
-/*                                                                                      */
-/*  This function can be used to force a full re-initialisation of the algorithm        */
-/*  by calling with hInstance = Instance Handle. In this case the memory table          */
-/*  should be correct for the instance, this can be ensured by calling the function     */
-/*  DBE_Memory before calling this function.                                            */
+/*  Create and initialisation function for the N-Band equaliser module.                 */
 /*                                                                                      */
 /* PARAMETERS:                                                                          */
-/*  hInstance               Instance handle                                             */
-/*  pMemoryTable            Pointer to the memory definition table                      */
-/*  pCapabilities           Pointer to the instance capabilities                        */
+/*  phInstance              Pointer to instance handle                                  */
+/*  pCapabilities           Pointer to the initialisation capabilities                  */
+/*  pScratch                Pointer to bundle scratch buffer                            */
 /*                                                                                      */
 /* RETURNS:                                                                             */
 /*  LVEQNB_SUCCESS          Initialisation succeeded                                    */
-/*  LVEQNB_NULLADDRESS        When pCapabilities or pMemoryTableis or phInstance are NULL */
-/*  LVEQNB_NULLADDRESS        One or more of the memory regions has a NULL base address   */
-/*                          pointer for a memory region with a non-zero size.           */
+/*  LVEQNB_NULLADDRESS      One or more memory has a NULL pointer - malloc failure      */
 /*                                                                                      */
 /* NOTES:                                                                               */
-/*  1.  The instance handle is the pointer to the base address of the first memory      */
-/*      region.                                                                         */
-/*  2.  This function must not be interrupted by the LVEQNB_Process function            */
+/*  1.  This function must not be interrupted by the LVEQNB_Process function            */
 /*                                                                                      */
 /****************************************************************************************/
 
 LVEQNB_ReturnStatus_en LVEQNB_Init(LVEQNB_Handle_t          *phInstance,
-                                   LVEQNB_MemTab_t          *pMemoryTable,
-                                   LVEQNB_Capabilities_t    *pCapabilities)
+                                   LVEQNB_Capabilities_t    *pCapabilities,
+                                   void                     *pScratch)
 {
 
     LVEQNB_Instance_t   *pInstance;
-    LVM_UINT32          MemSize;
-    INST_ALLOC          AllocMem;
-    LVM_INT32           i;
 
-    /*
-     * Check for NULL pointers
-     */
-    if((phInstance == LVM_NULL) || (pMemoryTable == LVM_NULL) || (pCapabilities == LVM_NULL))
+    *phInstance = calloc(1, sizeof(*pInstance));
+    if (phInstance == LVM_NULL)
+    {
+        return LVEQNB_NULLADDRESS;
+    }
+    pInstance =(LVEQNB_Instance_t  *)*phInstance;
+
+    pInstance->Capabilities = *pCapabilities;
+    pInstance->pScratch = pScratch;
+
+    /* Equaliser Biquad Instance */
+    LVM_UINT32 MemSize = pCapabilities->MaxBands * sizeof(*(pInstance->pEQNB_FilterState_Float));
+    pInstance->pEQNB_FilterState_Float = (Biquad_FLOAT_Instance_t *)calloc(1, MemSize);
+    if (pInstance->pEQNB_FilterState_Float == LVM_NULL)
     {
         return LVEQNB_NULLADDRESS;
     }
 
-    /*
-     * Check the memory table for NULL pointers
-     */
-    for (i = 0; i < LVEQNB_NR_MEMORY_REGIONS; i++)
+    MemSize = (pCapabilities->MaxBands * sizeof(*(pInstance->pEQNB_Taps_Float)));
+    pInstance->pEQNB_Taps_Float = (Biquad_2I_Order2_FLOAT_Taps_t *)calloc(1, MemSize);
+    if (pInstance->pEQNB_Taps_Float == LVM_NULL)
     {
-        if (pMemoryTable->Region[i].Size!=0)
-        {
-            if (pMemoryTable->Region[i].pBaseAddress==LVM_NULL)
-            {
-                return(LVEQNB_NULLADDRESS);
-            }
-        }
+        return LVEQNB_NULLADDRESS;
     }
 
-    /*
-     * Set the instance handle if not already initialised
-     */
-
-    InstAlloc_Init(&AllocMem,  pMemoryTable->Region[LVEQNB_MEMREGION_INSTANCE].pBaseAddress);
-
-    if (*phInstance == LVM_NULL)
+    MemSize = (pCapabilities->MaxBands * sizeof(*(pInstance->pBandDefinitions)));
+    pInstance->pBandDefinitions  = (LVEQNB_BandDef_t *)calloc(1, MemSize);
+    if (pInstance->pBandDefinitions == LVM_NULL)
     {
-        *phInstance = InstAlloc_AddMember(&AllocMem, sizeof(LVEQNB_Instance_t));
+        return LVEQNB_NULLADDRESS;
     }
-    pInstance =(LVEQNB_Instance_t  *)*phInstance;
-
-    /*
-     * Save the memory table in the instance structure
-     */
-    pInstance->Capabilities = *pCapabilities;
-
-    /*
-     * Save the memory table in the instance structure and
-     * set the structure pointers
-     */
-    pInstance->MemoryTable       = *pMemoryTable;
-
-    /*
-     * Allocate coefficient memory
-     */
-    InstAlloc_Init(&AllocMem,
-                   pMemoryTable->Region[LVEQNB_MEMREGION_PERSISTENT_COEF].pBaseAddress);
-
-    /* Equaliser Biquad Instance */
-    pInstance->pEQNB_FilterState_Float = (Biquad_FLOAT_Instance_t *)
-        InstAlloc_AddMember(&AllocMem, pCapabilities->MaxBands * \
-                                                       sizeof(Biquad_FLOAT_Instance_t));
-
-    /*
-     * Allocate data memory
-     */
-    InstAlloc_Init(&AllocMem,
-                   pMemoryTable->Region[LVEQNB_MEMREGION_PERSISTENT_DATA].pBaseAddress);
-
-    MemSize = (pCapabilities->MaxBands * sizeof(Biquad_2I_Order2_FLOAT_Taps_t));
-    pInstance->pEQNB_Taps_Float = (Biquad_2I_Order2_FLOAT_Taps_t *)InstAlloc_AddMember(&AllocMem,
-                                                                                       MemSize);
-    MemSize = (pCapabilities->MaxBands * sizeof(LVEQNB_BandDef_t));
-    pInstance->pBandDefinitions  = (LVEQNB_BandDef_t *)InstAlloc_AddMember(&AllocMem,
-                                                                           MemSize);
     // clear all the bands, setting their gain to 0, otherwise when applying new params,
     // it will compare against uninitialized values
     memset(pInstance->pBandDefinitions, 0, MemSize);
-    MemSize = (pCapabilities->MaxBands * sizeof(LVEQNB_BiquadType_en));
-    pInstance->pBiquadType = (LVEQNB_BiquadType_en *)InstAlloc_AddMember(&AllocMem,
-                                                                         MemSize);
 
-    /*
-     * Internally map, structure and allign scratch memory
-     */
-    InstAlloc_Init(&AllocMem,
-                   pMemoryTable->Region[LVEQNB_MEMREGION_SCRATCH].pBaseAddress);
+    MemSize = (pCapabilities->MaxBands * sizeof(*(pInstance->pBiquadType)));
+    pInstance->pBiquadType = (LVEQNB_BiquadType_en *)calloc(1, MemSize);
+    if (pInstance->pBiquadType == LVM_NULL)
+    {
+        return LVEQNB_NULLADDRESS;
+    }
 
-    pInstance->pFastTemporary = (LVM_FLOAT *)InstAlloc_AddMember(&AllocMem,
-                                                                 sizeof(LVM_FLOAT));
+    pInstance->pFastTemporary = (LVM_FLOAT *)pScratch;
 
     /*
      * Update the instance parameters
@@ -319,4 +140,48 @@
 
     return(LVEQNB_SUCCESS);
 }
+/****************************************************************************************/
+/*                                                                                      */
+/* FUNCTION:                LVEQNB_DeInit                                               */
+/*                                                                                      */
+/* DESCRIPTION:                                                                         */
+/*    Free the memories created during LVEQNB_Init including instance handle            */
+/*                                                                                      */
+/* PARAMETERS:                                                                          */
+/*  phInstance              Pointer to instance handle                                  */
+/*                                                                                      */
+/* NOTES:                                                                               */
+/*  1.  This function must not be interrupted by the LVEQNB_Process function            */
+/*                                                                                      */
+/****************************************************************************************/
+
+void LVEQNB_DeInit(LVEQNB_Handle_t          *phInstance)
+{
+
+    LVEQNB_Instance_t   *pInstance;
+    if (phInstance == LVM_NULL) {
+        return;
+    }
+    pInstance =(LVEQNB_Instance_t  *)*phInstance;
+
+    /* Equaliser Biquad Instance */
+    if (pInstance->pEQNB_FilterState_Float != LVM_NULL) {
+        free(pInstance->pEQNB_FilterState_Float);
+        pInstance->pEQNB_FilterState_Float = LVM_NULL;
+    }
+    if (pInstance->pEQNB_Taps_Float != LVM_NULL) {
+        free(pInstance->pEQNB_Taps_Float);
+        pInstance->pEQNB_Taps_Float = LVM_NULL;
+    }
+    if (pInstance->pBandDefinitions != LVM_NULL) {
+        free(pInstance->pBandDefinitions);
+        pInstance->pBandDefinitions = LVM_NULL;
+    }
+    if (pInstance->pBiquadType != LVM_NULL) {
+        free(pInstance->pBiquadType);
+        pInstance->pBiquadType = LVM_NULL;
+    }
+    free(pInstance);
+    *phInstance = LVM_NULL;
+}
 
diff --git a/media/libeffects/lvm/lib/Eq/src/LVEQNB_Private.h b/media/libeffects/lvm/lib/Eq/src/LVEQNB_Private.h
index 40facfb..9569d85 100644
--- a/media/libeffects/lvm/lib/Eq/src/LVEQNB_Private.h
+++ b/media/libeffects/lvm/lib/Eq/src/LVEQNB_Private.h
@@ -36,19 +36,6 @@
 
 /* General */
 #define LVEQNB_INVALID              0xFFFF              /* Invalid init parameter */
-
-/* Memory */
-#define LVEQNB_INSTANCE_ALIGN       4                   /* 32-bit alignment for instance structures */
-#define LVEQNB_DATA_ALIGN           4                   /* 32-bit alignment for structures */
-#define LVEQNB_COEF_ALIGN           4                   /* 32-bit alignment for long words */
-#ifdef SUPPORT_MC
-/* Number of buffers required for inplace processing */
-#define LVEQNB_SCRATCHBUFFERS       (LVM_MAX_CHANNELS * 2)
-#else
-#define LVEQNB_SCRATCHBUFFERS       4                   /* Number of buffers required for inplace processing */
-#endif
-#define LVEQNB_SCRATCH_ALIGN        4                   /* 32-bit alignment for long data */
-
 #define LVEQNB_BYPASS_MIXER_TC      100                 /* Bypass Mixer TC */
 
 /****************************************************************************************/
@@ -77,7 +64,7 @@
 typedef struct
 {
     /* Public parameters */
-    LVEQNB_MemTab_t                 MemoryTable;        /* Instance memory allocation table */
+    void                            *pScratch;          /* Pointer to bundle scratch buffer */
     LVEQNB_Params_t                 Params;             /* Instance parameters */
     LVEQNB_Capabilities_t           Capabilities;       /* Instance capabilities */
 
diff --git a/media/libeffects/lvm/lib/Eq/src/LVEQNB_Process.cpp b/media/libeffects/lvm/lib/Eq/src/LVEQNB_Process.cpp
index 65eff53..8dd5587 100644
--- a/media/libeffects/lvm/lib/Eq/src/LVEQNB_Process.cpp
+++ b/media/libeffects/lvm/lib/Eq/src/LVEQNB_Process.cpp
@@ -65,13 +65,9 @@
 {                                     // updated to use samples = frames * channels.
     LVEQNB_Instance_t   *pInstance = (LVEQNB_Instance_t  *)hInstance;
 
-#ifdef SUPPORT_MC
     // Mono passed in as stereo
     const LVM_INT32 NrChannels = pInstance->Params.NrChannels == 1
         ? 2 : pInstance->Params.NrChannels;
-#else
-    const LVM_INT32 NrChannels = 2; // FCC_2
-#endif
     const LVM_INT32 NrSamples = NrChannels * NrFrames;
 
      /* Check for NULL pointers */
@@ -129,18 +125,11 @@
                     {
                         case LVEQNB_SinglePrecision_Float:
                         {
-#ifdef SUPPORT_MC
                             PK_Mc_D32F32C14G11_TRC_WRA_01(pBiquad,
                                                           pScratch,
                                                           pScratch,
                                                           (LVM_INT16)NrFrames,
                                                           (LVM_INT16)NrChannels);
-#else
-                            PK_2I_D32F32C14G11_TRC_WRA_01(pBiquad,
-                                                          pScratch,
-                                                          pScratch,
-                                                          (LVM_INT16)NrFrames);
-#endif
                             break;
                         }
                         default:
@@ -151,20 +140,12 @@
         }
 
         if(pInstance->bInOperatingModeTransition == LVM_TRUE){
-#ifdef SUPPORT_MC
             LVC_MixSoft_2Mc_D16C31_SAT(&pInstance->BypassMixer,
                                        pScratch,
                                        pInData,
                                        pScratch,
                                        (LVM_INT16)NrFrames,
                                        (LVM_INT16)NrChannels);
-#else
-            LVC_MixSoft_2St_D16C31_SAT(&pInstance->BypassMixer,
-                                       pScratch,
-                                       pInData,
-                                       pScratch,
-                                       (LVM_INT16)NrSamples);
-#endif
             // duplicate with else clause(s)
             Copy_Float(pScratch,                         /* Source */
                        pOutData,                         /* Destination */
diff --git a/media/libeffects/lvm/lib/Reverb/src/LVREV_SetControlParameters.cpp b/media/libeffects/lvm/lib/Reverb/src/LVREV_SetControlParameters.cpp
index 2a75559..7a68c21 100644
--- a/media/libeffects/lvm/lib/Reverb/src/LVREV_SetControlParameters.cpp
+++ b/media/libeffects/lvm/lib/Reverb/src/LVREV_SetControlParameters.cpp
@@ -69,14 +69,10 @@
         && (pNewParams->SampleRate != LVM_FS_88200) && (pNewParams->SampleRate != LVM_FS_96000)
         && (pNewParams->SampleRate != LVM_FS_176400) && (pNewParams->SampleRate != LVM_FS_192000)
         )
-#ifdef SUPPORT_MC
         || ((pNewParams->SourceFormat != LVM_STEREO)       &&
             (pNewParams->SourceFormat != LVM_MONOINSTEREO) &&
             (pNewParams->SourceFormat != LVM_MONO)         &&
             (pNewParams->SourceFormat != LVM_MULTICHANNEL)))
-#else
-        || ((pNewParams->SourceFormat != LVM_STEREO) && (pNewParams->SourceFormat != LVM_MONOINSTEREO) && (pNewParams->SourceFormat != LVM_MONO)) )
-#endif
     {
         return (LVREV_OUTOFRANGE);
     }
diff --git a/media/libeffects/lvm/lib/SpectrumAnalyzer/lib/LVPSA.h b/media/libeffects/lvm/lib/SpectrumAnalyzer/lib/LVPSA.h
index c9fa7ad..0ba662a 100644
--- a/media/libeffects/lvm/lib/SpectrumAnalyzer/lib/LVPSA.h
+++ b/media/libeffects/lvm/lib/SpectrumAnalyzer/lib/LVPSA.h
@@ -22,28 +22,9 @@
 
 /****************************************************************************************/
 /*                                                                                      */
-/*  CONSTANTS DEFINITIONS                                                               */
-/*                                                                                      */
-/****************************************************************************************/
-
-/* Memory table*/
-#define     LVPSA_NR_MEMORY_REGIONS                  4      /* Number of memory regions                                          */
-
-/****************************************************************************************/
-/*                                                                                      */
 /*  TYPES DEFINITIONS                                                                   */
 /*                                                                                      */
 /****************************************************************************************/
-/* Memory Types */
-typedef enum
-{
-    LVPSA_PERSISTENT      = LVM_PERSISTENT,
-    LVPSA_PERSISTENT_DATA = LVM_PERSISTENT_DATA,
-    LVPSA_PERSISTENT_COEF = LVM_PERSISTENT_COEF,
-    LVPSA_SCRATCH         = LVM_SCRATCH,
-    LVPSA_MEMORY_DUMMY = LVM_MAXINT_32                      /* Force 32 bits enum, don't use it!                                 */
-} LVPSA_MemoryTypes_en;
-
 /* Level detection speed control parameters */
 typedef enum
 {
@@ -80,20 +61,6 @@
 
 } LVPSA_ControlParams_t, *pLVPSA_ControlParams_t;
 
-/* Memory region definition */
-typedef struct
-{
-    LVM_UINT32                 Size;                        /* Region size in bytes                                              */
-    LVPSA_MemoryTypes_en       Type;                        /* Region type                                                       */
-    void                       *pBaseAddress;               /* Pointer to the region base address                                */
-} LVPSA_MemoryRegion_t;
-
-/* Memory table containing the region definitions */
-typedef struct
-{
-    LVPSA_MemoryRegion_t       Region[LVPSA_NR_MEMORY_REGIONS];/* One definition for each region                                 */
-} LVPSA_MemTab_t;
-
 /* Audio time type */
 typedef LVM_INT32 LVPSA_Time;
 
@@ -113,62 +80,43 @@
 /*********************************************************************************************************************************
    FUNCTIONS PROTOTYPE
 **********************************************************************************************************************************/
-/*********************************************************************************************************************************/
-/*                                                                                                                               */
-/* FUNCTION:            LVPSA_Memory                                                                                         */
-/*                                                                                                                               */
-/* DESCRIPTION:                                                                                                                  */
-/*  This function is used for memory allocation and free. It can be called in                                                    */
-/*  two ways:                                                                                                                    */
-/*                                                                                                                               */
-/*      hInstance = NULL                Returns the memory requirements                                                          */
-/*      hInstance = Instance handle     Returns the memory requirements and                                                      */
-/*                                      allocated base addresses for the instance                                                */
-/*                                                                                                                               */
-/*  When this function is called for memory allocation (hInstance=NULL) the memory                                               */
-/*  base address pointers are NULL on return.                                                                                    */
-/*                                                                                                                               */
-/*  When the function is called for free (hInstance = Instance Handle) the memory                                                */
-/*  table returns the allocated memory and base addresses used during initialisation.                                            */
-/*                                                                                                                               */
-/* PARAMETERS:                                                                                                                   */
-/*  hInstance           Instance Handle                                                                                          */
-/*  pMemoryTable        Pointer to an empty memory definition table                                                              */
-/*  pInitParams         Pointer to the instance init parameters                                                                  */
-/*                                                                                                                               */
-/* RETURNS:                                                                                                                      */
-/*  LVPSA_OK            Succeeds                                                                                                 */
-/*  otherwise           Error due to bad parameters                                                                              */
-/*                                                                                                                               */
-/*********************************************************************************************************************************/
-LVPSA_RETURN LVPSA_Memory            ( pLVPSA_Handle_t             hInstance,
-                                       LVPSA_MemTab_t             *pMemoryTable,
-                                       LVPSA_InitParams_t         *pInitParams    );
+/************************************************************************************/
+/*                                                                                  */
+/* FUNCTION:            LVPSA_Init                                                  */
+/*                                                                                  */
+/* DESCRIPTION:                                                                     */
+/*  Create and Initialize the LVPSA module including instance handle                */
+/*                                                                                  */
+/*                                                                                  */
+/* PARAMETERS:                                                                      */
+/*  phInstance          Pointer to the instance handle                              */
+/*  InitParams          Init parameters structure                                   */
+/*  ControlParams       Control parameters structure                                */
+/*  pScratch            Pointer to bundle scratch memory area                       */
+/*                                                                                  */
+/*                                                                                  */
+/* RETURNS:                                                                         */
+/*  LVPSA_OK            Succeeds                                                    */
+/*  otherwise           Error due to bad parameters                                 */
+/*                                                                                  */
+/************************************************************************************/
+LVPSA_RETURN LVPSA_Init(pLVPSA_Handle_t             *phInstance,
+                        LVPSA_InitParams_t          *pInitParams,
+                        LVPSA_ControlParams_t       *pControlParams,
+                        void                        *pScratch);
 
-/*********************************************************************************************************************************/
-/*                                                                                                                               */
-/* FUNCTION:            LVPSA_Init                                                                                               */
-/*                                                                                                                               */
-/* DESCRIPTION:                                                                                                                  */
-/*  Initializes the LVPSA module.                                                                                                */
-/*                                                                                                                               */
-/*                                                                                                                               */
-/* PARAMETERS:                                                                                                                   */
-/*  phInstance          Pointer to the instance Handle                                                                           */
-/*  pInitParams         Pointer to the instance init parameters                                                                  */
-/*  pControlParams      Pointer to the instance control parameters                                                               */
-/*  pMemoryTable        Pointer to the memory definition table                                                                   */
-/*                                                                                                                               */
-/*                                                                                                                               */
-/* RETURNS:                                                                                                                      */
-/*  LVPSA_OK            Succeeds                                                                                                 */
-/*  otherwise           Error due to bad parameters                                                                              */
-/*                                                                                                                               */
-/*********************************************************************************************************************************/
-LVPSA_RETURN LVPSA_Init              ( pLVPSA_Handle_t             *phInstance,
-                                       LVPSA_InitParams_t          *pInitParams,
-                                       LVPSA_ControlParams_t       *pControlParams,
-                                       LVPSA_MemTab_t              *pMemoryTable  );
+/************************************************************************************/
+/*                                                                                  */
+/* FUNCTION:            LVPSA_DeInit                                                */
+/*                                                                                  */
+/* DESCRIPTION:                                                                     */
+/*    Free the memories created in LVPSA_Init call including instance handle        */
+/*                                                                                  */
+/* PARAMETERS:                                                                      */
+/*  phInstance          Pointer to the instance handle                              */
+/*                                                                                  */
+/************************************************************************************/
+void LVPSA_DeInit(pLVPSA_Handle_t             *phInstance);
 
 /*********************************************************************************************************************************/
 /*                                                                                                                               */
diff --git a/media/libeffects/lvm/lib/SpectrumAnalyzer/src/LVPSA_Init.cpp b/media/libeffects/lvm/lib/SpectrumAnalyzer/src/LVPSA_Init.cpp
index 9fcd82f..be3c68f 100644
--- a/media/libeffects/lvm/lib/SpectrumAnalyzer/src/LVPSA_Init.cpp
+++ b/media/libeffects/lvm/lib/SpectrumAnalyzer/src/LVPSA_Init.cpp
@@ -15,6 +15,7 @@
  * limitations under the License.
  */
 
+#include    <stdlib.h>
 #include    "LVPSA.h"
 #include    "LVPSA_Private.h"
 #include    "InstAlloc.h"
@@ -24,14 +25,14 @@
 /* FUNCTION:            LVPSA_Init                                                  */
 /*                                                                                  */
 /* DESCRIPTION:                                                                     */
-/*  Initialize the LVPSA module                                                     */
+/*  Create and Initialize the LVPSA module including instance handle                */
 /*                                                                                  */
 /*                                                                                  */
 /* PARAMETERS:                                                                      */
-/*  phInstance          Pointer to pointer to the instance                          */
+/*  phInstance          Pointer to the instance handle                              */
 /*  InitParams          Init parameters structure                                   */
 /*  ControlParams       Control parameters structure                                */
-/*  pMemoryTable        Memory table that contains memory areas definition          */
+/*  pScratch            Pointer to bundle scratch memory area                       */
 /*                                                                                  */
 /*                                                                                  */
 /* RETURNS:                                                                         */
@@ -39,10 +40,10 @@
 /*  otherwise           Error due to bad parameters                                 */
 /*                                                                                  */
 /************************************************************************************/
-LVPSA_RETURN LVPSA_Init              ( pLVPSA_Handle_t             *phInstance,
-                                       LVPSA_InitParams_t          *pInitParams,
-                                       LVPSA_ControlParams_t       *pControlParams,
-                                       LVPSA_MemTab_t              *pMemoryTable )
+LVPSA_RETURN LVPSA_Init(pLVPSA_Handle_t             *phInstance,
+                        LVPSA_InitParams_t          *pInitParams,
+                        LVPSA_ControlParams_t       *pControlParams,
+                        void                        *pScratch)
 {
     LVPSA_InstancePr_t          *pLVPSA_Inst;
     LVPSA_RETURN                errorCode       = LVPSA_OK;
@@ -50,64 +51,15 @@
     extern LVM_FLOAT            LVPSA_Float_GainTable[];
     LVM_UINT32                  BufferLength = 0;
 
-    /* Ints_Alloc instances, needed for memory alignment management */
-    INST_ALLOC          Instance;
-    INST_ALLOC          Scratch;
-    INST_ALLOC          Data;
-    INST_ALLOC          Coef;
-
-    /* Check parameters */
-    if((phInstance == LVM_NULL) || (pInitParams == LVM_NULL) || (pControlParams == LVM_NULL) || (pMemoryTable == LVM_NULL))
-    {
-        return(LVPSA_ERROR_NULLADDRESS);
-    }
-    if( (pInitParams->SpectralDataBufferDuration > LVPSA_MAXBUFFERDURATION)   ||
-        (pInitParams->SpectralDataBufferDuration == 0)                        ||
-        (pInitParams->MaxInputBlockSize > LVPSA_MAXINPUTBLOCKSIZE)      ||
-        (pInitParams->MaxInputBlockSize == 0)                           ||
-        (pInitParams->nBands < LVPSA_NBANDSMIN)                         ||
-        (pInitParams->nBands > LVPSA_NBANDSMAX)                         ||
-        (pInitParams->pFiltersParams == 0))
-    {
-        return(LVPSA_ERROR_INVALIDPARAM);
-    }
-    for(ii = 0; ii < pInitParams->nBands; ii++)
-    {
-        if((pInitParams->pFiltersParams[ii].CenterFrequency > LVPSA_MAXCENTERFREQ) ||
-           (pInitParams->pFiltersParams[ii].PostGain        > LVPSA_MAXPOSTGAIN)   ||
-           (pInitParams->pFiltersParams[ii].PostGain        < LVPSA_MINPOSTGAIN)   ||
-           (pInitParams->pFiltersParams[ii].QFactor < LVPSA_MINQFACTOR)            ||
-           (pInitParams->pFiltersParams[ii].QFactor > LVPSA_MAXQFACTOR))
-           {
-                return(LVPSA_ERROR_INVALIDPARAM);
-           }
-    }
-
-    /*Inst_Alloc instances initialization */
-    InstAlloc_Init( &Instance   , pMemoryTable->Region[LVPSA_MEMREGION_INSTANCE].pBaseAddress);
-    InstAlloc_Init( &Scratch    , pMemoryTable->Region[LVPSA_MEMREGION_SCRATCH].pBaseAddress);
-    InstAlloc_Init( &Data       , pMemoryTable->Region[LVPSA_MEMREGION_PERSISTENT_DATA].pBaseAddress);
-    InstAlloc_Init( &Coef       , pMemoryTable->Region[LVPSA_MEMREGION_PERSISTENT_COEF].pBaseAddress);
-
     /* Set the instance handle if not already initialised */
+    *phInstance = calloc(1, sizeof(*pLVPSA_Inst));
     if (*phInstance == LVM_NULL)
     {
-        *phInstance = InstAlloc_AddMember( &Instance, sizeof(LVPSA_InstancePr_t) );
+        return LVPSA_ERROR_NULLADDRESS;
     }
     pLVPSA_Inst =(LVPSA_InstancePr_t*)*phInstance;
 
-    /* Check the memory table for NULL pointers */
-    for (ii = 0; ii < LVPSA_NR_MEMORY_REGIONS; ii++)
-    {
-        if (pMemoryTable->Region[ii].Size!=0)
-        {
-            if (pMemoryTable->Region[ii].pBaseAddress==LVM_NULL)
-            {
-                return(LVPSA_ERROR_NULLADDRESS);
-            }
-            pLVPSA_Inst->MemoryTable.Region[ii] = pMemoryTable->Region[ii];
-        }
-    }
+    pLVPSA_Inst->pScratch = pScratch;
 
     /* Initialize module's internal parameters */
     pLVPSA_Inst->bControlPending = LVM_FALSE;
@@ -137,31 +89,61 @@
     }
 
     /* Assign the pointers */
-    pLVPSA_Inst->pPostGains             =
-        (LVM_FLOAT *)InstAlloc_AddMember(&Instance, pInitParams->nBands * sizeof(LVM_FLOAT));
-    pLVPSA_Inst->pFiltersParams             = (LVPSA_FilterParam_t *)
-        InstAlloc_AddMember(&Instance, pInitParams->nBands * sizeof(LVPSA_FilterParam_t));
-    pLVPSA_Inst->pSpectralDataBufferStart   = (LVM_UINT8 *)
-        InstAlloc_AddMember(&Instance, pInitParams->nBands * \
-                                pLVPSA_Inst->SpectralDataBufferLength * sizeof(LVM_UINT8));
-    pLVPSA_Inst->pPreviousPeaks             = (LVM_UINT8 *)
-                  InstAlloc_AddMember(&Instance, pInitParams->nBands * sizeof(LVM_UINT8));
-    pLVPSA_Inst->pBPFiltersPrecision        = (LVPSA_BPFilterPrecision_en *)
-                  InstAlloc_AddMember(&Instance, pInitParams->nBands * \
-                                                       sizeof(LVPSA_BPFilterPrecision_en));
-    pLVPSA_Inst->pBP_Instances          = (Biquad_FLOAT_Instance_t *)
-                  InstAlloc_AddMember(&Coef, pInitParams->nBands * \
-                                                          sizeof(Biquad_FLOAT_Instance_t));
-    pLVPSA_Inst->pQPD_States            = (QPD_FLOAT_State_t *)
-                  InstAlloc_AddMember(&Coef, pInitParams->nBands * \
-                                                                sizeof(QPD_FLOAT_State_t));
-
-    pLVPSA_Inst->pBP_Taps               = (Biquad_1I_Order2_FLOAT_Taps_t *)
-        InstAlloc_AddMember(&Data, pInitParams->nBands * \
-                                                     sizeof(Biquad_1I_Order2_FLOAT_Taps_t));
-    pLVPSA_Inst->pQPD_Taps              = (QPD_FLOAT_Taps_t *)
-        InstAlloc_AddMember(&Data, pInitParams->nBands * \
-                                                    sizeof(QPD_FLOAT_Taps_t));
+    pLVPSA_Inst->pPostGains = (LVM_FLOAT *)
+                    calloc(pInitParams->nBands, sizeof(*(pLVPSA_Inst->pPostGains)));
+    if (pLVPSA_Inst->pPostGains == LVM_NULL)
+    {
+        return LVPSA_ERROR_NULLADDRESS;
+    }
+    pLVPSA_Inst->pFiltersParams = (LVPSA_FilterParam_t *)
+                    calloc(pInitParams->nBands, sizeof(*(pLVPSA_Inst->pFiltersParams)));
+    if (pLVPSA_Inst->pFiltersParams == LVM_NULL)
+    {
+        return LVPSA_ERROR_NULLADDRESS;
+    }
+    pLVPSA_Inst->pSpectralDataBufferStart = (LVM_UINT8 *)
+                    calloc(pInitParams->nBands, pLVPSA_Inst->SpectralDataBufferLength * \
+                            sizeof(*(pLVPSA_Inst->pSpectralDataBufferStart)));
+    if (pLVPSA_Inst->pSpectralDataBufferStart == LVM_NULL)
+    {
+        return LVPSA_ERROR_NULLADDRESS;
+    }
+    pLVPSA_Inst->pPreviousPeaks = (LVM_UINT8 *)
+                        calloc(pInitParams->nBands, sizeof(*(pLVPSA_Inst->pPreviousPeaks)));
+    if (pLVPSA_Inst->pPreviousPeaks == LVM_NULL)
+    {
+        return LVPSA_ERROR_NULLADDRESS;
+    }
+    pLVPSA_Inst->pBPFiltersPrecision = (LVPSA_BPFilterPrecision_en *)
+                        calloc(pInitParams->nBands, sizeof(*(pLVPSA_Inst->pBPFiltersPrecision)));
+    if (pLVPSA_Inst->pBPFiltersPrecision == LVM_NULL)
+    {
+        return LVPSA_ERROR_NULLADDRESS;
+    }
+    pLVPSA_Inst->pBP_Instances = (Biquad_FLOAT_Instance_t *)
+                        calloc(pInitParams->nBands, sizeof(*(pLVPSA_Inst->pBP_Instances)));
+    if (pLVPSA_Inst->pBP_Instances == LVM_NULL)
+    {
+        return LVPSA_ERROR_NULLADDRESS;
+    }
+    pLVPSA_Inst->pQPD_States = (QPD_FLOAT_State_t *)
+                        calloc(pInitParams->nBands, sizeof(*(pLVPSA_Inst->pQPD_States)));
+    if (pLVPSA_Inst->pQPD_States == LVM_NULL)
+    {
+        return LVPSA_ERROR_NULLADDRESS;
+    }
+    pLVPSA_Inst->pBP_Taps = (Biquad_1I_Order2_FLOAT_Taps_t *)
+                        calloc(pInitParams->nBands, sizeof(*(pLVPSA_Inst->pBP_Taps)));
+    if (pLVPSA_Inst->pBP_Taps == LVM_NULL)
+    {
+        return LVPSA_ERROR_NULLADDRESS;
+    }
+    pLVPSA_Inst->pQPD_Taps = (QPD_FLOAT_Taps_t *)
+                        calloc(pInitParams->nBands, sizeof(*(pLVPSA_Inst->pQPD_Taps)));
+    if (pLVPSA_Inst->pQPD_Taps == LVM_NULL)
+    {
+        return LVPSA_ERROR_NULLADDRESS;
+    }
 
     /* Copy filters parameters in the private instance */
     for(ii = 0; ii < pLVPSA_Inst->nBands; ii++)
@@ -195,3 +177,60 @@
     return(errorCode);
 }
 
+/************************************************************************************/
+/*                                                                                  */
+/* FUNCTION:            LVPSA_DeInit                                                */
+/*                                                                                  */
+/* DESCRIPTION:                                                                     */
+/*    Free the memories created in LVPSA_Init call including instance handle        */
+/*                                                                                  */
+/* PARAMETERS:                                                                      */
+/*  phInstance          Pointer to the instance handle                              */
+/*                                                                                  */
+/************************************************************************************/
+void LVPSA_DeInit(pLVPSA_Handle_t *phInstance)
+{
+    LVPSA_InstancePr_t *pLVPSA_Inst = (LVPSA_InstancePr_t *)*phInstance;
+    if (pLVPSA_Inst == LVM_NULL) {
+        return;
+    }
+    if (pLVPSA_Inst->pPostGains != LVM_NULL) {
+        free(pLVPSA_Inst->pPostGains);
+        pLVPSA_Inst->pPostGains = LVM_NULL;
+    }
+    if (pLVPSA_Inst->pFiltersParams != LVM_NULL) {
+        free(pLVPSA_Inst->pFiltersParams);
+        pLVPSA_Inst->pFiltersParams = LVM_NULL;
+    }
+    if (pLVPSA_Inst->pSpectralDataBufferStart != LVM_NULL) {
+        free(pLVPSA_Inst->pSpectralDataBufferStart);
+        pLVPSA_Inst->pSpectralDataBufferStart = LVM_NULL;
+    }
+    if (pLVPSA_Inst->pPreviousPeaks != LVM_NULL) {
+        free(pLVPSA_Inst->pPreviousPeaks);
+        pLVPSA_Inst->pPreviousPeaks = LVM_NULL;
+    }
+    if (pLVPSA_Inst->pBPFiltersPrecision != LVM_NULL) {
+        free(pLVPSA_Inst->pBPFiltersPrecision);
+        pLVPSA_Inst->pBPFiltersPrecision = LVM_NULL;
+    }
+    if (pLVPSA_Inst->pBP_Instances != LVM_NULL) {
+        free(pLVPSA_Inst->pBP_Instances);
+        pLVPSA_Inst->pBP_Instances = LVM_NULL;
+    }
+    if (pLVPSA_Inst->pQPD_States != LVM_NULL) {
+        free(pLVPSA_Inst->pQPD_States);
+        pLVPSA_Inst->pQPD_States = LVM_NULL;
+    }
+    if (pLVPSA_Inst->pBP_Taps != LVM_NULL) {
+        free(pLVPSA_Inst->pBP_Taps);
+        pLVPSA_Inst->pBP_Taps = LVM_NULL;
+    }
+    if (pLVPSA_Inst->pQPD_Taps != LVM_NULL) {
+        free(pLVPSA_Inst->pQPD_Taps);
+        pLVPSA_Inst->pQPD_Taps = LVM_NULL;
+    }
+    free(pLVPSA_Inst);
+    *phInstance = LVM_NULL;
+}
+
diff --git a/media/libeffects/lvm/lib/SpectrumAnalyzer/src/LVPSA_Memory.cpp b/media/libeffects/lvm/lib/SpectrumAnalyzer/src/LVPSA_Memory.cpp
deleted file mode 100644
index eafcbe6..0000000
--- a/media/libeffects/lvm/lib/SpectrumAnalyzer/src/LVPSA_Memory.cpp
+++ /dev/null
@@ -1,165 +0,0 @@
-/*
- * Copyright (C) 2004-2010 NXP Software
- * Copyright (C) 2010 The Android Open Source Project
- *
- * Licensed under the Apache License, Version 2.0 (the "License");
- * you may not use this file except in compliance with the License.
- * You may obtain a copy of the License at
- *
- *      http://www.apache.org/licenses/LICENSE-2.0
- *
- * Unless required by applicable law or agreed to in writing, software
- * distributed under the License is distributed on an "AS IS" BASIS,
- * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
- * See the License for the specific language governing permissions and
- * limitations under the License.
- */
-
-#include    "LVPSA.h"
-#include    "LVPSA_Private.h"
-#include    "InstAlloc.h"
-
-/****************************************************************************************/
-/*                                                                                      */
-/* FUNCTION:                LVEQNB_Memory                                               */
-/*                                                                                      */
-/* DESCRIPTION:                                                                         */
-/*  This function is used for memory allocation and free. It can be called in           */
-/*  two ways:                                                                           */
-/*                                                                                      */
-/*      hInstance = NULL         Returns the memory requirements                        */
-/*      hInstance = Instance handle     Returns the memory requirements and             */
-/*                                      allocated base addresses for the instance       */
-/*                                                                                      */
-/*  When this function is called for memory allocation (hInstance=NULL) the memory      */
-/*  base address pointers are NULL on return.                                           */
-/*                                                                                      */
-/*  When the function is called for free (hInstance = Instance Handle) the memory       */
-/*  table returns the allocated memory and base addresses used during initialisation.   */
-/*                                                                                      */
-/* PARAMETERS:                                                                          */
-/*  hInstance               Instance Handle                                             */
-/*  pMemoryTable            Pointer to an empty memory definition table                 */
-/*  InitParams              Pointer to the instance init parameters                     */
-/*                                                                                      */
-/* RETURNS:                                                                             */
-/*  LVPSA_OK            Succeeds                                                        */
-/*  otherwise           Error due to bad parameters                                     */
-/*                                                                                      */
-/****************************************************************************************/
-LVPSA_RETURN LVPSA_Memory            ( pLVPSA_Handle_t             hInstance,
-                                       LVPSA_MemTab_t             *pMemoryTable,
-                                       LVPSA_InitParams_t         *pInitParams    )
-{
-    LVM_UINT32          ii;
-    LVM_UINT32          BufferLength;
-    INST_ALLOC          Instance;
-    INST_ALLOC          Scratch;
-    INST_ALLOC          Data;
-    INST_ALLOC          Coef;
-    LVPSA_InstancePr_t *pLVPSA_Inst = (LVPSA_InstancePr_t*)hInstance;
-
-    InstAlloc_Init( &Instance   , LVM_NULL);
-    InstAlloc_Init( &Scratch    , LVM_NULL);
-    InstAlloc_Init( &Data       , LVM_NULL);
-    InstAlloc_Init( &Coef       , LVM_NULL);
-
-    if((pMemoryTable == LVM_NULL) || (pInitParams == LVM_NULL))
-    {
-        return(LVPSA_ERROR_NULLADDRESS);
-    }
-
-    /*
-     * Fill in the memory table
-     */
-    if (hInstance == LVM_NULL)
-    {
-
-        /* Check init parameter */
-        if( (pInitParams->SpectralDataBufferDuration > LVPSA_MAXBUFFERDURATION)   ||
-            (pInitParams->SpectralDataBufferDuration == 0)                        ||
-            (pInitParams->MaxInputBlockSize > LVPSA_MAXINPUTBLOCKSIZE)      ||
-            (pInitParams->MaxInputBlockSize == 0)                           ||
-            (pInitParams->nBands < LVPSA_NBANDSMIN)                         ||
-            (pInitParams->nBands > LVPSA_NBANDSMAX)                         ||
-            (pInitParams->pFiltersParams == 0))
-        {
-            return(LVPSA_ERROR_INVALIDPARAM);
-        }
-        for(ii = 0; ii < pInitParams->nBands; ii++)
-        {
-            if((pInitParams->pFiltersParams[ii].CenterFrequency > LVPSA_MAXCENTERFREQ) ||
-               (pInitParams->pFiltersParams[ii].PostGain        > LVPSA_MAXPOSTGAIN)   ||
-               (pInitParams->pFiltersParams[ii].PostGain        < LVPSA_MINPOSTGAIN)   ||
-               (pInitParams->pFiltersParams[ii].QFactor < LVPSA_MINQFACTOR)            ||
-               (pInitParams->pFiltersParams[ii].QFactor > LVPSA_MAXQFACTOR))
-               {
-                    return(LVPSA_ERROR_INVALIDPARAM);
-               }
-        }
-
-        /*
-         * Instance memory
-         */
-
-        InstAlloc_AddMember( &Instance, sizeof(LVPSA_InstancePr_t) );
-        InstAlloc_AddMember( &Instance, pInitParams->nBands * sizeof(LVM_FLOAT) );
-        InstAlloc_AddMember( &Instance, pInitParams->nBands * sizeof(LVPSA_FilterParam_t) );
-
-        {
-            /* for avoiding QAC warnings as MUL32x32INTO32 works on LVM_INT32 only*/
-            LVM_INT32 SDBD=(LVM_INT32)pInitParams->SpectralDataBufferDuration;
-            LVM_INT32 IRTI=(LVM_INT32)LVPSA_InternalRefreshTimeInv;
-            LVM_INT32 BL;
-
-            MUL32x32INTO32(SDBD,IRTI,BL,LVPSA_InternalRefreshTimeShift)
-            BufferLength=(LVM_UINT32)BL;
-        }
-
-        if((BufferLength * LVPSA_InternalRefreshTime) != pInitParams->SpectralDataBufferDuration)
-        {
-            BufferLength++;
-        }
-        InstAlloc_AddMember( &Instance, pInitParams->nBands * BufferLength * sizeof(LVM_UINT8) );
-        InstAlloc_AddMember( &Instance, pInitParams->nBands * sizeof(LVM_UINT8) );
-        InstAlloc_AddMember( &Instance, pInitParams->nBands * sizeof(LVPSA_BPFilterPrecision_en) );
-        pMemoryTable->Region[LVPSA_MEMREGION_INSTANCE].Size         = InstAlloc_GetTotal(&Instance);
-        pMemoryTable->Region[LVPSA_MEMREGION_INSTANCE].Type         = LVPSA_PERSISTENT;
-        pMemoryTable->Region[LVPSA_MEMREGION_INSTANCE].pBaseAddress = LVM_NULL;
-
-        /*
-         * Scratch memory
-         */
-        InstAlloc_AddMember( &Scratch, 2 * pInitParams->MaxInputBlockSize * sizeof(LVM_FLOAT) );
-        pMemoryTable->Region[LVPSA_MEMREGION_SCRATCH].Size         = InstAlloc_GetTotal(&Scratch);
-        pMemoryTable->Region[LVPSA_MEMREGION_SCRATCH].Type         = LVPSA_SCRATCH;
-        pMemoryTable->Region[LVPSA_MEMREGION_SCRATCH].pBaseAddress = LVM_NULL;
-
-        /*
-         * Persistent coefficients memory
-         */
-        InstAlloc_AddMember( &Coef, pInitParams->nBands * sizeof(Biquad_FLOAT_Instance_t) );
-        InstAlloc_AddMember( &Coef, pInitParams->nBands * sizeof(QPD_FLOAT_State_t) );
-        pMemoryTable->Region[LVPSA_MEMREGION_PERSISTENT_COEF].Size         = InstAlloc_GetTotal(&Coef);
-        pMemoryTable->Region[LVPSA_MEMREGION_PERSISTENT_COEF].Type         = LVPSA_PERSISTENT_COEF;
-        pMemoryTable->Region[LVPSA_MEMREGION_PERSISTENT_COEF].pBaseAddress = LVM_NULL;
-
-        /*
-         * Persistent data memory
-         */
-        InstAlloc_AddMember( &Data, pInitParams->nBands * sizeof(Biquad_1I_Order2_FLOAT_Taps_t) );
-        InstAlloc_AddMember( &Data, pInitParams->nBands * sizeof(QPD_FLOAT_Taps_t) );
-        pMemoryTable->Region[LVPSA_MEMREGION_PERSISTENT_DATA].Size         = InstAlloc_GetTotal(&Data);
-        pMemoryTable->Region[LVPSA_MEMREGION_PERSISTENT_DATA].Type         = LVPSA_PERSISTENT_DATA;
-        pMemoryTable->Region[LVPSA_MEMREGION_PERSISTENT_DATA].pBaseAddress = LVM_NULL;
-
-    }
-    else
-    {
-        /* Read back memory allocation table */
-        *pMemoryTable = pLVPSA_Inst->MemoryTable;
-    }
-
-    return(LVPSA_OK);
-}
-
diff --git a/media/libeffects/lvm/lib/SpectrumAnalyzer/src/LVPSA_Private.h b/media/libeffects/lvm/lib/SpectrumAnalyzer/src/LVPSA_Private.h
index 61987b5..fc67a75 100644
--- a/media/libeffects/lvm/lib/SpectrumAnalyzer/src/LVPSA_Private.h
+++ b/media/libeffects/lvm/lib/SpectrumAnalyzer/src/LVPSA_Private.h
@@ -27,16 +27,6 @@
    CONSTANT DEFINITIONS
 ***********************************************************************************/
 
-/* Memory */
-#define LVPSA_INSTANCE_ALIGN             4      /* 32-bit alignment for structures                                  */
-#define LVPSA_SCRATCH_ALIGN              4      /* 32-bit alignment for long data                                   */
-#define LVPSA_COEF_ALIGN                 4      /* 32-bit alignment for long words                                  */
-#define LVPSA_DATA_ALIGN                 4      /* 32-bit alignment for long data                                   */
-
-#define LVPSA_MEMREGION_INSTANCE         0      /* Offset to instance memory region in memory table                 */
-#define LVPSA_MEMREGION_PERSISTENT_COEF  1      /* Offset to persistent coefficients  memory region in memory table */
-#define LVPSA_MEMREGION_PERSISTENT_DATA  2      /* Offset to persistent taps  memory region in memory table         */
-#define LVPSA_MEMREGION_SCRATCH          3      /* Offset to scratch  memory region in memory table                 */
 #define LVPSA_NR_SUPPORTED_RATE          13      /* From 8000Hz to 192000Hz*/
 #define LVPSA_NR_SUPPORTED_SPEED         3      /* LOW, MEDIUM, HIGH                                                */
 
@@ -82,7 +72,8 @@
 
     LVPSA_ControlParams_t       CurrentParams;                      /* Current control parameters of the module                                                     */
     LVPSA_ControlParams_t       NewParams;                          /* New control parameters given by the user                                                     */
-    LVPSA_MemTab_t              MemoryTable;
+    void                        *pScratch;
+    /* Pointer to bundle scratch buffer */
 
     LVPSA_BPFilterPrecision_en *pBPFiltersPrecision;                /* Points a nBands elements array that contains the filter precision for each band              */
     Biquad_FLOAT_Instance_t          *pBP_Instances;
diff --git a/media/libeffects/lvm/lib/SpectrumAnalyzer/src/LVPSA_Process.cpp b/media/libeffects/lvm/lib/SpectrumAnalyzer/src/LVPSA_Process.cpp
index 81a88c5..b4d111e 100644
--- a/media/libeffects/lvm/lib/SpectrumAnalyzer/src/LVPSA_Process.cpp
+++ b/media/libeffects/lvm/lib/SpectrumAnalyzer/src/LVPSA_Process.cpp
@@ -79,8 +79,7 @@
     {
         return(LVPSA_ERROR_INVALIDPARAM);
     }
-
-    pScratch = (LVM_FLOAT*)pLVPSA_Inst->MemoryTable.Region[LVPSA_MEMREGION_SCRATCH].pBaseAddress;
+    pScratch = (LVM_FLOAT*)pLVPSA_Inst->pScratch;
     pWrite_Save = pLVPSA_Inst->pSpectralDataBufferWritePointer;
 
     /******************************************************************************
diff --git a/media/libeffects/lvm/lib/StereoWidening/lib/LVCS.h b/media/libeffects/lvm/lib/StereoWidening/lib/LVCS.h
index 0adfd1b..58ba8ad 100644
--- a/media/libeffects/lvm/lib/StereoWidening/lib/LVCS.h
+++ b/media/libeffects/lvm/lib/StereoWidening/lib/LVCS.h
@@ -71,13 +71,6 @@
 /*                                                                                      */
 /****************************************************************************************/
 
-/* Memory table */
-#define LVCS_MEMREGION_PERSISTENT_SLOW_DATA    0    /* Offset to the instance memory region */
-#define LVCS_MEMREGION_PERSISTENT_FAST_DATA    1    /* Offset to the persistent data memory region */
-#define LVCS_MEMREGION_PERSISTENT_FAST_COEF    2    /* Offset to the persistent coefficient memory region */
-#define LVCS_MEMREGION_TEMPORARY_FAST          3    /* Offset to temporary memory region */
-#define LVCS_NR_MEMORY_REGIONS                 4    /* Number of memory regions */
-
 /* Effect Level */
 #define LVCS_EFFECT_LOW                    16384    /* Effect scaling 50% */
 #define LVCS_EFFECT_MEDIUM                 24576    /* Effect scaling 75% */
@@ -104,24 +97,12 @@
     LVCS_MAX = LVM_MAXENUM
 } LVCS_Modes_en;
 
-/* Memory Types */
-typedef enum
-{
-    LVCS_SCRATCH        = 0,
-    LVCS_DATA           = 1,
-    LVCS_COEFFICIENT    = 2,
-    LVCS_PERSISTENT     = 3,
-    LVCS_MEMORYTYPE_MAX = LVM_MAXENUM
-} LVCS_MemoryTypes_en;
-
 /* Function return status */
 typedef enum
 {
     LVCS_SUCCESS        = 0,                        /* Successful return from a routine */
-    LVCS_ALIGNMENTERROR = 1,                        /* Memory alignment error */
-    LVCS_NULLADDRESS    = 2,                        /* NULL allocation address */
-    LVCS_TOOMANYSAMPLES = 3,                        /* Maximum block size exceeded */
-    LVCS_INVALIDBUFFER  = 4,                        /* Invalid buffer processing request */
+    LVCS_NULLADDRESS    = 1,                        /* NULL allocation address */
+    LVCS_TOOMANYSAMPLES = 2,                        /* Maximum block size exceeded */
     LVCS_STATUSMAX      = LVM_MAXENUM
 } LVCS_ReturnStatus_en;
 
@@ -166,20 +147,6 @@
 /*                                                                                      */
 /****************************************************************************************/
 
-/* Memory region definition */
-typedef struct
-{
-    LVM_UINT32              Size;                   /* Region size in bytes */
-    LVCS_MemoryTypes_en     Type;                   /* Region type */
-    void                    *pBaseAddress;          /* Pointer to the region base address */
-} LVCS_MemoryRegion_t;
-
-/* Memory table containing the region definitions */
-typedef struct
-{
-    LVCS_MemoryRegion_t Region[LVCS_NR_MEMORY_REGIONS]; /* One definition for each region */
-} LVCS_MemTab_t;
-
 /* Concert Sound parameter structure */
 typedef struct
 {
@@ -190,9 +157,7 @@
     LVM_Fs_en               SampleRate;             /* Sampling rate */
     LVM_INT16               EffectLevel;            /* Effect level */
     LVM_UINT16              ReverbLevel;            /* Reverb level in % */
-#ifdef SUPPORT_MC
     LVM_INT32               NrChannels;
-#endif
 } LVCS_Params_t;
 
 /* Concert Sound Capability structure */
@@ -213,82 +178,45 @@
 /*                                                                                      */
 /****************************************************************************************/
 
-/****************************************************************************************/
-/*                                                                                      */
-/* FUNCTION:                LVCS_Memory                                                 */
-/*                                                                                      */
-/* DESCRIPTION:                                                                         */
-/*  This function is used for memory allocation and free. It can be called in           */
-/*  two ways:                                                                           */
-/*                                                                                      */
-/*      hInstance = NULL                Returns the memory requirements                 */
-/*      hInstance = Instance handle     Returns the memory requirements and             */
-/*                                      allocated base addresses for the instance       */
-/*                                                                                      */
-/*  When this function is called for memory allocation (hInstance=NULL) it is           */
-/*  passed the default capabilities, of these only the buffer processing setting is     */
-/*  used.                                                                               */
-/*                                                                                      */
-/*  When called for memory allocation the memory base address pointers are NULL on      */
-/*  return.                                                                             */
-/*                                                                                      */
-/*  When the function is called for free (hInstance = Instance Handle) the              */
-/*  capabilities are ignored and the memory table returns the allocated memory and      */
-/*  base addresses used during initialisation.                                          */
-/*                                                                                      */
-/* PARAMETERS:                                                                          */
-/*  hInstance               Instance Handle                                             */
-/*  pMemoryTable            Pointer to an empty memory definition table                 */
-/*  pCapabilities           Pointer to the default capabilites                          */
-/*                                                                                      */
-/* RETURNS:                                                                             */
-/*  LVCS_Success            Succeeded                                                   */
-/*                                                                                      */
-/* NOTES:                                                                               */
-/*  1.  This function may be interrupted by the LVCS_Process function                   */
-/*                                                                                      */
-/****************************************************************************************/
-
-LVCS_ReturnStatus_en LVCS_Memory(LVCS_Handle_t          hInstance,
-                                 LVCS_MemTab_t          *pMemoryTable,
-                                 LVCS_Capabilities_t    *pCapabilities);
-
-/****************************************************************************************/
-/*                                                                                      */
-/* FUNCTION:                LVCS_Init                                                   */
-/*                                                                                      */
-/* DESCRIPTION:                                                                         */
-/*  Create and initialisation function for the Concert Sound module                     */
-/*                                                                                      */
-/*  This function can be used to create an algorithm instance by calling with           */
-/*  hInstance set to NULL. In this case the algorithm returns the new instance          */
-/*  handle.                                                                             */
-/*                                                                                      */
-/*  This function can be used to force a full re-initialisation of the algorithm        */
-/*  by calling with hInstance = Instance Handle. In this case the memory table          */
-/*  should be correct for the instance, this can be ensured by calling the function     */
-/*  LVCS_Memory before calling this function.                                           */
-/*                                                                                      */
-/* PARAMETERS:                                                                          */
-/*  hInstance               Instance handle                                             */
-/*  pMemoryTable            Pointer to the memory definition table                      */
-/*  pCapabilities           Pointer to the initialisation capabilities                  */
-/*                                                                                      */
-/* RETURNS:                                                                             */
-/*  LVCS_Success            Initialisation succeeded                                    */
-/*  LVCS_AlignmentError     Instance or scratch memory on incorrect alignment           */
-/*  LVCS_NullAddress        Instance or scratch memory has a NULL pointer               */
-/*                                                                                      */
-/* NOTES:                                                                               */
-/*  1.  The instance handle is the pointer to the base address of the first memory      */
-/*      region.                                                                         */
-/*  2.  This function must not be interrupted by the LVCS_Process function              */
-/*                                                                                      */
-/****************************************************************************************/
-
+/************************************************************************************/
+/*                                                                                  */
+/* FUNCTION:                LVCS_Init                                               */
+/*                                                                                  */
+/* DESCRIPTION:                                                                     */
+/*  Create and initialisation function for the Concert Sound module                 */
+/*                                                                                  */
+/* PARAMETERS:                                                                      */
+/*  phInstance              Pointer to instance handle                              */
+/*  pCapabilities           Pointer to the capabilities structure                   */
+/*  pScratch                Pointer to the scratch buffer                           */
+/*                                                                                  */
+/* RETURNS:                                                                         */
+/*  LVCS_Success            Initialisation succeeded                                */
+/*  LVDBE_NULLADDRESS       One or more memory has a NULL pointer                   */
+/*                                                                                  */
+/* NOTES:                                                                           */
+/*  1.  This function must not be interrupted by the LVCS_Process function          */
+/*                                                                                  */
+/************************************************************************************/
 LVCS_ReturnStatus_en LVCS_Init(LVCS_Handle_t            *phInstance,
-                               LVCS_MemTab_t            *pMemoryTable,
-                               LVCS_Capabilities_t      *pCapabilities);
+                               LVCS_Capabilities_t      *pCapabilities,
+                               void                     *pScratch);
+
+/************************************************************************************/
+/*                                                                                  */
+/* FUNCTION:                LVCS_DeInit                                             */
+/*                                                                                  */
+/* DESCRIPTION:                                                                     */
+/*  Free memories created during the LVCS_Init call including instance handle       */
+/*                                                                                  */
+/* PARAMETERS:                                                                      */
+/*  phInstance              Pointer to instance handle                              */
+/*                                                                                  */
+/* NOTES:                                                                           */
+/*  1.  This function must not be interrupted by the LVCS_Process function          */
+/*                                                                                  */
+/************************************************************************************/
+void LVCS_DeInit(LVCS_Handle_t          *phInstance);
 
 /****************************************************************************************/
 /*                                                                                      */
diff --git a/media/libeffects/lvm/lib/StereoWidening/src/LVCS_Equaliser.cpp b/media/libeffects/lvm/lib/StereoWidening/src/LVCS_Equaliser.cpp
index 431b7e3..abadae3 100644
--- a/media/libeffects/lvm/lib/StereoWidening/src/LVCS_Equaliser.cpp
+++ b/media/libeffects/lvm/lib/StereoWidening/src/LVCS_Equaliser.cpp
@@ -65,11 +65,8 @@
     BQ_FLOAT_Coefs_t      Coeffs;
     const BiquadA012B12CoefsSP_t *pEqualiserCoefTable;
 
-    pData = (LVCS_Data_t *) \
-                pInstance->MemoryTable.Region[LVCS_MEMREGION_PERSISTENT_FAST_DATA].pBaseAddress;
-
-    pCoefficients = (LVCS_Coefficient_t *) \
-                pInstance->MemoryTable.Region[LVCS_MEMREGION_PERSISTENT_FAST_COEF].pBaseAddress;
+    pData         = (LVCS_Data_t *)pInstance->pData;
+    pCoefficients = (LVCS_Coefficient_t *)pInstance->pCoeff;
     /*
      * If the sample rate changes re-initialise the filters
      */
@@ -144,8 +141,7 @@
     LVCS_Equaliser_t    *pConfig   = (LVCS_Equaliser_t  *)&pInstance->Equaliser;
     LVCS_Coefficient_t  *pCoefficients;
 
-    pCoefficients = (LVCS_Coefficient_t *) \
-                  pInstance->MemoryTable.Region[LVCS_MEMREGION_PERSISTENT_FAST_COEF].pBaseAddress;
+    pCoefficients = (LVCS_Coefficient_t *)pInstance->pCoeff;
 
     /*
      * Check if the equaliser is required
diff --git a/media/libeffects/lvm/lib/StereoWidening/src/LVCS_Init.cpp b/media/libeffects/lvm/lib/StereoWidening/src/LVCS_Init.cpp
index 630ecf7..312885c 100644
--- a/media/libeffects/lvm/lib/StereoWidening/src/LVCS_Init.cpp
+++ b/media/libeffects/lvm/lib/StereoWidening/src/LVCS_Init.cpp
@@ -20,99 +20,11 @@
 /*  Includes                                                                        */
 /*                                                                                  */
 /************************************************************************************/
-
+#include <stdlib.h>
 #include "LVCS.h"
 #include "LVCS_Private.h"
 #include "LVCS_Tables.h"
 
-/****************************************************************************************/
-/*                                                                                      */
-/* FUNCTION:                LVCS_Memory                                                 */
-/*                                                                                      */
-/* DESCRIPTION:                                                                         */
-/*  This function is used for memory allocation and free. It can be called in           */
-/*  two ways:                                                                           */
-/*                                                                                      */
-/*      hInstance = NULL                Returns the memory requirements                 */
-/*      hInstance = Instance handle     Returns the memory requirements and             */
-/*                                      allocated base addresses for the instance       */
-/*                                                                                      */
-/*  When this function is called for memory allocation (hInstance=NULL) it is           */
-/*  passed the default capabilities.                                                    */
-/*                                                                                      */
-/*  When called for memory allocation the memory base address pointers are NULL on      */
-/*  return.                                                                             */
-/*                                                                                      */
-/*  When the function is called for free (hInstance = Instance Handle) the              */
-/*  capabilities are ignored and the memory table returns the allocated memory and      */
-/*  base addresses used during initialisation.                                          */
-/*                                                                                      */
-/* PARAMETERS:                                                                          */
-/*  hInstance               Instance Handle                                             */
-/*  pMemoryTable            Pointer to an empty memory definition table                 */
-/*  pCapabilities           Pointer to the default capabilites                          */
-/*                                                                                      */
-/* RETURNS:                                                                             */
-/*  LVCS_Success            Succeeded                                                   */
-/*                                                                                      */
-/* NOTES:                                                                               */
-/*  1.  This function may be interrupted by the LVCS_Process function                   */
-/*                                                                                      */
-/****************************************************************************************/
-
-LVCS_ReturnStatus_en LVCS_Memory(LVCS_Handle_t          hInstance,
-                                 LVCS_MemTab_t          *pMemoryTable,
-                                 LVCS_Capabilities_t    *pCapabilities)
-{
-
-    LVM_UINT32          ScratchSize;
-    LVCS_Instance_t     *pInstance = (LVCS_Instance_t *)hInstance;
-
-    /*
-     * Fill in the memory table
-     */
-    if (hInstance == LVM_NULL)
-    {
-        /*
-         * Instance memory
-         */
-        pMemoryTable->Region[LVCS_MEMREGION_PERSISTENT_SLOW_DATA].Size         = (LVM_UINT32)sizeof(LVCS_Instance_t);
-        pMemoryTable->Region[LVCS_MEMREGION_PERSISTENT_SLOW_DATA].Type         = LVCS_PERSISTENT;
-        pMemoryTable->Region[LVCS_MEMREGION_PERSISTENT_SLOW_DATA].pBaseAddress = LVM_NULL;
-
-        /*
-         * Data memory
-         */
-        pMemoryTable->Region[LVCS_MEMREGION_PERSISTENT_FAST_DATA].Size         = (LVM_UINT32)sizeof(LVCS_Data_t);
-        pMemoryTable->Region[LVCS_MEMREGION_PERSISTENT_FAST_DATA].Type         = LVCS_DATA;
-        pMemoryTable->Region[LVCS_MEMREGION_PERSISTENT_FAST_DATA].pBaseAddress = LVM_NULL;
-
-        /*
-         * Coefficient memory
-         */
-        pMemoryTable->Region[LVCS_MEMREGION_PERSISTENT_FAST_COEF].Size         = (LVM_UINT32)sizeof(LVCS_Coefficient_t);
-        pMemoryTable->Region[LVCS_MEMREGION_PERSISTENT_FAST_COEF].Type         = LVCS_COEFFICIENT;
-        pMemoryTable->Region[LVCS_MEMREGION_PERSISTENT_FAST_COEF].pBaseAddress = LVM_NULL;
-
-        /*
-         * Scratch memory
-         */
-        /* Inplace processing */
-        ScratchSize = (LVM_UINT32) \
-                        (LVCS_SCRATCHBUFFERS * sizeof(LVM_FLOAT) * pCapabilities->MaxBlockSize);
-        pMemoryTable->Region[LVCS_MEMREGION_TEMPORARY_FAST].Size         = ScratchSize;
-        pMemoryTable->Region[LVCS_MEMREGION_TEMPORARY_FAST].Type         = LVCS_SCRATCH;
-        pMemoryTable->Region[LVCS_MEMREGION_TEMPORARY_FAST].pBaseAddress = LVM_NULL;
-    }
-    else
-    {
-        /* Read back memory allocation table */
-        *pMemoryTable = pInstance->MemoryTable;
-    }
-
-    return(LVCS_SUCCESS);
-}
-
 /************************************************************************************/
 /*                                                                                  */
 /* FUNCTION:                LVCS_Init                                               */
@@ -120,46 +32,38 @@
 /* DESCRIPTION:                                                                     */
 /*  Create and initialisation function for the Concert Sound module                 */
 /*                                                                                  */
-/*  This function can be used to create an algorithm instance by calling with       */
-/*  hInstance set to LVM_NULL. In this case the algorithm returns the new instance  */
-/*  handle.                                                                         */
-/*                                                                                  */
-/*  This function can be used to force a full re-initialisation of the algorithm    */
-/*  by calling with hInstance = Instance Handle. In this case the memory table      */
-/*  should be correct for the instance, this can be ensured by calling the function */
-/*  LVCS_Memory before calling this function.                                       */
-/*                                                                                  */
 /* PARAMETERS:                                                                      */
-/*  hInstance               Instance handle                                         */
-/*  pMemoryTable            Pointer to the memory definition table                  */
+/*  phInstance              Pointer to instance handle                              */
 /*  pCapabilities           Pointer to the capabilities structure                   */
+/*  pScratch                Pointer to scratch buffer                               */
 /*                                                                                  */
 /* RETURNS:                                                                         */
 /*  LVCS_Success            Initialisation succeeded                                */
+/*  LVDBE_NULLADDRESS       One or more memory has a NULL pointer - malloc failure  */
 /*                                                                                  */
 /* NOTES:                                                                           */
-/*  1.  The instance handle is the pointer to the base address of the first memory  */
-/*      region.                                                                     */
-/*  2.  This function must not be interrupted by the LVCS_Process function          */
-/*  3.  This function must be called with the same capabilities as used for the     */
-/*      call to the memory function                                                 */
+/*  1.  This function must not be interrupted by the LVCS_Process function          */
 /*                                                                                  */
 /************************************************************************************/
 
 LVCS_ReturnStatus_en LVCS_Init(LVCS_Handle_t         *phInstance,
-                               LVCS_MemTab_t         *pMemoryTable,
-                               LVCS_Capabilities_t   *pCapabilities)
+                               LVCS_Capabilities_t   *pCapabilities,
+                               void                  *pScratch)
 {
 
-    LVCS_Instance_t                 *pInstance;
-    LVCS_VolCorrect_t               *pLVCS_VolCorrectTable;
+    LVCS_Instance_t    *pInstance;
+    LVCS_VolCorrect_t  *pLVCS_VolCorrectTable;
 
     /*
-     * Set the instance handle if not already initialised
+     * Create the instance handle if not already initialised
      */
     if (*phInstance == LVM_NULL)
     {
-        *phInstance = (LVCS_Handle_t)pMemoryTable->Region[LVCS_MEMREGION_PERSISTENT_SLOW_DATA].pBaseAddress;
+        *phInstance = calloc(1, sizeof(*pInstance));
+    }
+    if (*phInstance == LVM_NULL)
+    {
+        return LVCS_NULLADDRESS;
     }
     pInstance =(LVCS_Instance_t  *)*phInstance;
 
@@ -168,10 +72,7 @@
      */
     pInstance->Capabilities = *pCapabilities;
 
-    /*
-     * Save the memory table in the instance structure
-     */
-    pInstance->MemoryTable = *pMemoryTable;
+    pInstance->pScratch     = pScratch;
 
     /*
      * Set all initial parameters to invalid to force a full initialisation
@@ -208,3 +109,35 @@
     return(LVCS_SUCCESS);
 }
 
+/************************************************************************************/
+/*                                                                                  */
+/* FUNCTION:                LVCS_DeInit                                             */
+/*                                                                                  */
+/* DESCRIPTION:                                                                     */
+/*  Free memories created during the LVCS_Init call including instance handle       */
+/*                                                                                  */
+/* PARAMETERS:                                                                      */
+/*  phInstance              Pointer to instance handle                              */
+/*                                                                                  */
+/* NOTES:                                                                           */
+/*  1.  This function must not be interrupted by the LVCS_Process function          */
+/*                                                                                  */
+/************************************************************************************/
+void LVCS_DeInit(LVCS_Handle_t *phInstance)
+{
+    LVCS_Instance_t *pInstance = (LVCS_Instance_t *)*phInstance;
+    if (pInstance == LVM_NULL) {
+        return;
+    }
+    if (pInstance->pCoeff != LVM_NULL) {
+        free(pInstance->pCoeff);
+        pInstance->pCoeff = LVM_NULL;
+    }
+    if (pInstance->pData != LVM_NULL) {
+        free(pInstance->pData);
+        pInstance->pData = LVM_NULL;
+    }
+    free(pInstance);
+    *phInstance = LVM_NULL;
+    return;
+}
diff --git a/media/libeffects/lvm/lib/StereoWidening/src/LVCS_Private.h b/media/libeffects/lvm/lib/StereoWidening/src/LVCS_Private.h
index 154ea55..7adfb50 100644
--- a/media/libeffects/lvm/lib/StereoWidening/src/LVCS_Private.h
+++ b/media/libeffects/lvm/lib/StereoWidening/src/LVCS_Private.h
@@ -54,12 +54,7 @@
 #define LVCS_COMPGAINFRAME          64          /* Compressor gain update interval */
 
 /* Memory */
-#ifdef SUPPORT_MC
 #define LVCS_SCRATCHBUFFERS              8      /* Number of buffers required for inplace processing */
-#else
-#define LVCS_SCRATCHBUFFERS              6      /* Number of buffers required for inplace processing */
-#endif
-#ifdef SUPPORT_MC
 /*
  * The Concert Surround module applies processing only on the first two
  * channels of a multichannel input. The data of first two channels is copied
@@ -67,7 +62,6 @@
  * are used for this purpose
  */
 #define LVCS_MC_SCRATCHBUFFERS           2
-#endif
 
 /* General */
 #define LVCS_INVALID                0xFFFF      /* Invalid init parameter */
@@ -110,7 +104,6 @@
 typedef struct
 {
     /* Public parameters */
-    LVCS_MemTab_t           MemoryTable;        /* Instance memory allocation table */
     LVCS_Params_t           Params;             /* Instance parameters */
     LVCS_Capabilities_t     Capabilities;       /* Initialisation capabilities */
 
@@ -133,6 +126,9 @@
     LVM_INT16               bTimerDone;                         /* Timer completion flag */
     LVM_Timer_Params_t      TimerParams;                        /* Timer parameters */
     LVM_Timer_Instance_t    TimerInstance;                      /* Timer instance */
+    void                    *pCoeff;           /* pointer to buffer for equaliser filter coeffs */
+    void                    *pData;            /* pointer to buffer for equaliser filter states */
+    void                    *pScratch;         /* Pointer to bundle scratch buffer */
 
 } LVCS_Instance_t;
 
diff --git a/media/libeffects/lvm/lib/StereoWidening/src/LVCS_Process.cpp b/media/libeffects/lvm/lib/StereoWidening/src/LVCS_Process.cpp
index 8e09be2..72b4c8b 100644
--- a/media/libeffects/lvm/lib/StereoWidening/src/LVCS_Process.cpp
+++ b/media/libeffects/lvm/lib/StereoWidening/src/LVCS_Process.cpp
@@ -74,7 +74,6 @@
     LVCS_Instance_t     *pInstance = (LVCS_Instance_t  *)hInstance;
     LVM_FLOAT           *pScratch;
     LVCS_ReturnStatus_en err;
-#ifdef SUPPORT_MC
     LVM_FLOAT           *pStIn;
     LVM_INT32           channels = pInstance->Params.NrChannels;
 #define NrFrames NumSamples  // alias for clarity
@@ -89,15 +88,12 @@
     {
         channels = 2;
     }
-#endif
 
-    pScratch  = (LVM_FLOAT *) \
-                  pInstance->MemoryTable.Region[LVCS_MEMREGION_TEMPORARY_FAST].pBaseAddress;
+    pScratch  = (LVM_FLOAT *)pInstance->pScratch;
 
     /*
      * Check if the processing is inplace
      */
-#ifdef SUPPORT_MC
     /*
      * The pInput buffer holds the first 2 (Left, Right) channels information.
      * Hence the memory required by this buffer is 2 * NumFrames.
@@ -115,35 +111,13 @@
     Copy_Float((LVM_FLOAT *)pInput,
                (LVM_FLOAT *)pStIn,
                (LVM_INT16)(2 * NrFrames));
-#else
-    if (pInData == pOutData)
-    {
-        /* Processing inplace */
-        pInput = pScratch + (2 * NumSamples);
-        Copy_Float((LVM_FLOAT *)pInData,           /* Source */
-                   (LVM_FLOAT *)pInput,            /* Destination */
-                   (LVM_INT16)(2 * NumSamples));     /* Left and right */
-    }
-    else
-    {
-        /* Processing outplace */
-        pInput = pInData;
-    }
-#endif
     /*
      * Call the stereo enhancer
      */
-#ifdef SUPPORT_MC
     err = LVCS_StereoEnhancer(hInstance,              /* Instance handle */
                               pStIn,                  /* Pointer to the input data */
                               pOutData,               /* Pointer to the output data */
                               NrFrames);              /* Number of frames to process */
-#else
-    err = LVCS_StereoEnhancer(hInstance,              /* Instance handle */
-                              pInData,                    /* Pointer to the input data */
-                              pOutData,                   /* Pointer to the output data */
-                              NumSamples);                /* Number of samples to process */
-#endif
 
     /*
      * Call the reverb generator
@@ -210,7 +184,6 @@
 
     LVCS_Instance_t *pInstance = (LVCS_Instance_t  *)hInstance;
     LVCS_ReturnStatus_en err;
-#ifdef SUPPORT_MC
     /*Extract number of Channels info*/
     LVM_INT32 channels = pInstance->Params.NrChannels;
 #define NrFrames NumSamples  // alias for clarity
@@ -218,7 +191,6 @@
     {
         channels = 2;
     }
-#endif
     /*
      * Check the number of samples is not too large
      */
@@ -232,7 +204,6 @@
      */
     if (pInstance->Params.OperatingMode != LVCS_OFF)
     {
-#ifdef SUPPORT_MC
         LVM_FLOAT *pStereoOut;
         /*
          * LVCS_Process_CS uses output buffer to store intermediate outputs of StereoEnhancer,
@@ -248,10 +219,8 @@
            * second and fourth are used as input buffers by pInput and pStIn in LVCS_Process_CS.
            * Hence, pStereoOut is pointed to use unused third portion of scratch memory.
            */
-            pStereoOut = (LVM_FLOAT *) \
-                          pInstance->MemoryTable. \
-                          Region[LVCS_MEMREGION_TEMPORARY_FAST].pBaseAddress +
-                          ((LVCS_SCRATCHBUFFERS - 4) * NrFrames);
+            pStereoOut = (LVM_FLOAT *)pInstance->pScratch +
+                                     ((LVCS_SCRATCHBUFFERS - 4) * NrFrames);
         }
         else
         {
@@ -265,12 +234,6 @@
                                   pInData,
                                   pStereoOut,
                                   NrFrames);
-#else
-            err = LVCS_Process_CS(hInstance,
-                                  pInData,
-                                  pOutData,
-                                  NumSamples);
-#endif
 
         /*
          * Compress to reduce expansion effect of Concert Sound and correct volume
@@ -289,17 +252,10 @@
 
             if(NumSamples < LVCS_COMPGAINFRAME)
             {
-#ifdef SUPPORT_MC
                 NonLinComp_Float(Gain,                    /* Compressor gain setting */
                                  pStereoOut,
                                  pStereoOut,
                                  (LVM_INT32)(2 * NrFrames));
-#else
-                NonLinComp_Float(Gain,                    /* Compressor gain setting */
-                                 pOutData,
-                                 pOutData,
-                                 (LVM_INT32)(2 * NumSamples));
-#endif
             }
             else
             {
@@ -328,11 +284,7 @@
 
                 FinalGain = Gain;
                 Gain = pInstance->CompressGain;
-#ifdef SUPPORT_MC
                 pOutPtr = pStereoOut;
-#else
-                pOutPtr = pOutData;
-#endif
 
                 while(SampleToProcess > 0)
                 {
@@ -396,33 +348,22 @@
                             (LVM_INT16)NumSamples);
             }
         }
-#ifdef SUPPORT_MC
         Copy_Float_Stereo_Mc(pInData,
                              pStereoOut,
                              pOutData,
                              NrFrames,
                              channels);
-#endif
     }
     else
     {
         if (pInData != pOutData)
         {
-#ifdef SUPPORT_MC
             /*
              * The algorithm is disabled so just copy the data
              */
             Copy_Float((LVM_FLOAT *)pInData,               /* Source */
                        (LVM_FLOAT *)pOutData,                  /* Destination */
                        (LVM_INT16)(channels * NrFrames));    /* All Channels*/
-#else
-            /*
-             * The algorithm is disabled so just copy the data
-             */
-            Copy_Float((LVM_FLOAT *)pInData,               /* Source */
-                       (LVM_FLOAT *)pOutData,                  /* Destination */
-                       (LVM_INT16)(2 * NumSamples));             /* Left and right */
-#endif
         }
     }
 
diff --git a/media/libeffects/lvm/lib/StereoWidening/src/LVCS_ReverbGenerator.cpp b/media/libeffects/lvm/lib/StereoWidening/src/LVCS_ReverbGenerator.cpp
index d0e6e09..441b667 100644
--- a/media/libeffects/lvm/lib/StereoWidening/src/LVCS_ReverbGenerator.cpp
+++ b/media/libeffects/lvm/lib/StereoWidening/src/LVCS_ReverbGenerator.cpp
@@ -20,7 +20,7 @@
 /*  Includes                                                                        */
 /*                                                                                  */
 /************************************************************************************/
-
+#include <stdlib.h>
 #include "LVCS.h"
 #include "LVCS_Private.h"
 #include "LVCS_ReverbGenerator.h"
@@ -70,11 +70,31 @@
     BQ_FLOAT_Coefs_t         Coeffs;
     const BiquadA012B12CoefsSP_t  *pReverbCoefTable;
 
-    pData = (LVCS_Data_t *) \
-                 pInstance->MemoryTable.Region[LVCS_MEMREGION_PERSISTENT_FAST_DATA].pBaseAddress;
-
-    pCoefficients = (LVCS_Coefficient_t *) \
-                 pInstance->MemoryTable.Region[LVCS_MEMREGION_PERSISTENT_FAST_COEF].pBaseAddress;
+    if (pInstance->pData == LVM_NULL)
+    {
+        pInstance->pData = pData = (LVCS_Data_t *)calloc(1, sizeof(*pData));
+        if (pData == LVM_NULL)
+        {
+            return LVCS_NULLADDRESS;
+        }
+    }
+    else
+    {
+        pData = (LVCS_Data_t *)pInstance->pData;
+    }
+    if (pInstance->pCoeff == LVM_NULL)
+    {
+        pInstance->pCoeff = pCoefficients = (LVCS_Coefficient_t *)calloc(1, \
+                                                                          sizeof(*pCoefficients));
+        if (pCoefficients == LVM_NULL)
+        {
+            return LVCS_NULLADDRESS;
+        }
+    }
+    else
+    {
+        pCoefficients = (LVCS_Coefficient_t *)pInstance->pCoeff;
+    }
 
     /*
      * Initialise the delay and filters if:
@@ -192,11 +212,8 @@
     LVCS_Coefficient_t      *pCoefficients;
     LVM_FLOAT               *pScratch;
 
-    pCoefficients = (LVCS_Coefficient_t *)\
-                   pInstance->MemoryTable.Region[LVCS_MEMREGION_PERSISTENT_FAST_COEF].pBaseAddress;
-
-    pScratch  = (LVM_FLOAT *)\
-                    pInstance->MemoryTable.Region[LVCS_MEMREGION_TEMPORARY_FAST].pBaseAddress;
+    pCoefficients = (LVCS_Coefficient_t *)pInstance->pCoeff;
+    pScratch      = (LVM_FLOAT *)pInstance->pScratch;
 
     /*
      * Copy the data to the output in outplace processing
diff --git a/media/libeffects/lvm/lib/StereoWidening/src/LVCS_StereoEnhancer.cpp b/media/libeffects/lvm/lib/StereoWidening/src/LVCS_StereoEnhancer.cpp
index 7fd8444..6929015 100644
--- a/media/libeffects/lvm/lib/StereoWidening/src/LVCS_StereoEnhancer.cpp
+++ b/media/libeffects/lvm/lib/StereoWidening/src/LVCS_StereoEnhancer.cpp
@@ -62,11 +62,8 @@
     BQ_FLOAT_Coefs_t          CoeffsSide;
     const BiquadA012B12CoefsSP_t *pSESideCoefs;
 
-    pData     = (LVCS_Data_t *) \
-                  pInstance->MemoryTable.Region[LVCS_MEMREGION_PERSISTENT_FAST_DATA].pBaseAddress;
-
-    pCoefficient = (LVCS_Coefficient_t *) \
-                  pInstance->MemoryTable.Region[LVCS_MEMREGION_PERSISTENT_FAST_COEF].pBaseAddress;
+    pData        = (LVCS_Data_t *)pInstance->pData;
+    pCoefficient = (LVCS_Coefficient_t *)pInstance->pCoeff;
 
     /*
      * If the sample rate or speaker type has changed update the filters
@@ -188,12 +185,8 @@
     LVCS_StereoEnhancer_t   *pConfig   = (LVCS_StereoEnhancer_t *)&pInstance->StereoEnhancer;
     LVCS_Coefficient_t      *pCoefficient;
     LVM_FLOAT               *pScratch;
-
-    pCoefficient = (LVCS_Coefficient_t *) \
-                   pInstance->MemoryTable.Region[LVCS_MEMREGION_PERSISTENT_FAST_COEF].pBaseAddress;
-
-    pScratch  = (LVM_FLOAT *) \
-                    pInstance->MemoryTable.Region[LVCS_MEMREGION_TEMPORARY_FAST].pBaseAddress;
+    pCoefficient = (LVCS_Coefficient_t *)pInstance->pCoeff;
+    pScratch     = (LVM_FLOAT *)pInstance->pScratch;
     /*
      * Check if the Stereo Enhancer is enabled
      */
diff --git a/media/libeffects/lvm/tests/build_and_run_all_unit_tests_reverb.sh b/media/libeffects/lvm/tests/build_and_run_all_unit_tests_reverb.sh
index 5a972db..0c3b0b5 100755
--- a/media/libeffects/lvm/tests/build_and_run_all_unit_tests_reverb.sh
+++ b/media/libeffects/lvm/tests/build_and_run_all_unit_tests_reverb.sh
@@ -41,47 +41,65 @@
     192000
 )
 
+flags_arr=(
+    "--M --fch 1"
+    "--fch 2"
+)
+
 # run reverb at different configs, saving only the stereo channel
 # pair.
 error_count=0
+testcase_count=0
 for cmd in "${cmds[@]}"
 do
     $cmd
-    for preset_val in {0..6}
+    for flags in "${flags_arr[@]}"
     do
-        for fs in ${fs_arr[*]}
+        for preset_val in {0..6}
         do
-            for chMask in {1..22}
+            for fs in ${fs_arr[*]}
             do
-                adb shell LD_LIBRARY_PATH=/system/vendor/lib/soundfx $testdir/reverb_test \
-                    --input $testdir/sinesweepraw.raw \
-                    --output $testdir/sinesweep_$((chMask))_$((fs)).raw \
-                    --chMask $chMask --fs $fs --preset $preset_val
+                for chMask in {0..22}
+                do
+                    adb shell LD_LIBRARY_PATH=/system/vendor/lib/soundfx $testdir/reverb_test \
+                        --input $testdir/sinesweepraw.raw \
+                        --output $testdir/sinesweep_$((chMask))_$((fs)).raw \
+                        --chMask $chMask $flags --fs $fs --preset $preset_val
 
-                shell_ret=$?
-                if [ $shell_ret -ne 0 ]; then
-                    echo "error: $shell_ret"
-                    ((++error_count))
-                fi
+                    shell_ret=$?
+                    if [ $shell_ret -ne 0 ]; then
+                        echo "error: $shell_ret"
+                        ((++error_count))
+                    fi
 
-                # two channel files should be identical to higher channel
-                # computation (first 2 channels).
-                if [[ "$chMask" -gt 1 ]]
-                then
-                    adb shell cmp $testdir/sinesweep_1_$((fs)).raw \
-                        $testdir/sinesweep_$((chMask))_$((fs)).raw
-                fi
-                # cmp returns EXIT_FAILURE on mismatch.
-                shell_ret=$?
-                if [ $shell_ret -ne 0 ]; then
-                    echo "error: $shell_ret"
-                    ((++error_count))
-                fi
+                    if [[ "$chMask" -gt 0 ]] && [[ $flags != *"--fch 2"* ]]
+                    then
+                        # single channel files should be identical to higher channel
+                        # computation (first channel).
+                        adb shell cmp $testdir/sinesweep_0_$((fs)).raw \
+                            $testdir/sinesweep_$((chMask))_$((fs)).raw
+                    elif [[ "$chMask" -gt 1 ]]
+                    then
+                        # two channel files should be identical to higher channel
+                        # computation (first 2 channels).
+                        adb shell cmp $testdir/sinesweep_1_$((fs)).raw \
+                            $testdir/sinesweep_$((chMask))_$((fs)).raw
+                    fi
+
+                    # cmp returns EXIT_FAILURE on mismatch.
+                    shell_ret=$?
+                    if [ $shell_ret -ne 0 ]; then
+                        echo "error: $shell_ret"
+                        ((++error_count))
+                    fi
+                    ((++testcase_count))
+                done
             done
         done
     done
 done
 
 adb shell rm -r $testdir
+echo "$testcase_count tests performed"
 echo "$error_count errors"
 exit $error_count
diff --git a/media/libeffects/lvm/tests/lvmtest.cpp b/media/libeffects/lvm/tests/lvmtest.cpp
index a4ace6c..59b27ad 100644
--- a/media/libeffects/lvm/tests/lvmtest.cpp
+++ b/media/libeffects/lvm/tests/lvmtest.cpp
@@ -182,49 +182,6 @@
   printf("\n           Enable Equalizer");
 }
 
-//----------------------------------------------------------------------------
-// LvmEffect_free()
-//----------------------------------------------------------------------------
-// Purpose: Free all memory associated with the Bundle.
-//
-// Inputs:
-//  pContext:   effect engine context
-//
-// Outputs:
-//
-//----------------------------------------------------------------------------
-
-void LvmEffect_free(struct EffectContext *pContext) {
-  LVM_ReturnStatus_en LvmStatus = LVM_SUCCESS; /* Function call status */
-  LVM_MemTab_t MemTab;
-
-  /* Free the algorithm memory */
-  LvmStatus = LVM_GetMemoryTable(pContext->pBundledContext->hInstance, &MemTab,
-                                 LVM_NULL);
-
-  LVM_ERROR_CHECK(LvmStatus, "LVM_GetMemoryTable", "LvmEffect_free")
-
-  for (int i = 0; i < LVM_NR_MEMORY_REGIONS; i++) {
-    if (MemTab.Region[i].Size != 0) {
-      if (MemTab.Region[i].pBaseAddress != NULL) {
-        ALOGV("\tLvmEffect_free - START freeing %" PRIu32
-              " bytes for region %u at %p\n",
-              MemTab.Region[i].Size, i, MemTab.Region[i].pBaseAddress);
-
-        free(MemTab.Region[i].pBaseAddress);
-
-        ALOGV("\tLvmEffect_free - END   freeing %" PRIu32
-              " bytes for region %u at %p\n",
-              MemTab.Region[i].Size, i, MemTab.Region[i].pBaseAddress);
-      } else {
-        ALOGE(
-            "\tLVM_ERROR : LvmEffect_free - trying to free with NULL pointer "
-            "%" PRIu32 " bytes for region %u at %p ERROR\n",
-            MemTab.Region[i].Size, i, MemTab.Region[i].pBaseAddress);
-      }
-    }
-  }
-} /* end LvmEffect_free */
 
 //----------------------------------------------------------------------------
 // LvmBundle_init()
@@ -263,8 +220,7 @@
     ALOGV(
         "\tLvmBundle_init pContext->pBassBoost != NULL "
         "-> Calling pContext->pBassBoost->free()");
-
-    LvmEffect_free(pContext);
+    LVM_DelInstanceHandle(&pContext->pBundledContext->hInstance);
 
     ALOGV(
         "\tLvmBundle_init pContext->pBassBoost != NULL "
@@ -276,8 +232,6 @@
   LVM_EQNB_BandDef_t BandDefs[MAX_NUM_BANDS];  /* Equaliser band definitions */
   LVM_HeadroomParams_t HeadroomParams;         /* Headroom parameters */
   LVM_HeadroomBandDef_t HeadroomBandDef[LVM_HEADROOM_MAX_NBANDS];
-  LVM_MemTab_t MemTab; /* Memory allocation table */
-  bool bMallocFailure = LVM_FALSE;
 
   /* Set the capabilities */
   InstParams.BufferMode = LVM_UNMANAGED_BUFFERS;
@@ -285,63 +239,8 @@
   InstParams.EQNB_NumBands = MAX_NUM_BANDS;
   InstParams.PSA_Included = LVM_PSA_ON;
 
-  /* Allocate memory, forcing alignment */
-  LvmStatus = LVM_GetMemoryTable(LVM_NULL, &MemTab, &InstParams);
-
-  LVM_ERROR_CHECK(LvmStatus, "LVM_GetMemoryTable", "LvmBundle_init");
-  if (LvmStatus != LVM_SUCCESS) return -EINVAL;
-
-  ALOGV("\tCreateInstance Succesfully called LVM_GetMemoryTable\n");
-
-  /* Allocate memory */
-  for (int i = 0; i < LVM_NR_MEMORY_REGIONS; i++) {
-    if (MemTab.Region[i].Size != 0) {
-      MemTab.Region[i].pBaseAddress = malloc(MemTab.Region[i].Size);
-
-      if (MemTab.Region[i].pBaseAddress == LVM_NULL) {
-        ALOGE(
-            "\tLVM_ERROR :LvmBundle_init CreateInstance Failed to allocate "
-            "%" PRIu32 " bytes for region %u\n",
-            MemTab.Region[i].Size, i);
-        bMallocFailure = LVM_TRUE;
-        break;
-      } else {
-        ALOGV("\tLvmBundle_init CreateInstance allocated %" PRIu32
-              " bytes for region %u at %p\n",
-              MemTab.Region[i].Size, i, MemTab.Region[i].pBaseAddress);
-      }
-    }
-  }
-
-  /* If one or more of the memory regions failed to allocate, free the regions
-   * that were
-   * succesfully allocated and return with an error
-   */
-  if (bMallocFailure == LVM_TRUE) {
-    for (int i = 0; i < LVM_NR_MEMORY_REGIONS; i++) {
-      if (MemTab.Region[i].pBaseAddress == LVM_NULL) {
-        ALOGE(
-            "\tLVM_ERROR :LvmBundle_init CreateInstance Failed to allocate "
-            "%" PRIu32 " bytes for region %u Not freeing\n",
-            MemTab.Region[i].Size, i);
-      } else {
-        ALOGE(
-            "\tLVM_ERROR :LvmBundle_init CreateInstance Failed: but allocated "
-            "%" PRIu32 " bytes for region %u at %p- free\n",
-            MemTab.Region[i].Size, i, MemTab.Region[i].pBaseAddress);
-        free(MemTab.Region[i].pBaseAddress);
-      }
-    }
-    return -EINVAL;
-  }
-  ALOGV("\tLvmBundle_init CreateInstance Succesfully malloc'd memory\n");
-
-  /* Initialise */
-  pContext->pBundledContext->hInstance = LVM_NULL;
-
-  /* Init sets the instance handle */
   LvmStatus = LVM_GetInstanceHandle(&pContext->pBundledContext->hInstance,
-                                    &MemTab, &InstParams);
+                                    &InstParams);
 
   LVM_ERROR_CHECK(LvmStatus, "LVM_GetInstanceHandle", "LvmBundle_init");
   if (LvmStatus != LVM_SUCCESS) return -EINVAL;
@@ -812,7 +711,7 @@
   /* Free the allocated buffers */
   if (context.pBundledContext != nullptr) {
     if (context.pBundledContext->hInstance != nullptr) {
-      LvmEffect_free(&context);
+      LVM_DelInstanceHandle(&context.pBundledContext->hInstance);
     }
     free(context.pBundledContext);
   }
diff --git a/media/libeffects/lvm/tests/reverb_test.cpp b/media/libeffects/lvm/tests/reverb_test.cpp
index a9cf348..f403229 100644
--- a/media/libeffects/lvm/tests/reverb_test.cpp
+++ b/media/libeffects/lvm/tests/reverb_test.cpp
@@ -297,6 +297,9 @@
   config.inputCfg.samplingRate = config.outputCfg.samplingRate = revConfigParams.sampleRate;
   config.inputCfg.channels = config.outputCfg.channels = revConfigParams.chMask;
   config.inputCfg.format = config.outputCfg.format = AUDIO_FORMAT_PCM_FLOAT;
+  if (AUDIO_CHANNEL_OUT_MONO == revConfigParams.chMask) {
+    config.outputCfg.channels = AUDIO_CHANNEL_OUT_STEREO;
+  }
   if (int status =
           reverbCreateEffect(&effectHandle, &config, sessionId, ioId, revConfigParams.auxiliary);
       status != 0) {
@@ -332,15 +335,15 @@
    * Mono input will be converted to 2 channels internally in the process call
    * by copying the same data into the second channel.
    * Hence when channelCount is 1, output buffer should be allocated for
-   * 2 channels. The memAllocChCount takes care of allocation of sufficient
+   * 2 channels. The outChannelCount takes care of allocation of sufficient
    * memory for the output buffer.
    */
-  const int memAllocChCount = (channelCount == 1 ? 2 : channelCount);
+  const int outChannelCount = (channelCount == 1 ? 2 : channelCount);
 
   std::vector<short> in(frameLength * maxChannelCount);
   std::vector<short> out(frameLength * maxChannelCount);
   std::vector<float> floatIn(frameLength * channelCount);
-  std::vector<float> floatOut(frameLength * memAllocChCount);
+  std::vector<float> floatOut(frameLength * outChannelCount);
 
   int frameCounter = 0;
 
@@ -374,11 +377,11 @@
 #else
     memcpy(floatOut.data(), floatIn.data(), frameLength * frameSize);
 #endif
-    memcpy_to_i16_from_float(out.data(), floatOut.data(), frameLength * channelCount);
+    memcpy_to_i16_from_float(out.data(), floatOut.data(), frameLength * outChannelCount);
 
-    if (ioChannelCount != channelCount) {
-      adjust_channels(out.data(), channelCount, out.data(), ioChannelCount, sizeof(short),
-                      frameLength * channelCount * sizeof(short));
+    if (ioChannelCount != outChannelCount) {
+      adjust_channels(out.data(), outChannelCount, out.data(), ioChannelCount, sizeof(short),
+                      frameLength * outChannelCount * sizeof(short));
     }
     (void)fwrite(out.data(), ioFrameSize, frameLength, outputFp.get());
     frameCounter += frameLength;
diff --git a/media/libeffects/lvm/wrapper/Android.bp b/media/libeffects/lvm/wrapper/Android.bp
index afc4220..f08caec 100644
--- a/media/libeffects/lvm/wrapper/Android.bp
+++ b/media/libeffects/lvm/wrapper/Android.bp
@@ -13,7 +13,6 @@
 
     cppflags: [
         "-fvisibility=hidden",
-        "-DSUPPORT_MC",
 
         "-Wall",
         "-Werror",
diff --git a/media/libeffects/lvm/wrapper/Bundle/EffectBundle.cpp b/media/libeffects/lvm/wrapper/Bundle/EffectBundle.cpp
index 6fca0e7..dac283e 100644
--- a/media/libeffects/lvm/wrapper/Bundle/EffectBundle.cpp
+++ b/media/libeffects/lvm/wrapper/Bundle/EffectBundle.cpp
@@ -136,7 +136,6 @@
 int  LvmBundle_init            (EffectContext *pContext);
 int  LvmEffect_enable          (EffectContext *pContext);
 int  LvmEffect_disable         (EffectContext *pContext);
-void LvmEffect_free            (EffectContext *pContext);
 int  Effect_setConfig          (EffectContext *pContext, effect_config_t *pConfig);
 void Effect_getConfig          (EffectContext *pContext, effect_config_t *pConfig);
 int  BassBoost_setParameter    (EffectContext *pContext,
@@ -433,7 +432,7 @@
         pSessionContext->bBundledEffectsEnabled = LVM_FALSE;
         pSessionContext->pBundledContext = LVM_NULL;
         ALOGV("\tEffectRelease: Freeing LVM Bundle memory\n");
-        LvmEffect_free(pContext);
+        LVM_DelInstanceHandle(&pContext->pBundledContext->hInstance);
         ALOGV("\tEffectRelease: Deleting LVM Bundle context %p\n", pContext->pBundledContext);
         if (pContext->pBundledContext->workBuffer != NULL) {
             free(pContext->pBundledContext->workBuffer);
@@ -529,8 +528,7 @@
     if (pContext->pBundledContext->hInstance != NULL){
         ALOGV("\tLvmBundle_init pContext->pBassBoost != NULL "
                 "-> Calling pContext->pBassBoost->free()");
-
-        LvmEffect_free(pContext);
+        LVM_DelInstanceHandle(&pContext->pBundledContext->hInstance);
 
         ALOGV("\tLvmBundle_init pContext->pBassBoost != NULL "
                 "-> Called pContext->pBassBoost->free()");
@@ -542,8 +540,6 @@
     LVM_EQNB_BandDef_t      BandDefs[MAX_NUM_BANDS];        /* Equaliser band definitions */
     LVM_HeadroomParams_t    HeadroomParams;                 /* Headroom parameters */
     LVM_HeadroomBandDef_t   HeadroomBandDef[LVM_HEADROOM_MAX_NBANDS];
-    LVM_MemTab_t            MemTab;                         /* Memory allocation table */
-    bool                    bMallocFailure = LVM_FALSE;
 
     /* Set the capabilities */
     InstParams.BufferMode       = LVM_UNMANAGED_BUFFERS;
@@ -551,58 +547,7 @@
     InstParams.EQNB_NumBands    = MAX_NUM_BANDS;
     InstParams.PSA_Included     = LVM_PSA_ON;
 
-    /* Allocate memory, forcing alignment */
-    LvmStatus = LVM_GetMemoryTable(LVM_NULL,
-                                  &MemTab,
-                                  &InstParams);
-
-    LVM_ERROR_CHECK(LvmStatus, "LVM_GetMemoryTable", "LvmBundle_init")
-    if(LvmStatus != LVM_SUCCESS) return -EINVAL;
-
-    ALOGV("\tCreateInstance Succesfully called LVM_GetMemoryTable\n");
-
-    /* Allocate memory */
-    for (int i=0; i<LVM_NR_MEMORY_REGIONS; i++){
-        if (MemTab.Region[i].Size != 0){
-            MemTab.Region[i].pBaseAddress = malloc(MemTab.Region[i].Size);
-
-            if (MemTab.Region[i].pBaseAddress == LVM_NULL){
-                ALOGV("\tLVM_ERROR :LvmBundle_init CreateInstance Failed to allocate %" PRIu32
-                        " bytes for region %u\n", MemTab.Region[i].Size, i );
-                bMallocFailure = LVM_TRUE;
-            }else{
-                ALOGV("\tLvmBundle_init CreateInstance allocated %" PRIu32
-                        " bytes for region %u at %p\n",
-                        MemTab.Region[i].Size, i, MemTab.Region[i].pBaseAddress);
-            }
-        }
-    }
-
-    /* If one or more of the memory regions failed to allocate, free the regions that were
-     * succesfully allocated and return with an error
-     */
-    if(bMallocFailure == LVM_TRUE){
-        for (int i=0; i<LVM_NR_MEMORY_REGIONS; i++){
-            if (MemTab.Region[i].pBaseAddress == LVM_NULL){
-                ALOGV("\tLVM_ERROR :LvmBundle_init CreateInstance Failed to allocate %" PRIu32
-                        " bytes for region %u Not freeing\n", MemTab.Region[i].Size, i );
-            }else{
-                ALOGV("\tLVM_ERROR :LvmBundle_init CreateInstance Failed: but allocated %" PRIu32
-                     " bytes for region %u at %p- free\n",
-                     MemTab.Region[i].Size, i, MemTab.Region[i].pBaseAddress);
-                free(MemTab.Region[i].pBaseAddress);
-            }
-        }
-        return -EINVAL;
-    }
-    ALOGV("\tLvmBundle_init CreateInstance Succesfully malloc'd memory\n");
-
-    /* Initialise */
-    pContext->pBundledContext->hInstance = LVM_NULL;
-
-    /* Init sets the instance handle */
     LvmStatus = LVM_GetInstanceHandle(&pContext->pBundledContext->hInstance,
-                                      &MemTab,
                                       &InstParams);
 
     LVM_ERROR_CHECK(LvmStatus, "LVM_GetInstanceHandle", "LvmBundle_init")
@@ -618,9 +563,7 @@
     params.SpeakerType            = LVM_HEADPHONES;
 
     pContext->pBundledContext->SampleRate = LVM_FS_44100;
-#ifdef SUPPORT_MC
     pContext->pBundledContext->ChMask = AUDIO_CHANNEL_OUT_STEREO;
-#endif
 
     /* Concert Sound parameters */
     params.VirtualizerOperatingMode   = LVM_MODE_OFF;
@@ -666,11 +609,9 @@
     params.TE_OperatingMode       = LVM_TE_OFF;
     params.TE_EffectLevel         = 0;
 
-#ifdef SUPPORT_MC
     params.NrChannels             =
         audio_channel_count_from_out_mask(AUDIO_CHANNEL_OUT_STEREO);
     params.ChMask                 = AUDIO_CHANNEL_OUT_STEREO;
-#endif
     /* Activate the initial settings */
     LvmStatus = LVM_SetControlParameters(pContext->pBundledContext->hInstance,
                                          &params);
@@ -1030,41 +971,6 @@
     return 0;
 }
 
-//----------------------------------------------------------------------------
-// LvmEffect_free()
-//----------------------------------------------------------------------------
-// Purpose: Free all memory associated with the Bundle.
-//
-// Inputs:
-//  pContext:   effect engine context
-//
-// Outputs:
-//
-//----------------------------------------------------------------------------
-
-void LvmEffect_free(EffectContext *pContext){
-    LVM_ReturnStatus_en     LvmStatus=LVM_SUCCESS;         /* Function call status */
-    LVM_MemTab_t            MemTab;
-
-    /* Free the algorithm memory */
-    LvmStatus = LVM_GetMemoryTable(pContext->pBundledContext->hInstance,
-                                   &MemTab,
-                                   LVM_NULL);
-
-    LVM_ERROR_CHECK(LvmStatus, "LVM_GetMemoryTable", "LvmEffect_free")
-
-    for (int i=0; i<LVM_NR_MEMORY_REGIONS; i++){
-        if (MemTab.Region[i].Size != 0){
-            if (MemTab.Region[i].pBaseAddress != NULL){
-                free(MemTab.Region[i].pBaseAddress);
-            }else{
-                ALOGV("\tLVM_ERROR : LvmEffect_free - trying to free with NULL pointer %" PRIu32
-                        " bytes for region %u at %p ERROR\n",
-                        MemTab.Region[i].Size, i, MemTab.Region[i].pBaseAddress);
-            }
-        }
-    }
-}    /* end LvmEffect_free */
 
 //----------------------------------------------------------------------------
 // Effect_setConfig()
@@ -1090,11 +996,7 @@
     CHECK_ARG(pConfig->inputCfg.samplingRate == pConfig->outputCfg.samplingRate);
     CHECK_ARG(pConfig->inputCfg.channels == pConfig->outputCfg.channels);
     CHECK_ARG(pConfig->inputCfg.format == pConfig->outputCfg.format);
-#ifdef SUPPORT_MC
     CHECK_ARG(audio_channel_count_from_out_mask(pConfig->inputCfg.channels) <= LVM_MAX_CHANNELS);
-#else
-    CHECK_ARG(pConfig->inputCfg.channels == AUDIO_CHANNEL_OUT_STEREO);
-#endif
     CHECK_ARG(pConfig->outputCfg.accessMode == EFFECT_BUFFER_ACCESS_WRITE
               || pConfig->outputCfg.accessMode == EFFECT_BUFFER_ACCESS_ACCUMULATE);
     CHECK_ARG(pConfig->inputCfg.format == EFFECT_BUFFER_FORMAT);
@@ -1147,12 +1049,8 @@
         return -EINVAL;
     }
 
-#ifdef SUPPORT_MC
     if (pContext->pBundledContext->SampleRate != SampleRate ||
         pContext->pBundledContext->ChMask != pConfig->inputCfg.channels) {
-#else
-    if(pContext->pBundledContext->SampleRate != SampleRate){
-#endif
 
         LVM_ControlParams_t     ActiveParams;
         LVM_ReturnStatus_en     LvmStatus = LVM_SUCCESS;
@@ -1168,19 +1066,15 @@
 
         ActiveParams.SampleRate = SampleRate;
 
-#ifdef SUPPORT_MC
         ActiveParams.NrChannels = NrChannels;
         ActiveParams.ChMask = pConfig->inputCfg.channels;
-#endif
 
         LvmStatus = LVM_SetControlParameters(pContext->pBundledContext->hInstance, &ActiveParams);
 
         LVM_ERROR_CHECK(LvmStatus, "LVM_SetControlParameters", "Effect_setConfig")
         ALOGV("\tEffect_setConfig Succesfully called LVM_SetControlParameters\n");
         pContext->pBundledContext->SampleRate = SampleRate;
-#ifdef SUPPORT_MC
         pContext->pBundledContext->ChMask = pConfig->inputCfg.channels;
-#endif
 
         LvmEffect_limitLevel(pContext);
 
diff --git a/media/libeffects/lvm/wrapper/Bundle/EffectBundle.h b/media/libeffects/lvm/wrapper/Bundle/EffectBundle.h
index 524e103..63bc45c 100644
--- a/media/libeffects/lvm/wrapper/Bundle/EffectBundle.h
+++ b/media/libeffects/lvm/wrapper/Bundle/EffectBundle.h
@@ -94,9 +94,7 @@
     int                             frameCount;
     int32_t                         bandGaindB[FIVEBAND_NUMBANDS];
     int                             volume;
-#ifdef SUPPORT_MC
     LVM_INT32                       ChMask;
-#endif
 
     /* Bitmask whether drain is in progress due to disabling the effect.
        The corresponding bit to an effect is set by 1 << lvm_effect_en. */
diff --git a/media/libeffects/lvm/wrapper/Reverb/EffectReverb.cpp b/media/libeffects/lvm/wrapper/Reverb/EffectReverb.cpp
index 39f5bb6..4411a7d 100644
--- a/media/libeffects/lvm/wrapper/Reverb/EffectReverb.cpp
+++ b/media/libeffects/lvm/wrapper/Reverb/EffectReverb.cpp
@@ -259,6 +259,7 @@
 
     int channels = audio_channel_count_from_out_mask(pContext->config.inputCfg.channels);
 
+    channels = (pContext->auxiliary == true)? channels : FCC_2;
     // Allocate memory for reverb process (*2 is for STEREO)
     pContext->bufferSizeIn = LVREV_MAX_FRAME_SIZE * sizeof(process_buffer_t) * channels;
     pContext->bufferSizeOut = LVREV_MAX_FRAME_SIZE * sizeof(process_buffer_t) * FCC_2;
@@ -343,9 +344,9 @@
     int channels = audio_channel_count_from_out_mask(pContext->config.inputCfg.channels);
     LVREV_ReturnStatus_en   LvmStatus = LVREV_SUCCESS;              /* Function call status */
 
-    // Check that the input is either mono or stereo
-    if (!(channels == 1 || channels == FCC_2) ) {
-        ALOGE("\tLVREV_ERROR : process invalid PCM format");
+    // Reverb only effects the stereo channels in multichannel source.
+    if (channels < 1 || channels > LVM_MAX_CHANNELS) {
+        ALOGE("\tLVREV_ERROR : process invalid PCM channels %d", channels);
         return -EINVAL;
     }
 
@@ -380,11 +381,20 @@
         static_assert(std::is_same<decltype(*pIn), decltype(*pContext->InFrames)>::value,
                 "pIn and InFrames must be same type");
         memcpy(pContext->InFrames, pIn, frameCount * channels * sizeof(*pIn));
+    } else {
+        // mono input is duplicated
+        if (channels >= FCC_2) {
+            for (int i = 0; i < frameCount; i++) {
+                pContext->InFrames[FCC_2 * i] =
+                            (process_buffer_t)pIn[channels * i] * REVERB_SEND_LEVEL;
+                pContext->InFrames[FCC_2 * i + 1] =
+                            (process_buffer_t)pIn[channels * i + 1] * REVERB_SEND_LEVEL;
+            }
         } else {
-        // insert reverb input is always stereo
-        for (int i = 0; i < frameCount; i++) {
-            pContext->InFrames[2 * i] = (process_buffer_t)pIn[2 * i] * REVERB_SEND_LEVEL;
-            pContext->InFrames[2 * i + 1] = (process_buffer_t)pIn[2 * i + 1] * REVERB_SEND_LEVEL;
+            for (int i = 0; i < frameCount; i++) {
+                pContext->InFrames[FCC_2 * i] = pContext->InFrames[FCC_2 * i + 1] =
+                            (process_buffer_t)pIn[i] * REVERB_SEND_LEVEL;
+            }
         }
     }
 
@@ -412,9 +422,18 @@
     if (pContext->auxiliary) {
         // nothing to do here
     } else {
-        for (int i = 0; i < frameCount * FCC_2; i++) { // always stereo here
-            // Mix with dry input
-            pContext->OutFrames[i] += pIn[i];
+        if (channels >= FCC_2) {
+            for (int i = 0; i < frameCount; i++) {
+                // Mix with dry input
+                pContext->OutFrames[FCC_2 * i] += pIn[channels * i];
+                pContext->OutFrames[FCC_2 * i + 1] += pIn[channels * i + 1];
+            }
+        } else {
+            for (int i = 0; i < frameCount; i++) {
+                // Mix with dry input
+                pContext->OutFrames[FCC_2 * i] += pIn[i];
+                pContext->OutFrames[FCC_2 * i + 1] += pIn[i];
+            }
         }
         // apply volume with ramp if needed
         if ((pContext->leftVolume != pContext->prevLeftVolume ||
@@ -450,18 +469,33 @@
         }
     }
 
-
-    // Accumulate if required
-    if (pContext->config.outputCfg.accessMode == EFFECT_BUFFER_ACCESS_ACCUMULATE){
-        //ALOGV("\tBuffer access is ACCUMULATE");
-        for (int i = 0; i < frameCount * FCC_2; i++) { // always stereo here
-            pOut[i] += pContext->OutFrames[i];
+    if (channels > 2) {
+        //Accumulate if required
+        if (pContext->config.outputCfg.accessMode == EFFECT_BUFFER_ACCESS_ACCUMULATE) {
+            for (int i = 0; i < frameCount; i++) {
+                pOut[channels * i] += pContext->OutFrames[FCC_2 * i];
+                pOut[channels * i + 1] += pContext->OutFrames[FCC_2 * i + 1];
+            }
+        } else {
+            for (int i = 0; i < frameCount; i++) {
+                pOut[channels * i] = pContext->OutFrames[FCC_2 * i];
+                pOut[channels * i + 1] = pContext->OutFrames[FCC_2 * i + 1];
+            }
         }
-    }else{
-        //ALOGV("\tBuffer access is WRITE");
-        memcpy(pOut, pContext->OutFrames, frameCount * sizeof(*pOut) * FCC_2);
+        for (int i = 0; i < frameCount; i++) {
+            for (int j = FCC_2; j < channels; j++) {
+                pOut[channels * i + j] = pIn[channels * i + j];
+            }
+        }
+    } else {
+        if (pContext->config.outputCfg.accessMode == EFFECT_BUFFER_ACCESS_ACCUMULATE) {
+            for (int i = 0; i < frameCount * FCC_2; i++) {
+                pOut[i] += pContext->OutFrames[i];
+            }
+        } else {
+            memcpy(pOut, pContext->OutFrames, frameCount * sizeof(*pOut) * FCC_2);
+        }
     }
-
     return 0;
 }    /* end process */
 
@@ -525,9 +559,12 @@
 
     CHECK_ARG(pConfig->inputCfg.samplingRate == pConfig->outputCfg.samplingRate);
     CHECK_ARG(pConfig->inputCfg.format == pConfig->outputCfg.format);
+    int inputChannels = audio_channel_count_from_out_mask(pConfig->inputCfg.channels);
     CHECK_ARG((pContext->auxiliary && pConfig->inputCfg.channels == AUDIO_CHANNEL_OUT_MONO) ||
-              ((!pContext->auxiliary) && pConfig->inputCfg.channels == AUDIO_CHANNEL_OUT_STEREO));
-    CHECK_ARG(pConfig->outputCfg.channels == AUDIO_CHANNEL_OUT_STEREO);
+              ((!pContext->auxiliary) &&
+              (inputChannels <= LVM_MAX_CHANNELS)));
+    int outputChannels = audio_channel_count_from_out_mask(pConfig->outputCfg.channels);
+    CHECK_ARG(outputChannels >= FCC_2 && outputChannels <= LVM_MAX_CHANNELS);
     CHECK_ARG(pConfig->outputCfg.accessMode == EFFECT_BUFFER_ACCESS_WRITE
               || pConfig->outputCfg.accessMode == EFFECT_BUFFER_ACCESS_ACCUMULATE);
     CHECK_ARG(pConfig->inputCfg.format == EFFECT_BUFFER_FORMAT);
@@ -691,7 +728,7 @@
     /* Allocate memory */
     for (int i=0; i<LVM_NR_MEMORY_REGIONS; i++){
         if (MemTab.Region[i].Size != 0){
-            MemTab.Region[i].pBaseAddress = malloc(MemTab.Region[i].Size);
+            MemTab.Region[i].pBaseAddress = calloc(1, MemTab.Region[i].Size);
 
             if (MemTab.Region[i].pBaseAddress == LVM_NULL){
                 ALOGV("\tLVREV_ERROR :Reverb_init CreateInstance Failed to allocate %" PRIu32
@@ -749,6 +786,9 @@
         params.SourceFormat   = LVM_STEREO;
     }
 
+    if ((pContext->auxiliary == false) && (params.SourceFormat == LVM_MONO)) {
+        params.SourceFormat   = LVM_STEREO;
+    }
     /* Reverb parameters */
     params.Level          = 0;
     params.LPF            = 23999;
diff --git a/media/libmedia/Android.bp b/media/libmedia/Android.bp
index 1caee04..39523de 100644
--- a/media/libmedia/Android.bp
+++ b/media/libmedia/Android.bp
@@ -49,28 +49,6 @@
     path: "aidl",
 }
 
-filegroup {
-    name: "resourcemanager_aidl",
-    srcs: [
-        "aidl/android/media/IResourceManagerClient.aidl",
-        "aidl/android/media/IResourceManagerService.aidl",
-        "aidl/android/media/MediaResourceType.aidl",
-        "aidl/android/media/MediaResourceSubType.aidl",
-        "aidl/android/media/MediaResourceParcel.aidl",
-        "aidl/android/media/MediaResourcePolicyParcel.aidl",
-    ],
-    path: "aidl",
-}
-
-aidl_interface {
-    name: "resourcemanager_aidl_interface",
-    unstable: true,
-    local_include_dir: "aidl",
-    srcs: [
-        ":resourcemanager_aidl",
-    ],
-}
-
 cc_library_shared {
     name: "libmedia_omx",
     vendor_available: true,
diff --git a/media/libmedia/IMediaPlayerService.cpp b/media/libmedia/IMediaPlayerService.cpp
index bd18a40..11005c6 100644
--- a/media/libmedia/IMediaPlayerService.cpp
+++ b/media/libmedia/IMediaPlayerService.cpp
@@ -62,11 +62,13 @@
     }
 
     virtual sp<IMediaPlayer> create(
-            const sp<IMediaPlayerClient>& client, audio_session_t audioSessionId) {
+            const sp<IMediaPlayerClient>& client, audio_session_t audioSessionId,
+            const std::string opPackageName) {
         Parcel data, reply;
         data.writeInterfaceToken(IMediaPlayerService::getInterfaceDescriptor());
         data.writeStrongBinder(IInterface::asBinder(client));
         data.writeInt32(audioSessionId);
+        data.writeCString(opPackageName.c_str());
 
         remote()->transact(CREATE, data, &reply);
         return interface_cast<IMediaPlayer>(reply.readStrongBinder());
@@ -127,7 +129,12 @@
             sp<IMediaPlayerClient> client =
                 interface_cast<IMediaPlayerClient>(data.readStrongBinder());
             audio_session_t audioSessionId = (audio_session_t) data.readInt32();
-            sp<IMediaPlayer> player = create(client, audioSessionId);
+            const char* opPackageName = data.readCString();
+            if (opPackageName == nullptr) {
+                return FAILED_TRANSACTION;
+            }
+            std::string opPackageNameStr(opPackageName);
+            sp<IMediaPlayer> player = create(client, audioSessionId, opPackageNameStr);
             reply->writeStrongBinder(IInterface::asBinder(player));
             return NO_ERROR;
         } break;
diff --git a/media/libmedia/MediaProfiles.cpp b/media/libmedia/MediaProfiles.cpp
index 1be82d8..e8839ba 100644
--- a/media/libmedia/MediaProfiles.cpp
+++ b/media/libmedia/MediaProfiles.cpp
@@ -240,7 +240,10 @@
 
     const size_t nMappings = sizeof(sVideoEncoderNameMap)/sizeof(sVideoEncoderNameMap[0]);
     const int codec = findTagForName(sVideoEncoderNameMap, nMappings, atts[1]);
-    CHECK(codec != -1);
+    if (codec == -1) {
+      ALOGE("MediaProfiles::createVideoCodec failed to locate codec %s", atts[1]);
+      return nullptr;
+    }
 
     MediaProfiles::VideoCodec *videoCodec =
         new MediaProfiles::VideoCodec(static_cast<video_encoder>(codec),
@@ -262,7 +265,10 @@
           !strcmp("channels",   atts[6]));
     const size_t nMappings = sizeof(sAudioEncoderNameMap)/sizeof(sAudioEncoderNameMap[0]);
     const int codec = findTagForName(sAudioEncoderNameMap, nMappings, atts[1]);
-    CHECK(codec != -1);
+    if (codec == -1) {
+      ALOGE("MediaProfiles::createAudioCodec failed to locate codec %s", atts[1]);
+      return nullptr;
+    }
 
     MediaProfiles::AudioCodec *audioCodec =
         new MediaProfiles::AudioCodec(static_cast<audio_encoder>(codec),
@@ -282,7 +288,10 @@
 
     const size_t nMappings = sizeof(sAudioDecoderNameMap)/sizeof(sAudioDecoderNameMap[0]);
     const int codec = findTagForName(sAudioDecoderNameMap, nMappings, atts[1]);
-    CHECK(codec != -1);
+    if (codec == -1) {
+      ALOGE("MediaProfiles::createAudioDecoderCap failed to locate codec %s", atts[1]);
+      return nullptr;
+    }
 
     MediaProfiles::AudioDecoderCap *cap =
         new MediaProfiles::AudioDecoderCap(static_cast<audio_decoder>(codec));
@@ -298,7 +307,10 @@
 
     const size_t nMappings = sizeof(sVideoDecoderNameMap)/sizeof(sVideoDecoderNameMap[0]);
     const int codec = findTagForName(sVideoDecoderNameMap, nMappings, atts[1]);
-    CHECK(codec != -1);
+    if (codec == -1) {
+      ALOGE("MediaProfiles::createVideoDecoderCap failed to locate codec %s", atts[1]);
+      return nullptr;
+    }
 
     MediaProfiles::VideoDecoderCap *cap =
         new MediaProfiles::VideoDecoderCap(static_cast<video_decoder>(codec));
@@ -322,7 +334,10 @@
 
     const size_t nMappings = sizeof(sVideoEncoderNameMap)/sizeof(sVideoEncoderNameMap[0]);
     const int codec = findTagForName(sVideoEncoderNameMap, nMappings, atts[1]);
-    CHECK(codec != -1);
+    if (codec == -1) {
+      ALOGE("MediaProfiles::createVideoEncoderCap failed to locate codec %s", atts[1]);
+      return nullptr;
+    }
 
     MediaProfiles::VideoEncoderCap *cap =
         new MediaProfiles::VideoEncoderCap(static_cast<video_encoder>(codec),
@@ -346,7 +361,10 @@
 
     const size_t nMappings = sizeof(sAudioEncoderNameMap)/sizeof(sAudioEncoderNameMap[0]);
     const int codec = findTagForName(sAudioEncoderNameMap, nMappings, atts[1]);
-    CHECK(codec != -1);
+    if (codec == -1) {
+      ALOGE("MediaProfiles::createAudioEncoderCap failed to locate codec %s", atts[1]);
+      return nullptr;
+    }
 
     MediaProfiles::AudioEncoderCap *cap =
         new MediaProfiles::AudioEncoderCap(static_cast<audio_encoder>(codec), atoi(atts[5]),
@@ -386,11 +404,17 @@
     const size_t nProfileMappings = sizeof(sCamcorderQualityNameMap)/
             sizeof(sCamcorderQualityNameMap[0]);
     const int quality = findTagForName(sCamcorderQualityNameMap, nProfileMappings, atts[1]);
-    CHECK(quality != -1);
+    if (quality == -1) {
+      ALOGE("MediaProfiles::createCamcorderProfile failed to locate quality %s", atts[1]);
+      return nullptr;
+    }
 
     const size_t nFormatMappings = sizeof(sFileFormatMap)/sizeof(sFileFormatMap[0]);
     const int fileFormat = findTagForName(sFileFormatMap, nFormatMappings, atts[3]);
-    CHECK(fileFormat != -1);
+    if (fileFormat == -1) {
+      ALOGE("MediaProfiles::createCamcorderProfile failed to locate file format %s", atts[1]);
+      return nullptr;
+    }
 
     MediaProfiles::CamcorderProfile *profile = new MediaProfiles::CamcorderProfile;
     profile->mCameraId = cameraId;
@@ -462,24 +486,39 @@
         createAudioCodec(atts, profiles);
     } else if (strcmp("VideoEncoderCap", name) == 0 &&
                strcmp("true", atts[3]) == 0) {
-        profiles->mVideoEncoders.add(createVideoEncoderCap(atts));
+        MediaProfiles::VideoEncoderCap* cap = createVideoEncoderCap(atts);
+        if (cap != nullptr) {
+          profiles->mVideoEncoders.add(cap);
+        }
     } else if (strcmp("AudioEncoderCap", name) == 0 &&
                strcmp("true", atts[3]) == 0) {
-        profiles->mAudioEncoders.add(createAudioEncoderCap(atts));
+        MediaProfiles::AudioEncoderCap* cap = createAudioEncoderCap(atts);
+        if (cap != nullptr) {
+          profiles->mAudioEncoders.add(cap);
+        }
     } else if (strcmp("VideoDecoderCap", name) == 0 &&
                strcmp("true", atts[3]) == 0) {
-        profiles->mVideoDecoders.add(createVideoDecoderCap(atts));
+        MediaProfiles::VideoDecoderCap* cap = createVideoDecoderCap(atts);
+        if (cap != nullptr) {
+          profiles->mVideoDecoders.add(cap);
+        }
     } else if (strcmp("AudioDecoderCap", name) == 0 &&
                strcmp("true", atts[3]) == 0) {
-        profiles->mAudioDecoders.add(createAudioDecoderCap(atts));
+        MediaProfiles::AudioDecoderCap* cap = createAudioDecoderCap(atts);
+        if (cap != nullptr) {
+          profiles->mAudioDecoders.add(cap);
+        }
     } else if (strcmp("EncoderOutputFileFormat", name) == 0) {
         profiles->mEncoderOutputFileFormats.add(createEncoderOutputFileFormat(atts));
     } else if (strcmp("CamcorderProfiles", name) == 0) {
         profiles->mCurrentCameraId = getCameraId(atts);
         profiles->addStartTimeOffset(profiles->mCurrentCameraId, atts);
     } else if (strcmp("EncoderProfile", name) == 0) {
-        profiles->mCamcorderProfiles.add(
-            createCamcorderProfile(profiles->mCurrentCameraId, atts, profiles->mCameraIds));
+      MediaProfiles::CamcorderProfile* profile = createCamcorderProfile(
+          profiles->mCurrentCameraId, atts, profiles->mCameraIds);
+      if (profile != nullptr) {
+        profiles->mCamcorderProfiles.add(profile);
+      }
     } else if (strcmp("ImageEncoding", name) == 0) {
         profiles->addImageEncodingQualityLevel(profiles->mCurrentCameraId, atts);
     }
diff --git a/media/libmedia/MediaResource.cpp b/media/libmedia/MediaResource.cpp
index fe86d27..ec52a49 100644
--- a/media/libmedia/MediaResource.cpp
+++ b/media/libmedia/MediaResource.cpp
@@ -43,11 +43,11 @@
 }
 
 //static
-MediaResource MediaResource::CodecResource(bool secure, bool video) {
+MediaResource MediaResource::CodecResource(bool secure, bool video, int64_t instanceCount) {
     return MediaResource(
             secure ? Type::kSecureCodec : Type::kNonSecureCodec,
             video ? SubType::kVideoCodec : SubType::kAudioCodec,
-            1);
+            instanceCount);
 }
 
 //static
diff --git a/media/libmedia/include/media/IMediaPlayerService.h b/media/libmedia/include/media/IMediaPlayerService.h
index f2e2060..a4207eb 100644
--- a/media/libmedia/include/media/IMediaPlayerService.h
+++ b/media/libmedia/include/media/IMediaPlayerService.h
@@ -28,6 +28,8 @@
 #include <media/IMediaPlayerClient.h>
 #include <media/IMediaMetadataRetriever.h>
 
+#include <string>
+
 namespace android {
 
 class IMediaPlayer;
@@ -47,7 +49,8 @@
     virtual sp<IMediaRecorder> createMediaRecorder(const String16 &opPackageName) = 0;
     virtual sp<IMediaMetadataRetriever> createMetadataRetriever() = 0;
     virtual sp<IMediaPlayer> create(const sp<IMediaPlayerClient>& client,
-            audio_session_t audioSessionId = AUDIO_SESSION_ALLOCATE) = 0;
+            audio_session_t audioSessionId = AUDIO_SESSION_ALLOCATE,
+            const std::string opPackage = "") = 0;
     virtual sp<IMediaCodecList> getCodecList() const = 0;
 
     // Connects to a remote display.
diff --git a/media/libmedia/include/media/MediaResource.h b/media/libmedia/include/media/MediaResource.h
index 4927d28..4712528 100644
--- a/media/libmedia/include/media/MediaResource.h
+++ b/media/libmedia/include/media/MediaResource.h
@@ -37,7 +37,7 @@
     MediaResource(Type type, SubType subType, int64_t value);
     MediaResource(Type type, const std::vector<uint8_t> &id, int64_t value);
 
-    static MediaResource CodecResource(bool secure, bool video);
+    static MediaResource CodecResource(bool secure, bool video, int64_t instanceCount = 1);
     static MediaResource GraphicMemoryResource(int64_t value);
     static MediaResource CpuBoostResource();
     static MediaResource VideoBatteryResource();
diff --git a/media/libmedia/include/media/mediaplayer.h b/media/libmedia/include/media/mediaplayer.h
index 0073375..71c0bc5 100644
--- a/media/libmedia/include/media/mediaplayer.h
+++ b/media/libmedia/include/media/mediaplayer.h
@@ -33,6 +33,8 @@
 #include <utils/KeyedVector.h>
 #include <utils/String8.h>
 
+#include <string>
+
 struct ANativeWindow;
 
 namespace android {
@@ -209,7 +211,7 @@
                     public virtual IMediaDeathNotifier
 {
 public:
-    MediaPlayer();
+    MediaPlayer(const std::string opPackageName = "");
     ~MediaPlayer();
             void            died();
             void            disconnect();
@@ -313,6 +315,7 @@
     float                       mSendLevel;
     struct sockaddr_in          mRetransmitEndpoint;
     bool                        mRetransmitEndpointValid;
+    const std::string           mOpPackageName;
 };
 
 }; // namespace android
diff --git a/media/libmedia/mediaplayer.cpp b/media/libmedia/mediaplayer.cpp
index 1b89fc7..30c5006 100644
--- a/media/libmedia/mediaplayer.cpp
+++ b/media/libmedia/mediaplayer.cpp
@@ -41,7 +41,7 @@
 
 using media::VolumeShaper;
 
-MediaPlayer::MediaPlayer()
+MediaPlayer::MediaPlayer(const std::string opPackageName) : mOpPackageName(opPackageName)
 {
     ALOGV("constructor");
     mListener = NULL;
@@ -152,7 +152,7 @@
     if (url != NULL) {
         const sp<IMediaPlayerService> service(getMediaPlayerService());
         if (service != 0) {
-            sp<IMediaPlayer> player(service->create(this, mAudioSessionId));
+            sp<IMediaPlayer> player(service->create(this, mAudioSessionId, mOpPackageName));
             if ((NO_ERROR != doSetRetransmitEndpoint(player)) ||
                 (NO_ERROR != player->setDataSource(httpService, url, headers))) {
                 player.clear();
@@ -169,7 +169,7 @@
     status_t err = UNKNOWN_ERROR;
     const sp<IMediaPlayerService> service(getMediaPlayerService());
     if (service != 0) {
-        sp<IMediaPlayer> player(service->create(this, mAudioSessionId));
+        sp<IMediaPlayer> player(service->create(this, mAudioSessionId, mOpPackageName));
         if ((NO_ERROR != doSetRetransmitEndpoint(player)) ||
             (NO_ERROR != player->setDataSource(fd, offset, length))) {
             player.clear();
@@ -185,7 +185,7 @@
     status_t err = UNKNOWN_ERROR;
     const sp<IMediaPlayerService> service(getMediaPlayerService());
     if (service != 0) {
-        sp<IMediaPlayer> player(service->create(this, mAudioSessionId));
+        sp<IMediaPlayer> player(service->create(this, mAudioSessionId, mOpPackageName));
         if ((NO_ERROR != doSetRetransmitEndpoint(player)) ||
             (NO_ERROR != player->setDataSource(source))) {
             player.clear();
@@ -201,7 +201,7 @@
     status_t err = UNKNOWN_ERROR;
     const sp<IMediaPlayerService> service(getMediaPlayerService());
     if (service != 0) {
-        sp<IMediaPlayer> player(service->create(this, mAudioSessionId));
+        sp<IMediaPlayer> player(service->create(this, mAudioSessionId, mOpPackageName));
         if ((NO_ERROR != doSetRetransmitEndpoint(player)) ||
             (NO_ERROR != player->setDataSource(rtpParams))) {
             player.clear();
diff --git a/media/libmediaplayerservice/MediaPlayerService.cpp b/media/libmediaplayerservice/MediaPlayerService.cpp
index 555f459..4d90d98 100644
--- a/media/libmediaplayerservice/MediaPlayerService.cpp
+++ b/media/libmediaplayerservice/MediaPlayerService.cpp
@@ -480,14 +480,14 @@
 }
 
 sp<IMediaPlayer> MediaPlayerService::create(const sp<IMediaPlayerClient>& client,
-        audio_session_t audioSessionId)
+        audio_session_t audioSessionId, std::string opPackageName)
 {
     pid_t pid = IPCThreadState::self()->getCallingPid();
     int32_t connId = android_atomic_inc(&mNextConnId);
 
     sp<Client> c = new Client(
             this, pid, connId, client, audioSessionId,
-            IPCThreadState::self()->getCallingUid());
+            IPCThreadState::self()->getCallingUid(), opPackageName);
 
     ALOGV("Create new client(%d) from pid %d, uid %d, ", connId, pid,
          IPCThreadState::self()->getCallingUid());
@@ -733,7 +733,8 @@
 MediaPlayerService::Client::Client(
         const sp<MediaPlayerService>& service, pid_t pid,
         int32_t connId, const sp<IMediaPlayerClient>& client,
-        audio_session_t audioSessionId, uid_t uid)
+        audio_session_t audioSessionId, uid_t uid, const std::string& opPackageName)
+        : mOpPackageName(opPackageName)
 {
     ALOGV("Client(%d) constructor", connId);
     mPid = pid;
@@ -922,7 +923,7 @@
 
     if (!p->hardwareOutput()) {
         mAudioOutput = new AudioOutput(mAudioSessionId, IPCThreadState::self()->getCallingUid(),
-                mPid, mAudioAttributes, mAudioDeviceUpdatedListener);
+                mPid, mAudioAttributes, mAudioDeviceUpdatedListener, mOpPackageName);
         static_cast<MediaPlayerInterface*>(p.get())->setAudioSink(mAudioOutput);
     }
 
@@ -1772,7 +1773,8 @@
 #undef LOG_TAG
 #define LOG_TAG "AudioSink"
 MediaPlayerService::AudioOutput::AudioOutput(audio_session_t sessionId, uid_t uid, int pid,
-        const audio_attributes_t* attr, const sp<AudioSystem::AudioDeviceCallback>& deviceCallback)
+        const audio_attributes_t* attr, const sp<AudioSystem::AudioDeviceCallback>& deviceCallback,
+        const std::string& opPackageName)
     : mCallback(NULL),
       mCallbackCookie(NULL),
       mCallbackData(NULL),
@@ -1793,7 +1795,8 @@
       mSelectedDeviceId(AUDIO_PORT_HANDLE_NONE),
       mRoutedDeviceId(AUDIO_PORT_HANDLE_NONE),
       mDeviceCallbackEnabled(false),
-      mDeviceCallback(deviceCallback)
+      mDeviceCallback(deviceCallback),
+      mOpPackageName(opPackageName)
 {
     ALOGV("AudioOutput(%d)", sessionId);
     if (attr != NULL) {
@@ -2187,7 +2190,8 @@
                     mAttributes,
                     doNotReconnect,
                     1.0f,  // default value for maxRequiredSpeed
-                    mSelectedDeviceId);
+                    mSelectedDeviceId,
+                    mOpPackageName);
         } else {
             // TODO: Due to buffer memory concerns, we use a max target playback speed
             // based on mPlaybackRate at the time of open (instead of kMaxRequiredSpeed),
@@ -2215,7 +2219,8 @@
                     mAttributes,
                     doNotReconnect,
                     targetSpeed,
-                    mSelectedDeviceId);
+                    mSelectedDeviceId,
+                    mOpPackageName);
         }
         // Set caller name so it can be logged in destructor.
         // MediaMetricsConstants.h: AMEDIAMETRICS_PROP_CALLERNAME_VALUE_MEDIA
diff --git a/media/libmediaplayerservice/MediaPlayerService.h b/media/libmediaplayerservice/MediaPlayerService.h
index 3d596a5..b2f1b9b 100644
--- a/media/libmediaplayerservice/MediaPlayerService.h
+++ b/media/libmediaplayerservice/MediaPlayerService.h
@@ -19,6 +19,7 @@
 #define ANDROID_MEDIAPLAYERSERVICE_H
 
 #include <arpa/inet.h>
+#include <string>
 
 #include <utils/threads.h>
 #include <utils/Errors.h>
@@ -81,7 +82,8 @@
                                         uid_t uid,
                                         int pid,
                                         const audio_attributes_t * attr,
-                                        const sp<AudioSystem::AudioDeviceCallback>& deviceCallback);
+                                        const sp<AudioSystem::AudioDeviceCallback>& deviceCallback,
+                                        const std::string& opPackageName);
         virtual                 ~AudioOutput();
 
         virtual bool            ready() const { return mTrack != 0; }
@@ -178,6 +180,7 @@
         bool                    mDeviceCallbackEnabled;
         wp<AudioSystem::AudioDeviceCallback>        mDeviceCallback;
         mutable Mutex           mLock;
+        const std::string       mOpPackageName;
 
         // static variables below not protected by mutex
         static bool             mIsOnEmulator;
@@ -235,7 +238,8 @@
     virtual sp<IMediaMetadataRetriever> createMetadataRetriever();
 
     virtual sp<IMediaPlayer>    create(const sp<IMediaPlayerClient>& client,
-                                       audio_session_t audioSessionId);
+                                       audio_session_t audioSessionId,
+                                       const std::string opPackageName);
 
     virtual sp<IMediaCodecList> getCodecList() const;
 
@@ -411,7 +415,8 @@
                                         int32_t connId,
                                         const sp<IMediaPlayerClient>& client,
                                         audio_session_t audioSessionId,
-                                        uid_t uid);
+                                        uid_t uid,
+                                        const std::string& opPackageName);
                                 Client();
         virtual                 ~Client();
 
@@ -468,6 +473,7 @@
                     bool                          mRetransmitEndpointValid;
                     sp<Client>                    mNextClient;
                     sp<MediaPlayerBase::Listener> mListener;
+                    const std::string             mOpPackageName;
 
         // Metadata filters.
         media::Metadata::Filter mMetadataAllow;  // protected by mLock
diff --git a/media/libmediaplayerservice/MediaRecorderClient.cpp b/media/libmediaplayerservice/MediaRecorderClient.cpp
index 9b1974b..1cc255d 100644
--- a/media/libmediaplayerservice/MediaRecorderClient.cpp
+++ b/media/libmediaplayerservice/MediaRecorderClient.cpp
@@ -28,6 +28,7 @@
 #include <binder/IServiceManager.h>
 #include <binder/MemoryHeapBase.h>
 #include <binder/MemoryBase.h>
+#include <camera/CameraUtils.h>
 #include <codec2/hidl/client.h>
 #include <cutils/atomic.h>
 #include <cutils/properties.h> // for property_get
@@ -423,30 +424,35 @@
 
     sp<IServiceManager> sm = defaultServiceManager();
 
-    // WORKAROUND: We don't know if camera exists here and getService might block for 5 seconds.
-    // Use checkService for camera if we don't know it exists.
-    static std::atomic<bool> sCameraChecked(false);  // once true never becomes false.
-    static std::atomic<bool> sCameraVerified(false); // once true never becomes false.
-    sp<IBinder> binder = (sCameraVerified || !sCameraChecked)
-        ? sm->getService(String16("media.camera")) : sm->checkService(String16("media.camera"));
-    // If the device does not have a camera, do not create a death listener for it.
-    if (binder != NULL) {
-        sCameraVerified = true;
-        mDeathNotifiers.emplace_back(
-                binder, [l = wp<IMediaRecorderClient>(listener)](){
-            sp<IMediaRecorderClient> listener = l.promote();
-            if (listener) {
-                ALOGV("media.camera service died. "
-                      "Sending death notification.");
-                listener->notify(
-                        MEDIA_ERROR, MEDIA_ERROR_SERVER_DIED,
-                        MediaPlayerService::CAMERA_PROCESS_DEATH);
-            } else {
-                ALOGW("media.camera service died without a death handler.");
-            }
-        });
+    static const bool sCameraDisabled = CameraUtils::isCameraServiceDisabled();
+
+    if (!sCameraDisabled) {
+        // WORKAROUND: We don't know if camera exists here and getService might block for 5 seconds.
+        // Use checkService for camera if we don't know it exists.
+        static std::atomic<bool> sCameraChecked(false);  // once true never becomes false.
+        static std::atomic<bool> sCameraVerified(false); // once true never becomes false.
+
+        sp<IBinder> binder = (sCameraVerified || !sCameraChecked)
+            ? sm->getService(String16("media.camera")) : sm->checkService(String16("media.camera"));
+        // If the device does not have a camera, do not create a death listener for it.
+        if (binder != NULL) {
+            sCameraVerified = true;
+            mDeathNotifiers.emplace_back(
+                    binder, [l = wp<IMediaRecorderClient>(listener)](){
+                sp<IMediaRecorderClient> listener = l.promote();
+                if (listener) {
+                    ALOGV("media.camera service died. "
+                          "Sending death notification.");
+                    listener->notify(
+                            MEDIA_ERROR, MEDIA_ERROR_SERVER_DIED,
+                            MediaPlayerService::CAMERA_PROCESS_DEATH);
+                } else {
+                    ALOGW("media.camera service died without a death handler.");
+                }
+            });
+        }
+        sCameraChecked = true;
     }
-    sCameraChecked = true;
 
     {
         using ::android::hidl::base::V1_0::IBase;
diff --git a/media/libmediaplayerservice/tests/DrmSessionManager_test.cpp b/media/libmediaplayerservice/tests/DrmSessionManager_test.cpp
index f114046..c81a659 100644
--- a/media/libmediaplayerservice/tests/DrmSessionManager_test.cpp
+++ b/media/libmediaplayerservice/tests/DrmSessionManager_test.cpp
@@ -65,6 +65,14 @@
         return true;
     }
 
+    virtual bool overrideProcessInfo(
+            int /* pid */, int /* procState */, int /* oomScore */) {
+        return true;
+    }
+
+    virtual void removeProcessInfoOverride(int /* pid */) {
+    }
+
 private:
     DISALLOW_EVIL_CONSTRUCTORS(FakeProcessInfo);
 };
diff --git a/media/libmediatranscoding/Android.bp b/media/libmediatranscoding/Android.bp
index 29ed65a..128d0d8 100644
--- a/media/libmediatranscoding/Android.bp
+++ b/media/libmediatranscoding/Android.bp
@@ -14,11 +14,8 @@
  * limitations under the License.
  */
 
-// AIDL interfaces of MediaTranscoding.
-aidl_interface {
-    name: "mediatranscoding_aidl_interface",
-    unstable: true,
-    local_include_dir: "aidl",
+filegroup {
+    name: "libmediatranscoding_aidl",
     srcs: [
         "aidl/android/media/IMediaTranscodingService.aidl",
         "aidl/android/media/ITranscodingClient.aidl",
@@ -34,6 +31,15 @@
         "aidl/android/media/TranscodingResultParcel.aidl",
         "aidl/android/media/TranscodingTestConfig.aidl",
     ],
+    path: "aidl",
+}
+
+// AIDL interfaces of MediaTranscoding.
+aidl_interface {
+    name: "mediatranscoding_aidl_interface",
+    unstable: true,
+    local_include_dir: "aidl",
+    srcs: [":libmediatranscoding_aidl"],
     backend:
     {
         java: {
@@ -48,6 +54,7 @@
     srcs: [
         "TranscodingClientManager.cpp",
         "TranscodingJobScheduler.cpp",
+        "TranscodingResourcePolicy.cpp",
         "TranscodingUidPolicy.cpp",
         "TranscoderWrapper.cpp",
     ],
@@ -61,11 +68,16 @@
         "libbinder",
         "libmediandk",
     ],
+    export_shared_lib_headers: [
+        "libmediandk",
+    ],
 
     export_include_dirs: ["include"],
 
     static_libs: [
         "mediatranscoding_aidl_interface-ndk_platform",
+        "resourcemanager_aidl_interface-ndk_platform",
+        "resourceobserver_aidl_interface-ndk_platform",
     ],
 
     cflags: [
diff --git a/media/libmediatranscoding/TranscoderWrapper.cpp b/media/libmediatranscoding/TranscoderWrapper.cpp
index bd03671..8062fcf 100644
--- a/media/libmediatranscoding/TranscoderWrapper.cpp
+++ b/media/libmediatranscoding/TranscoderWrapper.cpp
@@ -89,26 +89,40 @@
 }
 
 //static
-const char* TranscoderWrapper::toString(Event::Type type) {
-    switch (type) {
+std::string TranscoderWrapper::toString(const Event& event) {
+    std::string typeStr;
+    switch (event.type) {
     case Event::Start:
-        return "Start";
-    case Event::Pause:
-        return "Pause";
-    case Event::Resume:
-        return "Resume";
-    case Event::Stop:
-        return "Stop";
-    case Event::Finish:
-        return "Finish";
-    case Event::Error:
-        return "Error";
-    case Event::Progress:
-        return "Progress";
-    default:
+        typeStr = "Start";
         break;
+    case Event::Pause:
+        typeStr = "Pause";
+        break;
+    case Event::Resume:
+        typeStr = "Resume";
+        break;
+    case Event::Stop:
+        typeStr = "Stop";
+        break;
+    case Event::Finish:
+        typeStr = "Finish";
+        break;
+    case Event::Error:
+        typeStr = "Error";
+        break;
+    case Event::Progress:
+        typeStr = "Progress";
+        break;
+    default:
+        return "(unknown)";
     }
-    return "(unknown)";
+    std::string result;
+    result = "job {" + std::to_string(event.clientId) + "," + std::to_string(event.jobId) +
+             "}: " + typeStr;
+    if (event.type == Event::Error || event.type == Event::Progress) {
+        result += " " + std::to_string(event.arg);
+    }
+    return result;
 }
 
 class TranscoderWrapper::CallbackImpl : public MediaTranscoder::CallbackInterface {
@@ -128,7 +142,7 @@
                          media_status_t error) override {
         auto owner = mOwner.lock();
         if (owner != nullptr) {
-            owner->onError(mClientId, mJobId, toTranscodingError(error));
+            owner->onError(mClientId, mJobId, error);
         }
     }
 
@@ -160,20 +174,41 @@
     mCallback = cb;
 }
 
+static bool isResourceError(media_status_t err) {
+    return err == AMEDIACODEC_ERROR_RECLAIMED || err == AMEDIACODEC_ERROR_INSUFFICIENT_RESOURCE;
+}
+
+void TranscoderWrapper::reportError(ClientIdType clientId, JobIdType jobId, media_status_t err) {
+    auto callback = mCallback.lock();
+    if (callback != nullptr) {
+        if (isResourceError(err)) {
+            // Add a placeholder pause state to mPausedStateMap. This is required when resuming.
+            // TODO: remove this when transcoder pause/resume logic is ready. New logic will
+            // no longer use the pause states.
+            auto it = mPausedStateMap.find(JobKeyType(clientId, jobId));
+            if (it == mPausedStateMap.end()) {
+                mPausedStateMap.emplace(JobKeyType(clientId, jobId),
+                                        std::shared_ptr<const Parcel>());
+            }
+
+            callback->onResourceLost();
+        } else {
+            callback->onError(clientId, jobId, toTranscodingError(err));
+        }
+    }
+}
+
 void TranscoderWrapper::start(ClientIdType clientId, JobIdType jobId,
                               const TranscodingRequestParcel& request,
                               const std::shared_ptr<ITranscodingClientCallback>& clientCb) {
     queueEvent(Event::Start, clientId, jobId, [=] {
-        TranscodingErrorCode err = handleStart(clientId, jobId, request, clientCb);
+        media_status_t err = handleStart(clientId, jobId, request, clientCb);
 
-        auto callback = mCallback.lock();
-        if (err != TranscodingErrorCode::kNoError) {
+        if (err != AMEDIA_OK) {
             cleanup();
-
-            if (callback != nullptr) {
-                callback->onError(clientId, jobId, err);
-            }
+            reportError(clientId, jobId, err);
         } else {
+            auto callback = mCallback.lock();
             if (callback != nullptr) {
                 callback->onStarted(clientId, jobId);
             }
@@ -183,15 +218,15 @@
 
 void TranscoderWrapper::pause(ClientIdType clientId, JobIdType jobId) {
     queueEvent(Event::Pause, clientId, jobId, [=] {
-        TranscodingErrorCode err = handlePause(clientId, jobId);
+        media_status_t err = handlePause(clientId, jobId);
 
         cleanup();
 
-        auto callback = mCallback.lock();
-        if (callback != nullptr) {
-            if (err != TranscodingErrorCode::kNoError) {
-                callback->onError(clientId, jobId, err);
-            } else {
+        if (err != AMEDIA_OK) {
+            reportError(clientId, jobId, err);
+        } else {
+            auto callback = mCallback.lock();
+            if (callback != nullptr) {
                 callback->onPaused(clientId, jobId);
             }
         }
@@ -202,16 +237,13 @@
                                const TranscodingRequestParcel& request,
                                const std::shared_ptr<ITranscodingClientCallback>& clientCb) {
     queueEvent(Event::Resume, clientId, jobId, [=] {
-        TranscodingErrorCode err = handleResume(clientId, jobId, request, clientCb);
+        media_status_t err = handleResume(clientId, jobId, request, clientCb);
 
-        auto callback = mCallback.lock();
-        if (err != TranscodingErrorCode::kNoError) {
+        if (err != AMEDIA_OK) {
             cleanup();
-
-            if (callback != nullptr) {
-                callback->onError(clientId, jobId, err);
-            }
+            reportError(clientId, jobId, err);
         } else {
+            auto callback = mCallback.lock();
             if (callback != nullptr) {
                 callback->onResumed(clientId, jobId);
             }
@@ -225,7 +257,7 @@
             // Cancelling the currently running job.
             media_status_t err = mTranscoder->cancel();
             if (err != AMEDIA_OK) {
-                ALOGE("failed to stop transcoder: %d", err);
+                ALOGW("failed to stop transcoder: %d", err);
             } else {
                 ALOGI("transcoder stopped");
             }
@@ -251,41 +283,43 @@
     });
 }
 
-void TranscoderWrapper::onError(ClientIdType clientId, JobIdType jobId,
-                                TranscodingErrorCode error) {
-    queueEvent(Event::Error, clientId, jobId, [=] {
-        if (mTranscoder != nullptr && clientId == mCurrentClientId && jobId == mCurrentJobId) {
-            cleanup();
-        }
-
-        auto callback = mCallback.lock();
-        if (callback != nullptr) {
-            callback->onError(clientId, jobId, error);
-        }
-    });
+void TranscoderWrapper::onError(ClientIdType clientId, JobIdType jobId, media_status_t error) {
+    queueEvent(
+            Event::Error, clientId, jobId,
+            [=] {
+                if (mTranscoder != nullptr && clientId == mCurrentClientId &&
+                    jobId == mCurrentJobId) {
+                    cleanup();
+                }
+                reportError(clientId, jobId, error);
+            },
+            error);
 }
 
 void TranscoderWrapper::onProgress(ClientIdType clientId, JobIdType jobId, int32_t progress) {
-    queueEvent(Event::Progress, clientId, jobId, [=] {
-        auto callback = mCallback.lock();
-        if (callback != nullptr) {
-            callback->onProgressUpdate(clientId, jobId, progress);
-        }
-    });
+    queueEvent(
+            Event::Progress, clientId, jobId,
+            [=] {
+                auto callback = mCallback.lock();
+                if (callback != nullptr) {
+                    callback->onProgressUpdate(clientId, jobId, progress);
+                }
+            },
+            progress);
 }
 
-TranscodingErrorCode TranscoderWrapper::setupTranscoder(
+media_status_t TranscoderWrapper::setupTranscoder(
         ClientIdType clientId, JobIdType jobId, const TranscodingRequestParcel& request,
         const std::shared_ptr<ITranscodingClientCallback>& clientCb,
         const std::shared_ptr<const Parcel>& pausedState) {
     if (clientCb == nullptr) {
         ALOGE("client callback is null");
-        return TranscodingErrorCode::kInvalidParameter;
+        return AMEDIA_ERROR_INVALID_PARAMETER;
     }
 
     if (mTranscoder != nullptr) {
         ALOGE("transcoder already running");
-        return TranscodingErrorCode::kInvalidOperation;
+        return AMEDIA_ERROR_INVALID_OPERATION;
     }
 
     Status status;
@@ -293,7 +327,7 @@
     status = clientCb->openFileDescriptor(request.sourceFilePath, "r", &srcFd);
     if (!status.isOk() || srcFd.get() < 0) {
         ALOGE("failed to open source");
-        return TranscodingErrorCode::kErrorIO;
+        return AMEDIA_ERROR_IO;
     }
 
     // Open dest file with "rw", as the transcoder could potentially reuse part of it
@@ -302,7 +336,7 @@
     status = clientCb->openFileDescriptor(request.destinationFilePath, "rw", &dstFd);
     if (!status.isOk() || dstFd.get() < 0) {
         ALOGE("failed to open destination");
-        return TranscodingErrorCode::kErrorIO;
+        return AMEDIA_ERROR_IO;
     }
 
     mCurrentClientId = clientId;
@@ -311,19 +345,19 @@
     mTranscoder = MediaTranscoder::create(mTranscoderCb, pausedState);
     if (mTranscoder == nullptr) {
         ALOGE("failed to create transcoder");
-        return TranscodingErrorCode::kUnknown;
+        return AMEDIA_ERROR_UNKNOWN;
     }
 
     media_status_t err = mTranscoder->configureSource(srcFd.get());
     if (err != AMEDIA_OK) {
         ALOGE("failed to configure source: %d", err);
-        return toTranscodingError(err);
+        return err;
     }
 
     std::vector<std::shared_ptr<AMediaFormat>> trackFormats = mTranscoder->getTrackFormats();
     if (trackFormats.size() == 0) {
         ALOGE("failed to get track formats!");
-        return TranscodingErrorCode::kMalformed;
+        return AMEDIA_ERROR_MALFORMED;
     }
 
     for (int i = 0; i < trackFormats.size(); ++i) {
@@ -341,43 +375,43 @@
         }
         if (err != AMEDIA_OK) {
             ALOGE("failed to configure track format for track %d: %d", i, err);
-            return toTranscodingError(err);
+            return err;
         }
     }
 
     err = mTranscoder->configureDestination(dstFd.get());
     if (err != AMEDIA_OK) {
         ALOGE("failed to configure dest: %d", err);
-        return toTranscodingError(err);
+        return err;
     }
 
-    return TranscodingErrorCode::kNoError;
+    return AMEDIA_OK;
 }
 
-TranscodingErrorCode TranscoderWrapper::handleStart(
+media_status_t TranscoderWrapper::handleStart(
         ClientIdType clientId, JobIdType jobId, const TranscodingRequestParcel& request,
         const std::shared_ptr<ITranscodingClientCallback>& clientCb) {
-    ALOGI("setting up transcoder for start");
-    TranscodingErrorCode err = setupTranscoder(clientId, jobId, request, clientCb);
-    if (err != TranscodingErrorCode::kNoError) {
+    ALOGI("%s: setting up transcoder for start", __FUNCTION__);
+    media_status_t err = setupTranscoder(clientId, jobId, request, clientCb);
+    if (err != AMEDIA_OK) {
         ALOGI("%s: failed to setup transcoder", __FUNCTION__);
         return err;
     }
 
-    media_status_t status = mTranscoder->start();
-    if (status != AMEDIA_OK) {
+    err = mTranscoder->start();
+    if (err != AMEDIA_OK) {
         ALOGE("%s: failed to start transcoder: %d", __FUNCTION__, err);
-        return toTranscodingError(status);
+        return err;
     }
 
     ALOGI("%s: transcoder started", __FUNCTION__);
-    return TranscodingErrorCode::kNoError;
+    return AMEDIA_OK;
 }
 
-TranscodingErrorCode TranscoderWrapper::handlePause(ClientIdType clientId, JobIdType jobId) {
+media_status_t TranscoderWrapper::handlePause(ClientIdType clientId, JobIdType jobId) {
     if (mTranscoder == nullptr) {
         ALOGE("%s: transcoder is not running", __FUNCTION__);
-        return TranscodingErrorCode::kInvalidOperation;
+        return AMEDIA_ERROR_INVALID_OPERATION;
     }
 
     if (clientId != mCurrentClientId || jobId != mCurrentJobId) {
@@ -385,19 +419,21 @@
               (long long)clientId, jobId, (long long)mCurrentClientId, mCurrentJobId);
     }
 
+    ALOGI("%s: pausing transcoder", __FUNCTION__);
+
     std::shared_ptr<const Parcel> pauseStates;
     media_status_t err = mTranscoder->pause(&pauseStates);
     if (err != AMEDIA_OK) {
         ALOGE("%s: failed to pause transcoder: %d", __FUNCTION__, err);
-        return toTranscodingError(err);
+        return err;
     }
     mPausedStateMap[JobKeyType(clientId, jobId)] = pauseStates;
 
     ALOGI("%s: transcoder paused", __FUNCTION__);
-    return TranscodingErrorCode::kNoError;
+    return AMEDIA_OK;
 }
 
-TranscodingErrorCode TranscoderWrapper::handleResume(
+media_status_t TranscoderWrapper::handleResume(
         ClientIdType clientId, JobIdType jobId, const TranscodingRequestParcel& request,
         const std::shared_ptr<ITranscodingClientCallback>& clientCb) {
     std::shared_ptr<const Parcel> pausedState;
@@ -407,24 +443,24 @@
         mPausedStateMap.erase(it);
     } else {
         ALOGE("%s: can't find paused state", __FUNCTION__);
-        return TranscodingErrorCode::kInvalidOperation;
+        return AMEDIA_ERROR_INVALID_OPERATION;
     }
 
-    ALOGI("setting up transcoder for resume");
-    TranscodingErrorCode err = setupTranscoder(clientId, jobId, request, clientCb, pausedState);
-    if (err != TranscodingErrorCode::kNoError) {
-        ALOGE("%s: failed to setup transcoder", __FUNCTION__);
+    ALOGI("%s: setting up transcoder for resume", __FUNCTION__);
+    media_status_t err = setupTranscoder(clientId, jobId, request, clientCb, pausedState);
+    if (err != AMEDIA_OK) {
+        ALOGE("%s: failed to setup transcoder: %d", __FUNCTION__, err);
         return err;
     }
 
-    media_status_t status = mTranscoder->resume();
-    if (status != AMEDIA_OK) {
+    err = mTranscoder->resume();
+    if (err != AMEDIA_OK) {
         ALOGE("%s: failed to resume transcoder: %d", __FUNCTION__, err);
-        return toTranscodingError(status);
+        return err;
     }
 
     ALOGI("%s: transcoder resumed", __FUNCTION__);
-    return TranscodingErrorCode::kNoError;
+    return AMEDIA_OK;
 }
 
 void TranscoderWrapper::cleanup() {
@@ -435,12 +471,10 @@
 }
 
 void TranscoderWrapper::queueEvent(Event::Type type, ClientIdType clientId, JobIdType jobId,
-                                   const std::function<void()> runnable) {
-    ALOGV("%s: job {%lld, %d}: %s", __FUNCTION__, (long long)clientId, jobId, toString(type));
-
+                                   const std::function<void()> runnable, int32_t arg) {
     std::scoped_lock lock{mLock};
 
-    mQueue.push_back({type, clientId, jobId, runnable});
+    mQueue.push_back({type, clientId, jobId, runnable, arg});
     mCondition.notify_one();
 }
 
@@ -457,8 +491,7 @@
         Event event = *mQueue.begin();
         mQueue.pop_front();
 
-        ALOGD("%s: job {%lld, %d}: %s", __FUNCTION__, (long long)event.clientId, event.jobId,
-              toString(event.type));
+        ALOGD("%s: %s", __FUNCTION__, toString(event).c_str());
 
         lock.unlock();
         event.runnable();
diff --git a/media/libmediatranscoding/TranscodingClientManager.cpp b/media/libmediatranscoding/TranscodingClientManager.cpp
index ce3ac13..d9f3f28 100644
--- a/media/libmediatranscoding/TranscodingClientManager.cpp
+++ b/media/libmediatranscoding/TranscodingClientManager.cpp
@@ -23,6 +23,7 @@
 #include <inttypes.h>
 #include <media/TranscodingClientManager.h>
 #include <media/TranscodingRequest.h>
+#include <private/android_filesystem_config.h>
 #include <utils/Log.h>
 namespace android {
 
@@ -44,6 +45,26 @@
         TranscodingClientManager::sCookie2Client;
 ///////////////////////////////////////////////////////////////////////////////
 
+// Convenience methods for constructing binder::Status objects for error returns
+#define STATUS_ERROR_FMT(errorCode, errorString, ...) \
+    Status::fromServiceSpecificErrorWithMessage(      \
+            errorCode,                                \
+            String8::format("%s:%d: " errorString, __FUNCTION__, __LINE__, ##__VA_ARGS__))
+
+// Can MediaTranscoding service trust the caller based on the calling UID?
+// TODO(hkuang): Add MediaProvider's UID.
+static bool isTrustedCallingUid(uid_t uid) {
+    switch (uid) {
+    case AID_ROOT:  // root user
+    case AID_SYSTEM:
+    case AID_SHELL:
+    case AID_MEDIA:  // mediaserver
+        return true;
+    default:
+        return false;
+    }
+}
+
 /**
  * ClientImpl implements a single client and contains all its information.
  */
@@ -60,8 +81,6 @@
      * (casted to int64t_t) as the client id.
      */
     ClientIdType mClientId;
-    pid_t mClientPid;
-    uid_t mClientUid;
     std::string mClientName;
     std::string mClientOpPackageName;
 
@@ -72,7 +91,7 @@
     // Weak pointer to the client manager for this client.
     std::weak_ptr<TranscodingClientManager> mOwner;
 
-    ClientImpl(const std::shared_ptr<ITranscodingClientCallback>& callback, pid_t pid, uid_t uid,
+    ClientImpl(const std::shared_ptr<ITranscodingClientCallback>& callback,
                const std::string& clientName, const std::string& opPackageName,
                const std::weak_ptr<TranscodingClientManager>& owner);
 
@@ -88,14 +107,11 @@
 };
 
 TranscodingClientManager::ClientImpl::ClientImpl(
-        const std::shared_ptr<ITranscodingClientCallback>& callback, pid_t pid, uid_t uid,
-        const std::string& clientName, const std::string& opPackageName,
-        const std::weak_ptr<TranscodingClientManager>& owner)
+        const std::shared_ptr<ITranscodingClientCallback>& callback, const std::string& clientName,
+        const std::string& opPackageName, const std::weak_ptr<TranscodingClientManager>& owner)
       : mClientBinder((callback != nullptr) ? callback->asBinder() : nullptr),
         mClientCallback(callback),
         mClientId(sCookieCounter.fetch_add(1, std::memory_order_relaxed)),
-        mClientPid(pid),
-        mClientUid(uid),
         mClientName(clientName),
         mClientOpPackageName(opPackageName),
         mNextJobId(0),
@@ -113,14 +129,52 @@
     }
 
     if (in_request.sourceFilePath.empty() || in_request.destinationFilePath.empty()) {
-        // This is the only error we check for now.
         return Status::ok();
     }
 
+    int32_t callingPid = AIBinder_getCallingPid();
+    int32_t callingUid = AIBinder_getCallingUid();
+    int32_t in_clientUid = in_request.clientUid;
+    int32_t in_clientPid = in_request.clientPid;
+
+    // Check if we can trust clientUid. Only privilege caller could forward the
+    // uid on app client's behalf.
+    if (in_clientUid == IMediaTranscodingService::USE_CALLING_UID) {
+        in_clientUid = callingUid;
+    } else if (in_clientUid < 0) {
+        return Status::ok();
+    } else if (in_clientUid != callingUid && !isTrustedCallingUid(callingUid)) {
+        ALOGE("MediaTranscodingService::registerClient rejected (clientPid %d, clientUid %d) "
+              "(don't trust callingUid %d)",
+              in_clientPid, in_clientUid, callingUid);
+        return STATUS_ERROR_FMT(
+                IMediaTranscodingService::ERROR_PERMISSION_DENIED,
+                "MediaTranscodingService::registerClient rejected (clientPid %d, clientUid %d) "
+                "(don't trust callingUid %d)",
+                in_clientPid, in_clientUid, callingUid);
+    }
+
+    // Check if we can trust clientPid. Only privilege caller could forward the
+    // pid on app client's behalf.
+    if (in_clientPid == IMediaTranscodingService::USE_CALLING_PID) {
+        in_clientPid = callingPid;
+    } else if (in_clientPid < 0) {
+        return Status::ok();
+    } else if (in_clientPid != callingPid && !isTrustedCallingUid(callingUid)) {
+        ALOGE("MediaTranscodingService::registerClient rejected (clientPid %d, clientUid %d) "
+              "(don't trust callingUid %d)",
+              in_clientPid, in_clientUid, callingUid);
+        return STATUS_ERROR_FMT(
+                IMediaTranscodingService::ERROR_PERMISSION_DENIED,
+                "MediaTranscodingService::registerClient rejected (clientPid %d, clientUid %d) "
+                "(don't trust callingUid %d)",
+                in_clientPid, in_clientUid, callingUid);
+    }
+
     int32_t jobId = mNextJobId.fetch_add(1);
 
-    *_aidl_return =
-            owner->mJobScheduler->submit(mClientId, jobId, mClientUid, in_request, mClientCallback);
+    *_aidl_return = owner->mJobScheduler->submit(mClientId, jobId, in_clientUid, in_request,
+                                                 mClientCallback);
 
     if (*_aidl_return) {
         out_job->jobId = jobId;
@@ -246,11 +300,10 @@
 }
 
 status_t TranscodingClientManager::addClient(
-        const std::shared_ptr<ITranscodingClientCallback>& callback, pid_t pid, uid_t uid,
-        const std::string& clientName, const std::string& opPackageName,
-        std::shared_ptr<ITranscodingClient>* outClient) {
+        const std::shared_ptr<ITranscodingClientCallback>& callback, const std::string& clientName,
+        const std::string& opPackageName, std::shared_ptr<ITranscodingClient>* outClient) {
     // Validate the client.
-    if (callback == nullptr || pid < 0 || clientName.empty() || opPackageName.empty()) {
+    if (callback == nullptr || clientName.empty() || opPackageName.empty()) {
         ALOGE("Invalid client");
         return IMediaTranscodingService::ERROR_ILLEGAL_ARGUMENT;
     }
@@ -264,12 +317,11 @@
         return IMediaTranscodingService::ERROR_ALREADY_EXISTS;
     }
 
-    // Creates the client and uses its process id as client id.
+    // Creates the client (with the id assigned by ClientImpl).
     std::shared_ptr<ClientImpl> client = ::ndk::SharedRefBase::make<ClientImpl>(
-            callback, pid, uid, clientName, opPackageName, shared_from_this());
+            callback, clientName, opPackageName, shared_from_this());
 
-    ALOGD("Adding client id %lld, pid %d, uid %d, name %s, package %s",
-          (long long)client->mClientId, client->mClientPid, client->mClientUid,
+    ALOGD("Adding client id %lld, name %s, package %s", (long long)client->mClientId,
           client->mClientName.c_str(), client->mClientOpPackageName.c_str());
 
     {
diff --git a/media/libmediatranscoding/TranscodingJobScheduler.cpp b/media/libmediatranscoding/TranscodingJobScheduler.cpp
index 3e4f319..24ac682 100644
--- a/media/libmediatranscoding/TranscodingJobScheduler.cpp
+++ b/media/libmediatranscoding/TranscodingJobScheduler.cpp
@@ -38,8 +38,13 @@
 
 TranscodingJobScheduler::TranscodingJobScheduler(
         const std::shared_ptr<TranscoderInterface>& transcoder,
-        const std::shared_ptr<UidPolicyInterface>& uidPolicy)
-      : mTranscoder(transcoder), mUidPolicy(uidPolicy), mCurrentJob(nullptr), mResourceLost(false) {
+        const std::shared_ptr<UidPolicyInterface>& uidPolicy,
+        const std::shared_ptr<ResourcePolicyInterface>& resourcePolicy)
+      : mTranscoder(transcoder),
+        mUidPolicy(uidPolicy),
+        mResourcePolicy(resourcePolicy),
+        mCurrentJob(nullptr),
+        mResourceLost(false) {
     // Only push empty offline queue initially. Realtime queues are added when requests come in.
     mUidSortedList.push_back(OFFLINE_UID);
     mOfflineUidIterator = mUidSortedList.begin();
@@ -398,15 +403,24 @@
 }
 
 void TranscodingJobScheduler::onResourceLost() {
-    ALOGV("%s", __FUNCTION__);
+    ALOGI("%s", __FUNCTION__);
 
     std::scoped_lock lock{mLock};
 
+    if (mResourceLost) {
+        return;
+    }
+
     // If we receive a resource loss event, the TranscoderLibrary already paused
     // the transcoding, so we don't need to call onPaused to notify it to pause.
     // Only need to update the job state here.
     if (mCurrentJob != nullptr && mCurrentJob->state == Job::RUNNING) {
         mCurrentJob->state = Job::PAUSED;
+        // Notify the client as a paused event.
+        auto clientCallback = mCurrentJob->callback.lock();
+        if (clientCallback != nullptr) {
+            clientCallback->onTranscodingPaused(mCurrentJob->key.second);
+        }
     }
     mResourceLost = true;
 
@@ -439,10 +453,14 @@
 }
 
 void TranscodingJobScheduler::onResourceAvailable() {
-    ALOGV("%s", __FUNCTION__);
-
     std::scoped_lock lock{mLock};
 
+    if (!mResourceLost) {
+        return;
+    }
+
+    ALOGI("%s", __FUNCTION__);
+
     mResourceLost = false;
     updateCurrentJob_l();
 
diff --git a/media/libmediatranscoding/TranscodingResourcePolicy.cpp b/media/libmediatranscoding/TranscodingResourcePolicy.cpp
new file mode 100644
index 0000000..4fd8338
--- /dev/null
+++ b/media/libmediatranscoding/TranscodingResourcePolicy.cpp
@@ -0,0 +1,169 @@
+/*
+ * Copyright (C) 2020 The Android Open Source Project
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ *      http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+//#define LOG_NDEBUG 0
+#define LOG_TAG "TranscodingResourcePolicy"
+
+#include <aidl/android/media/BnResourceObserver.h>
+#include <aidl/android/media/IResourceObserverService.h>
+#include <android/binder_manager.h>
+#include <android/binder_process.h>
+#include <binder/IServiceManager.h>
+#include <media/TranscodingResourcePolicy.h>
+#include <utils/Log.h>
+
+namespace android {
+
+using Status = ::ndk::ScopedAStatus;
+using ::aidl::android::media::BnResourceObserver;
+using ::aidl::android::media::IResourceObserverService;
+using ::aidl::android::media::MediaObservableEvent;
+using ::aidl::android::media::MediaObservableFilter;
+using ::aidl::android::media::MediaObservableParcel;
+using ::aidl::android::media::MediaObservableType;
+
+static std::string toString(const MediaObservableParcel& observable) {
+    return "{" + ::aidl::android::media::toString(observable.type) + ", " +
+           std::to_string(observable.value) + "}";
+}
+
+struct TranscodingResourcePolicy::ResourceObserver : public BnResourceObserver {
+    explicit ResourceObserver(TranscodingResourcePolicy* owner) : mOwner(owner), mPid(getpid()) {}
+
+    // IResourceObserver
+    ::ndk::ScopedAStatus onStatusChanged(
+            MediaObservableEvent event, int32_t uid, int32_t pid,
+            const std::vector<MediaObservableParcel>& observables) override {
+        ALOGD("%s: %s, uid %d, pid %d, %s", __FUNCTION__,
+              ::aidl::android::media::toString(event).c_str(), uid, pid,
+              toString(observables[0]).c_str());
+
+        // Only report kIdle event for codec resources from other processes.
+        if (((uint64_t)event & (uint64_t)MediaObservableEvent::kIdle) != 0 && (pid != mPid)) {
+            for (auto& observable : observables) {
+                if (observable.type == MediaObservableType::kVideoSecureCodec ||
+                    observable.type == MediaObservableType::kVideoNonSecureCodec) {
+                    mOwner->onResourceAvailable();
+                    break;
+                }
+            }
+        }
+        return ::ndk::ScopedAStatus::ok();
+    }
+
+    TranscodingResourcePolicy* mOwner;
+    const pid_t mPid;
+};
+
+// static
+void TranscodingResourcePolicy::BinderDiedCallback(void* cookie) {
+    TranscodingResourcePolicy* owner = reinterpret_cast<TranscodingResourcePolicy*>(cookie);
+    if (owner != nullptr) {
+        owner->unregisterSelf();
+    }
+    // TODO(chz): retry to connecting to IResourceObserverService after failure.
+    // Also need to have back-up logic if IResourceObserverService is offline for
+    // Prolonged period of time. A possible alternative could be, during period where
+    // IResourceObserverService is not available, trigger onResourceAvailable() everytime
+    // when top uid changes (in hope that'll free up some codec instances that we could
+    // reclaim).
+}
+
+TranscodingResourcePolicy::TranscodingResourcePolicy()
+      : mRegistered(false), mDeathRecipient(AIBinder_DeathRecipient_new(BinderDiedCallback)) {
+    registerSelf();
+}
+
+TranscodingResourcePolicy::~TranscodingResourcePolicy() {
+    unregisterSelf();
+}
+
+void TranscodingResourcePolicy::registerSelf() {
+    ALOGI("TranscodingResourcePolicy: registerSelf");
+
+    ::ndk::SpAIBinder binder(AServiceManager_getService("media.resource_observer"));
+
+    std::scoped_lock lock{mRegisteredLock};
+
+    if (mRegistered) {
+        return;
+    }
+
+    // TODO(chz): retry to connecting to IResourceObserverService after failure.
+    mService = IResourceObserverService::fromBinder(binder);
+    if (mService == nullptr) {
+        ALOGE("Failed to get IResourceObserverService");
+        return;
+    }
+
+    // Only register filters for codec resource available.
+    mObserver = ::ndk::SharedRefBase::make<ResourceObserver>(this);
+    std::vector<MediaObservableFilter> filters = {
+            {MediaObservableType::kVideoSecureCodec, MediaObservableEvent::kIdle},
+            {MediaObservableType::kVideoNonSecureCodec, MediaObservableEvent::kIdle}};
+
+    Status status = mService->registerObserver(mObserver, filters);
+    if (!status.isOk()) {
+        ALOGE("failed to register: error %d", status.getServiceSpecificError());
+        mService = nullptr;
+        mObserver = nullptr;
+        return;
+    }
+
+    AIBinder_linkToDeath(binder.get(), mDeathRecipient.get(), reinterpret_cast<void*>(this));
+
+    ALOGD("@@@ registered observer");
+    mRegistered = true;
+}
+
+void TranscodingResourcePolicy::unregisterSelf() {
+    ALOGI("TranscodingResourcePolicy: unregisterSelf");
+
+    std::scoped_lock lock{mRegisteredLock};
+
+    if (!mRegistered) {
+        return;
+    }
+
+    ::ndk::SpAIBinder binder = mService->asBinder();
+    if (binder.get() != nullptr) {
+        Status status = mService->unregisterObserver(mObserver);
+        AIBinder_unlinkToDeath(binder.get(), mDeathRecipient.get(), reinterpret_cast<void*>(this));
+    }
+
+    mService = nullptr;
+    mObserver = nullptr;
+    mRegistered = false;
+}
+
+void TranscodingResourcePolicy::setCallback(
+        const std::shared_ptr<ResourcePolicyCallbackInterface>& cb) {
+    std::scoped_lock lock{mCallbackLock};
+    mResourcePolicyCallback = cb;
+}
+
+void TranscodingResourcePolicy::onResourceAvailable() {
+    std::shared_ptr<ResourcePolicyCallbackInterface> cb;
+    {
+        std::scoped_lock lock{mCallbackLock};
+        cb = mResourcePolicyCallback.lock();
+    }
+
+    if (cb != nullptr) {
+        cb->onResourceAvailable();
+    }
+}
+}  // namespace android
diff --git a/media/libmediatranscoding/TranscodingUidPolicy.cpp b/media/libmediatranscoding/TranscodingUidPolicy.cpp
index b72a2b9..fd41f65 100644
--- a/media/libmediatranscoding/TranscodingUidPolicy.cpp
+++ b/media/libmediatranscoding/TranscodingUidPolicy.cpp
@@ -17,6 +17,10 @@
 //#define LOG_NDEBUG 0
 #define LOG_TAG "TranscodingUidPolicy"
 
+#include <aidl/android/media/BnResourceManagerClient.h>
+#include <aidl/android/media/IResourceManagerService.h>
+#include <android/binder_manager.h>
+#include <android/binder_process.h>
 #include <binder/ActivityManager.h>
 #include <cutils/misc.h>  // FIRST_APPLICATION_UID
 #include <inttypes.h>
@@ -30,6 +34,43 @@
 constexpr static uid_t OFFLINE_UID = -1;
 constexpr static const char* kTranscodingTag = "transcoding";
 
+/*
+ * The OOM score we're going to ask ResourceManager to use for our native transcoding
+ * service. ResourceManager issues reclaims based on these scores. It gets the scores
+ * from ActivityManagerService, which doesn't track native services. The values of the
+ * OOM scores are defined in:
+ * frameworks/base/services/core/java/com/android/server/am/ProcessList.java
+ * We use SERVICE_ADJ which is lower priority than an app possibly visible to the
+ * user, but higher priority than a cached app (which could be killed without disruption
+ * to the user).
+ */
+constexpr static int32_t SERVICE_ADJ = 500;
+
+using Status = ::ndk::ScopedAStatus;
+using aidl::android::media::BnResourceManagerClient;
+using aidl::android::media::IResourceManagerService;
+
+/*
+ * Placeholder ResourceManagerClient for registering process info override
+ * with the IResourceManagerService. This is only used as a token by the service
+ * to get notifications about binder death, not used for reclaiming resources.
+ */
+struct TranscodingUidPolicy::ResourceManagerClient : public BnResourceManagerClient {
+    explicit ResourceManagerClient() = default;
+
+    Status reclaimResource(bool* _aidl_return) override {
+        *_aidl_return = false;
+        return Status::ok();
+    }
+
+    Status getName(::std::string* _aidl_return) override {
+        _aidl_return->clear();
+        return Status::ok();
+    }
+
+    virtual ~ResourceManagerClient() = default;
+};
+
 struct TranscodingUidPolicy::UidObserver : public BnUidObserver,
                                            public virtual IBinder::DeathRecipient {
     explicit UidObserver(TranscodingUidPolicy* owner) : mOwner(owner) {}
@@ -74,6 +115,7 @@
         mRegistered(false),
         mTopUidState(ActivityManager::PROCESS_STATE_UNKNOWN) {
     registerSelf();
+    setProcessInfoOverride();
 }
 
 TranscodingUidPolicy::~TranscodingUidPolicy() {
@@ -109,6 +151,22 @@
     ALOGI("TranscodingUidPolicy: Unregistered with ActivityManager");
 }
 
+void TranscodingUidPolicy::setProcessInfoOverride() {
+    ::ndk::SpAIBinder binder(AServiceManager_getService("media.resource_manager"));
+    std::shared_ptr<IResourceManagerService> service = IResourceManagerService::fromBinder(binder);
+    if (service == nullptr) {
+        ALOGE("Failed to get IResourceManagerService");
+        return;
+    }
+
+    mProcInfoOverrideClient = ::ndk::SharedRefBase::make<ResourceManagerClient>();
+    Status status = service->overrideProcessInfo(
+            mProcInfoOverrideClient, getpid(), ActivityManager::PROCESS_STATE_SERVICE, SERVICE_ADJ);
+    if (!status.isOk()) {
+        ALOGW("Failed to setProcessInfoOverride.");
+    }
+}
+
 void TranscodingUidPolicy::setUidObserverRegistered(bool registered) {
     Mutex::Autolock _l(mUidLock);
 
diff --git a/media/libmediatranscoding/aidl/android/media/IMediaTranscodingService.aidl b/media/libmediatranscoding/aidl/android/media/IMediaTranscodingService.aidl
index 40ca2c2..7fc7748 100644
--- a/media/libmediatranscoding/aidl/android/media/IMediaTranscodingService.aidl
+++ b/media/libmediatranscoding/aidl/android/media/IMediaTranscodingService.aidl
@@ -58,17 +58,13 @@
      *        the client.
      * @param clientName name of the client.
      * @param opPackageName op package name of the client.
-     * @param clientUid user id of the client.
-     * @param clientPid process id of the client.
      * @return an ITranscodingClient interface object, with nullptr indicating
      *         failure to register.
      */
     ITranscodingClient registerClient(
             in ITranscodingClientCallback callback,
             in String clientName,
-            in String opPackageName,
-            in int clientUid,
-            in int clientPid);
+            in String opPackageName);
 
     /**
     * Returns the number of clients. This is used for debugging.
diff --git a/media/libmediatranscoding/aidl/android/media/TranscodingRequestParcel.aidl b/media/libmediatranscoding/aidl/android/media/TranscodingRequestParcel.aidl
index 83ea707..14d19ba 100644
--- a/media/libmediatranscoding/aidl/android/media/TranscodingRequestParcel.aidl
+++ b/media/libmediatranscoding/aidl/android/media/TranscodingRequestParcel.aidl
@@ -39,6 +39,20 @@
     @utf8InCpp String destinationFilePath;
 
     /**
+     * The UID of the client that this transcoding request is for. Only privileged caller could
+     * set this Uid as only they could do the transcoding on behalf of the client.
+     * -1 means not available.
+     */
+    int clientUid = -1;
+
+    /**
+     * The PID of the client that this transcoding request is for. Only privileged caller could
+     * set this Uid as only they could do the transcoding on behalf of the client.
+     * -1 means not available.
+     */
+    int clientPid = -1;
+
+    /**
      * Type of the transcoding.
      */
     TranscodingType transcodingType;
diff --git a/media/libmediatranscoding/aidl/android/media/TranscodingVideoTrackFormat.aidl b/media/libmediatranscoding/aidl/android/media/TranscodingVideoTrackFormat.aidl
index a567a95..90502cd 100644
--- a/media/libmediatranscoding/aidl/android/media/TranscodingVideoTrackFormat.aidl
+++ b/media/libmediatranscoding/aidl/android/media/TranscodingVideoTrackFormat.aidl
@@ -67,4 +67,18 @@
      * -1 means unavailable.
      */
     int level = -1;
+
+    /**
+     * Decoder operating rate. This is used to work around the fact that vendor does not boost the
+     * hardware to maximum speed in transcoding usage case. This operating rate will be applied
+     * to decoder inside MediaTranscoder. -1 means unavailable.
+     */
+    int decoderOperatingRate = -1;
+
+    /**
+     * Encoder operating rate. This is used to work around the fact that vendor does not boost the
+     * hardware to maximum speed in transcoding usage case. This operating rate will be applied
+     * to encoder inside MediaTranscoder. -1 means unavailable.
+     */
+    int encoderOperatingRate = -1;
 }
diff --git a/media/libmediatranscoding/include/media/ResourcePolicyInterface.h b/media/libmediatranscoding/include/media/ResourcePolicyInterface.h
new file mode 100644
index 0000000..8bd7d6b
--- /dev/null
+++ b/media/libmediatranscoding/include/media/ResourcePolicyInterface.h
@@ -0,0 +1,48 @@
+/*
+ * Copyright (C) 2020 The Android Open Source Project
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ *      http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+#ifndef ANDROID_MEDIA_RESOURCE_POLICY_INTERFACE_H
+#define ANDROID_MEDIA_RESOURCE_POLICY_INTERFACE_H
+#include <memory>
+namespace android {
+
+class ResourcePolicyCallbackInterface;
+
+// Interface for the JobScheduler to control the resource status updates.
+class ResourcePolicyInterface {
+public:
+    // Set the associated callback interface to send the events when resource
+    // status changes. (Set to nullptr will stop the updates.)
+    virtual void setCallback(const std::shared_ptr<ResourcePolicyCallbackInterface>& cb) = 0;
+
+protected:
+    virtual ~ResourcePolicyInterface() = default;
+};
+
+// Interface for notifying the JobScheduler of a change in resource status.
+class ResourcePolicyCallbackInterface {
+public:
+    // Called when codec resources become available. The scheduler may use this
+    // as a signal to attempt restart transcoding jobs that were previously
+    // paused due to temporary resource loss.
+    virtual void onResourceAvailable() = 0;
+
+protected:
+    virtual ~ResourcePolicyCallbackInterface() = default;
+};
+
+}  // namespace android
+#endif  // ANDROID_MEDIA_RESOURCE_POLICY_INTERFACE_H
diff --git a/media/libmediatranscoding/include/media/TranscoderWrapper.h b/media/libmediatranscoding/include/media/TranscoderWrapper.h
index a4c92c5..c956042 100644
--- a/media/libmediatranscoding/include/media/TranscoderWrapper.h
+++ b/media/libmediatranscoding/include/media/TranscoderWrapper.h
@@ -18,6 +18,7 @@
 #define ANDROID_TRANSCODER_WRAPPER_H
 
 #include <android-base/thread_annotations.h>
+#include <media/NdkMediaError.h>
 #include <media/TranscoderInterface.h>
 
 #include <list>
@@ -55,6 +56,7 @@
         ClientIdType clientId;
         JobIdType jobId;
         std::function<void()> runnable;
+        int32_t arg;
     };
     using JobKeyType = std::pair<ClientIdType, JobIdType>;
 
@@ -68,26 +70,27 @@
     ClientIdType mCurrentClientId;
     JobIdType mCurrentJobId;
 
-    static const char* toString(Event::Type type);
+    static std::string toString(const Event& event);
     void onFinish(ClientIdType clientId, JobIdType jobId);
-    void onError(ClientIdType clientId, JobIdType jobId, TranscodingErrorCode error);
+    void onError(ClientIdType clientId, JobIdType jobId, media_status_t status);
     void onProgress(ClientIdType clientId, JobIdType jobId, int32_t progress);
 
-    TranscodingErrorCode handleStart(ClientIdType clientId, JobIdType jobId,
-                                     const TranscodingRequestParcel& request,
-                                     const std::shared_ptr<ITranscodingClientCallback>& callback);
-    TranscodingErrorCode handlePause(ClientIdType clientId, JobIdType jobId);
-    TranscodingErrorCode handleResume(ClientIdType clientId, JobIdType jobId,
-                                      const TranscodingRequestParcel& request,
-                                      const std::shared_ptr<ITranscodingClientCallback>& callback);
-    TranscodingErrorCode setupTranscoder(
-            ClientIdType clientId, JobIdType jobId, const TranscodingRequestParcel& request,
-            const std::shared_ptr<ITranscodingClientCallback>& callback,
-            const std::shared_ptr<const Parcel>& pausedState = nullptr);
+    media_status_t handleStart(ClientIdType clientId, JobIdType jobId,
+                               const TranscodingRequestParcel& request,
+                               const std::shared_ptr<ITranscodingClientCallback>& callback);
+    media_status_t handlePause(ClientIdType clientId, JobIdType jobId);
+    media_status_t handleResume(ClientIdType clientId, JobIdType jobId,
+                                const TranscodingRequestParcel& request,
+                                const std::shared_ptr<ITranscodingClientCallback>& callback);
+    media_status_t setupTranscoder(ClientIdType clientId, JobIdType jobId,
+                                   const TranscodingRequestParcel& request,
+                                   const std::shared_ptr<ITranscodingClientCallback>& callback,
+                                   const std::shared_ptr<const Parcel>& pausedState = nullptr);
 
     void cleanup();
+    void reportError(ClientIdType clientId, JobIdType jobId, media_status_t err);
     void queueEvent(Event::Type type, ClientIdType clientId, JobIdType jobId,
-                    const std::function<void()> runnable);
+                    const std::function<void()> runnable, int32_t arg = 0);
     void threadLoop();
 };
 
diff --git a/media/libmediatranscoding/include/media/TranscodingClientManager.h b/media/libmediatranscoding/include/media/TranscodingClientManager.h
index a62ad8c..015a83a 100644
--- a/media/libmediatranscoding/include/media/TranscodingClientManager.h
+++ b/media/libmediatranscoding/include/media/TranscodingClientManager.h
@@ -58,16 +58,14 @@
      * already been added, it will also return non-zero errorcode.
      *
      * @param callback client callback for the service to call this client.
-     * @param pid client's process id.
-     * @param uid client's user id.
      * @param clientName client's name.
      * @param opPackageName client's package name.
      * @param client output holding the ITranscodingClient interface for the client
      *        to use for subsequent communications with the service.
      * @return 0 if client is added successfully, non-zero errorcode otherwise.
      */
-    status_t addClient(const std::shared_ptr<ITranscodingClientCallback>& callback, pid_t pid,
-                       uid_t uid, const std::string& clientName, const std::string& opPackageName,
+    status_t addClient(const std::shared_ptr<ITranscodingClientCallback>& callback,
+                       const std::string& clientName, const std::string& opPackageName,
                        std::shared_ptr<ITranscodingClient>* client);
 
     /**
diff --git a/media/libmediatranscoding/include/media/TranscodingJobScheduler.h b/media/libmediatranscoding/include/media/TranscodingJobScheduler.h
index 5ccadad..8f5e2aa 100644
--- a/media/libmediatranscoding/include/media/TranscodingJobScheduler.h
+++ b/media/libmediatranscoding/include/media/TranscodingJobScheduler.h
@@ -18,6 +18,7 @@
 #define ANDROID_MEDIA_TRANSCODING_JOB_SCHEDULER_H
 
 #include <aidl/android/media/TranscodingJobPriority.h>
+#include <media/ResourcePolicyInterface.h>
 #include <media/SchedulerClientInterface.h>
 #include <media/TranscoderInterface.h>
 #include <media/TranscodingRequest.h>
@@ -34,7 +35,8 @@
 
 class TranscodingJobScheduler : public UidPolicyCallbackInterface,
                                 public SchedulerClientInterface,
-                                public TranscoderCallbackInterface {
+                                public TranscoderCallbackInterface,
+                                public ResourcePolicyCallbackInterface {
 public:
     virtual ~TranscodingJobScheduler();
 
@@ -58,9 +60,12 @@
 
     // UidPolicyCallbackInterface
     void onTopUidsChanged(const std::unordered_set<uid_t>& uids) override;
-    void onResourceAvailable() override;
     // ~UidPolicyCallbackInterface
 
+    // ResourcePolicyCallbackInterface
+    void onResourceAvailable() override;
+    // ~ResourcePolicyCallbackInterface
+
 private:
     friend class MediaTranscodingService;
     friend class TranscodingJobSchedulerTest;
@@ -96,13 +101,15 @@
 
     std::shared_ptr<TranscoderInterface> mTranscoder;
     std::shared_ptr<UidPolicyInterface> mUidPolicy;
+    std::shared_ptr<ResourcePolicyInterface> mResourcePolicy;
 
     Job* mCurrentJob;
     bool mResourceLost;
 
     // Only allow MediaTranscodingService and unit tests to instantiate.
     TranscodingJobScheduler(const std::shared_ptr<TranscoderInterface>& transcoder,
-                            const std::shared_ptr<UidPolicyInterface>& uidPolicy);
+                            const std::shared_ptr<UidPolicyInterface>& uidPolicy,
+                            const std::shared_ptr<ResourcePolicyInterface>& resourcePolicy);
 
     Job* getTopJob_l();
     void updateCurrentJob_l();
diff --git a/media/libmediatranscoding/include/media/TranscodingRequest.h b/media/libmediatranscoding/include/media/TranscodingRequest.h
index 63de1fb..a6cfed2 100644
--- a/media/libmediatranscoding/include/media/TranscodingRequest.h
+++ b/media/libmediatranscoding/include/media/TranscodingRequest.h
@@ -37,6 +37,8 @@
     void setTo(const TranscodingRequestParcel& parcel) {
         sourceFilePath = parcel.sourceFilePath;
         destinationFilePath = parcel.destinationFilePath;
+        clientUid = parcel.clientUid;
+        clientPid = parcel.clientPid;
         transcodingType = parcel.transcodingType;
         requestedVideoTrackFormat = parcel.requestedVideoTrackFormat;
         priority = parcel.priority;
diff --git a/media/libmediatranscoding/include/media/TranscodingResourcePolicy.h b/media/libmediatranscoding/include/media/TranscodingResourcePolicy.h
new file mode 100644
index 0000000..0836eda
--- /dev/null
+++ b/media/libmediatranscoding/include/media/TranscodingResourcePolicy.h
@@ -0,0 +1,65 @@
+/*
+ * Copyright (C) 2020 The Android Open Source Project
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ *      http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+#ifndef ANDROID_MEDIA_TRANSCODING_RESOURCE_POLICY_H
+#define ANDROID_MEDIA_TRANSCODING_RESOURCE_POLICY_H
+
+#include <android/binder_auto_utils.h>
+#include <media/ResourcePolicyInterface.h>
+#include <utils/Condition.h>
+
+#include <mutex>
+namespace aidl {
+namespace android {
+namespace media {
+class IResourceObserverService;
+}
+}  // namespace android
+}  // namespace aidl
+
+namespace android {
+
+using ::aidl::android::media::IResourceObserverService;
+
+class TranscodingResourcePolicy : public ResourcePolicyInterface {
+public:
+    explicit TranscodingResourcePolicy();
+    ~TranscodingResourcePolicy();
+
+    void setCallback(const std::shared_ptr<ResourcePolicyCallbackInterface>& cb) override;
+
+private:
+    struct ResourceObserver;
+    mutable std::mutex mRegisteredLock;
+    bool mRegistered GUARDED_BY(mRegisteredLock);
+    std::shared_ptr<IResourceObserverService> mService GUARDED_BY(mRegisteredLock);
+    std::shared_ptr<ResourceObserver> mObserver;
+
+    mutable std::mutex mCallbackLock;
+    std::weak_ptr<ResourcePolicyCallbackInterface> mResourcePolicyCallback
+            GUARDED_BY(mCallbackLock);
+
+    ::ndk::ScopedAIBinder_DeathRecipient mDeathRecipient;
+
+    static void BinderDiedCallback(void* cookie);
+
+    void registerSelf();
+    void unregisterSelf();
+    void onResourceAvailable();
+};  // class TranscodingUidPolicy
+
+}  // namespace android
+#endif  // ANDROID_MEDIA_TRANSCODING_RESOURCE_POLICY_H
diff --git a/media/libmediatranscoding/include/media/TranscodingUidPolicy.h b/media/libmediatranscoding/include/media/TranscodingUidPolicy.h
index 27dadd2..8319eee 100644
--- a/media/libmediatranscoding/include/media/TranscodingUidPolicy.h
+++ b/media/libmediatranscoding/include/media/TranscodingUidPolicy.h
@@ -53,10 +53,12 @@
     void setUidObserverRegistered(bool registerd);
     void registerSelf();
     void unregisterSelf();
+    void setProcessInfoOverride();
     int32_t getProcState_l(uid_t uid) NO_THREAD_SAFETY_ANALYSIS;
     void updateTopUid_l() NO_THREAD_SAFETY_ANALYSIS;
 
     struct UidObserver;
+    struct ResourceManagerClient;
     mutable Mutex mUidLock;
     std::shared_ptr<ActivityManager> mAm;
     sp<UidObserver> mUidObserver;
@@ -65,6 +67,7 @@
     std::unordered_map<uid_t, int32_t> mUidStateMap GUARDED_BY(mUidLock);
     std::map<int32_t, std::unordered_set<uid_t>> mStateUidMap GUARDED_BY(mUidLock);
     std::weak_ptr<UidPolicyCallbackInterface> mUidPolicyCallback;
+    std::shared_ptr<ResourceManagerClient> mProcInfoOverrideClient;
 };  // class TranscodingUidPolicy
 
 }  // namespace android
diff --git a/media/libmediatranscoding/include/media/UidPolicyInterface.h b/media/libmediatranscoding/include/media/UidPolicyInterface.h
index dc28027..f88c1ed 100644
--- a/media/libmediatranscoding/include/media/UidPolicyInterface.h
+++ b/media/libmediatranscoding/include/media/UidPolicyInterface.h
@@ -41,19 +41,13 @@
     virtual ~UidPolicyInterface() = default;
 };
 
-// Interface for notifying the scheduler of a change in uid states or
-// transcoding resource availability.
+// Interface for notifying the scheduler of a change in uid states.
 class UidPolicyCallbackInterface {
 public:
     // Called when the set of uids that's top priority among the uids of interest
     // has changed. The receiver of this callback should adjust accordingly.
     virtual void onTopUidsChanged(const std::unordered_set<uid_t>& uids) = 0;
 
-    // Called when resources become available for transcoding use. The scheduler
-    // may use this as a signal to attempt restart transcoding activity that
-    // were previously paused due to temporary resource loss.
-    virtual void onResourceAvailable() = 0;
-
 protected:
     virtual ~UidPolicyCallbackInterface() = default;
 };
diff --git a/media/libmediatranscoding/tests/TranscodingClientManager_tests.cpp b/media/libmediatranscoding/tests/TranscodingClientManager_tests.cpp
index 1583325..41f3ada 100644
--- a/media/libmediatranscoding/tests/TranscodingClientManager_tests.cpp
+++ b/media/libmediatranscoding/tests/TranscodingClientManager_tests.cpp
@@ -43,12 +43,11 @@
 using ::aidl::android::media::TranscodingRequestParcel;
 using ::aidl::android::media::TranscodingResultParcel;
 
-constexpr pid_t kInvalidClientPid = -1;
+constexpr pid_t kInvalidClientPid = -5;
+constexpr pid_t kInvalidClientUid = -10;
 constexpr const char* kInvalidClientName = "";
 constexpr const char* kInvalidClientPackage = "";
 
-constexpr pid_t kClientPid = 2;
-constexpr uid_t kClientUid = 3;
 constexpr const char* kClientName = "TestClientName";
 constexpr const char* kClientPackage = "TestClientPackage";
 
@@ -236,17 +235,17 @@
     ~TranscodingClientManagerTest() { ALOGD("TranscodingClientManagerTest destroyed"); }
 
     void addMultipleClients() {
-        EXPECT_EQ(mClientManager->addClient(mClientCallback1, kClientPid, kClientUid, kClientName,
+        EXPECT_EQ(mClientManager->addClient(mClientCallback1, kClientName,
                                             kClientPackage, &mClient1),
                   OK);
         EXPECT_NE(mClient1, nullptr);
 
-        EXPECT_EQ(mClientManager->addClient(mClientCallback2, kClientPid, kClientUid, kClientName,
+        EXPECT_EQ(mClientManager->addClient(mClientCallback2, kClientName,
                                             kClientPackage, &mClient2),
                   OK);
         EXPECT_NE(mClient2, nullptr);
 
-        EXPECT_EQ(mClientManager->addClient(mClientCallback3, kClientPid, kClientUid, kClientName,
+        EXPECT_EQ(mClientManager->addClient(mClientCallback3, kClientName,
                                             kClientPackage, &mClient3),
                   OK);
         EXPECT_NE(mClient3, nullptr);
@@ -274,23 +273,23 @@
 TEST_F(TranscodingClientManagerTest, TestAddingWithInvalidClientCallback) {
     // Add a client with null callback and expect failure.
     std::shared_ptr<ITranscodingClient> client;
-    status_t err = mClientManager->addClient(nullptr, kClientPid, kClientUid, kClientName,
+    status_t err = mClientManager->addClient(nullptr, kClientName,
                                              kClientPackage, &client);
     EXPECT_EQ(err, IMediaTranscodingService::ERROR_ILLEGAL_ARGUMENT);
 }
-
-TEST_F(TranscodingClientManagerTest, TestAddingWithInvalidClientPid) {
-    // Add a client with invalid Pid and expect failure.
-    std::shared_ptr<ITranscodingClient> client;
-    status_t err = mClientManager->addClient(mClientCallback1, kInvalidClientPid, kClientUid,
-                                             kClientName, kClientPackage, &client);
-    EXPECT_EQ(err, IMediaTranscodingService::ERROR_ILLEGAL_ARGUMENT);
-}
+//
+//TEST_F(TranscodingClientManagerTest, TestAddingWithInvalidClientPid) {
+//    // Add a client with invalid Pid and expect failure.
+//    std::shared_ptr<ITranscodingClient> client;
+//    status_t err = mClientManager->addClient(mClientCallback1,
+//                                             kClientName, kClientPackage, &client);
+//    EXPECT_EQ(err, IMediaTranscodingService::ERROR_ILLEGAL_ARGUMENT);
+//}
 
 TEST_F(TranscodingClientManagerTest, TestAddingWithInvalidClientName) {
     // Add a client with invalid name and expect failure.
     std::shared_ptr<ITranscodingClient> client;
-    status_t err = mClientManager->addClient(mClientCallback1, kClientPid, kClientUid,
+    status_t err = mClientManager->addClient(mClientCallback1,
                                              kInvalidClientName, kClientPackage, &client);
     EXPECT_EQ(err, IMediaTranscodingService::ERROR_ILLEGAL_ARGUMENT);
 }
@@ -298,7 +297,7 @@
 TEST_F(TranscodingClientManagerTest, TestAddingWithInvalidClientPackageName) {
     // Add a client with invalid packagename and expect failure.
     std::shared_ptr<ITranscodingClient> client;
-    status_t err = mClientManager->addClient(mClientCallback1, kClientPid, kClientUid, kClientName,
+    status_t err = mClientManager->addClient(mClientCallback1, kClientName,
                                              kInvalidClientPackage, &client);
     EXPECT_EQ(err, IMediaTranscodingService::ERROR_ILLEGAL_ARGUMENT);
 }
@@ -306,7 +305,7 @@
 TEST_F(TranscodingClientManagerTest, TestAddingValidClient) {
     // Add a valid client, should succeed.
     std::shared_ptr<ITranscodingClient> client;
-    status_t err = mClientManager->addClient(mClientCallback1, kClientPid, kClientUid, kClientName,
+    status_t err = mClientManager->addClient(mClientCallback1, kClientName,
                                              kClientPackage, &client);
     EXPECT_EQ(err, OK);
     EXPECT_NE(client.get(), nullptr);
@@ -320,14 +319,14 @@
 
 TEST_F(TranscodingClientManagerTest, TestAddingDupliacteClient) {
     std::shared_ptr<ITranscodingClient> client;
-    status_t err = mClientManager->addClient(mClientCallback1, kClientPid, kClientUid, kClientName,
+    status_t err = mClientManager->addClient(mClientCallback1, kClientName,
                                              kClientPackage, &client);
     EXPECT_EQ(err, OK);
     EXPECT_NE(client.get(), nullptr);
     EXPECT_EQ(mClientManager->getNumOfClients(), 1);
 
     std::shared_ptr<ITranscodingClient> dupClient;
-    err = mClientManager->addClient(mClientCallback1, kClientPid, kClientUid, "dupClient",
+    err = mClientManager->addClient(mClientCallback1, "dupClient",
                                     "dupPackage", &dupClient);
     EXPECT_EQ(err, IMediaTranscodingService::ERROR_ALREADY_EXISTS);
     EXPECT_EQ(dupClient.get(), nullptr);
@@ -337,8 +336,7 @@
     EXPECT_TRUE(status.isOk());
     EXPECT_EQ(mClientManager->getNumOfClients(), 0);
 
-    err = mClientManager->addClient(mClientCallback1, kClientPid, kClientUid, "dupClient",
-                                    "dupPackage", &dupClient);
+    err = mClientManager->addClient(mClientCallback1, "dupClient", "dupPackage", &dupClient);
     EXPECT_EQ(err, OK);
     EXPECT_NE(dupClient.get(), nullptr);
     EXPECT_EQ(mClientManager->getNumOfClients(), 1);
@@ -385,6 +383,14 @@
     EXPECT_TRUE(mClient1->submitRequest(badRequest, &job, &result).isOk());
     EXPECT_FALSE(result);
 
+    // Test submit with bad pid/uid.
+    badRequest.sourceFilePath = "test_source_file_3";
+    badRequest.destinationFilePath = "test_desintaion_file_3";
+    badRequest.clientPid = kInvalidClientPid;
+    badRequest.clientUid = kInvalidClientUid;
+    EXPECT_TRUE(mClient1->submitRequest(badRequest, &job, &result).isOk());
+    EXPECT_FALSE(result);
+
     // Test get jobs by id.
     EXPECT_TRUE(mClient1->getJobWithId(JOB(2), &job, &result).isOk());
     EXPECT_EQ(job.jobId, JOB(2));
@@ -468,7 +474,7 @@
 TEST_F(TranscodingClientManagerTest, TestUseAfterUnregister) {
     // Add a client.
     std::shared_ptr<ITranscodingClient> client;
-    status_t err = mClientManager->addClient(mClientCallback1, kClientPid, kClientUid, kClientName,
+    status_t err = mClientManager->addClient(mClientCallback1, kClientName,
                                              kClientPackage, &client);
     EXPECT_EQ(err, OK);
     EXPECT_NE(client.get(), nullptr);
diff --git a/media/libmediatranscoding/tests/TranscodingJobScheduler_tests.cpp b/media/libmediatranscoding/tests/TranscodingJobScheduler_tests.cpp
index d21b595..9b9df87 100644
--- a/media/libmediatranscoding/tests/TranscodingJobScheduler_tests.cpp
+++ b/media/libmediatranscoding/tests/TranscodingJobScheduler_tests.cpp
@@ -213,7 +213,8 @@
         ALOGI("TranscodingJobSchedulerTest set up");
         mTranscoder.reset(new TestTranscoder());
         mUidPolicy.reset(new TestUidPolicy());
-        mScheduler.reset(new TranscodingJobScheduler(mTranscoder, mUidPolicy));
+        mScheduler.reset(
+                new TranscodingJobScheduler(mTranscoder, mUidPolicy, nullptr /*resourcePolicy*/));
         mUidPolicy->setCallback(mScheduler);
 
         // Set priority only, ignore other fields for now.
diff --git a/media/libmediatranscoding/transcoder/MediaTranscoder.cpp b/media/libmediatranscoding/transcoder/MediaTranscoder.cpp
index e850d66..f35ea99 100644
--- a/media/libmediatranscoding/transcoder/MediaTranscoder.cpp
+++ b/media/libmediatranscoding/transcoder/MediaTranscoder.cpp
@@ -284,7 +284,7 @@
         format = std::shared_ptr<AMediaFormat>(mergedFormat, &AMediaFormat_delete);
     }
 
-    transcoder->configure(mSampleReader, trackIndex, format);
+    status = transcoder->configure(mSampleReader, trackIndex, format);
     if (status != AMEDIA_OK) {
         LOG(ERROR) << "Configure track transcoder for track #" << trackIndex << " returned error "
                    << status;
diff --git a/media/libshmem/Android.bp b/media/libshmem/Android.bp
index ee33f9e..fae98ed 100644
--- a/media/libshmem/Android.bp
+++ b/media/libshmem/Android.bp
@@ -15,12 +15,12 @@
         "libbinder",
         "libshmemutil",
         "libutils",
-        "shared-file-region-aidl-cpp",
+        "shared-file-region-aidl-unstable-cpp",
     ],
     export_shared_lib_headers: [
         "libbinder",
         "libutils",
-        "shared-file-region-aidl-cpp",
+        "shared-file-region-aidl-unstable-cpp",
     ],
 }
 
@@ -29,10 +29,10 @@
     export_include_dirs: ["include"],
     srcs: ["ShmemUtil.cpp"],
     shared_libs: [
-        "shared-file-region-aidl-cpp",
+        "shared-file-region-aidl-unstable-cpp",
     ],
     export_shared_lib_headers: [
-        "shared-file-region-aidl-cpp",
+        "shared-file-region-aidl-unstable-cpp",
     ],
 }
 
@@ -44,7 +44,7 @@
         "libshmemcompat",
         "libshmemutil",
         "libutils",
-        "shared-file-region-aidl-cpp",
+        "shared-file-region-aidl-unstable-cpp",
     ],
     test_suites: ["device-tests"],
 }
diff --git a/media/libstagefright/ACodec.cpp b/media/libstagefright/ACodec.cpp
index 382491e..d2f347c 100644
--- a/media/libstagefright/ACodec.cpp
+++ b/media/libstagefright/ACodec.cpp
@@ -2238,6 +2238,12 @@
             }
             err = setupG711Codec(encoder, sampleRate, numChannels);
         }
+    } else if (!strcasecmp(mime, MEDIA_MIMETYPE_AUDIO_OPUS)) {
+        int32_t numChannels = 1, sampleRate = 48000;
+        if (msg->findInt32("channel-count", &numChannels) &&
+            msg->findInt32("sample-rate", &sampleRate)) {
+            err = setupOpusCodec(encoder, sampleRate, numChannels);
+        }
     } else if (!strcasecmp(mime, MEDIA_MIMETYPE_AUDIO_FLAC)) {
         // numChannels needs to be set to properly communicate PCM values.
         int32_t numChannels = 2, sampleRate = 44100, compressionLevel = -1;
@@ -3117,6 +3123,26 @@
             kPortIndexInput, sampleRate, numChannels);
 }
 
+status_t ACodec::setupOpusCodec(bool encoder, int32_t sampleRate, int32_t numChannels) {
+    if (encoder) {
+        return INVALID_OPERATION;
+    }
+    OMX_AUDIO_PARAM_ANDROID_OPUSTYPE def;
+    InitOMXParams(&def);
+    def.nPortIndex = kPortIndexInput;
+    status_t err = mOMXNode->getParameter(
+            (OMX_INDEXTYPE)OMX_IndexParamAudioAndroidOpus, &def, sizeof(def));
+    if (err != OK) {
+        ALOGE("setupOpusCodec(): Error %d getting OMX_IndexParamAudioAndroidOpus parameter", err);
+        return err;
+    }
+    def.nSampleRate = sampleRate;
+    def.nChannels = numChannels;
+    err = mOMXNode->setParameter(
+           (OMX_INDEXTYPE)OMX_IndexParamAudioAndroidOpus, &def, sizeof(def));
+    return err;
+}
+
 status_t ACodec::setupFlacCodec(
         bool encoder, int32_t numChannels, int32_t sampleRate, int32_t compressionLevel,
         AudioEncoding encoding) {
diff --git a/media/libstagefright/Android.bp b/media/libstagefright/Android.bp
index c180edf..16977d7 100644
--- a/media/libstagefright/Android.bp
+++ b/media/libstagefright/Android.bp
@@ -211,7 +211,7 @@
     ],
 
     static_libs: [
-        "librenderengine",
+        "librenderfright",
     ],
 
     export_include_dirs: [
diff --git a/media/libstagefright/MediaCodec.cpp b/media/libstagefright/MediaCodec.cpp
index 5015787..86372e3 100644
--- a/media/libstagefright/MediaCodec.cpp
+++ b/media/libstagefright/MediaCodec.cpp
@@ -1009,6 +1009,12 @@
     return err;
 }
 
+void MediaCodec::PostReplyWithError(const sp<AMessage> &msg, int32_t err) {
+    sp<AReplyToken> replyID;
+    CHECK(msg->senderAwaitsResponse(&replyID));
+    PostReplyWithError(replyID, err);
+}
+
 void MediaCodec::PostReplyWithError(const sp<AReplyToken> &replyID, int32_t err) {
     int32_t finalErr = err;
     if (mReleasedByResourceManager) {
@@ -1512,7 +1518,6 @@
     mStickyError = OK;
 
     // reset state not reset by setState(UNINITIALIZED)
-    mReplyID = 0;
     mDequeueInputReplyID = 0;
     mDequeueOutputReplyID = 0;
     mDequeueInputTimeoutGeneration = 0;
@@ -2165,7 +2170,7 @@
                                 if (mState == RELEASING) {
                                     mComponentName.clear();
                                 }
-                                (new AMessage)->postReply(mReplyID);
+                                postPendingRepliesAndDeferredMessages();
                                 sendErrorResponse = false;
                             }
                             break;
@@ -2191,7 +2196,7 @@
                         case FLUSHED:
                         case STARTED:
                         {
-                            sendErrorResponse = false;
+                            sendErrorResponse = (mReplyID != nullptr);
 
                             setStickyError(err);
                             postActivityNotificationIfPossible();
@@ -2221,7 +2226,7 @@
 
                         default:
                         {
-                            sendErrorResponse = false;
+                            sendErrorResponse = (mReplyID != nullptr);
 
                             setStickyError(err);
                             postActivityNotificationIfPossible();
@@ -2248,7 +2253,15 @@
                     }
 
                     if (sendErrorResponse) {
-                        PostReplyWithError(mReplyID, err);
+                        // TRICKY: replicate PostReplyWithError logic for
+                        //         err code override
+                        int32_t finalErr = err;
+                        if (mReleasedByResourceManager) {
+                            // override the err code if MediaCodec has been
+                            // released by ResourceManager.
+                            finalErr = DEAD_OBJECT;
+                        }
+                        postPendingRepliesAndDeferredMessages(finalErr);
                     }
                     break;
                 }
@@ -2296,7 +2309,7 @@
                                 MediaResource::CodecResource(mFlags & kFlagIsSecure, mIsVideo));
                     }
 
-                    (new AMessage)->postReply(mReplyID);
+                    postPendingRepliesAndDeferredMessages();
                     break;
                 }
 
@@ -2335,7 +2348,7 @@
                         mFlags |= kFlagUsesSoftwareRenderer;
                     }
                     setState(CONFIGURED);
-                    (new AMessage)->postReply(mReplyID);
+                    postPendingRepliesAndDeferredMessages();
 
                     // augment our media metrics info, now that we know more things
                     // such as what the codec extracted from any CSD passed in.
@@ -2380,6 +2393,12 @@
 
                 case kWhatInputSurfaceCreated:
                 {
+                    if (mState != CONFIGURED) {
+                        // state transitioned unexpectedly; we should have replied already.
+                        ALOGD("received kWhatInputSurfaceCreated message in state %s",
+                                stateString(mState).c_str());
+                        break;
+                    }
                     // response to initiateCreateInputSurface()
                     status_t err = NO_ERROR;
                     sp<AMessage> response = new AMessage;
@@ -2398,12 +2417,18 @@
                     } else {
                         response->setInt32("err", err);
                     }
-                    response->postReply(mReplyID);
+                    postPendingRepliesAndDeferredMessages(response);
                     break;
                 }
 
                 case kWhatInputSurfaceAccepted:
                 {
+                    if (mState != CONFIGURED) {
+                        // state transitioned unexpectedly; we should have replied already.
+                        ALOGD("received kWhatInputSurfaceAccepted message in state %s",
+                                stateString(mState).c_str());
+                        break;
+                    }
                     // response to initiateSetInputSurface()
                     status_t err = NO_ERROR;
                     sp<AMessage> response = new AMessage();
@@ -2414,19 +2439,25 @@
                     } else {
                         response->setInt32("err", err);
                     }
-                    response->postReply(mReplyID);
+                    postPendingRepliesAndDeferredMessages(response);
                     break;
                 }
 
                 case kWhatSignaledInputEOS:
                 {
+                    if (!isExecuting()) {
+                        // state transitioned unexpectedly; we should have replied already.
+                        ALOGD("received kWhatSignaledInputEOS message in state %s",
+                                stateString(mState).c_str());
+                        break;
+                    }
                     // response to signalEndOfInputStream()
                     sp<AMessage> response = new AMessage;
                     status_t err;
                     if (msg->findInt32("err", &err)) {
                         response->setInt32("err", err);
                     }
-                    response->postReply(mReplyID);
+                    postPendingRepliesAndDeferredMessages(response);
                     break;
                 }
 
@@ -2446,7 +2477,7 @@
                                 MediaResource::GraphicMemoryResource(getGraphicBufferSize()));
                     }
                     setState(STARTED);
-                    (new AMessage)->postReply(mReplyID);
+                    postPendingRepliesAndDeferredMessages();
                     break;
                 }
 
@@ -2583,7 +2614,7 @@
                         break;
                     }
                     setState(INITIALIZED);
-                    (new AMessage)->postReply(mReplyID);
+                    postPendingRepliesAndDeferredMessages();
                     break;
                 }
 
@@ -2608,7 +2639,7 @@
                     mReleaseSurface.reset();
 
                     if (mReplyID != nullptr) {
-                        (new AMessage)->postReply(mReplyID);
+                        postPendingRepliesAndDeferredMessages();
                     }
                     if (mAsyncReleaseCompleteNotification != nullptr) {
                         flushMediametrics();
@@ -2633,7 +2664,7 @@
                         mCodec->signalResume();
                     }
 
-                    (new AMessage)->postReply(mReplyID);
+                    postPendingRepliesAndDeferredMessages();
                     break;
                 }
 
@@ -2645,14 +2676,18 @@
 
         case kWhatInit:
         {
-            sp<AReplyToken> replyID;
-            CHECK(msg->senderAwaitsResponse(&replyID));
-
             if (mState != UNINITIALIZED) {
-                PostReplyWithError(replyID, INVALID_OPERATION);
+                PostReplyWithError(msg, INVALID_OPERATION);
                 break;
             }
 
+            if (mReplyID) {
+                mDeferredMessages.push_back(msg);
+                break;
+            }
+            sp<AReplyToken> replyID;
+            CHECK(msg->senderAwaitsResponse(&replyID));
+
             mReplyID = replyID;
             setState(INITIALIZING);
 
@@ -2714,14 +2749,18 @@
 
         case kWhatConfigure:
         {
-            sp<AReplyToken> replyID;
-            CHECK(msg->senderAwaitsResponse(&replyID));
-
             if (mState != INITIALIZED) {
-                PostReplyWithError(replyID, INVALID_OPERATION);
+                PostReplyWithError(msg, INVALID_OPERATION);
                 break;
             }
 
+            if (mReplyID) {
+                mDeferredMessages.push_back(msg);
+                break;
+            }
+            sp<AReplyToken> replyID;
+            CHECK(msg->senderAwaitsResponse(&replyID));
+
             sp<RefBase> obj;
             CHECK(msg->findObject("surface", &obj));
 
@@ -2859,15 +2898,19 @@
         case kWhatCreateInputSurface:
         case kWhatSetInputSurface:
         {
-            sp<AReplyToken> replyID;
-            CHECK(msg->senderAwaitsResponse(&replyID));
-
             // Must be configured, but can't have been started yet.
             if (mState != CONFIGURED) {
-                PostReplyWithError(replyID, INVALID_OPERATION);
+                PostReplyWithError(msg, INVALID_OPERATION);
                 break;
             }
 
+            if (mReplyID) {
+                mDeferredMessages.push_back(msg);
+                break;
+            }
+            sp<AReplyToken> replyID;
+            CHECK(msg->senderAwaitsResponse(&replyID));
+
             mReplyID = replyID;
             if (msg->what() == kWhatCreateInputSurface) {
                 mCodec->initiateCreateInputSurface();
@@ -2882,9 +2925,6 @@
         }
         case kWhatStart:
         {
-            sp<AReplyToken> replyID;
-            CHECK(msg->senderAwaitsResponse(&replyID));
-
             if (mState == FLUSHED) {
                 setState(STARTED);
                 if (mHavePendingInputBuffers) {
@@ -2892,13 +2932,20 @@
                     mHavePendingInputBuffers = false;
                 }
                 mCodec->signalResume();
-                PostReplyWithError(replyID, OK);
+                PostReplyWithError(msg, OK);
                 break;
             } else if (mState != CONFIGURED) {
-                PostReplyWithError(replyID, INVALID_OPERATION);
+                PostReplyWithError(msg, INVALID_OPERATION);
                 break;
             }
 
+            if (mReplyID) {
+                mDeferredMessages.push_back(msg);
+                break;
+            }
+            sp<AReplyToken> replyID;
+            CHECK(msg->senderAwaitsResponse(&replyID));
+
             mReplyID = replyID;
             setState(STARTING);
 
@@ -2906,15 +2953,42 @@
             break;
         }
 
-        case kWhatStop:
+        case kWhatStop: {
+            if (mReplyID) {
+                mDeferredMessages.push_back(msg);
+                break;
+            }
+            [[fallthrough]];
+        }
         case kWhatRelease:
         {
             State targetState =
                 (msg->what() == kWhatStop) ? INITIALIZED : UNINITIALIZED;
 
+            if ((mState == RELEASING && targetState == UNINITIALIZED)
+                    || (mState == STOPPING && targetState == INITIALIZED)) {
+                mDeferredMessages.push_back(msg);
+                break;
+            }
+
             sp<AReplyToken> replyID;
             CHECK(msg->senderAwaitsResponse(&replyID));
 
+            sp<AMessage> asyncNotify;
+            (void)msg->findMessage("async", &asyncNotify);
+            // post asyncNotify if going out of scope.
+            struct AsyncNotifyPost {
+                AsyncNotifyPost(const sp<AMessage> &asyncNotify) : mAsyncNotify(asyncNotify) {}
+                ~AsyncNotifyPost() {
+                    if (mAsyncNotify) {
+                        mAsyncNotify->post();
+                    }
+                }
+                void clear() { mAsyncNotify.clear(); }
+            private:
+                sp<AMessage> mAsyncNotify;
+            } asyncNotifyPost{asyncNotify};
+
             // already stopped/released
             if (mState == UNINITIALIZED && mReleasedByResourceManager) {
                 sp<AMessage> response = new AMessage;
@@ -2926,7 +3000,13 @@
             int32_t reclaimed = 0;
             msg->findInt32("reclaimed", &reclaimed);
             if (reclaimed) {
-                mReleasedByResourceManager = true;
+                if (!mReleasedByResourceManager) {
+                    // notify the async client
+                    if (mFlags & kFlagIsAsync) {
+                        onError(DEAD_OBJECT, ACTION_CODE_FATAL);
+                    }
+                    mReleasedByResourceManager = true;
+                }
 
                 int32_t force = 0;
                 msg->findInt32("force", &force);
@@ -2938,10 +3018,6 @@
                     response->setInt32("err", WOULD_BLOCK);
                     response->postReply(replyID);
 
-                    // notify the async client
-                    if (mFlags & kFlagIsAsync) {
-                        onError(DEAD_OBJECT, ACTION_CODE_FATAL);
-                    }
                     break;
                 }
             }
@@ -2978,12 +3054,14 @@
             // after this, and we'll no longer be able to reply.
             if (mState == FLUSHING || mState == STOPPING
                     || mState == CONFIGURING || mState == STARTING) {
-                (new AMessage)->postReply(mReplyID);
+                // mReply is always set if in these states.
+                postPendingRepliesAndDeferredMessages();
             }
 
             if (mFlags & kFlagSawMediaServerDie) {
                 // It's dead, Jim. Don't expect initiateShutdown to yield
                 // any useful results now...
+                // Any pending reply would have been handled at kWhatError.
                 setState(UNINITIALIZED);
                 if (targetState == UNINITIALIZED) {
                     mComponentName.clear();
@@ -2997,12 +3075,12 @@
             // reply now with an error to unblock the client, client can
             // release after the failure (instead of ANR).
             if (msg->what() == kWhatStop && (mFlags & kFlagStickyError)) {
+                // Any pending reply would have been handled at kWhatError.
                 PostReplyWithError(replyID, getStickyError());
                 break;
             }
 
-            sp<AMessage> asyncNotify;
-            if (msg->findMessage("async", &asyncNotify) && asyncNotify != nullptr) {
+            if (asyncNotify != nullptr) {
                 if (mSurface != NULL) {
                     if (!mReleaseSurface) {
                         mReleaseSurface.reset(new ReleaseSurface);
@@ -3022,6 +3100,12 @@
                 }
             }
 
+            if (mReplyID) {
+                // State transition replies are handled above, so this reply
+                // would not be related to state transition. As we are
+                // shutting down the component, just fail the operation.
+                postPendingRepliesAndDeferredMessages(UNKNOWN_ERROR);
+            }
             mReplyID = replyID;
             setState(msg->what() == kWhatStop ? STOPPING : RELEASING);
 
@@ -3036,8 +3120,8 @@
 
             if (asyncNotify != nullptr) {
                 mResourceManagerProxy->markClientForPendingRemoval();
-                (new AMessage)->postReply(mReplyID);
-                mReplyID = 0;
+                postPendingRepliesAndDeferredMessages();
+                asyncNotifyPost.clear();
                 mAsyncReleaseCompleteNotification = asyncNotify;
             }
 
@@ -3208,17 +3292,21 @@
 
         case kWhatSignalEndOfInputStream:
         {
-            sp<AReplyToken> replyID;
-            CHECK(msg->senderAwaitsResponse(&replyID));
-
             if (!isExecuting() || !mHaveInputSurface) {
-                PostReplyWithError(replyID, INVALID_OPERATION);
+                PostReplyWithError(msg, INVALID_OPERATION);
                 break;
             } else if (mFlags & kFlagStickyError) {
-                PostReplyWithError(replyID, getStickyError());
+                PostReplyWithError(msg, getStickyError());
                 break;
             }
 
+            if (mReplyID) {
+                mDeferredMessages.push_back(msg);
+                break;
+            }
+            sp<AReplyToken> replyID;
+            CHECK(msg->senderAwaitsResponse(&replyID));
+
             mReplyID = replyID;
             mCodec->signalEndOfInputStream();
             break;
@@ -3260,17 +3348,21 @@
 
         case kWhatFlush:
         {
-            sp<AReplyToken> replyID;
-            CHECK(msg->senderAwaitsResponse(&replyID));
-
             if (!isExecuting()) {
-                PostReplyWithError(replyID, INVALID_OPERATION);
+                PostReplyWithError(msg, INVALID_OPERATION);
                 break;
             } else if (mFlags & kFlagStickyError) {
-                PostReplyWithError(replyID, getStickyError());
+                PostReplyWithError(msg, getStickyError());
                 break;
             }
 
+            if (mReplyID) {
+                mDeferredMessages.push_back(msg);
+                break;
+            }
+            sp<AReplyToken> replyID;
+            CHECK(msg->senderAwaitsResponse(&replyID));
+
             mReplyID = replyID;
             // TODO: skip flushing if already FLUSHED
             setState(FLUSHING);
@@ -4215,6 +4307,26 @@
     return OK;
 }
 
+void MediaCodec::postPendingRepliesAndDeferredMessages(status_t err /* = OK */) {
+    sp<AMessage> response{new AMessage};
+    if (err != OK) {
+        response->setInt32("err", err);
+    }
+    postPendingRepliesAndDeferredMessages(response);
+}
+
+void MediaCodec::postPendingRepliesAndDeferredMessages(const sp<AMessage> &response) {
+    CHECK(mReplyID);
+    response->postReply(mReplyID);
+    mReplyID.clear();
+    ALOGV_IF(!mDeferredMessages.empty(),
+            "posting %zu deferred messages", mDeferredMessages.size());
+    for (sp<AMessage> msg : mDeferredMessages) {
+        msg->post();
+    }
+    mDeferredMessages.clear();
+}
+
 std::string MediaCodec::stateString(State state) {
     const char *rval = NULL;
     char rawbuffer[16]; // room for "%d"
diff --git a/media/libstagefright/MediaMuxer.cpp b/media/libstagefright/MediaMuxer.cpp
index 8bbffd4..c91386d 100644
--- a/media/libstagefright/MediaMuxer.cpp
+++ b/media/libstagefright/MediaMuxer.cpp
@@ -92,7 +92,9 @@
     }
 
     sp<MetaData> trackMeta = new MetaData;
-    convertMessageToMetaData(format, trackMeta);
+    if (convertMessageToMetaData(format, trackMeta) != OK) {
+        return BAD_VALUE;
+    }
 
     sp<MediaAdapter> newTrack = new MediaAdapter(trackMeta);
     status_t result = mWriter->addSource(newTrack);
diff --git a/media/libstagefright/SurfaceUtils.cpp b/media/libstagefright/SurfaceUtils.cpp
index 85ff474..1f569ef 100644
--- a/media/libstagefright/SurfaceUtils.cpp
+++ b/media/libstagefright/SurfaceUtils.cpp
@@ -132,37 +132,47 @@
 }
 
 void setNativeWindowHdrMetadata(ANativeWindow *nativeWindow, HDRStaticInfo *info) {
-    struct android_smpte2086_metadata smpte2086_meta = {
-            .displayPrimaryRed = {
-                    info->sType1.mR.x * 0.00002f,
-                    info->sType1.mR.y * 0.00002f
-            },
-            .displayPrimaryGreen = {
-                    info->sType1.mG.x * 0.00002f,
-                    info->sType1.mG.y * 0.00002f
-            },
-            .displayPrimaryBlue = {
-                    info->sType1.mB.x * 0.00002f,
-                    info->sType1.mB.y * 0.00002f
-            },
-            .whitePoint = {
-                    info->sType1.mW.x * 0.00002f,
-                    info->sType1.mW.y * 0.00002f
-            },
-            .maxLuminance = (float) info->sType1.mMaxDisplayLuminance,
-            .minLuminance = info->sType1.mMinDisplayLuminance * 0.0001f
-    };
+    // If mastering max and min luminance fields are 0, do not use them.
+    // It indicates the value may not be present in the stream.
+    if ((float)info->sType1.mMaxDisplayLuminance > 0.0f &&
+        (info->sType1.mMinDisplayLuminance * 0.0001f) > 0.0f) {
+        struct android_smpte2086_metadata smpte2086_meta = {
+                .displayPrimaryRed = {
+                        info->sType1.mR.x * 0.00002f,
+                        info->sType1.mR.y * 0.00002f
+                },
+                .displayPrimaryGreen = {
+                        info->sType1.mG.x * 0.00002f,
+                        info->sType1.mG.y * 0.00002f
+                },
+                .displayPrimaryBlue = {
+                        info->sType1.mB.x * 0.00002f,
+                        info->sType1.mB.y * 0.00002f
+                },
+                .whitePoint = {
+                        info->sType1.mW.x * 0.00002f,
+                        info->sType1.mW.y * 0.00002f
+                },
+                .maxLuminance = (float) info->sType1.mMaxDisplayLuminance,
+                .minLuminance = info->sType1.mMinDisplayLuminance * 0.0001f
+        };
 
-    int err = native_window_set_buffers_smpte2086_metadata(nativeWindow, &smpte2086_meta);
-    ALOGW_IF(err != 0, "failed to set smpte2086 metadata on surface (%d)", err);
+        int err = native_window_set_buffers_smpte2086_metadata(nativeWindow, &smpte2086_meta);
+        ALOGW_IF(err != 0, "failed to set smpte2086 metadata on surface (%d)", err);
+    }
 
-    struct android_cta861_3_metadata cta861_meta = {
-            .maxContentLightLevel = (float) info->sType1.mMaxContentLightLevel,
-            .maxFrameAverageLightLevel = (float) info->sType1.mMaxFrameAverageLightLevel
-    };
+    // If the content light level fields are 0, do not use them, it
+    // indicates the value may not be present in the stream.
+    if ((float)info->sType1.mMaxContentLightLevel > 0.0f &&
+        (float)info->sType1.mMaxFrameAverageLightLevel > 0.0f) {
+        struct android_cta861_3_metadata cta861_meta = {
+                .maxContentLightLevel = (float) info->sType1.mMaxContentLightLevel,
+                .maxFrameAverageLightLevel = (float) info->sType1.mMaxFrameAverageLightLevel
+        };
 
-    err = native_window_set_buffers_cta861_3_metadata(nativeWindow, &cta861_meta);
-    ALOGW_IF(err != 0, "failed to set cta861_3 metadata on surface (%d)", err);
+        int err = native_window_set_buffers_cta861_3_metadata(nativeWindow, &cta861_meta);
+        ALOGW_IF(err != 0, "failed to set cta861_3 metadata on surface (%d)", err);
+    }
 }
 
 status_t setNativeWindowRotation(
diff --git a/media/libstagefright/TEST_MAPPING b/media/libstagefright/TEST_MAPPING
index 3dceef7..a95829c 100644
--- a/media/libstagefright/TEST_MAPPING
+++ b/media/libstagefright/TEST_MAPPING
@@ -1,12 +1,17 @@
 {
-  "presubmit": [
-    // TODO(b/148094059): unit tests not allowed to download content
-    // { "name": "HEVCUtilsUnitTest" },
-    //{ "name": "ExtractorFactoryTest" },
+  // tests which require dynamic content
+  // invoke with: atest -- --enable-module-dynamic-download=true
+  // TODO(b/148094059): unit tests not allowed to download content
+  "dynamic-presubmit": [
     // writerTest fails about 5 out of 66
-    // in addition to needing the download ability
-    //{ "name": "writerTest" },
+    // { "name": "writerTest" },
 
+    { "name": "HEVCUtilsUnitTest" },
+    { "name": "ExtractorFactoryTest" }
+
+  ],
+
+  "presubmit": [
     {
       "name": "CtsMediaTestCases",
       "options": [
diff --git a/media/libstagefright/Utils.cpp b/media/libstagefright/Utils.cpp
index d67874f..6446857 100644
--- a/media/libstagefright/Utils.cpp
+++ b/media/libstagefright/Utils.cpp
@@ -769,6 +769,7 @@
         { "sei", kKeySEI },
         { "text-format-data", kKeyTextFormatData },
         { "thumbnail-csd-hevc", kKeyThumbnailHVCC },
+        { "slow-motion-markers", kKeySlowMotionMarkers },
     }
 };
 
@@ -1663,13 +1664,16 @@
         meta->setInt32(kKeyColorMatrix, colorAspects.mMatrixCoeffs);
     }
 }
-
-void convertMessageToMetaData(const sp<AMessage> &msg, sp<MetaData> &meta) {
+/* Converts key and value pairs in AMessage format to MetaData format.
+ * Also checks for the presence of required keys.
+ */
+status_t convertMessageToMetaData(const sp<AMessage> &msg, sp<MetaData> &meta) {
     AString mime;
     if (msg->findString("mime", &mime)) {
         meta->setCString(kKeyMIMEType, mime.c_str());
     } else {
-        ALOGW("did not find mime type");
+        ALOGE("did not find mime type");
+        return BAD_VALUE;
     }
 
     convertMessageToMetaDataFromMappings(msg, meta);
@@ -1718,7 +1722,8 @@
             meta->setInt32(kKeyWidth, width);
             meta->setInt32(kKeyHeight, height);
         } else {
-            ALOGV("did not find width and/or height");
+            ALOGE("did not find width and/or height");
+            return BAD_VALUE;
         }
 
         int32_t sarWidth, sarHeight;
@@ -1803,14 +1808,14 @@
             }
         }
     } else if (mime.startsWith("audio/")) {
-        int32_t numChannels;
-        if (msg->findInt32("channel-count", &numChannels)) {
-            meta->setInt32(kKeyChannelCount, numChannels);
+        int32_t numChannels, sampleRate;
+        if (!msg->findInt32("channel-count", &numChannels) ||
+                !msg->findInt32("sample-rate", &sampleRate)) {
+            ALOGE("did not find channel-count and/or sample-rate");
+            return BAD_VALUE;
         }
-        int32_t sampleRate;
-        if (msg->findInt32("sample-rate", &sampleRate)) {
-            meta->setInt32(kKeySampleRate, sampleRate);
-        }
+        meta->setInt32(kKeyChannelCount, numChannels);
+        meta->setInt32(kKeySampleRate, sampleRate);
         int32_t bitsPerSample;
         if (msg->findInt32("bits-per-sample", &bitsPerSample)) {
             meta->setInt32(kKeyBitsPerSample, bitsPerSample);
@@ -1925,7 +1930,8 @@
                     }
                 }
             } else {
-                ALOGW("We need csd-2!!. %s", msg->debugString().c_str());
+                ALOGE("We need csd-2!!. %s", msg->debugString().c_str());
+                return BAD_VALUE;
             }
         } else if (mime == MEDIA_MIMETYPE_VIDEO_VP9) {
             meta->setData(kKeyVp9CodecPrivate, 0, csd0->data(), csd0->size());
@@ -1991,6 +1997,7 @@
     ALOGI("converted %s to:", msg->debugString(0).c_str());
     meta->dumpToLog();
 #endif
+    return OK;
 }
 
 status_t sendMetaDataToHal(sp<MediaPlayerBase::AudioSink>& sink,
diff --git a/media/libstagefright/codecs/amrnb/TEST_MAPPING b/media/libstagefright/codecs/amrnb/TEST_MAPPING
index 2909099..343d08a 100644
--- a/media/libstagefright/codecs/amrnb/TEST_MAPPING
+++ b/media/libstagefright/codecs/amrnb/TEST_MAPPING
@@ -1,11 +1,10 @@
 // mappings for frameworks/av/media/libstagefright/codecs/amrnb
 {
-  "presubmit": [
-    // TODO(b/148094059): unit tests not allowed to download content
-    // { "name": "AmrnbDecoderTest"},
-
-    // TODO(b/148094059): unit tests not allowed to download content
-    // { "name": "AmrnbEncoderTest"}
-
+  // tests which require dynamic content
+  // invoke with: atest -- --enable-module-dynamic-download=true
+  // TODO(b/148094059): unit tests not allowed to download content
+  "dynamic-presubmit": [
+    { "name": "AmrnbDecoderTest"},
+    { "name": "AmrnbEncoderTest"}
   ]
 }
diff --git a/media/libstagefright/codecs/amrwb/TEST_MAPPING b/media/libstagefright/codecs/amrwb/TEST_MAPPING
index 3d58ba2..0278d26 100644
--- a/media/libstagefright/codecs/amrwb/TEST_MAPPING
+++ b/media/libstagefright/codecs/amrwb/TEST_MAPPING
@@ -1,8 +1,10 @@
 // mappings for frameworks/av/media/libstagefright/codecs/amrwb
 {
-  "presubmit": [
-    // TODO(b/148094059): unit tests not allowed to download content
-    // { "name": "AmrwbDecoderTest"}
+  // tests which require dynamic content
+  // invoke with: atest -- --enable-module-dynamic-download=true
+  // TODO(b/148094059): unit tests not allowed to download content
+  "dynamic-presubmit": [
+    { "name": "AmrwbDecoderTest"}
 
   ]
 }
diff --git a/media/libstagefright/codecs/amrwb/test/Android.bp b/media/libstagefright/codecs/amrwb/test/Android.bp
index 968215a..e8a2aa9 100644
--- a/media/libstagefright/codecs/amrwb/test/Android.bp
+++ b/media/libstagefright/codecs/amrwb/test/Android.bp
@@ -16,6 +16,7 @@
 
 cc_test {
     name: "AmrwbDecoderTest",
+    test_suites: ["device-tests"],
     gtest: true,
 
     srcs: [
diff --git a/media/libstagefright/codecs/amrwbenc/TEST_MAPPING b/media/libstagefright/codecs/amrwbenc/TEST_MAPPING
index d53d665..045e8b3 100644
--- a/media/libstagefright/codecs/amrwbenc/TEST_MAPPING
+++ b/media/libstagefright/codecs/amrwbenc/TEST_MAPPING
@@ -1,8 +1,10 @@
 // mappings for frameworks/av/media/libstagefright/codecs/amrwbenc
 {
-  "presubmit": [
-    // TODO(b/148094059): unit tests not allowed to download content
-    // { "name": "AmrwbEncoderTest"}
+  // tests which require dynamic content
+  // invoke with: atest -- --enable-module-dynamic-download=true
+  // TODO(b/148094059): unit tests not allowed to download content
+  "dynamic-presubmit": [
+    { "name": "AmrwbEncoderTest"}
 
   ]
 }
diff --git a/media/libstagefright/codecs/amrwbenc/test/Android.bp b/media/libstagefright/codecs/amrwbenc/test/Android.bp
index 7042bc5..0872570 100644
--- a/media/libstagefright/codecs/amrwbenc/test/Android.bp
+++ b/media/libstagefright/codecs/amrwbenc/test/Android.bp
@@ -16,6 +16,7 @@
 
 cc_test {
     name: "AmrwbEncoderTest",
+    test_suites: ["device-tests"],
     gtest: true,
 
     srcs: [
diff --git a/media/libstagefright/codecs/m4v_h263/TEST_MAPPING b/media/libstagefright/codecs/m4v_h263/TEST_MAPPING
index 6b42847..ba3ff1c 100644
--- a/media/libstagefright/codecs/m4v_h263/TEST_MAPPING
+++ b/media/libstagefright/codecs/m4v_h263/TEST_MAPPING
@@ -1,7 +1,9 @@
 // mappings for frameworks/av/media/libstagefright/codecs/m4v_h263
 {
-  "presubmit": [
-    // TODO(b/148094059): unit tests not allowed to download content
+  // tests which require dynamic content
+  // invoke with: atest -- --enable-module-dynamic-download=true
+  // TODO(b/148094059): unit tests not allowed to download content
+  "dynamic-presubmit": [
 
     // the decoder reports something bad about an unexpected newline in the *config file
     // and the config file looks like the AndroidTest.xml file that we put in there.
@@ -9,8 +11,8 @@
     // between decode and encode AndroidTest.xml files -- except that encode does NOT
     // finish with a newline.
     // strange.
-    // { "name": "Mpeg4H263DecoderTest"},
-    // { "name": "Mpeg4H263EncoderTest"}
+    { "name": "Mpeg4H263DecoderTest"},
+    { "name": "Mpeg4H263EncoderTest"}
 
   ]
 }
diff --git a/media/libstagefright/codecs/mp3dec/TEST_MAPPING b/media/libstagefright/codecs/mp3dec/TEST_MAPPING
index b237d65..4ef4317 100644
--- a/media/libstagefright/codecs/mp3dec/TEST_MAPPING
+++ b/media/libstagefright/codecs/mp3dec/TEST_MAPPING
@@ -1,7 +1,9 @@
 // mappings for frameworks/av/media/libstagefright/codecs/mp3dec
 {
-  "presubmit": [
-    // TODO(b/148094059): unit tests not allowed to download content
-    // { "name": "Mp3DecoderTest"}
+  // tests which require dynamic content
+  // invoke with: atest -- --enable-module-dynamic-download=true
+  // TODO(b/148094059): unit tests not allowed to download content
+  "dynamic-presubmit": [
+    { "name": "Mp3DecoderTest"}
   ]
 }
diff --git a/media/libstagefright/codecs/mp3dec/src/pvmp3_dct_6.cpp b/media/libstagefright/codecs/mp3dec/src/pvmp3_dct_6.cpp
index 1f8018a..c306873 100644
--- a/media/libstagefright/codecs/mp3dec/src/pvmp3_dct_6.cpp
+++ b/media/libstagefright/codecs/mp3dec/src/pvmp3_dct_6.cpp
@@ -111,6 +111,7 @@
 ; FUNCTION CODE
 ----------------------------------------------------------------------------*/
 
+__attribute__((no_sanitize("integer")))
 void pvmp3_dct_6(int32 vec[])
 {
 
diff --git a/media/libstagefright/codecs/mp3dec/src/pvmp3_mdct_6.cpp b/media/libstagefright/codecs/mp3dec/src/pvmp3_mdct_6.cpp
index 8d80e8f..1ba080d 100644
--- a/media/libstagefright/codecs/mp3dec/src/pvmp3_mdct_6.cpp
+++ b/media/libstagefright/codecs/mp3dec/src/pvmp3_mdct_6.cpp
@@ -118,7 +118,7 @@
 ; FUNCTION CODE
 ----------------------------------------------------------------------------*/
 
-
+__attribute__((no_sanitize("integer")))
 void pvmp3_mdct_6(int32 vec[], int32 *history)
 {
     int32 i;
diff --git a/media/libstagefright/codecs/mp3dec/test/AndroidTest.xml b/media/libstagefright/codecs/mp3dec/test/AndroidTest.xml
index 7ff9732..233f9bb 100644
--- a/media/libstagefright/codecs/mp3dec/test/AndroidTest.xml
+++ b/media/libstagefright/codecs/mp3dec/test/AndroidTest.xml
@@ -19,7 +19,7 @@
         <option name="cleanup" value="true" />
         <option name="push" value="Mp3DecoderTest->/data/local/tmp/Mp3DecoderTest" />
         <option name="push-file"
-            key="https://storage.googleapis.com/android_media/frameworks/av/media/libstagefright/mp3dec/test/Mp3DecoderTest.zip?unzip=true"
+            key="https://storage.googleapis.com/android_media/frameworks/av/media/libstagefright/mp3dec/test/Mp3DecoderTest-1.1.zip?unzip=true"
             value="/data/local/tmp/Mp3DecoderTestRes/" />
     </target_preparer>
 
diff --git a/media/libstagefright/codecs/mp3dec/test/Mp3DecoderTest.cpp b/media/libstagefright/codecs/mp3dec/test/Mp3DecoderTest.cpp
index 99553ec..0784c0c 100644
--- a/media/libstagefright/codecs/mp3dec/test/Mp3DecoderTest.cpp
+++ b/media/libstagefright/codecs/mp3dec/test/Mp3DecoderTest.cpp
@@ -185,6 +185,7 @@
 INSTANTIATE_TEST_SUITE_P(Mp3DecoderTestAll, Mp3DecoderTest,
                          ::testing::Values(("bbb_44100hz_2ch_128kbps_mp3_30sec.mp3"),
                                            ("bbb_44100hz_2ch_128kbps_mp3_5mins.mp3"),
+                                           ("bug_136053885.mp3"),
                                            ("bbb_mp3_stereo_192kbps_48000hz.mp3")));
 
 int main(int argc, char **argv) {
diff --git a/media/libstagefright/codecs/opus/dec/SoftOpus.cpp b/media/libstagefright/codecs/opus/dec/SoftOpus.cpp
index 4f61aa8..5bb1879 100644
--- a/media/libstagefright/codecs/opus/dec/SoftOpus.cpp
+++ b/media/libstagefright/codecs/opus/dec/SoftOpus.cpp
@@ -58,6 +58,8 @@
       mInputBufferCount(0),
       mDecoder(NULL),
       mHeader(NULL),
+      mNumChannels(1),
+      mSamplingRate(kRate),
       mCodecDelay(0),
       mSeekPreRoll(0),
       mAnchorTimeUs(0),
@@ -169,11 +171,11 @@
             }
 
             opusParams->nAudioBandWidth = 0;
-            opusParams->nSampleRate = kRate;
+            opusParams->nSampleRate = mSamplingRate;
             opusParams->nBitRate = 0;
 
             if (!isConfigured()) {
-                opusParams->nChannels = 1;
+                opusParams->nChannels = mNumChannels;
             } else {
                 opusParams->nChannels = mHeader->channels;
             }
@@ -274,7 +276,8 @@
             if (opusParams->nPortIndex != 0) {
                 return OMX_ErrorUndefined;
             }
-
+            mNumChannels = opusParams->nChannels;
+            mSamplingRate = opusParams->nSampleRate;
             return OMX_ErrorNone;
         }
 
@@ -496,6 +499,8 @@
                                    *(reinterpret_cast<int64_t*>(inHeader->pBuffer +
                                                                 inHeader->nOffset)),
                                    kRate);
+                mSamplingRate = kRate;
+                mNumChannels = mHeader->channels;
                 notify(OMX_EventPortSettingsChanged, 1, 0, NULL);
                 mOutputPortSettingsChange = AWAITING_DISABLED;
             }
diff --git a/media/libstagefright/codecs/opus/dec/SoftOpus.h b/media/libstagefright/codecs/opus/dec/SoftOpus.h
index 91cafa1..00058c8 100644
--- a/media/libstagefright/codecs/opus/dec/SoftOpus.h
+++ b/media/libstagefright/codecs/opus/dec/SoftOpus.h
@@ -70,6 +70,8 @@
     OpusMSDecoder *mDecoder;
     OpusHeader *mHeader;
 
+    int32_t mNumChannels;
+    int32_t mSamplingRate;
     int64_t mCodecDelay;
     int64_t mSeekPreRoll;
     int64_t mSamplesToDiscard;
diff --git a/media/libstagefright/foundation/TEST_MAPPING b/media/libstagefright/foundation/TEST_MAPPING
index 0d6a6da..a70c352 100644
--- a/media/libstagefright/foundation/TEST_MAPPING
+++ b/media/libstagefright/foundation/TEST_MAPPING
@@ -1,9 +1,13 @@
 // mappings for frameworks/av/media/libstagefright/foundation
 {
-  "presubmit": [
-    // TODO(b/148094059): unit tests not allowed to download content
-    //{ "name": "OpusHeaderTest" },
+  // tests which require dynamic content
+  // invoke with: atest -- --enable-module-dynamic-download=true
+  // TODO(b/148094059): unit tests not allowed to download content
+  "dynamic-presubmit": [
+    { "name": "OpusHeaderTest" }
+  ],
 
+  "presubmit": [
     { "name": "sf_foundation_test" },
     { "name": "MetaDataBaseUnitTest"}
   ]
diff --git a/media/libstagefright/foundation/tests/OpusHeader/Android.bp b/media/libstagefright/foundation/tests/OpusHeader/Android.bp
index c1251a8..ed3298c 100644
--- a/media/libstagefright/foundation/tests/OpusHeader/Android.bp
+++ b/media/libstagefright/foundation/tests/OpusHeader/Android.bp
@@ -16,6 +16,7 @@
 
 cc_test {
     name: "OpusHeaderTest",
+    test_suites: ["device-tests"],
     gtest: true,
 
     srcs: [
diff --git a/media/libstagefright/id3/TEST_MAPPING b/media/libstagefright/id3/TEST_MAPPING
index e4454c1..d070d25 100644
--- a/media/libstagefright/id3/TEST_MAPPING
+++ b/media/libstagefright/id3/TEST_MAPPING
@@ -1,9 +1,13 @@
 // frameworks/av/media/libstagefright/id3
 {
-  "presubmit": [
-    // TODO(b/148094059): unit tests not allowed to download content
-    //{ "name": "ID3Test" },
+  // tests which require dynamic content
+  // invoke with: atest -- --enable-module-dynamic-download=true
+  // TODO(b/148094059): unit tests not allowed to download content
+  "dynamic-presubmit": [
+    { "name": "ID3Test" }
+  ],
 
+  "presubmit": [
     // this doesn't seem to run any tests.
     // but: cts-tradefed run -m CtsMediaTestCases -t android.media.cts.MediaMetadataRetrieverTest
     // does run he 32 and 64 bit tests, but not the instant tests
diff --git a/media/libstagefright/id3/test/Android.bp b/media/libstagefright/id3/test/Android.bp
index 9d26eec..acf38e2 100644
--- a/media/libstagefright/id3/test/Android.bp
+++ b/media/libstagefright/id3/test/Android.bp
@@ -16,6 +16,7 @@
 
 cc_test {
     name: "ID3Test",
+    test_suites: ["device-tests"],
     gtest: true,
 
     srcs: ["ID3Test.cpp"],
diff --git a/media/libstagefright/include/media/stagefright/ACodec.h b/media/libstagefright/include/media/stagefright/ACodec.h
index cc40f76..797ba31 100644
--- a/media/libstagefright/include/media/stagefright/ACodec.h
+++ b/media/libstagefright/include/media/stagefright/ACodec.h
@@ -500,6 +500,7 @@
     status_t setupAMRCodec(bool encoder, bool isWAMR, int32_t bitRate);
     status_t setupG711Codec(bool encoder, int32_t sampleRate, int32_t numChannels);
 
+    status_t setupOpusCodec(bool encoder, int32_t sampleRate, int32_t numChannels);
     status_t setupFlacCodec(
             bool encoder, int32_t numChannels, int32_t sampleRate, int32_t compressionLevel,
             AudioEncoding encoding);
diff --git a/media/libstagefright/include/media/stagefright/MediaCodec.h b/media/libstagefright/include/media/stagefright/MediaCodec.h
index c4026ec..46cff28 100644
--- a/media/libstagefright/include/media/stagefright/MediaCodec.h
+++ b/media/libstagefright/include/media/stagefright/MediaCodec.h
@@ -373,6 +373,7 @@
     AString mOwnerName;
     sp<MediaCodecInfo> mCodecInfo;
     sp<AReplyToken> mReplyID;
+    std::vector<sp<AMessage>> mDeferredMessages;
     uint32_t mFlags;
     status_t mStickyError;
     sp<Surface> mSurface;
@@ -442,6 +443,7 @@
     static status_t PostAndAwaitResponse(
             const sp<AMessage> &msg, sp<AMessage> *response);
 
+    void PostReplyWithError(const sp<AMessage> &msg, int32_t err);
     void PostReplyWithError(const sp<AReplyToken> &replyID, int32_t err);
 
     status_t init(const AString &name);
@@ -493,6 +495,9 @@
     bool hasPendingBuffer(int portIndex);
     bool hasPendingBuffer();
 
+    void postPendingRepliesAndDeferredMessages(status_t err = OK);
+    void postPendingRepliesAndDeferredMessages(const sp<AMessage> &response);
+
     /* called to get the last codec error when the sticky flag is set.
      * if no such codec error is found, returns UNKNOWN_ERROR.
      */
diff --git a/media/libstagefright/include/media/stagefright/MetaDataBase.h b/media/libstagefright/include/media/stagefright/MetaDataBase.h
index 2f34094..6b0d28f 100644
--- a/media/libstagefright/include/media/stagefright/MetaDataBase.h
+++ b/media/libstagefright/include/media/stagefright/MetaDataBase.h
@@ -257,6 +257,10 @@
     kKeyRtpCvoDegrees    = 'cvod', // int32_t, rtp cvo degrees as per 3GPP 26.114.
     kKeyRtpDscp          = 'dscp', // int32_t, DSCP(Differentiated services codepoint) of RFC 2474.
     kKeySocketNetwork    = 'sNet', // int64_t, socket will be bound to network handle.
+
+    // Slow-motion markers
+    kKeySlowMotionMarkers = 'slmo', // raw data, byte array following spec for
+                                    // MediaFormat#KEY_SLOW_MOTION_MARKERS
 };
 
 enum {
diff --git a/media/libstagefright/include/media/stagefright/ProcessInfo.h b/media/libstagefright/include/media/stagefright/ProcessInfo.h
index 0be1a52..b8a3c10 100644
--- a/media/libstagefright/include/media/stagefright/ProcessInfo.h
+++ b/media/libstagefright/include/media/stagefright/ProcessInfo.h
@@ -20,6 +20,9 @@
 
 #include <media/stagefright/foundation/ABase.h>
 #include <media/stagefright/ProcessInfoInterface.h>
+#include <map>
+#include <mutex>
+#include <utils/Condition.h>
 
 namespace android {
 
@@ -28,11 +31,20 @@
 
     virtual bool getPriority(int pid, int* priority);
     virtual bool isValidPid(int pid);
+    virtual bool overrideProcessInfo(int pid, int procState, int oomScore);
+    virtual void removeProcessInfoOverride(int pid);
 
 protected:
     virtual ~ProcessInfo();
 
 private:
+    struct ProcessInfoOverride {
+        int procState;
+        int oomScore;
+    };
+    std::mutex mOverrideLock;
+    std::map<int, ProcessInfoOverride> mOverrideMap GUARDED_BY(mOverrideLock);
+
     DISALLOW_EVIL_CONSTRUCTORS(ProcessInfo);
 };
 
diff --git a/media/libstagefright/include/media/stagefright/ProcessInfoInterface.h b/media/libstagefright/include/media/stagefright/ProcessInfoInterface.h
index b39112a..9260181 100644
--- a/media/libstagefright/include/media/stagefright/ProcessInfoInterface.h
+++ b/media/libstagefright/include/media/stagefright/ProcessInfoInterface.h
@@ -24,6 +24,8 @@
 struct ProcessInfoInterface : public RefBase {
     virtual bool getPriority(int pid, int* priority) = 0;
     virtual bool isValidPid(int pid) = 0;
+    virtual bool overrideProcessInfo(int pid, int procState, int oomScore);
+    virtual void removeProcessInfoOverride(int pid);
 
 protected:
     virtual ~ProcessInfoInterface() {}
diff --git a/media/libstagefright/include/media/stagefright/Utils.h b/media/libstagefright/include/media/stagefright/Utils.h
index 2b9b759..1673120 100644
--- a/media/libstagefright/include/media/stagefright/Utils.h
+++ b/media/libstagefright/include/media/stagefright/Utils.h
@@ -33,7 +33,7 @@
         const MetaDataBase *meta, sp<AMessage> *format);
 status_t convertMetaDataToMessage(
         const sp<MetaData> &meta, sp<AMessage> *format);
-void convertMessageToMetaData(
+status_t convertMessageToMetaData(
         const sp<AMessage> &format, sp<MetaData> &meta);
 
 // Returns a pointer to the next NAL start code in buffer of size |length| starting at |data|, or
diff --git a/media/libstagefright/mpeg2ts/TEST_MAPPING b/media/libstagefright/mpeg2ts/TEST_MAPPING
index b25d732..9f4bbdf 100644
--- a/media/libstagefright/mpeg2ts/TEST_MAPPING
+++ b/media/libstagefright/mpeg2ts/TEST_MAPPING
@@ -1,7 +1,9 @@
 // frameworks/av/media/libstagefright/mpeg2ts
 {
-  "presubmit": [
-    // TODO(b/148094059): unit tests not allowed to download content
-    //{ "name": "Mpeg2tsUnitTest" }
+  // tests which require dynamic content
+  // invoke with: atest -- --enable-module-dynamic-download=true
+  // TODO(b/148094059): unit tests not allowed to download content
+  "dynamic-presubmit": [
+    { "name": "Mpeg2tsUnitTest" }
   ]
 }
diff --git a/media/libstagefright/renderfright/Android.bp b/media/libstagefright/renderfright/Android.bp
new file mode 100644
index 0000000..c17f84e
--- /dev/null
+++ b/media/libstagefright/renderfright/Android.bp
@@ -0,0 +1,111 @@
+cc_defaults {
+    name: "renderfright_defaults",
+    cflags: [
+        "-DLOG_TAG=\"renderfright\"",
+        "-Wall",
+        "-Werror",
+        "-Wthread-safety",
+        "-Wunused",
+        "-Wunreachable-code",
+    ],
+}
+
+cc_defaults {
+    name: "librenderfright_defaults",
+    defaults: ["renderfright_defaults"],
+    cflags: [
+        "-DGL_GLEXT_PROTOTYPES",
+        "-DEGL_EGLEXT_PROTOTYPES",
+    ],
+    shared_libs: [
+        "libbase",
+        "libcutils",
+        "libEGL",
+        "libGLESv1_CM",
+        "libGLESv2",
+        "libgui",
+        "liblog",
+        "libnativewindow",
+        "libprocessgroup",
+        "libsync",
+        "libui",
+        "libutils",
+    ],
+    local_include_dirs: ["include"],
+    export_include_dirs: ["include"],
+}
+
+filegroup {
+    name: "librenderfright_sources",
+    srcs: [
+        "Description.cpp",
+        "Mesh.cpp",
+        "RenderEngine.cpp",
+        "Texture.cpp",
+    ],
+}
+
+filegroup {
+    name: "librenderfright_gl_sources",
+    srcs: [
+        "gl/GLESRenderEngine.cpp",
+        "gl/GLExtensions.cpp",
+        "gl/GLFramebuffer.cpp",
+        "gl/GLImage.cpp",
+        "gl/GLShadowTexture.cpp",
+        "gl/GLShadowVertexGenerator.cpp",
+        "gl/GLSkiaShadowPort.cpp",
+        "gl/GLVertexBuffer.cpp",
+        "gl/ImageManager.cpp",
+        "gl/Program.cpp",
+        "gl/ProgramCache.cpp",
+        "gl/filters/BlurFilter.cpp",
+        "gl/filters/GenericProgram.cpp",
+    ],
+}
+
+filegroup {
+    name: "librenderfright_threaded_sources",
+    srcs: [
+        "threaded/RenderEngineThreaded.cpp",
+    ],
+}
+
+cc_library_static {
+    name: "librenderfright",
+    defaults: ["librenderfright_defaults"],
+    vendor_available: true,
+    vndk: {
+        enabled: true,
+    },
+    double_loadable: true,
+    clang: true,
+    cflags: [
+        "-fvisibility=hidden",
+        "-Werror=format",
+    ],
+    srcs: [
+        ":librenderfright_sources",
+        ":librenderfright_gl_sources",
+        ":librenderfright_threaded_sources",
+    ],
+    lto: {
+        thin: true,
+    },
+}
+
+cc_library_static {
+    name: "librenderfright_mocks",
+    defaults: ["librenderfright_defaults"],
+    srcs: [
+        "mock/Framebuffer.cpp",
+        "mock/Image.cpp",
+        "mock/RenderEngine.cpp",
+    ],
+    static_libs: [
+        "libgtest",
+        "libgmock",
+    ],
+    local_include_dirs: ["include"],
+    export_include_dirs: ["include"],
+}
diff --git a/media/libstagefright/renderfright/Description.cpp b/media/libstagefright/renderfright/Description.cpp
new file mode 100644
index 0000000..b9cea10
--- /dev/null
+++ b/media/libstagefright/renderfright/Description.cpp
@@ -0,0 +1,56 @@
+/*
+ * Copyright 2013 The Android Open Source Project
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ *      http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+#include <renderengine/private/Description.h>
+
+#include <stdint.h>
+
+#include <utils/TypeHelpers.h>
+
+namespace android {
+namespace renderengine {
+
+Description::TransferFunction Description::dataSpaceToTransferFunction(ui::Dataspace dataSpace) {
+    ui::Dataspace transfer = static_cast<ui::Dataspace>(dataSpace & ui::Dataspace::TRANSFER_MASK);
+    switch (transfer) {
+        case ui::Dataspace::TRANSFER_ST2084:
+            return Description::TransferFunction::ST2084;
+        case ui::Dataspace::TRANSFER_HLG:
+            return Description::TransferFunction::HLG;
+        case ui::Dataspace::TRANSFER_LINEAR:
+            return Description::TransferFunction::LINEAR;
+        default:
+            return Description::TransferFunction::SRGB;
+    }
+}
+
+bool Description::hasInputTransformMatrix() const {
+    const mat4 identity;
+    return inputTransformMatrix != identity;
+}
+
+bool Description::hasOutputTransformMatrix() const {
+    const mat4 identity;
+    return outputTransformMatrix != identity;
+}
+
+bool Description::hasColorMatrix() const {
+    const mat4 identity;
+    return colorMatrix != identity;
+}
+
+} // namespace renderengine
+} // namespace android
diff --git a/media/libstagefright/renderfright/Mesh.cpp b/media/libstagefright/renderfright/Mesh.cpp
new file mode 100644
index 0000000..ed2f45f
--- /dev/null
+++ b/media/libstagefright/renderfright/Mesh.cpp
@@ -0,0 +1,146 @@
+/*
+ * Copyright 2013 The Android Open Source Project
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ *      http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+#include <renderengine/Mesh.h>
+
+#include <utils/Log.h>
+
+namespace android {
+namespace renderengine {
+
+Mesh::Mesh(Primitive primitive, size_t vertexCount, size_t vertexSize, size_t texCoordSize,
+           size_t cropCoordsSize, size_t shadowColorSize, size_t shadowParamsSize,
+           size_t indexCount)
+      : mVertexCount(vertexCount),
+        mVertexSize(vertexSize),
+        mTexCoordsSize(texCoordSize),
+        mCropCoordsSize(cropCoordsSize),
+        mShadowColorSize(shadowColorSize),
+        mShadowParamsSize(shadowParamsSize),
+        mPrimitive(primitive),
+        mIndexCount(indexCount) {
+    if (vertexCount == 0) {
+        mVertices.resize(1);
+        mVertices[0] = 0.0f;
+        mStride = 0;
+        return;
+    }
+    size_t stride = vertexSize + texCoordSize + cropCoordsSize + shadowColorSize + shadowParamsSize;
+    size_t remainder = (stride * vertexCount) / vertexCount;
+    // Since all of the input parameters are unsigned, if stride is less than
+    // either vertexSize or texCoordSize, it must have overflowed. remainder
+    // will be equal to stride as long as stride * vertexCount doesn't overflow.
+    if ((stride < vertexSize) || (remainder != stride)) {
+        ALOGE("Overflow in Mesh(..., %zu, %zu, %zu, %zu, %zu, %zu)", vertexCount, vertexSize,
+              texCoordSize, cropCoordsSize, shadowColorSize, shadowParamsSize);
+        mVertices.resize(1);
+        mVertices[0] = 0.0f;
+        mVertexCount = 0;
+        mVertexSize = 0;
+        mTexCoordsSize = 0;
+        mCropCoordsSize = 0;
+        mShadowColorSize = 0;
+        mShadowParamsSize = 0;
+        mStride = 0;
+        return;
+    }
+
+    mVertices.resize(stride * vertexCount);
+    mStride = stride;
+    mIndices.resize(indexCount);
+}
+
+Mesh::Primitive Mesh::getPrimitive() const {
+    return mPrimitive;
+}
+
+float const* Mesh::getPositions() const {
+    return mVertices.data();
+}
+float* Mesh::getPositions() {
+    return mVertices.data();
+}
+
+float const* Mesh::getTexCoords() const {
+    return mVertices.data() + mVertexSize;
+}
+float* Mesh::getTexCoords() {
+    return mVertices.data() + mVertexSize;
+}
+
+float const* Mesh::getCropCoords() const {
+    return mVertices.data() + mVertexSize + mTexCoordsSize;
+}
+float* Mesh::getCropCoords() {
+    return mVertices.data() + mVertexSize + mTexCoordsSize;
+}
+
+float const* Mesh::getShadowColor() const {
+    return mVertices.data() + mVertexSize + mTexCoordsSize + mCropCoordsSize;
+}
+float* Mesh::getShadowColor() {
+    return mVertices.data() + mVertexSize + mTexCoordsSize + mCropCoordsSize;
+}
+
+float const* Mesh::getShadowParams() const {
+    return mVertices.data() + mVertexSize + mTexCoordsSize + mCropCoordsSize + mShadowColorSize;
+}
+float* Mesh::getShadowParams() {
+    return mVertices.data() + mVertexSize + mTexCoordsSize + mCropCoordsSize + mShadowColorSize;
+}
+
+uint16_t const* Mesh::getIndices() const {
+    return mIndices.data();
+}
+
+uint16_t* Mesh::getIndices() {
+    return mIndices.data();
+}
+
+size_t Mesh::getVertexCount() const {
+    return mVertexCount;
+}
+
+size_t Mesh::getVertexSize() const {
+    return mVertexSize;
+}
+
+size_t Mesh::getTexCoordsSize() const {
+    return mTexCoordsSize;
+}
+
+size_t Mesh::getShadowColorSize() const {
+    return mShadowColorSize;
+}
+
+size_t Mesh::getShadowParamsSize() const {
+    return mShadowParamsSize;
+}
+
+size_t Mesh::getByteStride() const {
+    return mStride * sizeof(float);
+}
+
+size_t Mesh::getStride() const {
+    return mStride;
+}
+
+size_t Mesh::getIndexCount() const {
+    return mIndexCount;
+}
+
+} // namespace renderengine
+} // namespace android
diff --git a/media/libstagefright/renderfright/RenderEngine.cpp b/media/libstagefright/renderfright/RenderEngine.cpp
new file mode 100644
index 0000000..c3fbb60
--- /dev/null
+++ b/media/libstagefright/renderfright/RenderEngine.cpp
@@ -0,0 +1,71 @@
+/*
+ * Copyright 2013 The Android Open Source Project
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ *      http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+#include <renderengine/RenderEngine.h>
+
+#include <cutils/properties.h>
+#include <log/log.h>
+#include <private/gui/SyncFeatures.h>
+#include "gl/GLESRenderEngine.h"
+#include "threaded/RenderEngineThreaded.h"
+
+namespace android {
+namespace renderengine {
+
+std::unique_ptr<RenderEngine> RenderEngine::create(const RenderEngineCreationArgs& args) {
+    RenderEngineType renderEngineType = args.renderEngineType;
+
+    // Keep the ability to override by PROPERTIES:
+    char prop[PROPERTY_VALUE_MAX];
+    property_get(PROPERTY_DEBUG_RENDERENGINE_BACKEND, prop, "");
+    if (strcmp(prop, "gles") == 0) {
+        renderEngineType = RenderEngineType::GLES;
+    }
+    if (strcmp(prop, "threaded") == 0) {
+        renderEngineType = RenderEngineType::THREADED;
+    }
+
+    switch (renderEngineType) {
+        case RenderEngineType::THREADED:
+            ALOGD("Threaded RenderEngine with GLES Backend");
+            return renderengine::threaded::RenderEngineThreaded::create(
+                    [args]() { return android::renderengine::gl::GLESRenderEngine::create(args); });
+        case RenderEngineType::GLES:
+        default:
+            ALOGD("RenderEngine with GLES Backend");
+            return renderengine::gl::GLESRenderEngine::create(args);
+    }
+}
+
+RenderEngine::~RenderEngine() = default;
+
+namespace impl {
+
+RenderEngine::RenderEngine(const RenderEngineCreationArgs& args) : mArgs(args) {}
+
+RenderEngine::~RenderEngine() = default;
+
+bool RenderEngine::useNativeFenceSync() const {
+    return SyncFeatures::getInstance().useNativeFenceSync();
+}
+
+bool RenderEngine::useWaitSync() const {
+    return SyncFeatures::getInstance().useWaitSync();
+}
+
+} // namespace impl
+} // namespace renderengine
+} // namespace android
diff --git a/media/libstagefright/renderfright/Texture.cpp b/media/libstagefright/renderfright/Texture.cpp
new file mode 100644
index 0000000..154cde8
--- /dev/null
+++ b/media/libstagefright/renderfright/Texture.cpp
@@ -0,0 +1,77 @@
+/*
+ * Copyright 2013 The Android Open Source Project
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ *      http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+#include <renderengine/Texture.h>
+
+namespace android {
+namespace renderengine {
+
+Texture::Texture()
+      : mTextureName(0), mTextureTarget(TEXTURE_2D), mWidth(0), mHeight(0), mFiltering(false) {}
+
+Texture::Texture(Target textureTarget, uint32_t textureName)
+      : mTextureName(textureName),
+        mTextureTarget(textureTarget),
+        mWidth(0),
+        mHeight(0),
+        mFiltering(false) {}
+
+void Texture::init(Target textureTarget, uint32_t textureName) {
+    mTextureName = textureName;
+    mTextureTarget = textureTarget;
+}
+
+Texture::~Texture() {}
+
+void Texture::setMatrix(float const* matrix) {
+    mTextureMatrix = mat4(matrix);
+}
+
+void Texture::setFiltering(bool enabled) {
+    mFiltering = enabled;
+}
+
+void Texture::setDimensions(size_t width, size_t height) {
+    mWidth = width;
+    mHeight = height;
+}
+
+uint32_t Texture::getTextureName() const {
+    return mTextureName;
+}
+
+uint32_t Texture::getTextureTarget() const {
+    return mTextureTarget;
+}
+
+const mat4& Texture::getMatrix() const {
+    return mTextureMatrix;
+}
+
+bool Texture::getFiltering() const {
+    return mFiltering;
+}
+
+size_t Texture::getWidth() const {
+    return mWidth;
+}
+
+size_t Texture::getHeight() const {
+    return mHeight;
+}
+
+} // namespace renderengine
+} // namespace android
diff --git a/media/libstagefright/renderfright/gl/GLESRenderEngine.cpp b/media/libstagefright/renderfright/gl/GLESRenderEngine.cpp
new file mode 100644
index 0000000..824bdd9
--- /dev/null
+++ b/media/libstagefright/renderfright/gl/GLESRenderEngine.cpp
@@ -0,0 +1,1772 @@
+/*
+ * Copyright 2013 The Android Open Source Project
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ *      http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+//#define LOG_NDEBUG 0
+#undef LOG_TAG
+#define LOG_TAG "RenderEngine"
+#define ATRACE_TAG ATRACE_TAG_GRAPHICS
+
+#include <sched.h>
+#include <cmath>
+#include <fstream>
+#include <sstream>
+#include <unordered_set>
+
+#include <GLES2/gl2.h>
+#include <GLES2/gl2ext.h>
+#include <android-base/stringprintf.h>
+#include <cutils/compiler.h>
+#include <cutils/properties.h>
+#include <gui/DebugEGLImageTracker.h>
+#include <renderengine/Mesh.h>
+#include <renderengine/Texture.h>
+#include <renderengine/private/Description.h>
+#include <sync/sync.h>
+#include <ui/ColorSpace.h>
+#include <ui/DebugUtils.h>
+#include <ui/GraphicBuffer.h>
+#include <ui/Rect.h>
+#include <ui/Region.h>
+#include <utils/KeyedVector.h>
+#include <utils/Trace.h>
+#include "GLESRenderEngine.h"
+#include "GLExtensions.h"
+#include "GLFramebuffer.h"
+#include "GLImage.h"
+#include "GLShadowVertexGenerator.h"
+#include "Program.h"
+#include "ProgramCache.h"
+#include "filters/BlurFilter.h"
+
+bool checkGlError(const char* op, int lineNumber) {
+    bool errorFound = false;
+    GLint error = glGetError();
+    while (error != GL_NO_ERROR) {
+        errorFound = true;
+        error = glGetError();
+        ALOGV("after %s() (line # %d) glError (0x%x)\n", op, lineNumber, error);
+    }
+    return errorFound;
+}
+
+static constexpr bool outputDebugPPMs = false;
+
+void writePPM(const char* basename, GLuint width, GLuint height) {
+    ALOGV("writePPM #%s: %d x %d", basename, width, height);
+
+    std::vector<GLubyte> pixels(width * height * 4);
+    std::vector<GLubyte> outBuffer(width * height * 3);
+
+    // TODO(courtneygo): We can now have float formats, need
+    // to remove this code or update to support.
+    // Make returned pixels fit in uint32_t, one byte per component
+    glReadPixels(0, 0, width, height, GL_RGBA, GL_UNSIGNED_BYTE, pixels.data());
+    if (checkGlError(__FUNCTION__, __LINE__)) {
+        return;
+    }
+
+    std::string filename(basename);
+    filename.append(".ppm");
+    std::ofstream file(filename.c_str(), std::ios::binary);
+    if (!file.is_open()) {
+        ALOGE("Unable to open file: %s", filename.c_str());
+        ALOGE("You may need to do: \"adb shell setenforce 0\" to enable "
+              "surfaceflinger to write debug images");
+        return;
+    }
+
+    file << "P6\n";
+    file << width << "\n";
+    file << height << "\n";
+    file << 255 << "\n";
+
+    auto ptr = reinterpret_cast<char*>(pixels.data());
+    auto outPtr = reinterpret_cast<char*>(outBuffer.data());
+    for (int y = height - 1; y >= 0; y--) {
+        char* data = ptr + y * width * sizeof(uint32_t);
+
+        for (GLuint x = 0; x < width; x++) {
+            // Only copy R, G and B components
+            outPtr[0] = data[0];
+            outPtr[1] = data[1];
+            outPtr[2] = data[2];
+            data += sizeof(uint32_t);
+            outPtr += 3;
+        }
+    }
+    file.write(reinterpret_cast<char*>(outBuffer.data()), outBuffer.size());
+}
+
+namespace android {
+namespace renderengine {
+namespace gl {
+
+using base::StringAppendF;
+using ui::Dataspace;
+
+static status_t selectConfigForAttribute(EGLDisplay dpy, EGLint const* attrs, EGLint attribute,
+                                         EGLint wanted, EGLConfig* outConfig) {
+    EGLint numConfigs = -1, n = 0;
+    eglGetConfigs(dpy, nullptr, 0, &numConfigs);
+    std::vector<EGLConfig> configs(numConfigs, EGL_NO_CONFIG_KHR);
+    eglChooseConfig(dpy, attrs, configs.data(), configs.size(), &n);
+    configs.resize(n);
+
+    if (!configs.empty()) {
+        if (attribute != EGL_NONE) {
+            for (EGLConfig config : configs) {
+                EGLint value = 0;
+                eglGetConfigAttrib(dpy, config, attribute, &value);
+                if (wanted == value) {
+                    *outConfig = config;
+                    return NO_ERROR;
+                }
+            }
+        } else {
+            // just pick the first one
+            *outConfig = configs[0];
+            return NO_ERROR;
+        }
+    }
+
+    return NAME_NOT_FOUND;
+}
+
+static status_t selectEGLConfig(EGLDisplay display, EGLint format, EGLint renderableType,
+                                EGLConfig* config) {
+    // select our EGLConfig. It must support EGL_RECORDABLE_ANDROID if
+    // it is to be used with WIFI displays
+    status_t err;
+    EGLint wantedAttribute;
+    EGLint wantedAttributeValue;
+
+    std::vector<EGLint> attribs;
+    if (renderableType) {
+        const ui::PixelFormat pixelFormat = static_cast<ui::PixelFormat>(format);
+        const bool is1010102 = pixelFormat == ui::PixelFormat::RGBA_1010102;
+
+        // Default to 8 bits per channel.
+        const EGLint tmpAttribs[] = {
+                EGL_RENDERABLE_TYPE,
+                renderableType,
+                EGL_RECORDABLE_ANDROID,
+                EGL_TRUE,
+                EGL_SURFACE_TYPE,
+                EGL_WINDOW_BIT | EGL_PBUFFER_BIT,
+                EGL_FRAMEBUFFER_TARGET_ANDROID,
+                EGL_TRUE,
+                EGL_RED_SIZE,
+                is1010102 ? 10 : 8,
+                EGL_GREEN_SIZE,
+                is1010102 ? 10 : 8,
+                EGL_BLUE_SIZE,
+                is1010102 ? 10 : 8,
+                EGL_ALPHA_SIZE,
+                is1010102 ? 2 : 8,
+                EGL_NONE,
+        };
+        std::copy(tmpAttribs, tmpAttribs + (sizeof(tmpAttribs) / sizeof(EGLint)),
+                  std::back_inserter(attribs));
+        wantedAttribute = EGL_NONE;
+        wantedAttributeValue = EGL_NONE;
+    } else {
+        // if no renderable type specified, fallback to a simplified query
+        wantedAttribute = EGL_NATIVE_VISUAL_ID;
+        wantedAttributeValue = format;
+    }
+
+    err = selectConfigForAttribute(display, attribs.data(), wantedAttribute, wantedAttributeValue,
+                                   config);
+    if (err == NO_ERROR) {
+        EGLint caveat;
+        if (eglGetConfigAttrib(display, *config, EGL_CONFIG_CAVEAT, &caveat))
+            ALOGW_IF(caveat == EGL_SLOW_CONFIG, "EGL_SLOW_CONFIG selected!");
+    }
+
+    return err;
+}
+
+std::unique_ptr<GLESRenderEngine> GLESRenderEngine::create(const RenderEngineCreationArgs& args) {
+    // initialize EGL for the default display
+    EGLDisplay display = eglGetDisplay(EGL_DEFAULT_DISPLAY);
+    if (!eglInitialize(display, nullptr, nullptr)) {
+        LOG_ALWAYS_FATAL("failed to initialize EGL");
+    }
+
+    const auto eglVersion = eglQueryString(display, EGL_VERSION);
+    if (!eglVersion) {
+        checkGlError(__FUNCTION__, __LINE__);
+        LOG_ALWAYS_FATAL("eglQueryString(EGL_VERSION) failed");
+    }
+
+    const auto eglExtensions = eglQueryString(display, EGL_EXTENSIONS);
+    if (!eglExtensions) {
+        checkGlError(__FUNCTION__, __LINE__);
+        LOG_ALWAYS_FATAL("eglQueryString(EGL_EXTENSIONS) failed");
+    }
+
+    GLExtensions& extensions = GLExtensions::getInstance();
+    extensions.initWithEGLStrings(eglVersion, eglExtensions);
+
+    // The code assumes that ES2 or later is available if this extension is
+    // supported.
+    EGLConfig config = EGL_NO_CONFIG;
+    if (!extensions.hasNoConfigContext()) {
+        config = chooseEglConfig(display, args.pixelFormat, /*logConfig*/ true);
+    }
+
+    bool useContextPriority =
+            extensions.hasContextPriority() && args.contextPriority == ContextPriority::HIGH;
+    EGLContext protectedContext = EGL_NO_CONTEXT;
+    if (args.enableProtectedContext && extensions.hasProtectedContent()) {
+        protectedContext = createEglContext(display, config, nullptr, useContextPriority,
+                                            Protection::PROTECTED);
+        ALOGE_IF(protectedContext == EGL_NO_CONTEXT, "Can't create protected context");
+    }
+
+    EGLContext ctxt = createEglContext(display, config, protectedContext, useContextPriority,
+                                       Protection::UNPROTECTED);
+
+    // if can't create a GL context, we can only abort.
+    LOG_ALWAYS_FATAL_IF(ctxt == EGL_NO_CONTEXT, "EGLContext creation failed");
+
+    EGLSurface stub = EGL_NO_SURFACE;
+    if (!extensions.hasSurfacelessContext()) {
+        stub = createStubEglPbufferSurface(display, config, args.pixelFormat,
+                                           Protection::UNPROTECTED);
+        LOG_ALWAYS_FATAL_IF(stub == EGL_NO_SURFACE, "can't create stub pbuffer");
+    }
+    EGLBoolean success = eglMakeCurrent(display, stub, stub, ctxt);
+    LOG_ALWAYS_FATAL_IF(!success, "can't make stub pbuffer current");
+    extensions.initWithGLStrings(glGetString(GL_VENDOR), glGetString(GL_RENDERER),
+                                 glGetString(GL_VERSION), glGetString(GL_EXTENSIONS));
+
+    EGLSurface protectedStub = EGL_NO_SURFACE;
+    if (protectedContext != EGL_NO_CONTEXT && !extensions.hasSurfacelessContext()) {
+        protectedStub = createStubEglPbufferSurface(display, config, args.pixelFormat,
+                                                    Protection::PROTECTED);
+        ALOGE_IF(protectedStub == EGL_NO_SURFACE, "can't create protected stub pbuffer");
+    }
+
+    // now figure out what version of GL did we actually get
+    GlesVersion version = parseGlesVersion(extensions.getVersion());
+
+    LOG_ALWAYS_FATAL_IF(args.supportsBackgroundBlur && version < GLES_VERSION_3_0,
+        "Blurs require OpenGL ES 3.0. Please unset ro.surface_flinger.supports_background_blur");
+
+    // initialize the renderer while GL is current
+    std::unique_ptr<GLESRenderEngine> engine;
+    switch (version) {
+        case GLES_VERSION_1_0:
+        case GLES_VERSION_1_1:
+            LOG_ALWAYS_FATAL("SurfaceFlinger requires OpenGL ES 2.0 minimum to run.");
+            break;
+        case GLES_VERSION_2_0:
+        case GLES_VERSION_3_0:
+            engine = std::make_unique<GLESRenderEngine>(args, display, config, ctxt, stub,
+                                                        protectedContext, protectedStub);
+            break;
+    }
+
+    ALOGI("OpenGL ES informations:");
+    ALOGI("vendor    : %s", extensions.getVendor());
+    ALOGI("renderer  : %s", extensions.getRenderer());
+    ALOGI("version   : %s", extensions.getVersion());
+    ALOGI("extensions: %s", extensions.getExtensions());
+    ALOGI("GL_MAX_TEXTURE_SIZE = %zu", engine->getMaxTextureSize());
+    ALOGI("GL_MAX_VIEWPORT_DIMS = %zu", engine->getMaxViewportDims());
+
+    return engine;
+}
+
+EGLConfig GLESRenderEngine::chooseEglConfig(EGLDisplay display, int format, bool logConfig) {
+    status_t err;
+    EGLConfig config;
+
+    // First try to get an ES3 config
+    err = selectEGLConfig(display, format, EGL_OPENGL_ES3_BIT, &config);
+    if (err != NO_ERROR) {
+        // If ES3 fails, try to get an ES2 config
+        err = selectEGLConfig(display, format, EGL_OPENGL_ES2_BIT, &config);
+        if (err != NO_ERROR) {
+            // If ES2 still doesn't work, probably because we're on the emulator.
+            // try a simplified query
+            ALOGW("no suitable EGLConfig found, trying a simpler query");
+            err = selectEGLConfig(display, format, 0, &config);
+            if (err != NO_ERROR) {
+                // this EGL is too lame for android
+                LOG_ALWAYS_FATAL("no suitable EGLConfig found, giving up");
+            }
+        }
+    }
+
+    if (logConfig) {
+        // print some debugging info
+        EGLint r, g, b, a;
+        eglGetConfigAttrib(display, config, EGL_RED_SIZE, &r);
+        eglGetConfigAttrib(display, config, EGL_GREEN_SIZE, &g);
+        eglGetConfigAttrib(display, config, EGL_BLUE_SIZE, &b);
+        eglGetConfigAttrib(display, config, EGL_ALPHA_SIZE, &a);
+        ALOGI("EGL information:");
+        ALOGI("vendor    : %s", eglQueryString(display, EGL_VENDOR));
+        ALOGI("version   : %s", eglQueryString(display, EGL_VERSION));
+        ALOGI("extensions: %s", eglQueryString(display, EGL_EXTENSIONS));
+        ALOGI("Client API: %s", eglQueryString(display, EGL_CLIENT_APIS) ?: "Not Supported");
+        ALOGI("EGLSurface: %d-%d-%d-%d, config=%p", r, g, b, a, config);
+    }
+
+    return config;
+}
+
+GLESRenderEngine::GLESRenderEngine(const RenderEngineCreationArgs& args, EGLDisplay display,
+                                   EGLConfig config, EGLContext ctxt, EGLSurface stub,
+                                   EGLContext protectedContext, EGLSurface protectedStub)
+      : renderengine::impl::RenderEngine(args),
+        mEGLDisplay(display),
+        mEGLConfig(config),
+        mEGLContext(ctxt),
+        mStubSurface(stub),
+        mProtectedEGLContext(protectedContext),
+        mProtectedStubSurface(protectedStub),
+        mVpWidth(0),
+        mVpHeight(0),
+        mFramebufferImageCacheSize(args.imageCacheSize),
+        mUseColorManagement(args.useColorManagement) {
+    glGetIntegerv(GL_MAX_TEXTURE_SIZE, &mMaxTextureSize);
+    glGetIntegerv(GL_MAX_VIEWPORT_DIMS, mMaxViewportDims);
+
+    glPixelStorei(GL_UNPACK_ALIGNMENT, 4);
+    glPixelStorei(GL_PACK_ALIGNMENT, 4);
+
+    // Initialize protected EGL Context.
+    if (mProtectedEGLContext != EGL_NO_CONTEXT) {
+        EGLBoolean success = eglMakeCurrent(display, mProtectedStubSurface, mProtectedStubSurface,
+                                            mProtectedEGLContext);
+        ALOGE_IF(!success, "can't make protected context current");
+        glPixelStorei(GL_UNPACK_ALIGNMENT, 4);
+        glPixelStorei(GL_PACK_ALIGNMENT, 4);
+        success = eglMakeCurrent(display, mStubSurface, mStubSurface, mEGLContext);
+        LOG_ALWAYS_FATAL_IF(!success, "can't make default context current");
+    }
+
+    // mColorBlindnessCorrection = M;
+
+    if (mUseColorManagement) {
+        const ColorSpace srgb(ColorSpace::sRGB());
+        const ColorSpace displayP3(ColorSpace::DisplayP3());
+        const ColorSpace bt2020(ColorSpace::BT2020());
+
+        // no chromatic adaptation needed since all color spaces use D65 for their white points.
+        mSrgbToXyz = mat4(srgb.getRGBtoXYZ());
+        mDisplayP3ToXyz = mat4(displayP3.getRGBtoXYZ());
+        mBt2020ToXyz = mat4(bt2020.getRGBtoXYZ());
+        mXyzToSrgb = mat4(srgb.getXYZtoRGB());
+        mXyzToDisplayP3 = mat4(displayP3.getXYZtoRGB());
+        mXyzToBt2020 = mat4(bt2020.getXYZtoRGB());
+
+        // Compute sRGB to Display P3 and BT2020 transform matrix.
+        // NOTE: For now, we are limiting output wide color space support to
+        // Display-P3 and BT2020 only.
+        mSrgbToDisplayP3 = mXyzToDisplayP3 * mSrgbToXyz;
+        mSrgbToBt2020 = mXyzToBt2020 * mSrgbToXyz;
+
+        // Compute Display P3 to sRGB and BT2020 transform matrix.
+        mDisplayP3ToSrgb = mXyzToSrgb * mDisplayP3ToXyz;
+        mDisplayP3ToBt2020 = mXyzToBt2020 * mDisplayP3ToXyz;
+
+        // Compute BT2020 to sRGB and Display P3 transform matrix
+        mBt2020ToSrgb = mXyzToSrgb * mBt2020ToXyz;
+        mBt2020ToDisplayP3 = mXyzToDisplayP3 * mBt2020ToXyz;
+    }
+
+    char value[PROPERTY_VALUE_MAX];
+    property_get("debug.egl.traceGpuCompletion", value, "0");
+    if (atoi(value)) {
+        mTraceGpuCompletion = true;
+        mFlushTracer = std::make_unique<FlushTracer>(this);
+    }
+
+    if (args.supportsBackgroundBlur) {
+        mBlurFilter = new BlurFilter(*this);
+        checkErrors("BlurFilter creation");
+    }
+
+    mImageManager = std::make_unique<ImageManager>(this);
+    mImageManager->initThread();
+    mDrawingBuffer = createFramebuffer();
+    sp<GraphicBuffer> buf =
+            new GraphicBuffer(1, 1, PIXEL_FORMAT_RGBA_8888, 1,
+                              GRALLOC_USAGE_HW_RENDER | GRALLOC_USAGE_HW_TEXTURE, "placeholder");
+
+    const status_t err = buf->initCheck();
+    if (err != OK) {
+        ALOGE("Error allocating placeholder buffer: %d", err);
+        return;
+    }
+    mPlaceholderBuffer = buf.get();
+    EGLint attributes[] = {
+            EGL_NONE,
+    };
+    mPlaceholderImage = eglCreateImageKHR(mEGLDisplay, EGL_NO_CONTEXT, EGL_NATIVE_BUFFER_ANDROID,
+                                          mPlaceholderBuffer, attributes);
+    ALOGE_IF(mPlaceholderImage == EGL_NO_IMAGE_KHR, "Failed to create placeholder image: %#x",
+             eglGetError());
+}
+
+GLESRenderEngine::~GLESRenderEngine() {
+    // Destroy the image manager first.
+    mImageManager = nullptr;
+    std::lock_guard<std::mutex> lock(mRenderingMutex);
+    unbindFrameBuffer(mDrawingBuffer.get());
+    mDrawingBuffer = nullptr;
+    while (!mFramebufferImageCache.empty()) {
+        EGLImageKHR expired = mFramebufferImageCache.front().second;
+        mFramebufferImageCache.pop_front();
+        eglDestroyImageKHR(mEGLDisplay, expired);
+        DEBUG_EGL_IMAGE_TRACKER_DESTROY();
+    }
+    eglDestroyImageKHR(mEGLDisplay, mPlaceholderImage);
+    mImageCache.clear();
+    eglMakeCurrent(mEGLDisplay, EGL_NO_SURFACE, EGL_NO_SURFACE, EGL_NO_CONTEXT);
+    eglTerminate(mEGLDisplay);
+}
+
+std::unique_ptr<Framebuffer> GLESRenderEngine::createFramebuffer() {
+    return std::make_unique<GLFramebuffer>(*this);
+}
+
+std::unique_ptr<Image> GLESRenderEngine::createImage() {
+    return std::make_unique<GLImage>(*this);
+}
+
+Framebuffer* GLESRenderEngine::getFramebufferForDrawing() {
+    return mDrawingBuffer.get();
+}
+
+void GLESRenderEngine::primeCache() const {
+    ProgramCache::getInstance().primeCache(mInProtectedContext ? mProtectedEGLContext : mEGLContext,
+                                           mArgs.useColorManagement,
+                                           mArgs.precacheToneMapperShaderOnly);
+}
+
+base::unique_fd GLESRenderEngine::flush() {
+    ATRACE_CALL();
+    if (!GLExtensions::getInstance().hasNativeFenceSync()) {
+        return base::unique_fd();
+    }
+
+    EGLSyncKHR sync = eglCreateSyncKHR(mEGLDisplay, EGL_SYNC_NATIVE_FENCE_ANDROID, nullptr);
+    if (sync == EGL_NO_SYNC_KHR) {
+        ALOGW("failed to create EGL native fence sync: %#x", eglGetError());
+        return base::unique_fd();
+    }
+
+    // native fence fd will not be populated until flush() is done.
+    glFlush();
+
+    // get the fence fd
+    base::unique_fd fenceFd(eglDupNativeFenceFDANDROID(mEGLDisplay, sync));
+    eglDestroySyncKHR(mEGLDisplay, sync);
+    if (fenceFd == EGL_NO_NATIVE_FENCE_FD_ANDROID) {
+        ALOGW("failed to dup EGL native fence sync: %#x", eglGetError());
+    }
+
+    // Only trace if we have a valid fence, as current usage falls back to
+    // calling finish() if the fence fd is invalid.
+    if (CC_UNLIKELY(mTraceGpuCompletion && mFlushTracer) && fenceFd.get() >= 0) {
+        mFlushTracer->queueSync(eglCreateSyncKHR(mEGLDisplay, EGL_SYNC_FENCE_KHR, nullptr));
+    }
+
+    return fenceFd;
+}
+
+bool GLESRenderEngine::finish() {
+    ATRACE_CALL();
+    if (!GLExtensions::getInstance().hasFenceSync()) {
+        ALOGW("no synchronization support");
+        return false;
+    }
+
+    EGLSyncKHR sync = eglCreateSyncKHR(mEGLDisplay, EGL_SYNC_FENCE_KHR, nullptr);
+    if (sync == EGL_NO_SYNC_KHR) {
+        ALOGW("failed to create EGL fence sync: %#x", eglGetError());
+        return false;
+    }
+
+    if (CC_UNLIKELY(mTraceGpuCompletion && mFlushTracer)) {
+        mFlushTracer->queueSync(eglCreateSyncKHR(mEGLDisplay, EGL_SYNC_FENCE_KHR, nullptr));
+    }
+
+    return waitSync(sync, EGL_SYNC_FLUSH_COMMANDS_BIT_KHR);
+}
+
+bool GLESRenderEngine::waitSync(EGLSyncKHR sync, EGLint flags) {
+    EGLint result = eglClientWaitSyncKHR(mEGLDisplay, sync, flags, 2000000000 /*2 sec*/);
+    EGLint error = eglGetError();
+    eglDestroySyncKHR(mEGLDisplay, sync);
+    if (result != EGL_CONDITION_SATISFIED_KHR) {
+        if (result == EGL_TIMEOUT_EXPIRED_KHR) {
+            ALOGW("fence wait timed out");
+        } else {
+            ALOGW("error waiting on EGL fence: %#x", error);
+        }
+        return false;
+    }
+
+    return true;
+}
+
+bool GLESRenderEngine::waitFence(base::unique_fd fenceFd) {
+    if (!GLExtensions::getInstance().hasNativeFenceSync() ||
+        !GLExtensions::getInstance().hasWaitSync()) {
+        return false;
+    }
+
+    // release the fd and transfer the ownership to EGLSync
+    EGLint attribs[] = {EGL_SYNC_NATIVE_FENCE_FD_ANDROID, fenceFd.release(), EGL_NONE};
+    EGLSyncKHR sync = eglCreateSyncKHR(mEGLDisplay, EGL_SYNC_NATIVE_FENCE_ANDROID, attribs);
+    if (sync == EGL_NO_SYNC_KHR) {
+        ALOGE("failed to create EGL native fence sync: %#x", eglGetError());
+        return false;
+    }
+
+    // XXX: The spec draft is inconsistent as to whether this should return an
+    // EGLint or void.  Ignore the return value for now, as it's not strictly
+    // needed.
+    eglWaitSyncKHR(mEGLDisplay, sync, 0);
+    EGLint error = eglGetError();
+    eglDestroySyncKHR(mEGLDisplay, sync);
+    if (error != EGL_SUCCESS) {
+        ALOGE("failed to wait for EGL native fence sync: %#x", error);
+        return false;
+    }
+
+    return true;
+}
+
+void GLESRenderEngine::clearWithColor(float red, float green, float blue, float alpha) {
+    ATRACE_CALL();
+    glDisable(GL_BLEND);
+    glClearColor(red, green, blue, alpha);
+    glClear(GL_COLOR_BUFFER_BIT);
+}
+
+void GLESRenderEngine::fillRegionWithColor(const Region& region, float red, float green, float blue,
+                                           float alpha) {
+    size_t c;
+    Rect const* r = region.getArray(&c);
+    Mesh mesh = Mesh::Builder()
+                        .setPrimitive(Mesh::TRIANGLES)
+                        .setVertices(c * 6 /* count */, 2 /* size */)
+                        .build();
+    Mesh::VertexArray<vec2> position(mesh.getPositionArray<vec2>());
+    for (size_t i = 0; i < c; i++, r++) {
+        position[i * 6 + 0].x = r->left;
+        position[i * 6 + 0].y = r->top;
+        position[i * 6 + 1].x = r->left;
+        position[i * 6 + 1].y = r->bottom;
+        position[i * 6 + 2].x = r->right;
+        position[i * 6 + 2].y = r->bottom;
+        position[i * 6 + 3].x = r->left;
+        position[i * 6 + 3].y = r->top;
+        position[i * 6 + 4].x = r->right;
+        position[i * 6 + 4].y = r->bottom;
+        position[i * 6 + 5].x = r->right;
+        position[i * 6 + 5].y = r->top;
+    }
+    setupFillWithColor(red, green, blue, alpha);
+    drawMesh(mesh);
+}
+
+void GLESRenderEngine::setScissor(const Rect& region) {
+    glScissor(region.left, region.top, region.getWidth(), region.getHeight());
+    glEnable(GL_SCISSOR_TEST);
+}
+
+void GLESRenderEngine::disableScissor() {
+    glDisable(GL_SCISSOR_TEST);
+}
+
+void GLESRenderEngine::genTextures(size_t count, uint32_t* names) {
+    glGenTextures(count, names);
+}
+
+void GLESRenderEngine::deleteTextures(size_t count, uint32_t const* names) {
+    for (int i = 0; i < count; ++i) {
+        mTextureView.erase(names[i]);
+    }
+    glDeleteTextures(count, names);
+}
+
+void GLESRenderEngine::bindExternalTextureImage(uint32_t texName, const Image& image) {
+    ATRACE_CALL();
+    const GLImage& glImage = static_cast<const GLImage&>(image);
+    const GLenum target = GL_TEXTURE_EXTERNAL_OES;
+
+    glBindTexture(target, texName);
+    if (glImage.getEGLImage() != EGL_NO_IMAGE_KHR) {
+        glEGLImageTargetTexture2DOES(target, static_cast<GLeglImageOES>(glImage.getEGLImage()));
+    }
+}
+
+status_t GLESRenderEngine::bindExternalTextureBuffer(uint32_t texName,
+                                                     const sp<GraphicBuffer>& buffer,
+                                                     const sp<Fence>& bufferFence) {
+    if (buffer == nullptr) {
+        return BAD_VALUE;
+    }
+
+    ATRACE_CALL();
+
+    bool found = false;
+    {
+        std::lock_guard<std::mutex> lock(mRenderingMutex);
+        auto cachedImage = mImageCache.find(buffer->getId());
+        found = (cachedImage != mImageCache.end());
+    }
+
+    // If we couldn't find the image in the cache at this time, then either
+    // SurfaceFlinger messed up registering the buffer ahead of time or we got
+    // backed up creating other EGLImages.
+    if (!found) {
+        status_t cacheResult = mImageManager->cache(buffer);
+        if (cacheResult != NO_ERROR) {
+            return cacheResult;
+        }
+    }
+
+    // Whether or not we needed to cache, re-check mImageCache to make sure that
+    // there's an EGLImage. The current threading model guarantees that we don't
+    // destroy a cached image until it's really not needed anymore (i.e. this
+    // function should not be called), so the only possibility is that something
+    // terrible went wrong and we should just bind something and move on.
+    {
+        std::lock_guard<std::mutex> lock(mRenderingMutex);
+        auto cachedImage = mImageCache.find(buffer->getId());
+
+        if (cachedImage == mImageCache.end()) {
+            // We failed creating the image if we got here, so bail out.
+            ALOGE("Failed to create an EGLImage when rendering");
+            bindExternalTextureImage(texName, *createImage());
+            return NO_INIT;
+        }
+
+        bindExternalTextureImage(texName, *cachedImage->second);
+        mTextureView.insert_or_assign(texName, buffer->getId());
+    }
+
+    // Wait for the new buffer to be ready.
+    if (bufferFence != nullptr && bufferFence->isValid()) {
+        if (GLExtensions::getInstance().hasWaitSync()) {
+            base::unique_fd fenceFd(bufferFence->dup());
+            if (fenceFd == -1) {
+                ALOGE("error dup'ing fence fd: %d", errno);
+                return -errno;
+            }
+            if (!waitFence(std::move(fenceFd))) {
+                ALOGE("failed to wait on fence fd");
+                return UNKNOWN_ERROR;
+            }
+        } else {
+            status_t err = bufferFence->waitForever("RenderEngine::bindExternalTextureBuffer");
+            if (err != NO_ERROR) {
+                ALOGE("error waiting for fence: %d", err);
+                return err;
+            }
+        }
+    }
+
+    return NO_ERROR;
+}
+
+void GLESRenderEngine::cacheExternalTextureBuffer(const sp<GraphicBuffer>& buffer) {
+    mImageManager->cacheAsync(buffer, nullptr);
+}
+
+std::shared_ptr<ImageManager::Barrier> GLESRenderEngine::cacheExternalTextureBufferForTesting(
+        const sp<GraphicBuffer>& buffer) {
+    auto barrier = std::make_shared<ImageManager::Barrier>();
+    mImageManager->cacheAsync(buffer, barrier);
+    return barrier;
+}
+
+status_t GLESRenderEngine::cacheExternalTextureBufferInternal(const sp<GraphicBuffer>& buffer) {
+    if (buffer == nullptr) {
+        return BAD_VALUE;
+    }
+
+    {
+        std::lock_guard<std::mutex> lock(mRenderingMutex);
+        if (mImageCache.count(buffer->getId()) > 0) {
+            // If there's already an image then fail fast here.
+            return NO_ERROR;
+        }
+    }
+    ATRACE_CALL();
+
+    // Create the image without holding a lock so that we don't block anything.
+    std::unique_ptr<Image> newImage = createImage();
+
+    bool created = newImage->setNativeWindowBuffer(buffer->getNativeBuffer(),
+                                                   buffer->getUsage() & GRALLOC_USAGE_PROTECTED);
+    if (!created) {
+        ALOGE("Failed to create image. size=%ux%u st=%u usage=%#" PRIx64 " fmt=%d",
+              buffer->getWidth(), buffer->getHeight(), buffer->getStride(), buffer->getUsage(),
+              buffer->getPixelFormat());
+        return NO_INIT;
+    }
+
+    {
+        std::lock_guard<std::mutex> lock(mRenderingMutex);
+        if (mImageCache.count(buffer->getId()) > 0) {
+            // In theory it's possible for another thread to recache the image,
+            // so bail out if another thread won.
+            return NO_ERROR;
+        }
+        mImageCache.insert(std::make_pair(buffer->getId(), std::move(newImage)));
+    }
+
+    return NO_ERROR;
+}
+
+void GLESRenderEngine::unbindExternalTextureBuffer(uint64_t bufferId) {
+    mImageManager->releaseAsync(bufferId, nullptr);
+}
+
+std::shared_ptr<ImageManager::Barrier> GLESRenderEngine::unbindExternalTextureBufferForTesting(
+        uint64_t bufferId) {
+    auto barrier = std::make_shared<ImageManager::Barrier>();
+    mImageManager->releaseAsync(bufferId, barrier);
+    return barrier;
+}
+
+void GLESRenderEngine::unbindExternalTextureBufferInternal(uint64_t bufferId) {
+    std::unique_ptr<Image> image;
+    {
+        std::lock_guard<std::mutex> lock(mRenderingMutex);
+        const auto& cachedImage = mImageCache.find(bufferId);
+
+        if (cachedImage != mImageCache.end()) {
+            ALOGV("Destroying image for buffer: %" PRIu64, bufferId);
+            // Move the buffer out of cache first, so that we can destroy
+            // without holding the cache's lock.
+            image = std::move(cachedImage->second);
+            mImageCache.erase(bufferId);
+            return;
+        }
+    }
+    ALOGV("Failed to find image for buffer: %" PRIu64, bufferId);
+}
+
+FloatRect GLESRenderEngine::setupLayerCropping(const LayerSettings& layer, Mesh& mesh) {
+    // Translate win by the rounded corners rect coordinates, to have all values in
+    // layer coordinate space.
+    FloatRect cropWin = layer.geometry.boundaries;
+    const FloatRect& roundedCornersCrop = layer.geometry.roundedCornersCrop;
+    cropWin.left -= roundedCornersCrop.left;
+    cropWin.right -= roundedCornersCrop.left;
+    cropWin.top -= roundedCornersCrop.top;
+    cropWin.bottom -= roundedCornersCrop.top;
+    Mesh::VertexArray<vec2> cropCoords(mesh.getCropCoordArray<vec2>());
+    cropCoords[0] = vec2(cropWin.left, cropWin.top);
+    cropCoords[1] = vec2(cropWin.left, cropWin.top + cropWin.getHeight());
+    cropCoords[2] = vec2(cropWin.right, cropWin.top + cropWin.getHeight());
+    cropCoords[3] = vec2(cropWin.right, cropWin.top);
+
+    setupCornerRadiusCropSize(roundedCornersCrop.getWidth(), roundedCornersCrop.getHeight());
+    return cropWin;
+}
+
+void GLESRenderEngine::handleRoundedCorners(const DisplaySettings& display,
+                                            const LayerSettings& layer, const Mesh& mesh) {
+    // We separate the layer into 3 parts essentially, such that we only turn on blending for the
+    // top rectangle and the bottom rectangle, and turn off blending for the middle rectangle.
+    FloatRect bounds = layer.geometry.roundedCornersCrop;
+
+    // Explicitly compute the transform from the clip rectangle to the physical
+    // display. Normally, this is done in glViewport but we explicitly compute
+    // it here so that we can get the scissor bounds correct.
+    const Rect& source = display.clip;
+    const Rect& destination = display.physicalDisplay;
+    // Here we compute the following transform:
+    // 1. Translate the top left corner of the source clip to (0, 0)
+    // 2. Rotate the clip rectangle about the origin in accordance with the
+    // orientation flag
+    // 3. Translate the top left corner back to the origin.
+    // 4. Scale the clip rectangle to the destination rectangle dimensions
+    // 5. Translate the top left corner to the destination rectangle's top left
+    // corner.
+    const mat4 translateSource = mat4::translate(vec4(-source.left, -source.top, 0, 1));
+    mat4 rotation;
+    int displacementX = 0;
+    int displacementY = 0;
+    float destinationWidth = static_cast<float>(destination.getWidth());
+    float destinationHeight = static_cast<float>(destination.getHeight());
+    float sourceWidth = static_cast<float>(source.getWidth());
+    float sourceHeight = static_cast<float>(source.getHeight());
+    const float rot90InRadians = 2.0f * static_cast<float>(M_PI) / 4.0f;
+    switch (display.orientation) {
+        case ui::Transform::ROT_90:
+            rotation = mat4::rotate(rot90InRadians, vec3(0, 0, 1));
+            displacementX = source.getHeight();
+            std::swap(sourceHeight, sourceWidth);
+            break;
+        case ui::Transform::ROT_180:
+            rotation = mat4::rotate(rot90InRadians * 2.0f, vec3(0, 0, 1));
+            displacementY = source.getHeight();
+            displacementX = source.getWidth();
+            break;
+        case ui::Transform::ROT_270:
+            rotation = mat4::rotate(rot90InRadians * 3.0f, vec3(0, 0, 1));
+            displacementY = source.getWidth();
+            std::swap(sourceHeight, sourceWidth);
+            break;
+        default:
+            break;
+    }
+
+    const mat4 intermediateTranslation = mat4::translate(vec4(displacementX, displacementY, 0, 1));
+    const mat4 scale = mat4::scale(
+            vec4(destinationWidth / sourceWidth, destinationHeight / sourceHeight, 1, 1));
+    const mat4 translateDestination =
+            mat4::translate(vec4(destination.left, destination.top, 0, 1));
+    const mat4 globalTransform =
+            translateDestination * scale * intermediateTranslation * rotation * translateSource;
+
+    const mat4 transformMatrix = globalTransform * layer.geometry.positionTransform;
+    const vec4 leftTopCoordinate(bounds.left, bounds.top, 1.0, 1.0);
+    const vec4 rightBottomCoordinate(bounds.right, bounds.bottom, 1.0, 1.0);
+    const vec4 leftTopCoordinateInBuffer = transformMatrix * leftTopCoordinate;
+    const vec4 rightBottomCoordinateInBuffer = transformMatrix * rightBottomCoordinate;
+    bounds = FloatRect(std::min(leftTopCoordinateInBuffer[0], rightBottomCoordinateInBuffer[0]),
+                       std::min(leftTopCoordinateInBuffer[1], rightBottomCoordinateInBuffer[1]),
+                       std::max(leftTopCoordinateInBuffer[0], rightBottomCoordinateInBuffer[0]),
+                       std::max(leftTopCoordinateInBuffer[1], rightBottomCoordinateInBuffer[1]));
+
+    // Finally, we cut the layer into 3 parts, with top and bottom parts having rounded corners
+    // and the middle part without rounded corners.
+    const int32_t radius = ceil(layer.geometry.roundedCornersRadius);
+    const Rect topRect(bounds.left, bounds.top, bounds.right, bounds.top + radius);
+    setScissor(topRect);
+    drawMesh(mesh);
+    const Rect bottomRect(bounds.left, bounds.bottom - radius, bounds.right, bounds.bottom);
+    setScissor(bottomRect);
+    drawMesh(mesh);
+
+    // The middle part of the layer can turn off blending.
+    if (topRect.bottom < bottomRect.top) {
+        const Rect middleRect(bounds.left, bounds.top + radius, bounds.right,
+                              bounds.bottom - radius);
+        setScissor(middleRect);
+        mState.cornerRadius = 0.0;
+        disableBlending();
+        drawMesh(mesh);
+    }
+    disableScissor();
+}
+
+status_t GLESRenderEngine::bindFrameBuffer(Framebuffer* framebuffer) {
+    ATRACE_CALL();
+    GLFramebuffer* glFramebuffer = static_cast<GLFramebuffer*>(framebuffer);
+    EGLImageKHR eglImage = glFramebuffer->getEGLImage();
+    uint32_t textureName = glFramebuffer->getTextureName();
+    uint32_t framebufferName = glFramebuffer->getFramebufferName();
+
+    // Bind the texture and turn our EGLImage into a texture
+    glBindTexture(GL_TEXTURE_2D, textureName);
+    glEGLImageTargetTexture2DOES(GL_TEXTURE_2D, (GLeglImageOES)eglImage);
+
+    // Bind the Framebuffer to render into
+    glBindFramebuffer(GL_FRAMEBUFFER, framebufferName);
+    glFramebufferTexture2D(GL_FRAMEBUFFER, GL_COLOR_ATTACHMENT0, GL_TEXTURE_2D, textureName, 0);
+
+    uint32_t glStatus = glCheckFramebufferStatus(GL_FRAMEBUFFER);
+    ALOGE_IF(glStatus != GL_FRAMEBUFFER_COMPLETE_OES, "glCheckFramebufferStatusOES error %d",
+             glStatus);
+
+    return glStatus == GL_FRAMEBUFFER_COMPLETE_OES ? NO_ERROR : BAD_VALUE;
+}
+
+void GLESRenderEngine::unbindFrameBuffer(Framebuffer* /*framebuffer*/) {
+    ATRACE_CALL();
+
+    // back to main framebuffer
+    glBindFramebuffer(GL_FRAMEBUFFER, 0);
+}
+
+bool GLESRenderEngine::cleanupPostRender(CleanupMode mode) {
+    ATRACE_CALL();
+
+    if (mPriorResourcesCleaned ||
+        (mLastDrawFence != nullptr && mLastDrawFence->getStatus() != Fence::Status::Signaled)) {
+        // If we don't have a prior frame needing cleanup, then don't do anything.
+        return false;
+    }
+
+    // This is a bit of a band-aid fix for FrameCaptureProcessor, as we should
+    // not need to keep memory around if we don't need to do so.
+    if (mode == CleanupMode::CLEAN_ALL) {
+        // TODO: SurfaceFlinger memory utilization may benefit from resetting
+        // texture bindings as well. Assess if it does and there's no performance regression
+        // when rebinding the same image data to the same texture, and if so then its mode
+        // behavior can be tweaked.
+        if (mPlaceholderImage != EGL_NO_IMAGE_KHR) {
+            for (auto [textureName, bufferId] : mTextureView) {
+                if (bufferId && mPlaceholderImage != EGL_NO_IMAGE_KHR) {
+                    glBindTexture(GL_TEXTURE_EXTERNAL_OES, textureName);
+                    glEGLImageTargetTexture2DOES(GL_TEXTURE_EXTERNAL_OES,
+                                                 static_cast<GLeglImageOES>(mPlaceholderImage));
+                    mTextureView[textureName] = std::nullopt;
+                    checkErrors();
+                }
+            }
+        }
+        {
+            std::lock_guard<std::mutex> lock(mRenderingMutex);
+            mImageCache.clear();
+        }
+    }
+
+    // Bind the texture to placeholder so that backing image data can be freed.
+    GLFramebuffer* glFramebuffer = static_cast<GLFramebuffer*>(getFramebufferForDrawing());
+    glFramebuffer->allocateBuffers(1, 1, mPlaceholderDrawBuffer);
+    // Release the cached fence here, so that we don't churn reallocations when
+    // we could no-op repeated calls of this method instead.
+    mLastDrawFence = nullptr;
+    mPriorResourcesCleaned = true;
+    return true;
+}
+
+void GLESRenderEngine::checkErrors() const {
+    checkErrors(nullptr);
+}
+
+void GLESRenderEngine::checkErrors(const char* tag) const {
+    do {
+        // there could be more than one error flag
+        GLenum error = glGetError();
+        if (error == GL_NO_ERROR) break;
+        if (tag == nullptr) {
+            ALOGE("GL error 0x%04x", int(error));
+        } else {
+            ALOGE("GL error: %s -> 0x%04x", tag, int(error));
+        }
+    } while (true);
+}
+
+bool GLESRenderEngine::supportsProtectedContent() const {
+    return mProtectedEGLContext != EGL_NO_CONTEXT;
+}
+
+bool GLESRenderEngine::useProtectedContext(bool useProtectedContext) {
+    if (useProtectedContext == mInProtectedContext) {
+        return true;
+    }
+    if (useProtectedContext && mProtectedEGLContext == EGL_NO_CONTEXT) {
+        return false;
+    }
+    const EGLSurface surface = useProtectedContext ? mProtectedStubSurface : mStubSurface;
+    const EGLContext context = useProtectedContext ? mProtectedEGLContext : mEGLContext;
+    const bool success = eglMakeCurrent(mEGLDisplay, surface, surface, context) == EGL_TRUE;
+    if (success) {
+        mInProtectedContext = useProtectedContext;
+    }
+    return success;
+}
+EGLImageKHR GLESRenderEngine::createFramebufferImageIfNeeded(ANativeWindowBuffer* nativeBuffer,
+                                                             bool isProtected,
+                                                             bool useFramebufferCache) {
+    sp<GraphicBuffer> graphicBuffer = GraphicBuffer::from(nativeBuffer);
+    if (useFramebufferCache) {
+        std::lock_guard<std::mutex> lock(mFramebufferImageCacheMutex);
+        for (const auto& image : mFramebufferImageCache) {
+            if (image.first == graphicBuffer->getId()) {
+                return image.second;
+            }
+        }
+    }
+    EGLint attributes[] = {
+            isProtected ? EGL_PROTECTED_CONTENT_EXT : EGL_NONE,
+            isProtected ? EGL_TRUE : EGL_NONE,
+            EGL_NONE,
+    };
+    EGLImageKHR image = eglCreateImageKHR(mEGLDisplay, EGL_NO_CONTEXT, EGL_NATIVE_BUFFER_ANDROID,
+                                          nativeBuffer, attributes);
+    if (useFramebufferCache) {
+        if (image != EGL_NO_IMAGE_KHR) {
+            std::lock_guard<std::mutex> lock(mFramebufferImageCacheMutex);
+            if (mFramebufferImageCache.size() >= mFramebufferImageCacheSize) {
+                EGLImageKHR expired = mFramebufferImageCache.front().second;
+                mFramebufferImageCache.pop_front();
+                eglDestroyImageKHR(mEGLDisplay, expired);
+                DEBUG_EGL_IMAGE_TRACKER_DESTROY();
+            }
+            mFramebufferImageCache.push_back({graphicBuffer->getId(), image});
+        }
+    }
+
+    if (image != EGL_NO_IMAGE_KHR) {
+        DEBUG_EGL_IMAGE_TRACKER_CREATE();
+    }
+    return image;
+}
+
+status_t GLESRenderEngine::drawLayers(const DisplaySettings& display,
+                                      const std::vector<const LayerSettings*>& layers,
+                                      const sp<GraphicBuffer>& buffer,
+                                      const bool useFramebufferCache, base::unique_fd&& bufferFence,
+                                      base::unique_fd* drawFence) {
+    ATRACE_CALL();
+    if (layers.empty()) {
+        ALOGV("Drawing empty layer stack");
+        return NO_ERROR;
+    }
+
+    if (bufferFence.get() >= 0) {
+        // Duplicate the fence for passing to waitFence.
+        base::unique_fd bufferFenceDup(dup(bufferFence.get()));
+        if (bufferFenceDup < 0 || !waitFence(std::move(bufferFenceDup))) {
+            ATRACE_NAME("Waiting before draw");
+            sync_wait(bufferFence.get(), -1);
+        }
+    }
+
+    if (buffer == nullptr) {
+        ALOGE("No output buffer provided. Aborting GPU composition.");
+        return BAD_VALUE;
+    }
+
+    std::unique_ptr<BindNativeBufferAsFramebuffer> fbo;
+    // Gathering layers that requested blur, we'll need them to decide when to render to an
+    // offscreen buffer, and when to render to the native buffer.
+    std::deque<const LayerSettings*> blurLayers;
+    if (CC_LIKELY(mBlurFilter != nullptr)) {
+        for (auto layer : layers) {
+            if (layer->backgroundBlurRadius > 0) {
+                blurLayers.push_back(layer);
+            }
+        }
+    }
+    const auto blurLayersSize = blurLayers.size();
+
+    if (blurLayersSize == 0) {
+        fbo = std::make_unique<BindNativeBufferAsFramebuffer>(*this,
+                                                              buffer.get()->getNativeBuffer(),
+                                                              useFramebufferCache);
+        if (fbo->getStatus() != NO_ERROR) {
+            ALOGE("Failed to bind framebuffer! Aborting GPU composition for buffer (%p).",
+                  buffer->handle);
+            checkErrors();
+            return fbo->getStatus();
+        }
+        setViewportAndProjection(display.physicalDisplay, display.clip);
+    } else {
+        setViewportAndProjection(display.physicalDisplay, display.clip);
+        auto status =
+                mBlurFilter->setAsDrawTarget(display, blurLayers.front()->backgroundBlurRadius);
+        if (status != NO_ERROR) {
+            ALOGE("Failed to prepare blur filter! Aborting GPU composition for buffer (%p).",
+                  buffer->handle);
+            checkErrors();
+            return status;
+        }
+    }
+
+    // clear the entire buffer, sometimes when we reuse buffers we'd persist
+    // ghost images otherwise.
+    // we also require a full transparent framebuffer for overlays. This is
+    // probably not quite efficient on all GPUs, since we could filter out
+    // opaque layers.
+    clearWithColor(0.0, 0.0, 0.0, 0.0);
+
+    setOutputDataSpace(display.outputDataspace);
+    setDisplayMaxLuminance(display.maxLuminance);
+
+    const mat4 projectionMatrix =
+            ui::Transform(display.orientation).asMatrix4() * mState.projectionMatrix;
+    if (!display.clearRegion.isEmpty()) {
+        glDisable(GL_BLEND);
+        fillRegionWithColor(display.clearRegion, 0.0, 0.0, 0.0, 1.0);
+    }
+
+    Mesh mesh = Mesh::Builder()
+                        .setPrimitive(Mesh::TRIANGLE_FAN)
+                        .setVertices(4 /* count */, 2 /* size */)
+                        .setTexCoords(2 /* size */)
+                        .setCropCoords(2 /* size */)
+                        .build();
+    for (auto const layer : layers) {
+        if (blurLayers.size() > 0 && blurLayers.front() == layer) {
+            blurLayers.pop_front();
+
+            auto status = mBlurFilter->prepare();
+            if (status != NO_ERROR) {
+                ALOGE("Failed to render blur effect! Aborting GPU composition for buffer (%p).",
+                      buffer->handle);
+                checkErrors("Can't render first blur pass");
+                return status;
+            }
+
+            if (blurLayers.size() == 0) {
+                // Done blurring, time to bind the native FBO and render our blur onto it.
+                fbo = std::make_unique<BindNativeBufferAsFramebuffer>(*this,
+                                                                      buffer.get()
+                                                                              ->getNativeBuffer(),
+                                                                      useFramebufferCache);
+                status = fbo->getStatus();
+                setViewportAndProjection(display.physicalDisplay, display.clip);
+            } else {
+                // There's still something else to blur, so let's keep rendering to our FBO
+                // instead of to the display.
+                status = mBlurFilter->setAsDrawTarget(display,
+                                                      blurLayers.front()->backgroundBlurRadius);
+            }
+            if (status != NO_ERROR) {
+                ALOGE("Failed to bind framebuffer! Aborting GPU composition for buffer (%p).",
+                      buffer->handle);
+                checkErrors("Can't bind native framebuffer");
+                return status;
+            }
+
+            status = mBlurFilter->render(blurLayersSize > 1);
+            if (status != NO_ERROR) {
+                ALOGE("Failed to render blur effect! Aborting GPU composition for buffer (%p).",
+                      buffer->handle);
+                checkErrors("Can't render blur filter");
+                return status;
+            }
+        }
+
+        mState.maxMasteringLuminance = layer->source.buffer.maxMasteringLuminance;
+        mState.maxContentLuminance = layer->source.buffer.maxContentLuminance;
+        mState.projectionMatrix = projectionMatrix * layer->geometry.positionTransform;
+
+        const FloatRect bounds = layer->geometry.boundaries;
+        Mesh::VertexArray<vec2> position(mesh.getPositionArray<vec2>());
+        position[0] = vec2(bounds.left, bounds.top);
+        position[1] = vec2(bounds.left, bounds.bottom);
+        position[2] = vec2(bounds.right, bounds.bottom);
+        position[3] = vec2(bounds.right, bounds.top);
+
+        setupLayerCropping(*layer, mesh);
+        setColorTransform(display.colorTransform * layer->colorTransform);
+
+        bool usePremultipliedAlpha = true;
+        bool disableTexture = true;
+        bool isOpaque = false;
+        if (layer->source.buffer.buffer != nullptr) {
+            disableTexture = false;
+            isOpaque = layer->source.buffer.isOpaque;
+
+            sp<GraphicBuffer> gBuf = layer->source.buffer.buffer;
+            bindExternalTextureBuffer(layer->source.buffer.textureName, gBuf,
+                                      layer->source.buffer.fence);
+
+            usePremultipliedAlpha = layer->source.buffer.usePremultipliedAlpha;
+            Texture texture(Texture::TEXTURE_EXTERNAL, layer->source.buffer.textureName);
+            mat4 texMatrix = layer->source.buffer.textureTransform;
+
+            texture.setMatrix(texMatrix.asArray());
+            texture.setFiltering(layer->source.buffer.useTextureFiltering);
+
+            texture.setDimensions(gBuf->getWidth(), gBuf->getHeight());
+            setSourceY410BT2020(layer->source.buffer.isY410BT2020);
+
+            renderengine::Mesh::VertexArray<vec2> texCoords(mesh.getTexCoordArray<vec2>());
+            texCoords[0] = vec2(0.0, 0.0);
+            texCoords[1] = vec2(0.0, 1.0);
+            texCoords[2] = vec2(1.0, 1.0);
+            texCoords[3] = vec2(1.0, 0.0);
+            setupLayerTexturing(texture);
+        }
+
+        const half3 solidColor = layer->source.solidColor;
+        const half4 color = half4(solidColor.r, solidColor.g, solidColor.b, layer->alpha);
+        // Buffer sources will have a black solid color ignored in the shader,
+        // so in that scenario the solid color passed here is arbitrary.
+        setupLayerBlending(usePremultipliedAlpha, isOpaque, disableTexture, color,
+                           layer->geometry.roundedCornersRadius);
+        if (layer->disableBlending) {
+            glDisable(GL_BLEND);
+        }
+        setSourceDataSpace(layer->sourceDataspace);
+
+        if (layer->shadow.length > 0.0f) {
+            handleShadow(layer->geometry.boundaries, layer->geometry.roundedCornersRadius,
+                         layer->shadow);
+        }
+        // We only want to do a special handling for rounded corners when having rounded corners
+        // is the only reason it needs to turn on blending, otherwise, we handle it like the
+        // usual way since it needs to turn on blending anyway.
+        else if (layer->geometry.roundedCornersRadius > 0.0 && color.a >= 1.0f && isOpaque) {
+            handleRoundedCorners(display, *layer, mesh);
+        } else {
+            drawMesh(mesh);
+        }
+
+        // Cleanup if there's a buffer source
+        if (layer->source.buffer.buffer != nullptr) {
+            disableBlending();
+            setSourceY410BT2020(false);
+            disableTexturing();
+        }
+    }
+
+    if (drawFence != nullptr) {
+        *drawFence = flush();
+    }
+    // If flush failed or we don't support native fences, we need to force the
+    // gl command stream to be executed.
+    if (drawFence == nullptr || drawFence->get() < 0) {
+        bool success = finish();
+        if (!success) {
+            ALOGE("Failed to flush RenderEngine commands");
+            checkErrors();
+            // Chances are, something illegal happened (either the caller passed
+            // us bad parameters, or we messed up our shader generation).
+            return INVALID_OPERATION;
+        }
+        mLastDrawFence = nullptr;
+    } else {
+        // The caller takes ownership of drawFence, so we need to duplicate the
+        // fd here.
+        mLastDrawFence = new Fence(dup(drawFence->get()));
+    }
+    mPriorResourcesCleaned = false;
+
+    checkErrors();
+    return NO_ERROR;
+}
+
+void GLESRenderEngine::setViewportAndProjection(Rect viewport, Rect clip) {
+    ATRACE_CALL();
+    mVpWidth = viewport.getWidth();
+    mVpHeight = viewport.getHeight();
+
+    // We pass the top left corner instead of the bottom left corner,
+    // because since we're rendering off-screen first.
+    glViewport(viewport.left, viewport.top, mVpWidth, mVpHeight);
+
+    mState.projectionMatrix = mat4::ortho(clip.left, clip.right, clip.top, clip.bottom, 0, 1);
+}
+
+void GLESRenderEngine::setupLayerBlending(bool premultipliedAlpha, bool opaque, bool disableTexture,
+                                          const half4& color, float cornerRadius) {
+    mState.isPremultipliedAlpha = premultipliedAlpha;
+    mState.isOpaque = opaque;
+    mState.color = color;
+    mState.cornerRadius = cornerRadius;
+
+    if (disableTexture) {
+        mState.textureEnabled = false;
+    }
+
+    if (color.a < 1.0f || !opaque || cornerRadius > 0.0f) {
+        glEnable(GL_BLEND);
+        glBlendFunc(premultipliedAlpha ? GL_ONE : GL_SRC_ALPHA, GL_ONE_MINUS_SRC_ALPHA);
+    } else {
+        glDisable(GL_BLEND);
+    }
+}
+
+void GLESRenderEngine::setSourceY410BT2020(bool enable) {
+    mState.isY410BT2020 = enable;
+}
+
+void GLESRenderEngine::setSourceDataSpace(Dataspace source) {
+    mDataSpace = source;
+}
+
+void GLESRenderEngine::setOutputDataSpace(Dataspace dataspace) {
+    mOutputDataSpace = dataspace;
+}
+
+void GLESRenderEngine::setDisplayMaxLuminance(const float maxLuminance) {
+    mState.displayMaxLuminance = maxLuminance;
+}
+
+void GLESRenderEngine::setupLayerTexturing(const Texture& texture) {
+    GLuint target = texture.getTextureTarget();
+    glBindTexture(target, texture.getTextureName());
+    GLenum filter = GL_NEAREST;
+    if (texture.getFiltering()) {
+        filter = GL_LINEAR;
+    }
+    glTexParameteri(target, GL_TEXTURE_WRAP_S, GL_CLAMP_TO_EDGE);
+    glTexParameteri(target, GL_TEXTURE_WRAP_T, GL_CLAMP_TO_EDGE);
+    glTexParameteri(target, GL_TEXTURE_MAG_FILTER, filter);
+    glTexParameteri(target, GL_TEXTURE_MIN_FILTER, filter);
+
+    mState.texture = texture;
+    mState.textureEnabled = true;
+}
+
+void GLESRenderEngine::setColorTransform(const mat4& colorTransform) {
+    mState.colorMatrix = colorTransform;
+}
+
+void GLESRenderEngine::disableTexturing() {
+    mState.textureEnabled = false;
+}
+
+void GLESRenderEngine::disableBlending() {
+    glDisable(GL_BLEND);
+}
+
+void GLESRenderEngine::setupFillWithColor(float r, float g, float b, float a) {
+    mState.isPremultipliedAlpha = true;
+    mState.isOpaque = false;
+    mState.color = half4(r, g, b, a);
+    mState.textureEnabled = false;
+    glDisable(GL_BLEND);
+}
+
+void GLESRenderEngine::setupCornerRadiusCropSize(float width, float height) {
+    mState.cropSize = half2(width, height);
+}
+
+void GLESRenderEngine::drawMesh(const Mesh& mesh) {
+    ATRACE_CALL();
+    if (mesh.getTexCoordsSize()) {
+        glEnableVertexAttribArray(Program::texCoords);
+        glVertexAttribPointer(Program::texCoords, mesh.getTexCoordsSize(), GL_FLOAT, GL_FALSE,
+                              mesh.getByteStride(), mesh.getTexCoords());
+    }
+
+    glVertexAttribPointer(Program::position, mesh.getVertexSize(), GL_FLOAT, GL_FALSE,
+                          mesh.getByteStride(), mesh.getPositions());
+
+    if (mState.cornerRadius > 0.0f) {
+        glEnableVertexAttribArray(Program::cropCoords);
+        glVertexAttribPointer(Program::cropCoords, mesh.getVertexSize(), GL_FLOAT, GL_FALSE,
+                              mesh.getByteStride(), mesh.getCropCoords());
+    }
+
+    if (mState.drawShadows) {
+        glEnableVertexAttribArray(Program::shadowColor);
+        glVertexAttribPointer(Program::shadowColor, mesh.getShadowColorSize(), GL_FLOAT, GL_FALSE,
+                              mesh.getByteStride(), mesh.getShadowColor());
+
+        glEnableVertexAttribArray(Program::shadowParams);
+        glVertexAttribPointer(Program::shadowParams, mesh.getShadowParamsSize(), GL_FLOAT, GL_FALSE,
+                              mesh.getByteStride(), mesh.getShadowParams());
+    }
+
+    Description managedState = mState;
+    // By default, DISPLAY_P3 is the only supported wide color output. However,
+    // when HDR content is present, hardware composer may be able to handle
+    // BT2020 data space, in that case, the output data space is set to be
+    // BT2020_HLG or BT2020_PQ respectively. In GPU fall back we need
+    // to respect this and convert non-HDR content to HDR format.
+    if (mUseColorManagement) {
+        Dataspace inputStandard = static_cast<Dataspace>(mDataSpace & Dataspace::STANDARD_MASK);
+        Dataspace inputTransfer = static_cast<Dataspace>(mDataSpace & Dataspace::TRANSFER_MASK);
+        Dataspace outputStandard =
+                static_cast<Dataspace>(mOutputDataSpace & Dataspace::STANDARD_MASK);
+        Dataspace outputTransfer =
+                static_cast<Dataspace>(mOutputDataSpace & Dataspace::TRANSFER_MASK);
+        bool needsXYZConversion = needsXYZTransformMatrix();
+
+        // NOTE: if the input standard of the input dataspace is not STANDARD_DCI_P3 or
+        // STANDARD_BT2020, it will be  treated as STANDARD_BT709
+        if (inputStandard != Dataspace::STANDARD_DCI_P3 &&
+            inputStandard != Dataspace::STANDARD_BT2020) {
+            inputStandard = Dataspace::STANDARD_BT709;
+        }
+
+        if (needsXYZConversion) {
+            // The supported input color spaces are standard RGB, Display P3 and BT2020.
+            switch (inputStandard) {
+                case Dataspace::STANDARD_DCI_P3:
+                    managedState.inputTransformMatrix = mDisplayP3ToXyz;
+                    break;
+                case Dataspace::STANDARD_BT2020:
+                    managedState.inputTransformMatrix = mBt2020ToXyz;
+                    break;
+                default:
+                    managedState.inputTransformMatrix = mSrgbToXyz;
+                    break;
+            }
+
+            // The supported output color spaces are BT2020, Display P3 and standard RGB.
+            switch (outputStandard) {
+                case Dataspace::STANDARD_BT2020:
+                    managedState.outputTransformMatrix = mXyzToBt2020;
+                    break;
+                case Dataspace::STANDARD_DCI_P3:
+                    managedState.outputTransformMatrix = mXyzToDisplayP3;
+                    break;
+                default:
+                    managedState.outputTransformMatrix = mXyzToSrgb;
+                    break;
+            }
+        } else if (inputStandard != outputStandard) {
+            // At this point, the input data space and output data space could be both
+            // HDR data spaces, but they match each other, we do nothing in this case.
+            // In addition to the case above, the input data space could be
+            // - scRGB linear
+            // - scRGB non-linear
+            // - sRGB
+            // - Display P3
+            // - BT2020
+            // The output data spaces could be
+            // - sRGB
+            // - Display P3
+            // - BT2020
+            switch (outputStandard) {
+                case Dataspace::STANDARD_BT2020:
+                    if (inputStandard == Dataspace::STANDARD_BT709) {
+                        managedState.outputTransformMatrix = mSrgbToBt2020;
+                    } else if (inputStandard == Dataspace::STANDARD_DCI_P3) {
+                        managedState.outputTransformMatrix = mDisplayP3ToBt2020;
+                    }
+                    break;
+                case Dataspace::STANDARD_DCI_P3:
+                    if (inputStandard == Dataspace::STANDARD_BT709) {
+                        managedState.outputTransformMatrix = mSrgbToDisplayP3;
+                    } else if (inputStandard == Dataspace::STANDARD_BT2020) {
+                        managedState.outputTransformMatrix = mBt2020ToDisplayP3;
+                    }
+                    break;
+                default:
+                    if (inputStandard == Dataspace::STANDARD_DCI_P3) {
+                        managedState.outputTransformMatrix = mDisplayP3ToSrgb;
+                    } else if (inputStandard == Dataspace::STANDARD_BT2020) {
+                        managedState.outputTransformMatrix = mBt2020ToSrgb;
+                    }
+                    break;
+            }
+        }
+
+        // we need to convert the RGB value to linear space and convert it back when:
+        // - there is a color matrix that is not an identity matrix, or
+        // - there is an output transform matrix that is not an identity matrix, or
+        // - the input transfer function doesn't match the output transfer function.
+        if (managedState.hasColorMatrix() || managedState.hasOutputTransformMatrix() ||
+            inputTransfer != outputTransfer) {
+            managedState.inputTransferFunction =
+                    Description::dataSpaceToTransferFunction(inputTransfer);
+            managedState.outputTransferFunction =
+                    Description::dataSpaceToTransferFunction(outputTransfer);
+        }
+    }
+
+    ProgramCache::getInstance().useProgram(mInProtectedContext ? mProtectedEGLContext : mEGLContext,
+                                           managedState);
+
+    if (mState.drawShadows) {
+        glDrawElements(mesh.getPrimitive(), mesh.getIndexCount(), GL_UNSIGNED_SHORT,
+                       mesh.getIndices());
+    } else {
+        glDrawArrays(mesh.getPrimitive(), 0, mesh.getVertexCount());
+    }
+
+    if (mUseColorManagement && outputDebugPPMs) {
+        static uint64_t managedColorFrameCount = 0;
+        std::ostringstream out;
+        out << "/data/texture_out" << managedColorFrameCount++;
+        writePPM(out.str().c_str(), mVpWidth, mVpHeight);
+    }
+
+    if (mesh.getTexCoordsSize()) {
+        glDisableVertexAttribArray(Program::texCoords);
+    }
+
+    if (mState.cornerRadius > 0.0f) {
+        glDisableVertexAttribArray(Program::cropCoords);
+    }
+
+    if (mState.drawShadows) {
+        glDisableVertexAttribArray(Program::shadowColor);
+        glDisableVertexAttribArray(Program::shadowParams);
+    }
+}
+
+size_t GLESRenderEngine::getMaxTextureSize() const {
+    return mMaxTextureSize;
+}
+
+size_t GLESRenderEngine::getMaxViewportDims() const {
+    return mMaxViewportDims[0] < mMaxViewportDims[1] ? mMaxViewportDims[0] : mMaxViewportDims[1];
+}
+
+void GLESRenderEngine::dump(std::string& result) {
+    const GLExtensions& extensions = GLExtensions::getInstance();
+    ProgramCache& cache = ProgramCache::getInstance();
+
+    StringAppendF(&result, "EGL implementation : %s\n", extensions.getEGLVersion());
+    StringAppendF(&result, "%s\n", extensions.getEGLExtensions());
+    StringAppendF(&result, "GLES: %s, %s, %s\n", extensions.getVendor(), extensions.getRenderer(),
+                  extensions.getVersion());
+    StringAppendF(&result, "%s\n", extensions.getExtensions());
+    StringAppendF(&result, "RenderEngine supports protected context: %d\n",
+                  supportsProtectedContent());
+    StringAppendF(&result, "RenderEngine is in protected context: %d\n", mInProtectedContext);
+    StringAppendF(&result, "RenderEngine program cache size for unprotected context: %zu\n",
+                  cache.getSize(mEGLContext));
+    StringAppendF(&result, "RenderEngine program cache size for protected context: %zu\n",
+                  cache.getSize(mProtectedEGLContext));
+    StringAppendF(&result, "RenderEngine last dataspace conversion: (%s) to (%s)\n",
+                  dataspaceDetails(static_cast<android_dataspace>(mDataSpace)).c_str(),
+                  dataspaceDetails(static_cast<android_dataspace>(mOutputDataSpace)).c_str());
+    {
+        std::lock_guard<std::mutex> lock(mRenderingMutex);
+        StringAppendF(&result, "RenderEngine image cache size: %zu\n", mImageCache.size());
+        StringAppendF(&result, "Dumping buffer ids...\n");
+        for (const auto& [id, unused] : mImageCache) {
+            StringAppendF(&result, "0x%" PRIx64 "\n", id);
+        }
+    }
+    {
+        std::lock_guard<std::mutex> lock(mFramebufferImageCacheMutex);
+        StringAppendF(&result, "RenderEngine framebuffer image cache size: %zu\n",
+                      mFramebufferImageCache.size());
+        StringAppendF(&result, "Dumping buffer ids...\n");
+        for (const auto& [id, unused] : mFramebufferImageCache) {
+            StringAppendF(&result, "0x%" PRIx64 "\n", id);
+        }
+    }
+}
+
+GLESRenderEngine::GlesVersion GLESRenderEngine::parseGlesVersion(const char* str) {
+    int major, minor;
+    if (sscanf(str, "OpenGL ES-CM %d.%d", &major, &minor) != 2) {
+        if (sscanf(str, "OpenGL ES %d.%d", &major, &minor) != 2) {
+            ALOGW("Unable to parse GL_VERSION string: \"%s\"", str);
+            return GLES_VERSION_1_0;
+        }
+    }
+
+    if (major == 1 && minor == 0) return GLES_VERSION_1_0;
+    if (major == 1 && minor >= 1) return GLES_VERSION_1_1;
+    if (major == 2 && minor >= 0) return GLES_VERSION_2_0;
+    if (major == 3 && minor >= 0) return GLES_VERSION_3_0;
+
+    ALOGW("Unrecognized OpenGL ES version: %d.%d", major, minor);
+    return GLES_VERSION_1_0;
+}
+
+EGLContext GLESRenderEngine::createEglContext(EGLDisplay display, EGLConfig config,
+                                              EGLContext shareContext, bool useContextPriority,
+                                              Protection protection) {
+    EGLint renderableType = 0;
+    if (config == EGL_NO_CONFIG) {
+        renderableType = EGL_OPENGL_ES3_BIT;
+    } else if (!eglGetConfigAttrib(display, config, EGL_RENDERABLE_TYPE, &renderableType)) {
+        LOG_ALWAYS_FATAL("can't query EGLConfig RENDERABLE_TYPE");
+    }
+    EGLint contextClientVersion = 0;
+    if (renderableType & EGL_OPENGL_ES3_BIT) {
+        contextClientVersion = 3;
+    } else if (renderableType & EGL_OPENGL_ES2_BIT) {
+        contextClientVersion = 2;
+    } else if (renderableType & EGL_OPENGL_ES_BIT) {
+        contextClientVersion = 1;
+    } else {
+        LOG_ALWAYS_FATAL("no supported EGL_RENDERABLE_TYPEs");
+    }
+
+    std::vector<EGLint> contextAttributes;
+    contextAttributes.reserve(7);
+    contextAttributes.push_back(EGL_CONTEXT_CLIENT_VERSION);
+    contextAttributes.push_back(contextClientVersion);
+    if (useContextPriority) {
+        contextAttributes.push_back(EGL_CONTEXT_PRIORITY_LEVEL_IMG);
+        contextAttributes.push_back(EGL_CONTEXT_PRIORITY_HIGH_IMG);
+    }
+    if (protection == Protection::PROTECTED) {
+        contextAttributes.push_back(EGL_PROTECTED_CONTENT_EXT);
+        contextAttributes.push_back(EGL_TRUE);
+    }
+    contextAttributes.push_back(EGL_NONE);
+
+    EGLContext context = eglCreateContext(display, config, shareContext, contextAttributes.data());
+
+    if (contextClientVersion == 3 && context == EGL_NO_CONTEXT) {
+        // eglGetConfigAttrib indicated we can create GLES 3 context, but we failed, thus
+        // EGL_NO_CONTEXT so that we can abort.
+        if (config != EGL_NO_CONFIG) {
+            return context;
+        }
+        // If |config| is EGL_NO_CONFIG, we speculatively try to create GLES 3 context, so we should
+        // try to fall back to GLES 2.
+        contextAttributes[1] = 2;
+        context = eglCreateContext(display, config, shareContext, contextAttributes.data());
+    }
+
+    return context;
+}
+
+EGLSurface GLESRenderEngine::createStubEglPbufferSurface(EGLDisplay display, EGLConfig config,
+                                                         int hwcFormat, Protection protection) {
+    EGLConfig stubConfig = config;
+    if (stubConfig == EGL_NO_CONFIG) {
+        stubConfig = chooseEglConfig(display, hwcFormat, /*logConfig*/ true);
+    }
+    std::vector<EGLint> attributes;
+    attributes.reserve(7);
+    attributes.push_back(EGL_WIDTH);
+    attributes.push_back(1);
+    attributes.push_back(EGL_HEIGHT);
+    attributes.push_back(1);
+    if (protection == Protection::PROTECTED) {
+        attributes.push_back(EGL_PROTECTED_CONTENT_EXT);
+        attributes.push_back(EGL_TRUE);
+    }
+    attributes.push_back(EGL_NONE);
+
+    return eglCreatePbufferSurface(display, stubConfig, attributes.data());
+}
+
+bool GLESRenderEngine::isHdrDataSpace(const Dataspace dataSpace) const {
+    const Dataspace standard = static_cast<Dataspace>(dataSpace & Dataspace::STANDARD_MASK);
+    const Dataspace transfer = static_cast<Dataspace>(dataSpace & Dataspace::TRANSFER_MASK);
+    return standard == Dataspace::STANDARD_BT2020 &&
+            (transfer == Dataspace::TRANSFER_ST2084 || transfer == Dataspace::TRANSFER_HLG);
+}
+
+// For convenience, we want to convert the input color space to XYZ color space first,
+// and then convert from XYZ color space to output color space when
+// - SDR and HDR contents are mixed, either SDR content will be converted to HDR or
+//   HDR content will be tone-mapped to SDR; Or,
+// - there are HDR PQ and HLG contents presented at the same time, where we want to convert
+//   HLG content to PQ content.
+// In either case above, we need to operate the Y value in XYZ color space. Thus, when either
+// input data space or output data space is HDR data space, and the input transfer function
+// doesn't match the output transfer function, we would enable an intermediate transfrom to
+// XYZ color space.
+bool GLESRenderEngine::needsXYZTransformMatrix() const {
+    const bool isInputHdrDataSpace = isHdrDataSpace(mDataSpace);
+    const bool isOutputHdrDataSpace = isHdrDataSpace(mOutputDataSpace);
+    const Dataspace inputTransfer = static_cast<Dataspace>(mDataSpace & Dataspace::TRANSFER_MASK);
+    const Dataspace outputTransfer =
+            static_cast<Dataspace>(mOutputDataSpace & Dataspace::TRANSFER_MASK);
+
+    return (isInputHdrDataSpace || isOutputHdrDataSpace) && inputTransfer != outputTransfer;
+}
+
+bool GLESRenderEngine::isImageCachedForTesting(uint64_t bufferId) {
+    std::lock_guard<std::mutex> lock(mRenderingMutex);
+    const auto& cachedImage = mImageCache.find(bufferId);
+    return cachedImage != mImageCache.end();
+}
+
+bool GLESRenderEngine::isTextureNameKnownForTesting(uint32_t texName) {
+    const auto& entry = mTextureView.find(texName);
+    return entry != mTextureView.end();
+}
+
+std::optional<uint64_t> GLESRenderEngine::getBufferIdForTextureNameForTesting(uint32_t texName) {
+    const auto& entry = mTextureView.find(texName);
+    return entry != mTextureView.end() ? entry->second : std::nullopt;
+}
+
+bool GLESRenderEngine::isFramebufferImageCachedForTesting(uint64_t bufferId) {
+    std::lock_guard<std::mutex> lock(mFramebufferImageCacheMutex);
+    return std::any_of(mFramebufferImageCache.cbegin(), mFramebufferImageCache.cend(),
+                       [=](std::pair<uint64_t, EGLImageKHR> image) {
+                           return image.first == bufferId;
+                       });
+}
+
+// FlushTracer implementation
+GLESRenderEngine::FlushTracer::FlushTracer(GLESRenderEngine* engine) : mEngine(engine) {
+    mThread = std::thread(&GLESRenderEngine::FlushTracer::loop, this);
+}
+
+GLESRenderEngine::FlushTracer::~FlushTracer() {
+    {
+        std::lock_guard<std::mutex> lock(mMutex);
+        mRunning = false;
+    }
+    mCondition.notify_all();
+    if (mThread.joinable()) {
+        mThread.join();
+    }
+}
+
+void GLESRenderEngine::FlushTracer::queueSync(EGLSyncKHR sync) {
+    std::lock_guard<std::mutex> lock(mMutex);
+    char name[64];
+    const uint64_t frameNum = mFramesQueued++;
+    snprintf(name, sizeof(name), "Queueing sync for frame: %lu",
+             static_cast<unsigned long>(frameNum));
+    ATRACE_NAME(name);
+    mQueue.push({sync, frameNum});
+    ATRACE_INT("GPU Frames Outstanding", mQueue.size());
+    mCondition.notify_one();
+}
+
+void GLESRenderEngine::FlushTracer::loop() {
+    while (mRunning) {
+        QueueEntry entry;
+        {
+            std::lock_guard<std::mutex> lock(mMutex);
+
+            mCondition.wait(mMutex,
+                            [&]() REQUIRES(mMutex) { return !mQueue.empty() || !mRunning; });
+
+            if (!mRunning) {
+                // if mRunning is false, then FlushTracer is being destroyed, so
+                // bail out now.
+                break;
+            }
+            entry = mQueue.front();
+            mQueue.pop();
+        }
+        {
+            char name[64];
+            snprintf(name, sizeof(name), "waiting for frame %lu",
+                     static_cast<unsigned long>(entry.mFrameNum));
+            ATRACE_NAME(name);
+            mEngine->waitSync(entry.mSync, 0);
+        }
+    }
+}
+
+void GLESRenderEngine::handleShadow(const FloatRect& casterRect, float casterCornerRadius,
+                                    const ShadowSettings& settings) {
+    ATRACE_CALL();
+    const float casterZ = settings.length / 2.0f;
+    const GLShadowVertexGenerator shadows(casterRect, casterCornerRadius, casterZ,
+                                          settings.casterIsTranslucent, settings.ambientColor,
+                                          settings.spotColor, settings.lightPos,
+                                          settings.lightRadius);
+
+    // setup mesh for both shadows
+    Mesh mesh = Mesh::Builder()
+                        .setPrimitive(Mesh::TRIANGLES)
+                        .setVertices(shadows.getVertexCount(), 2 /* size */)
+                        .setShadowAttrs()
+                        .setIndices(shadows.getIndexCount())
+                        .build();
+
+    Mesh::VertexArray<vec2> position = mesh.getPositionArray<vec2>();
+    Mesh::VertexArray<vec4> shadowColor = mesh.getShadowColorArray<vec4>();
+    Mesh::VertexArray<vec3> shadowParams = mesh.getShadowParamsArray<vec3>();
+    shadows.fillVertices(position, shadowColor, shadowParams);
+    shadows.fillIndices(mesh.getIndicesArray());
+
+    mState.cornerRadius = 0.0f;
+    mState.drawShadows = true;
+    setupLayerTexturing(mShadowTexture.getTexture());
+    drawMesh(mesh);
+    mState.drawShadows = false;
+}
+
+} // namespace gl
+} // namespace renderengine
+} // namespace android
diff --git a/media/libstagefright/renderfright/gl/GLESRenderEngine.h b/media/libstagefright/renderfright/gl/GLESRenderEngine.h
new file mode 100644
index 0000000..2c6eae2
--- /dev/null
+++ b/media/libstagefright/renderfright/gl/GLESRenderEngine.h
@@ -0,0 +1,296 @@
+/*
+ * Copyright 2013 The Android Open Source Project
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ *      http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+#ifndef SF_GLESRENDERENGINE_H_
+#define SF_GLESRENDERENGINE_H_
+
+#include <condition_variable>
+#include <deque>
+#include <mutex>
+#include <queue>
+#include <thread>
+#include <unordered_map>
+
+#include <EGL/egl.h>
+#include <EGL/eglext.h>
+#include <GLES2/gl2.h>
+#include <android-base/thread_annotations.h>
+#include <renderengine/RenderEngine.h>
+#include <renderengine/private/Description.h>
+#include <sys/types.h>
+#include "GLShadowTexture.h"
+#include "ImageManager.h"
+
+#define EGL_NO_CONFIG ((EGLConfig)0)
+
+namespace android {
+
+namespace renderengine {
+
+class Mesh;
+class Texture;
+
+namespace gl {
+
+class GLImage;
+class BlurFilter;
+
+class GLESRenderEngine : public impl::RenderEngine {
+public:
+    static std::unique_ptr<GLESRenderEngine> create(const RenderEngineCreationArgs& args);
+
+    GLESRenderEngine(const RenderEngineCreationArgs& args, EGLDisplay display, EGLConfig config,
+                     EGLContext ctxt, EGLSurface stub, EGLContext protectedContext,
+                     EGLSurface protectedStub);
+    ~GLESRenderEngine() override EXCLUDES(mRenderingMutex);
+
+    void primeCache() const override;
+    void genTextures(size_t count, uint32_t* names) override;
+    void deleteTextures(size_t count, uint32_t const* names) override;
+    void bindExternalTextureImage(uint32_t texName, const Image& image) override;
+    status_t bindExternalTextureBuffer(uint32_t texName, const sp<GraphicBuffer>& buffer,
+                                       const sp<Fence>& fence) EXCLUDES(mRenderingMutex);
+    void cacheExternalTextureBuffer(const sp<GraphicBuffer>& buffer) EXCLUDES(mRenderingMutex);
+    void unbindExternalTextureBuffer(uint64_t bufferId) EXCLUDES(mRenderingMutex);
+    status_t bindFrameBuffer(Framebuffer* framebuffer) override;
+    void unbindFrameBuffer(Framebuffer* framebuffer) override;
+
+    bool isProtected() const override { return mInProtectedContext; }
+    bool supportsProtectedContent() const override;
+    bool useProtectedContext(bool useProtectedContext) override;
+    status_t drawLayers(const DisplaySettings& display,
+                        const std::vector<const LayerSettings*>& layers,
+                        const sp<GraphicBuffer>& buffer, const bool useFramebufferCache,
+                        base::unique_fd&& bufferFence, base::unique_fd* drawFence) override;
+    bool cleanupPostRender(CleanupMode mode) override;
+
+    EGLDisplay getEGLDisplay() const { return mEGLDisplay; }
+    // Creates an output image for rendering to
+    EGLImageKHR createFramebufferImageIfNeeded(ANativeWindowBuffer* nativeBuffer, bool isProtected,
+                                               bool useFramebufferCache)
+            EXCLUDES(mFramebufferImageCacheMutex);
+
+    // Test-only methods
+    // Returns true iff mImageCache contains an image keyed by bufferId
+    bool isImageCachedForTesting(uint64_t bufferId) EXCLUDES(mRenderingMutex);
+    // Returns true iff texName was previously generated by RenderEngine and was
+    // not destroyed.
+    bool isTextureNameKnownForTesting(uint32_t texName);
+    // Returns the buffer ID of the content bound to texName, or nullopt if no
+    // such mapping exists.
+    std::optional<uint64_t> getBufferIdForTextureNameForTesting(uint32_t texName);
+    // Returns true iff mFramebufferImageCache contains an image keyed by bufferId
+    bool isFramebufferImageCachedForTesting(uint64_t bufferId)
+            EXCLUDES(mFramebufferImageCacheMutex);
+    // These are wrappers around public methods above, but exposing Barrier
+    // objects so that tests can block.
+    std::shared_ptr<ImageManager::Barrier> cacheExternalTextureBufferForTesting(
+            const sp<GraphicBuffer>& buffer);
+    std::shared_ptr<ImageManager::Barrier> unbindExternalTextureBufferForTesting(uint64_t bufferId);
+
+protected:
+    Framebuffer* getFramebufferForDrawing() override;
+    void dump(std::string& result) override EXCLUDES(mRenderingMutex)
+            EXCLUDES(mFramebufferImageCacheMutex);
+    size_t getMaxTextureSize() const override;
+    size_t getMaxViewportDims() const override;
+
+private:
+    enum GlesVersion {
+        GLES_VERSION_1_0 = 0x10000,
+        GLES_VERSION_1_1 = 0x10001,
+        GLES_VERSION_2_0 = 0x20000,
+        GLES_VERSION_3_0 = 0x30000,
+    };
+
+    static EGLConfig chooseEglConfig(EGLDisplay display, int format, bool logConfig);
+    static GlesVersion parseGlesVersion(const char* str);
+    static EGLContext createEglContext(EGLDisplay display, EGLConfig config,
+                                       EGLContext shareContext, bool useContextPriority,
+                                       Protection protection);
+    static EGLSurface createStubEglPbufferSurface(EGLDisplay display, EGLConfig config,
+                                                  int hwcFormat, Protection protection);
+    std::unique_ptr<Framebuffer> createFramebuffer();
+    std::unique_ptr<Image> createImage();
+    void checkErrors() const;
+    void checkErrors(const char* tag) const;
+    void setScissor(const Rect& region);
+    void disableScissor();
+    bool waitSync(EGLSyncKHR sync, EGLint flags);
+    status_t cacheExternalTextureBufferInternal(const sp<GraphicBuffer>& buffer)
+            EXCLUDES(mRenderingMutex);
+    void unbindExternalTextureBufferInternal(uint64_t bufferId) EXCLUDES(mRenderingMutex);
+
+    // A data space is considered HDR data space if it has BT2020 color space
+    // with PQ or HLG transfer function.
+    bool isHdrDataSpace(const ui::Dataspace dataSpace) const;
+    bool needsXYZTransformMatrix() const;
+    // Defines the viewport, and sets the projection matrix to the projection
+    // defined by the clip.
+    void setViewportAndProjection(Rect viewport, Rect clip);
+    // Evicts stale images from the buffer cache.
+    void evictImages(const std::vector<LayerSettings>& layers);
+    // Computes the cropping window for the layer and sets up cropping
+    // coordinates for the mesh.
+    FloatRect setupLayerCropping(const LayerSettings& layer, Mesh& mesh);
+
+    // We do a special handling for rounded corners when it's possible to turn off blending
+    // for the majority of the layer. The rounded corners needs to turn on blending such that
+    // we can set the alpha value correctly, however, only the corners need this, and since
+    // blending is an expensive operation, we want to turn off blending when it's not necessary.
+    void handleRoundedCorners(const DisplaySettings& display, const LayerSettings& layer,
+                              const Mesh& mesh);
+    base::unique_fd flush();
+    bool finish();
+    bool waitFence(base::unique_fd fenceFd);
+    void clearWithColor(float red, float green, float blue, float alpha);
+    void fillRegionWithColor(const Region& region, float red, float green, float blue, float alpha);
+    void handleShadow(const FloatRect& casterRect, float casterCornerRadius,
+                      const ShadowSettings& shadowSettings);
+    void setupLayerBlending(bool premultipliedAlpha, bool opaque, bool disableTexture,
+                            const half4& color, float cornerRadius);
+    void setupLayerTexturing(const Texture& texture);
+    void setupFillWithColor(float r, float g, float b, float a);
+    void setColorTransform(const mat4& colorTransform);
+    void disableTexturing();
+    void disableBlending();
+    void setupCornerRadiusCropSize(float width, float height);
+
+    // HDR and color management related functions and state
+    void setSourceY410BT2020(bool enable);
+    void setSourceDataSpace(ui::Dataspace source);
+    void setOutputDataSpace(ui::Dataspace dataspace);
+    void setDisplayMaxLuminance(const float maxLuminance);
+
+    // drawing
+    void drawMesh(const Mesh& mesh);
+
+    EGLDisplay mEGLDisplay;
+    EGLConfig mEGLConfig;
+    EGLContext mEGLContext;
+    EGLSurface mStubSurface;
+    EGLContext mProtectedEGLContext;
+    EGLSurface mProtectedStubSurface;
+    GLint mMaxViewportDims[2];
+    GLint mMaxTextureSize;
+    GLuint mVpWidth;
+    GLuint mVpHeight;
+    Description mState;
+    GLShadowTexture mShadowTexture;
+
+    mat4 mSrgbToXyz;
+    mat4 mDisplayP3ToXyz;
+    mat4 mBt2020ToXyz;
+    mat4 mXyzToSrgb;
+    mat4 mXyzToDisplayP3;
+    mat4 mXyzToBt2020;
+    mat4 mSrgbToDisplayP3;
+    mat4 mSrgbToBt2020;
+    mat4 mDisplayP3ToSrgb;
+    mat4 mDisplayP3ToBt2020;
+    mat4 mBt2020ToSrgb;
+    mat4 mBt2020ToDisplayP3;
+
+    bool mInProtectedContext = false;
+    // If set to true, then enables tracing flush() and finish() to systrace.
+    bool mTraceGpuCompletion = false;
+    // Maximum size of mFramebufferImageCache. If more images would be cached, then (approximately)
+    // the last recently used buffer should be kicked out.
+    uint32_t mFramebufferImageCacheSize = 0;
+
+    // Cache of output images, keyed by corresponding GraphicBuffer ID.
+    std::deque<std::pair<uint64_t, EGLImageKHR>> mFramebufferImageCache
+            GUARDED_BY(mFramebufferImageCacheMutex);
+    // The only reason why we have this mutex is so that we don't segfault when
+    // dumping info.
+    std::mutex mFramebufferImageCacheMutex;
+
+    // Current dataspace of layer being rendered
+    ui::Dataspace mDataSpace = ui::Dataspace::UNKNOWN;
+
+    // Current output dataspace of the render engine
+    ui::Dataspace mOutputDataSpace = ui::Dataspace::UNKNOWN;
+
+    // Whether device supports color management, currently color management
+    // supports sRGB, DisplayP3 color spaces.
+    const bool mUseColorManagement = false;
+
+    // Cache of GL images that we'll store per GraphicBuffer ID
+    std::unordered_map<uint64_t, std::unique_ptr<Image>> mImageCache GUARDED_BY(mRenderingMutex);
+    std::unordered_map<uint32_t, std::optional<uint64_t>> mTextureView;
+
+    // Mutex guarding rendering operations, so that:
+    // 1. GL operations aren't interleaved, and
+    // 2. Internal state related to rendering that is potentially modified by
+    // multiple threads is guaranteed thread-safe.
+    std::mutex mRenderingMutex;
+
+    std::unique_ptr<Framebuffer> mDrawingBuffer;
+    // this is a 1x1 RGB buffer, but over-allocate in case a driver wants more
+    // memory or if it needs to satisfy alignment requirements. In this case:
+    // assume that each channel requires 4 bytes, and add 3 additional bytes to
+    // ensure that we align on a word. Allocating 16 bytes will provide a
+    // guarantee that we don't clobber memory.
+    uint32_t mPlaceholderDrawBuffer[4];
+    // Placeholder buffer and image, similar to mPlaceholderDrawBuffer, but
+    // instead these are intended for cleaning up texture memory with the
+    // GL_TEXTURE_EXTERNAL_OES target.
+    ANativeWindowBuffer* mPlaceholderBuffer = nullptr;
+    EGLImage mPlaceholderImage = EGL_NO_IMAGE_KHR;
+    sp<Fence> mLastDrawFence;
+    // Store a separate boolean checking if prior resources were cleaned up, as
+    // devices that don't support native sync fences can't rely on a last draw
+    // fence that doesn't exist.
+    bool mPriorResourcesCleaned = true;
+
+    // Blur effect processor, only instantiated when a layer requests it.
+    BlurFilter* mBlurFilter = nullptr;
+
+    class FlushTracer {
+    public:
+        FlushTracer(GLESRenderEngine* engine);
+        ~FlushTracer();
+        void queueSync(EGLSyncKHR sync) EXCLUDES(mMutex);
+
+        struct QueueEntry {
+            EGLSyncKHR mSync = nullptr;
+            uint64_t mFrameNum = 0;
+        };
+
+    private:
+        void loop();
+        GLESRenderEngine* const mEngine;
+        std::thread mThread;
+        std::condition_variable_any mCondition;
+        std::mutex mMutex;
+        std::queue<QueueEntry> mQueue GUARDED_BY(mMutex);
+        uint64_t mFramesQueued GUARDED_BY(mMutex) = 0;
+        bool mRunning = true;
+    };
+    friend class FlushTracer;
+    friend class ImageManager;
+    friend class GLFramebuffer;
+    friend class BlurFilter;
+    friend class GenericProgram;
+    std::unique_ptr<FlushTracer> mFlushTracer;
+    std::unique_ptr<ImageManager> mImageManager = std::make_unique<ImageManager>(this);
+};
+
+} // namespace gl
+} // namespace renderengine
+} // namespace android
+
+#endif /* SF_GLESRENDERENGINE_H_ */
diff --git a/media/libstagefright/renderfright/gl/GLExtensions.cpp b/media/libstagefright/renderfright/gl/GLExtensions.cpp
new file mode 100644
index 0000000..2924b0e
--- /dev/null
+++ b/media/libstagefright/renderfright/gl/GLExtensions.cpp
@@ -0,0 +1,135 @@
+/*
+ * Copyright (C) 2010 The Android Open Source Project
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ *      http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+#include "GLExtensions.h"
+
+#include <string>
+#include <unordered_set>
+
+#include <stdint.h>
+#include <stdio.h>
+#include <stdlib.h>
+
+ANDROID_SINGLETON_STATIC_INSTANCE(android::renderengine::gl::GLExtensions)
+
+namespace android {
+namespace renderengine {
+namespace gl {
+
+namespace {
+
+class ExtensionSet {
+public:
+    ExtensionSet(const char* extensions) {
+        char const* curr = extensions;
+        char const* head = curr;
+        do {
+            head = strchr(curr, ' ');
+            size_t len = head ? head - curr : strlen(curr);
+            if (len > 0) {
+                mExtensions.emplace(curr, len);
+            }
+            curr = head + 1;
+        } while (head);
+    }
+
+    bool hasExtension(const char* extension) const { return mExtensions.count(extension) > 0; }
+
+private:
+    std::unordered_set<std::string> mExtensions;
+};
+
+} // anonymous namespace
+
+void GLExtensions::initWithGLStrings(GLubyte const* vendor, GLubyte const* renderer,
+                                     GLubyte const* version, GLubyte const* extensions) {
+    mVendor = (char const*)vendor;
+    mRenderer = (char const*)renderer;
+    mVersion = (char const*)version;
+    mExtensions = (char const*)extensions;
+
+    ExtensionSet extensionSet(mExtensions.c_str());
+    if (extensionSet.hasExtension("GL_EXT_protected_textures")) {
+        mHasProtectedTexture = true;
+    }
+}
+
+char const* GLExtensions::getVendor() const {
+    return mVendor.string();
+}
+
+char const* GLExtensions::getRenderer() const {
+    return mRenderer.string();
+}
+
+char const* GLExtensions::getVersion() const {
+    return mVersion.string();
+}
+
+char const* GLExtensions::getExtensions() const {
+    return mExtensions.string();
+}
+
+void GLExtensions::initWithEGLStrings(char const* eglVersion, char const* eglExtensions) {
+    mEGLVersion = eglVersion;
+    mEGLExtensions = eglExtensions;
+
+    ExtensionSet extensionSet(eglExtensions);
+
+    // EGL_ANDROIDX_no_config_context is an experimental extension with no
+    // written specification. It will be replaced by something more formal.
+    // SurfaceFlinger is using it to allow a single EGLContext to render to
+    // both a 16-bit primary display framebuffer and a 32-bit virtual display
+    // framebuffer.
+    //
+    // EGL_KHR_no_config_context is official extension to allow creating a
+    // context that works with any surface of a display.
+    if (extensionSet.hasExtension("EGL_ANDROIDX_no_config_context") ||
+        extensionSet.hasExtension("EGL_KHR_no_config_context")) {
+        mHasNoConfigContext = true;
+    }
+
+    if (extensionSet.hasExtension("EGL_ANDROID_native_fence_sync")) {
+        mHasNativeFenceSync = true;
+    }
+    if (extensionSet.hasExtension("EGL_KHR_fence_sync")) {
+        mHasFenceSync = true;
+    }
+    if (extensionSet.hasExtension("EGL_KHR_wait_sync")) {
+        mHasWaitSync = true;
+    }
+    if (extensionSet.hasExtension("EGL_EXT_protected_content")) {
+        mHasProtectedContent = true;
+    }
+    if (extensionSet.hasExtension("EGL_IMG_context_priority")) {
+        mHasContextPriority = true;
+    }
+    if (extensionSet.hasExtension("EGL_KHR_surfaceless_context")) {
+        mHasSurfacelessContext = true;
+    }
+}
+
+char const* GLExtensions::getEGLVersion() const {
+    return mEGLVersion.string();
+}
+
+char const* GLExtensions::getEGLExtensions() const {
+    return mEGLExtensions.string();
+}
+
+} // namespace gl
+} // namespace renderengine
+} // namespace android
diff --git a/media/libstagefright/renderfright/gl/GLExtensions.h b/media/libstagefright/renderfright/gl/GLExtensions.h
new file mode 100644
index 0000000..ef00009
--- /dev/null
+++ b/media/libstagefright/renderfright/gl/GLExtensions.h
@@ -0,0 +1,86 @@
+/*
+ * Copyright (C) 2010 The Android Open Source Project
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ *      http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+#ifndef ANDROID_SF_GLEXTENSION_H
+#define ANDROID_SF_GLEXTENSION_H
+
+#include <stdint.h>
+#include <sys/types.h>
+
+#include <EGL/egl.h>
+#include <EGL/eglext.h>
+#include <GLES/gl.h>
+#include <GLES/glext.h>
+#include <utils/Singleton.h>
+#include <utils/String8.h>
+
+namespace android {
+namespace renderengine {
+namespace gl {
+
+class GLExtensions : public Singleton<GLExtensions> {
+public:
+    bool hasNoConfigContext() const { return mHasNoConfigContext; }
+    bool hasNativeFenceSync() const { return mHasNativeFenceSync; }
+    bool hasFenceSync() const { return mHasFenceSync; }
+    bool hasWaitSync() const { return mHasWaitSync; }
+    bool hasProtectedContent() const { return mHasProtectedContent; }
+    bool hasContextPriority() const { return mHasContextPriority; }
+    bool hasSurfacelessContext() const { return mHasSurfacelessContext; }
+    bool hasProtectedTexture() const { return mHasProtectedTexture; }
+
+    void initWithGLStrings(GLubyte const* vendor, GLubyte const* renderer, GLubyte const* version,
+                           GLubyte const* extensions);
+    char const* getVendor() const;
+    char const* getRenderer() const;
+    char const* getVersion() const;
+    char const* getExtensions() const;
+
+    void initWithEGLStrings(char const* eglVersion, char const* eglExtensions);
+    char const* getEGLVersion() const;
+    char const* getEGLExtensions() const;
+
+protected:
+    GLExtensions() = default;
+
+private:
+    friend class Singleton<GLExtensions>;
+
+    bool mHasNoConfigContext = false;
+    bool mHasNativeFenceSync = false;
+    bool mHasFenceSync = false;
+    bool mHasWaitSync = false;
+    bool mHasProtectedContent = false;
+    bool mHasContextPriority = false;
+    bool mHasSurfacelessContext = false;
+    bool mHasProtectedTexture = false;
+
+    String8 mVendor;
+    String8 mRenderer;
+    String8 mVersion;
+    String8 mExtensions;
+    String8 mEGLVersion;
+    String8 mEGLExtensions;
+
+    GLExtensions(const GLExtensions&);
+    GLExtensions& operator=(const GLExtensions&);
+};
+
+} // namespace gl
+} // namespace renderengine
+} // namespace android
+
+#endif // ANDROID_SF_GLEXTENSION_H
diff --git a/media/libstagefright/renderfright/gl/GLFramebuffer.cpp b/media/libstagefright/renderfright/gl/GLFramebuffer.cpp
new file mode 100644
index 0000000..383486b
--- /dev/null
+++ b/media/libstagefright/renderfright/gl/GLFramebuffer.cpp
@@ -0,0 +1,114 @@
+/*
+ * Copyright 2018 The Android Open Source Project
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ *      http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+#define ATRACE_TAG ATRACE_TAG_GRAPHICS
+
+#include "GLFramebuffer.h"
+
+#include <GLES/gl.h>
+#include <GLES/glext.h>
+#include <GLES2/gl2ext.h>
+#include <GLES3/gl3.h>
+#include <gui/DebugEGLImageTracker.h>
+#include <nativebase/nativebase.h>
+#include <utils/Trace.h>
+#include "GLESRenderEngine.h"
+
+namespace android {
+namespace renderengine {
+namespace gl {
+
+GLFramebuffer::GLFramebuffer(GLESRenderEngine& engine)
+      : mEngine(engine), mEGLDisplay(engine.getEGLDisplay()), mEGLImage(EGL_NO_IMAGE_KHR) {
+    glGenTextures(1, &mTextureName);
+    glGenFramebuffers(1, &mFramebufferName);
+}
+
+GLFramebuffer::~GLFramebuffer() {
+    glDeleteFramebuffers(1, &mFramebufferName);
+    glDeleteTextures(1, &mTextureName);
+}
+
+bool GLFramebuffer::setNativeWindowBuffer(ANativeWindowBuffer* nativeBuffer, bool isProtected,
+                                          const bool useFramebufferCache) {
+    ATRACE_CALL();
+    if (mEGLImage != EGL_NO_IMAGE_KHR) {
+        if (!usingFramebufferCache) {
+            eglDestroyImageKHR(mEGLDisplay, mEGLImage);
+            DEBUG_EGL_IMAGE_TRACKER_DESTROY();
+        }
+        mEGLImage = EGL_NO_IMAGE_KHR;
+        mBufferWidth = 0;
+        mBufferHeight = 0;
+    }
+
+    if (nativeBuffer) {
+        mEGLImage = mEngine.createFramebufferImageIfNeeded(nativeBuffer, isProtected,
+                                                           useFramebufferCache);
+        if (mEGLImage == EGL_NO_IMAGE_KHR) {
+            return false;
+        }
+        usingFramebufferCache = useFramebufferCache;
+        mBufferWidth = nativeBuffer->width;
+        mBufferHeight = nativeBuffer->height;
+    }
+    return true;
+}
+
+void GLFramebuffer::allocateBuffers(uint32_t width, uint32_t height, void* data) {
+    ATRACE_CALL();
+
+    glBindTexture(GL_TEXTURE_2D, mTextureName);
+    glTexImage2D(GL_TEXTURE_2D, 0, GL_RGB, width, height, 0, GL_RGB, GL_UNSIGNED_BYTE, data);
+    glTexParameteri(GL_TEXTURE_2D, GL_TEXTURE_MIN_FILTER, GL_LINEAR);
+    glTexParameteri(GL_TEXTURE_2D, GL_TEXTURE_MAG_FILTER, GL_LINEAR);
+    glTexParameteri(GL_TEXTURE_2D, GL_TEXTURE_WRAP_S, GL_MIRRORED_REPEAT);
+    glTexParameteri(GL_TEXTURE_2D, GL_TEXTURE_WRAP_T, GL_MIRRORED_REPEAT);
+
+    mBufferHeight = height;
+    mBufferWidth = width;
+    mEngine.checkErrors("Allocating Fbo texture");
+
+    bind();
+    glFramebufferTexture2D(GL_FRAMEBUFFER, GL_COLOR_ATTACHMENT0, GL_TEXTURE_2D, mTextureName, 0);
+    mStatus = glCheckFramebufferStatus(GL_FRAMEBUFFER);
+    unbind();
+    glBindTexture(GL_TEXTURE_2D, 0);
+
+    if (mStatus != GL_FRAMEBUFFER_COMPLETE) {
+        ALOGE("Frame buffer is not complete. Error %d", mStatus);
+    }
+}
+
+void GLFramebuffer::bind() const {
+    glBindFramebuffer(GL_FRAMEBUFFER, mFramebufferName);
+}
+
+void GLFramebuffer::bindAsReadBuffer() const {
+    glBindFramebuffer(GL_READ_FRAMEBUFFER, mFramebufferName);
+}
+
+void GLFramebuffer::bindAsDrawBuffer() const {
+    glBindFramebuffer(GL_DRAW_FRAMEBUFFER, mFramebufferName);
+}
+
+void GLFramebuffer::unbind() const {
+    glBindFramebuffer(GL_FRAMEBUFFER, 0);
+}
+
+} // namespace gl
+} // namespace renderengine
+} // namespace android
diff --git a/media/libstagefright/renderfright/gl/GLFramebuffer.h b/media/libstagefright/renderfright/gl/GLFramebuffer.h
new file mode 100644
index 0000000..6757695
--- /dev/null
+++ b/media/libstagefright/renderfright/gl/GLFramebuffer.h
@@ -0,0 +1,68 @@
+/*
+ * Copyright 2018 The Android Open Source Project
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ *      http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+#pragma once
+
+#include <cstdint>
+
+#include <EGL/egl.h>
+#include <EGL/eglext.h>
+#include <GLES2/gl2.h>
+#include <renderengine/Framebuffer.h>
+
+struct ANativeWindowBuffer;
+
+namespace android {
+namespace renderengine {
+namespace gl {
+
+class GLESRenderEngine;
+
+class GLFramebuffer : public renderengine::Framebuffer {
+public:
+    explicit GLFramebuffer(GLESRenderEngine& engine);
+    explicit GLFramebuffer(GLESRenderEngine& engine, bool multiTarget);
+    ~GLFramebuffer() override;
+
+    bool setNativeWindowBuffer(ANativeWindowBuffer* nativeBuffer, bool isProtected,
+                               const bool useFramebufferCache) override;
+    void allocateBuffers(uint32_t width, uint32_t height, void* data = nullptr);
+    EGLImageKHR getEGLImage() const { return mEGLImage; }
+    uint32_t getTextureName() const { return mTextureName; }
+    uint32_t getFramebufferName() const { return mFramebufferName; }
+    int32_t getBufferHeight() const { return mBufferHeight; }
+    int32_t getBufferWidth() const { return mBufferWidth; }
+    GLenum getStatus() const { return mStatus; }
+    void bind() const;
+    void bindAsReadBuffer() const;
+    void bindAsDrawBuffer() const;
+    void unbind() const;
+
+private:
+    GLESRenderEngine& mEngine;
+    EGLDisplay mEGLDisplay;
+    EGLImageKHR mEGLImage;
+    bool usingFramebufferCache = false;
+    GLenum mStatus = GL_FRAMEBUFFER_UNSUPPORTED;
+    uint32_t mTextureName, mFramebufferName;
+
+    int32_t mBufferHeight = 0;
+    int32_t mBufferWidth = 0;
+};
+
+} // namespace gl
+} // namespace renderengine
+} // namespace android
diff --git a/media/libstagefright/renderfright/gl/GLImage.cpp b/media/libstagefright/renderfright/gl/GLImage.cpp
new file mode 100644
index 0000000..8497721
--- /dev/null
+++ b/media/libstagefright/renderfright/gl/GLImage.cpp
@@ -0,0 +1,83 @@
+/*
+ * Copyright 2018 The Android Open Source Project
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ *      http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+#define ATRACE_TAG ATRACE_TAG_GRAPHICS
+
+#include "GLImage.h"
+
+#include <vector>
+
+#include <gui/DebugEGLImageTracker.h>
+#include <log/log.h>
+#include <utils/Trace.h>
+#include "GLESRenderEngine.h"
+#include "GLExtensions.h"
+
+namespace android {
+namespace renderengine {
+namespace gl {
+
+static std::vector<EGLint> buildAttributeList(bool isProtected) {
+    std::vector<EGLint> attrs;
+    attrs.reserve(16);
+
+    attrs.push_back(EGL_IMAGE_PRESERVED_KHR);
+    attrs.push_back(EGL_TRUE);
+
+    if (isProtected && GLExtensions::getInstance().hasProtectedContent()) {
+        attrs.push_back(EGL_PROTECTED_CONTENT_EXT);
+        attrs.push_back(EGL_TRUE);
+    }
+
+    attrs.push_back(EGL_NONE);
+
+    return attrs;
+}
+
+GLImage::GLImage(const GLESRenderEngine& engine) : mEGLDisplay(engine.getEGLDisplay()) {}
+
+GLImage::~GLImage() {
+    setNativeWindowBuffer(nullptr, false);
+}
+
+bool GLImage::setNativeWindowBuffer(ANativeWindowBuffer* buffer, bool isProtected) {
+    ATRACE_CALL();
+    if (mEGLImage != EGL_NO_IMAGE_KHR) {
+        if (!eglDestroyImageKHR(mEGLDisplay, mEGLImage)) {
+            ALOGE("failed to destroy image: %#x", eglGetError());
+        }
+        DEBUG_EGL_IMAGE_TRACKER_DESTROY();
+        mEGLImage = EGL_NO_IMAGE_KHR;
+    }
+
+    if (buffer) {
+        std::vector<EGLint> attrs = buildAttributeList(isProtected);
+        mEGLImage = eglCreateImageKHR(mEGLDisplay, EGL_NO_CONTEXT, EGL_NATIVE_BUFFER_ANDROID,
+                                      static_cast<EGLClientBuffer>(buffer), attrs.data());
+        if (mEGLImage == EGL_NO_IMAGE_KHR) {
+            ALOGE("failed to create EGLImage: %#x", eglGetError());
+            return false;
+        }
+        DEBUG_EGL_IMAGE_TRACKER_CREATE();
+        mProtected = isProtected;
+    }
+
+    return true;
+}
+
+} // namespace gl
+} // namespace renderengine
+} // namespace android
diff --git a/media/libstagefright/renderfright/gl/GLImage.h b/media/libstagefright/renderfright/gl/GLImage.h
new file mode 100644
index 0000000..59d6ce3
--- /dev/null
+++ b/media/libstagefright/renderfright/gl/GLImage.h
@@ -0,0 +1,54 @@
+/*
+ * Copyright 2018 The Android Open Source Project
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ *      http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+#pragma once
+
+#include <cstdint>
+
+#include <EGL/egl.h>
+#include <EGL/eglext.h>
+#include <android-base/macros.h>
+#include <renderengine/Image.h>
+
+struct ANativeWindowBuffer;
+
+namespace android {
+namespace renderengine {
+namespace gl {
+
+class GLESRenderEngine;
+
+class GLImage : public renderengine::Image {
+public:
+    explicit GLImage(const GLESRenderEngine& engine);
+    ~GLImage() override;
+
+    bool setNativeWindowBuffer(ANativeWindowBuffer* buffer, bool isProtected) override;
+
+    EGLImageKHR getEGLImage() const { return mEGLImage; }
+    bool isProtected() const { return mProtected; }
+
+private:
+    EGLDisplay mEGLDisplay;
+    EGLImageKHR mEGLImage = EGL_NO_IMAGE_KHR;
+    bool mProtected = false;
+
+    DISALLOW_COPY_AND_ASSIGN(GLImage);
+};
+
+} // namespace gl
+} // namespace renderengine
+} // namespace android
diff --git a/media/libstagefright/renderfright/gl/GLShadowTexture.cpp b/media/libstagefright/renderfright/gl/GLShadowTexture.cpp
new file mode 100644
index 0000000..2423a34
--- /dev/null
+++ b/media/libstagefright/renderfright/gl/GLShadowTexture.cpp
@@ -0,0 +1,52 @@
+/*
+ * Copyright 2020 The Android Open Source Project
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ *      http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+#include <GLES/gl.h>
+#include <GLES/glext.h>
+#include <GLES2/gl2.h>
+#include <GLES2/gl2ext.h>
+#include <GLES3/gl3.h>
+
+#include "GLShadowTexture.h"
+#include "GLSkiaShadowPort.h"
+
+namespace android {
+namespace renderengine {
+namespace gl {
+
+GLShadowTexture::GLShadowTexture() {
+    fillShadowTextureData(mTextureData, SHADOW_TEXTURE_WIDTH);
+
+    glGenTextures(1, &mName);
+    glBindTexture(GL_TEXTURE_2D, mName);
+    glTexImage2D(GL_TEXTURE_2D, 0 /* base image level */, GL_ALPHA, SHADOW_TEXTURE_WIDTH,
+                 SHADOW_TEXTURE_HEIGHT, 0 /* border */, GL_ALPHA, GL_UNSIGNED_BYTE, mTextureData);
+    mTexture.init(Texture::TEXTURE_2D, mName);
+    mTexture.setFiltering(true);
+    mTexture.setDimensions(SHADOW_TEXTURE_WIDTH, 1);
+}
+
+GLShadowTexture::~GLShadowTexture() {
+    glDeleteTextures(1, &mName);
+}
+
+const Texture& GLShadowTexture::getTexture() {
+    return mTexture;
+}
+
+} // namespace gl
+} // namespace renderengine
+} // namespace android
diff --git a/media/libstagefright/renderfright/gl/GLShadowTexture.h b/media/libstagefright/renderfright/gl/GLShadowTexture.h
new file mode 100644
index 0000000..250a9d7
--- /dev/null
+++ b/media/libstagefright/renderfright/gl/GLShadowTexture.h
@@ -0,0 +1,44 @@
+/*
+ * Copyright 2020 The Android Open Source Project
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ *      http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+#pragma once
+
+#include <renderengine/Texture.h>
+#include <cstdint>
+
+namespace android {
+namespace renderengine {
+namespace gl {
+
+class GLShadowTexture {
+public:
+    GLShadowTexture();
+    ~GLShadowTexture();
+
+    const Texture& getTexture();
+
+private:
+    static constexpr int SHADOW_TEXTURE_WIDTH = 128;
+    static constexpr int SHADOW_TEXTURE_HEIGHT = 1;
+
+    GLuint mName;
+    Texture mTexture;
+    uint8_t mTextureData[SHADOW_TEXTURE_WIDTH];
+};
+
+} // namespace gl
+} // namespace renderengine
+} // namespace android
diff --git a/media/libstagefright/renderfright/gl/GLShadowVertexGenerator.cpp b/media/libstagefright/renderfright/gl/GLShadowVertexGenerator.cpp
new file mode 100644
index 0000000..3181f9b
--- /dev/null
+++ b/media/libstagefright/renderfright/gl/GLShadowVertexGenerator.cpp
@@ -0,0 +1,98 @@
+/*
+ * Copyright 2019 The Android Open Source Project
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ *      http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+#include <renderengine/Mesh.h>
+
+#include <math/vec4.h>
+
+#include <ui/Rect.h>
+#include <ui/Transform.h>
+
+#include "GLShadowVertexGenerator.h"
+
+namespace android {
+namespace renderengine {
+namespace gl {
+
+GLShadowVertexGenerator::GLShadowVertexGenerator(const FloatRect& casterRect,
+                                                 float casterCornerRadius, float casterZ,
+                                                 bool casterIsTranslucent, const vec4& ambientColor,
+                                                 const vec4& spotColor, const vec3& lightPosition,
+                                                 float lightRadius) {
+    mDrawAmbientShadow = ambientColor.a > 0.f;
+    mDrawSpotShadow = spotColor.a > 0.f;
+
+    // Generate geometries and find number of vertices to generate
+    if (mDrawAmbientShadow) {
+        mAmbientShadowGeometry = getAmbientShadowGeometry(casterRect, casterCornerRadius, casterZ,
+                                                          casterIsTranslucent, ambientColor);
+        mAmbientShadowVertexCount = getVertexCountForGeometry(*mAmbientShadowGeometry.get());
+        mAmbientShadowIndexCount = getIndexCountForGeometry(*mAmbientShadowGeometry.get());
+    } else {
+        mAmbientShadowVertexCount = 0;
+        mAmbientShadowIndexCount = 0;
+    }
+
+    if (mDrawSpotShadow) {
+        mSpotShadowGeometry =
+                getSpotShadowGeometry(casterRect, casterCornerRadius, casterZ, casterIsTranslucent,
+                                      spotColor, lightPosition, lightRadius);
+        mSpotShadowVertexCount = getVertexCountForGeometry(*mSpotShadowGeometry.get());
+        mSpotShadowIndexCount = getIndexCountForGeometry(*mSpotShadowGeometry.get());
+    } else {
+        mSpotShadowVertexCount = 0;
+        mSpotShadowIndexCount = 0;
+    }
+}
+
+size_t GLShadowVertexGenerator::getVertexCount() const {
+    return mAmbientShadowVertexCount + mSpotShadowVertexCount;
+}
+
+size_t GLShadowVertexGenerator::getIndexCount() const {
+    return mAmbientShadowIndexCount + mSpotShadowIndexCount;
+}
+
+void GLShadowVertexGenerator::fillVertices(Mesh::VertexArray<vec2>& position,
+                                           Mesh::VertexArray<vec4>& color,
+                                           Mesh::VertexArray<vec3>& params) const {
+    if (mDrawAmbientShadow) {
+        fillVerticesForGeometry(*mAmbientShadowGeometry.get(), mAmbientShadowVertexCount, position,
+                                color, params);
+    }
+    if (mDrawSpotShadow) {
+        fillVerticesForGeometry(*mSpotShadowGeometry.get(), mSpotShadowVertexCount,
+                                Mesh::VertexArray<vec2>(position, mAmbientShadowVertexCount),
+                                Mesh::VertexArray<vec4>(color, mAmbientShadowVertexCount),
+                                Mesh::VertexArray<vec3>(params, mAmbientShadowVertexCount));
+    }
+}
+
+void GLShadowVertexGenerator::fillIndices(uint16_t* indices) const {
+    if (mDrawAmbientShadow) {
+        fillIndicesForGeometry(*mAmbientShadowGeometry.get(), mAmbientShadowIndexCount,
+                               0 /* starting vertex offset */, indices);
+    }
+    if (mDrawSpotShadow) {
+        fillIndicesForGeometry(*mSpotShadowGeometry.get(), mSpotShadowIndexCount,
+                               mAmbientShadowVertexCount /* starting vertex offset */,
+                               &(indices[mAmbientShadowIndexCount]));
+    }
+}
+
+} // namespace gl
+} // namespace renderengine
+} // namespace android
diff --git a/media/libstagefright/renderfright/gl/GLShadowVertexGenerator.h b/media/libstagefright/renderfright/gl/GLShadowVertexGenerator.h
new file mode 100644
index 0000000..112f976
--- /dev/null
+++ b/media/libstagefright/renderfright/gl/GLShadowVertexGenerator.h
@@ -0,0 +1,65 @@
+/*
+ * Copyright 2019 The Android Open Source Project
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ *      http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+#pragma once
+
+#include <math/vec4.h>
+#include <ui/Rect.h>
+
+#include "GLSkiaShadowPort.h"
+
+namespace android {
+namespace renderengine {
+
+class Mesh;
+
+namespace gl {
+
+/**
+ * Generates gl attributes required to draw shadow spot and/or ambient shadows.
+ *
+ * Each shadow can support different colors. This class generates three vertex attributes for
+ * each shadow, its position, color and shadow params(offset and distance). These can be sent
+ * using a single glDrawElements call.
+ */
+class GLShadowVertexGenerator {
+public:
+    GLShadowVertexGenerator(const FloatRect& casterRect, float casterCornerRadius, float casterZ,
+                            bool casterIsTranslucent, const vec4& ambientColor,
+                            const vec4& spotColor, const vec3& lightPosition, float lightRadius);
+    ~GLShadowVertexGenerator() = default;
+
+    size_t getVertexCount() const;
+    size_t getIndexCount() const;
+    void fillVertices(Mesh::VertexArray<vec2>& position, Mesh::VertexArray<vec4>& color,
+                      Mesh::VertexArray<vec3>& params) const;
+    void fillIndices(uint16_t* indices) const;
+
+private:
+    bool mDrawAmbientShadow;
+    std::unique_ptr<Geometry> mAmbientShadowGeometry;
+    int mAmbientShadowVertexCount = 0;
+    int mAmbientShadowIndexCount = 0;
+
+    bool mDrawSpotShadow;
+    std::unique_ptr<Geometry> mSpotShadowGeometry;
+    int mSpotShadowVertexCount = 0;
+    int mSpotShadowIndexCount = 0;
+};
+
+} // namespace gl
+} // namespace renderengine
+} // namespace android
diff --git a/media/libstagefright/renderfright/gl/GLSkiaShadowPort.cpp b/media/libstagefright/renderfright/gl/GLSkiaShadowPort.cpp
new file mode 100644
index 0000000..da8b435
--- /dev/null
+++ b/media/libstagefright/renderfright/gl/GLSkiaShadowPort.cpp
@@ -0,0 +1,656 @@
+/*
+ * Copyright 2019 The Android Open Source Project
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ *      http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+#include <math/vec4.h>
+
+#include <renderengine/Mesh.h>
+
+#include <ui/Rect.h>
+#include <ui/Transform.h>
+
+#include <utils/Log.h>
+
+#include "GLSkiaShadowPort.h"
+
+namespace android {
+namespace renderengine {
+namespace gl {
+
+/**
+ * The shadow geometry logic and vertex generation code has been ported from skia shadow
+ * fast path OpenGL implementation to draw shadows around rects and rounded rects including
+ * circles.
+ *
+ * path: skia/src/gpu/GrRenderTargetContext.cpp GrRenderTargetContext::drawFastShadow
+ *
+ * Modifications made:
+ * - Switched to using std lib math functions
+ * - Fall off function is implemented in vertex shader rather than a shadow texture
+ * - Removed transformations applied on the caster rect since the caster will be in local
+ *   coordinate space and will be transformed by the vertex shader.
+ */
+
+static inline float divide_and_pin(float numer, float denom, float min, float max) {
+    if (denom == 0.0f) return min;
+    return std::clamp(numer / denom, min, max);
+}
+
+static constexpr auto SK_ScalarSqrt2 = 1.41421356f;
+static constexpr auto kAmbientHeightFactor = 1.0f / 128.0f;
+static constexpr auto kAmbientGeomFactor = 64.0f;
+// Assuming that we have a light height of 600 for the spot shadow,
+// the spot values will reach their maximum at a height of approximately 292.3077.
+// We'll round up to 300 to keep it simple.
+static constexpr auto kMaxAmbientRadius = 300 * kAmbientHeightFactor * kAmbientGeomFactor;
+
+inline float AmbientBlurRadius(float height) {
+    return std::min(height * kAmbientHeightFactor * kAmbientGeomFactor, kMaxAmbientRadius);
+}
+inline float AmbientRecipAlpha(float height) {
+    return 1.0f + std::max(height * kAmbientHeightFactor, 0.0f);
+}
+
+//////////////////////////////////////////////////////////////////////////////
+// Circle Data
+//
+// We have two possible cases for geometry for a circle:
+
+// In the case of a normal fill, we draw geometry for the circle as an octagon.
+static const uint16_t gFillCircleIndices[] = {
+        // enter the octagon
+        // clang-format off
+         0, 1, 8, 1, 2, 8,
+         2, 3, 8, 3, 4, 8,
+         4, 5, 8, 5, 6, 8,
+         6, 7, 8, 7, 0, 8,
+        // clang-format on
+};
+
+// For stroked circles, we use two nested octagons.
+static const uint16_t gStrokeCircleIndices[] = {
+        // enter the octagon
+        // clang-format off
+         0, 1,  9, 0,  9,  8,
+         1, 2, 10, 1, 10,  9,
+         2, 3, 11, 2, 11, 10,
+         3, 4, 12, 3, 12, 11,
+         4, 5, 13, 4, 13, 12,
+         5, 6, 14, 5, 14, 13,
+         6, 7, 15, 6, 15, 14,
+         7, 0,  8, 7,  8, 15,
+        // clang-format on
+};
+
+#define SK_ARRAY_COUNT(a) (sizeof(a) / sizeof((a)[0]))
+static const int kIndicesPerFillCircle = SK_ARRAY_COUNT(gFillCircleIndices);
+static const int kIndicesPerStrokeCircle = SK_ARRAY_COUNT(gStrokeCircleIndices);
+static const int kVertsPerStrokeCircle = 16;
+static const int kVertsPerFillCircle = 9;
+
+static int circle_type_to_vert_count(bool stroked) {
+    return stroked ? kVertsPerStrokeCircle : kVertsPerFillCircle;
+}
+
+static int circle_type_to_index_count(bool stroked) {
+    return stroked ? kIndicesPerStrokeCircle : kIndicesPerFillCircle;
+}
+
+static const uint16_t* circle_type_to_indices(bool stroked) {
+    return stroked ? gStrokeCircleIndices : gFillCircleIndices;
+}
+
+///////////////////////////////////////////////////////////////////////////////
+// RoundRect Data
+//
+// The geometry for a shadow roundrect is similar to a 9-patch:
+//    ____________
+//   |_|________|_|
+//   | |        | |
+//   | |        | |
+//   | |        | |
+//   |_|________|_|
+//   |_|________|_|
+//
+// However, each corner is rendered as a fan rather than a simple quad, as below. (The diagram
+// shows the upper part of the upper left corner. The bottom triangle would similarly be split
+// into two triangles.)
+//    ________
+//   |\  \   |
+//   |  \ \  |
+//   |    \\ |
+//   |      \|
+//   --------
+//
+// The center of the fan handles the curve of the corner. For roundrects where the stroke width
+// is greater than the corner radius, the outer triangles blend from the curve to the straight
+// sides. Otherwise these triangles will be degenerate.
+//
+// In the case where the stroke width is greater than the corner radius and the
+// blur radius (overstroke), we add additional geometry to mark out the rectangle in the center.
+// This rectangle extends the coverage values of the center edges of the 9-patch.
+//    ____________
+//   |_|________|_|
+//   | |\ ____ /| |
+//   | | |    | | |
+//   | | |____| | |
+//   |_|/______\|_|
+//   |_|________|_|
+//
+// For filled rrects we reuse the stroke geometry but add an additional quad to the center.
+
+static const uint16_t gRRectIndices[] = {
+        // clang-format off
+     // overstroke quads
+     // we place this at the beginning so that we can skip these indices when rendering as filled
+     0, 6, 25, 0, 25, 24,
+     6, 18, 27, 6, 27, 25,
+     18, 12, 26, 18, 26, 27,
+     12, 0, 24, 12, 24, 26,
+
+     // corners
+     0, 1, 2, 0, 2, 3, 0, 3, 4, 0, 4, 5,
+     6, 11, 10, 6, 10, 9, 6, 9, 8, 6, 8, 7,
+     12, 17, 16, 12, 16, 15, 12, 15, 14, 12, 14, 13,
+     18, 19, 20, 18, 20, 21, 18, 21, 22, 18, 22, 23,
+
+     // edges
+     0, 5, 11, 0, 11, 6,
+     6, 7, 19, 6, 19, 18,
+     18, 23, 17, 18, 17, 12,
+     12, 13, 1, 12, 1, 0,
+
+     // fill quad
+     // we place this at the end so that we can skip these indices when rendering as stroked
+     0, 6, 18, 0, 18, 12,
+        // clang-format on
+};
+
+// overstroke count
+static const int kIndicesPerOverstrokeRRect = SK_ARRAY_COUNT(gRRectIndices) - 6;
+// simple stroke count skips overstroke indices
+static const int kIndicesPerStrokeRRect = kIndicesPerOverstrokeRRect - 6 * 4;
+// fill count adds final quad to stroke count
+static const int kIndicesPerFillRRect = kIndicesPerStrokeRRect + 6;
+static const int kVertsPerStrokeRRect = 24;
+static const int kVertsPerOverstrokeRRect = 28;
+static const int kVertsPerFillRRect = 24;
+
+static int rrect_type_to_vert_count(RRectType type) {
+    switch (type) {
+        case kFill_RRectType:
+            return kVertsPerFillRRect;
+        case kStroke_RRectType:
+            return kVertsPerStrokeRRect;
+        case kOverstroke_RRectType:
+            return kVertsPerOverstrokeRRect;
+    }
+    ALOGE("Invalid rect type: %d", type);
+    return -1;
+}
+
+static int rrect_type_to_index_count(RRectType type) {
+    switch (type) {
+        case kFill_RRectType:
+            return kIndicesPerFillRRect;
+        case kStroke_RRectType:
+            return kIndicesPerStrokeRRect;
+        case kOverstroke_RRectType:
+            return kIndicesPerOverstrokeRRect;
+    }
+    ALOGE("Invalid rect type: %d", type);
+    return -1;
+}
+
+static const uint16_t* rrect_type_to_indices(RRectType type) {
+    switch (type) {
+        case kFill_RRectType:
+        case kStroke_RRectType:
+            return gRRectIndices + 6 * 4;
+        case kOverstroke_RRectType:
+            return gRRectIndices;
+    }
+    ALOGE("Invalid rect type: %d", type);
+    return nullptr;
+}
+
+static void fillInCircleVerts(const Geometry& args, bool isStroked,
+                              Mesh::VertexArray<vec2>& position,
+                              Mesh::VertexArray<vec4>& shadowColor,
+                              Mesh::VertexArray<vec3>& shadowParams) {
+    vec4 color = args.fColor;
+    float outerRadius = args.fOuterRadius;
+    float innerRadius = args.fInnerRadius;
+    float blurRadius = args.fBlurRadius;
+    float distanceCorrection = outerRadius / blurRadius;
+
+    const FloatRect& bounds = args.fDevBounds;
+
+    // The inner radius in the vertex data must be specified in normalized space.
+    innerRadius = innerRadius / outerRadius;
+
+    vec2 center = vec2(bounds.getWidth() / 2.0f, bounds.getHeight() / 2.0f);
+    float halfWidth = 0.5f * bounds.getWidth();
+    float octOffset = 0.41421356237f; // sqrt(2) - 1
+    int vertexCount = 0;
+
+    position[vertexCount] = center + vec2(-octOffset * halfWidth, -halfWidth);
+    shadowColor[vertexCount] = color;
+    shadowParams[vertexCount] = vec3(-octOffset, -1, distanceCorrection);
+    vertexCount++;
+
+    position[vertexCount] = center + vec2(octOffset * halfWidth, -halfWidth);
+    shadowColor[vertexCount] = color;
+    shadowParams[vertexCount] = vec3(octOffset, -1, distanceCorrection);
+    vertexCount++;
+
+    position[vertexCount] = center + vec2(halfWidth, -octOffset * halfWidth);
+    shadowColor[vertexCount] = color;
+    shadowParams[vertexCount] = vec3(1, -octOffset, distanceCorrection);
+    vertexCount++;
+
+    position[vertexCount] = center + vec2(halfWidth, octOffset * halfWidth);
+    shadowColor[vertexCount] = color;
+    shadowParams[vertexCount] = vec3(1, octOffset, distanceCorrection);
+    vertexCount++;
+
+    position[vertexCount] = center + vec2(octOffset * halfWidth, halfWidth);
+    shadowColor[vertexCount] = color;
+    shadowParams[vertexCount] = vec3(octOffset, 1, distanceCorrection);
+    vertexCount++;
+
+    position[vertexCount] = center + vec2(-octOffset * halfWidth, halfWidth);
+    shadowColor[vertexCount] = color;
+    shadowParams[vertexCount] = vec3(-octOffset, 1, distanceCorrection);
+    vertexCount++;
+
+    position[vertexCount] = center + vec2(-halfWidth, octOffset * halfWidth);
+    shadowColor[vertexCount] = color;
+    shadowParams[vertexCount] = vec3(-1, octOffset, distanceCorrection);
+    vertexCount++;
+
+    position[vertexCount] = center + vec2(-halfWidth, -octOffset * halfWidth);
+    shadowColor[vertexCount] = color;
+    shadowParams[vertexCount] = vec3(-1, -octOffset, distanceCorrection);
+    vertexCount++;
+
+    if (isStroked) {
+        // compute the inner ring
+
+        // cosine and sine of pi/8
+        float c = 0.923579533f;
+        float s = 0.382683432f;
+        float r = args.fInnerRadius;
+
+        position[vertexCount] = center + vec2(-s * r, -c * r);
+        shadowColor[vertexCount] = color;
+        shadowParams[vertexCount] = vec3(-s * innerRadius, -c * innerRadius, distanceCorrection);
+        vertexCount++;
+
+        position[vertexCount] = center + vec2(s * r, -c * r);
+        shadowColor[vertexCount] = color;
+        shadowParams[vertexCount] = vec3(s * innerRadius, -c * innerRadius, distanceCorrection);
+        vertexCount++;
+
+        position[vertexCount] = center + vec2(c * r, -s * r);
+        shadowColor[vertexCount] = color;
+        shadowParams[vertexCount] = vec3(c * innerRadius, -s * innerRadius, distanceCorrection);
+        vertexCount++;
+
+        position[vertexCount] = center + vec2(c * r, s * r);
+        shadowColor[vertexCount] = color;
+        shadowParams[vertexCount] = vec3(c * innerRadius, s * innerRadius, distanceCorrection);
+        vertexCount++;
+
+        position[vertexCount] = center + vec2(s * r, c * r);
+        shadowColor[vertexCount] = color;
+        shadowParams[vertexCount] = vec3(s * innerRadius, c * innerRadius, distanceCorrection);
+        vertexCount++;
+
+        position[vertexCount] = center + vec2(-s * r, c * r);
+        shadowColor[vertexCount] = color;
+        shadowParams[vertexCount] = vec3(-s * innerRadius, c * innerRadius, distanceCorrection);
+        vertexCount++;
+
+        position[vertexCount] = center + vec2(-c * r, s * r);
+        shadowColor[vertexCount] = color;
+        shadowParams[vertexCount] = vec3(-c * innerRadius, s * innerRadius, distanceCorrection);
+        vertexCount++;
+
+        position[vertexCount] = center + vec2(-c * r, -s * r);
+        shadowColor[vertexCount] = color;
+        shadowParams[vertexCount] = vec3(-c * innerRadius, -s * innerRadius, distanceCorrection);
+        vertexCount++;
+    } else {
+        // filled
+        position[vertexCount] = center;
+        shadowColor[vertexCount] = color;
+        shadowParams[vertexCount] = vec3(0, 0, distanceCorrection);
+        vertexCount++;
+    }
+}
+
+static void fillInRRectVerts(const Geometry& args, Mesh::VertexArray<vec2>& position,
+                             Mesh::VertexArray<vec4>& shadowColor,
+                             Mesh::VertexArray<vec3>& shadowParams) {
+    vec4 color = args.fColor;
+    float outerRadius = args.fOuterRadius;
+
+    const FloatRect& bounds = args.fDevBounds;
+
+    float umbraInset = args.fUmbraInset;
+    float minDim = 0.5f * std::min(bounds.getWidth(), bounds.getHeight());
+    if (umbraInset > minDim) {
+        umbraInset = minDim;
+    }
+
+    float xInner[4] = {bounds.left + umbraInset, bounds.right - umbraInset,
+                       bounds.left + umbraInset, bounds.right - umbraInset};
+    float xMid[4] = {bounds.left + outerRadius, bounds.right - outerRadius,
+                     bounds.left + outerRadius, bounds.right - outerRadius};
+    float xOuter[4] = {bounds.left, bounds.right, bounds.left, bounds.right};
+    float yInner[4] = {bounds.top + umbraInset, bounds.top + umbraInset, bounds.bottom - umbraInset,
+                       bounds.bottom - umbraInset};
+    float yMid[4] = {bounds.top + outerRadius, bounds.top + outerRadius,
+                     bounds.bottom - outerRadius, bounds.bottom - outerRadius};
+    float yOuter[4] = {bounds.top, bounds.top, bounds.bottom, bounds.bottom};
+
+    float blurRadius = args.fBlurRadius;
+
+    // In the case where we have to inset more for the umbra, our two triangles in the
+    // corner get skewed to a diamond rather than a square. To correct for that,
+    // we also skew the vectors we send to the shader that help define the circle.
+    // By doing so, we end up with a quarter circle in the corner rather than the
+    // elliptical curve.
+
+    // This is a bit magical, but it gives us the correct results at extrema:
+    //   a) umbraInset == outerRadius produces an orthogonal vector
+    //   b) outerRadius == 0 produces a diagonal vector
+    // And visually the corner looks correct.
+    vec2 outerVec = vec2(outerRadius - umbraInset, -outerRadius - umbraInset);
+    outerVec = normalize(outerVec);
+    // We want the circle edge to fall fractionally along the diagonal at
+    //      (sqrt(2)*(umbraInset - outerRadius) + outerRadius)/sqrt(2)*umbraInset
+    //
+    // Setting the components of the diagonal offset to the following value will give us that.
+    float diagVal = umbraInset / (SK_ScalarSqrt2 * (outerRadius - umbraInset) - outerRadius);
+    vec2 diagVec = vec2(diagVal, diagVal);
+    float distanceCorrection = umbraInset / blurRadius;
+
+    int vertexCount = 0;
+    // build corner by corner
+    for (int i = 0; i < 4; ++i) {
+        // inner point
+        position[vertexCount] = vec2(xInner[i], yInner[i]);
+        shadowColor[vertexCount] = color;
+        shadowParams[vertexCount] = vec3(0, 0, distanceCorrection);
+        vertexCount++;
+
+        // outer points
+        position[vertexCount] = vec2(xOuter[i], yInner[i]);
+        shadowColor[vertexCount] = color;
+        shadowParams[vertexCount] = vec3(0, -1, distanceCorrection);
+        vertexCount++;
+
+        position[vertexCount] = vec2(xOuter[i], yMid[i]);
+        shadowColor[vertexCount] = color;
+        shadowParams[vertexCount] = vec3(outerVec.x, outerVec.y, distanceCorrection);
+        vertexCount++;
+
+        position[vertexCount] = vec2(xOuter[i], yOuter[i]);
+        shadowColor[vertexCount] = color;
+        shadowParams[vertexCount] = vec3(diagVec.x, diagVec.y, distanceCorrection);
+        vertexCount++;
+
+        position[vertexCount] = vec2(xMid[i], yOuter[i]);
+        shadowColor[vertexCount] = color;
+        shadowParams[vertexCount] = vec3(outerVec.x, outerVec.y, distanceCorrection);
+        vertexCount++;
+
+        position[vertexCount] = vec2(xInner[i], yOuter[i]);
+        shadowColor[vertexCount] = color;
+        shadowParams[vertexCount] = vec3(0, -1, distanceCorrection);
+        vertexCount++;
+    }
+
+    // Add the additional vertices for overstroked rrects.
+    // Effectively this is an additional stroked rrect, with its
+    // parameters equal to those in the center of the 9-patch. This will
+    // give constant values across this inner ring.
+    if (kOverstroke_RRectType == args.fType) {
+        float inset = umbraInset + args.fInnerRadius;
+
+        // TL
+        position[vertexCount] = vec2(bounds.left + inset, bounds.top + inset);
+        shadowColor[vertexCount] = color;
+        shadowParams[vertexCount] = vec3(0, 0, distanceCorrection);
+        vertexCount++;
+
+        // TR
+        position[vertexCount] = vec2(bounds.right - inset, bounds.top + inset);
+        shadowColor[vertexCount] = color;
+        shadowParams[vertexCount] = vec3(0, 0, distanceCorrection);
+        vertexCount++;
+
+        // BL
+        position[vertexCount] = vec2(bounds.left + inset, bounds.bottom - inset);
+        shadowColor[vertexCount] = color;
+        shadowParams[vertexCount] = vec3(0, 0, distanceCorrection);
+        vertexCount++;
+
+        // BR
+        position[vertexCount] = vec2(bounds.right - inset, bounds.bottom - inset);
+        shadowColor[vertexCount] = color;
+        shadowParams[vertexCount] = vec3(0, 0, distanceCorrection);
+        vertexCount++;
+    }
+}
+
+int getVertexCountForGeometry(const Geometry& shadowGeometry) {
+    if (shadowGeometry.fIsCircle) {
+        return circle_type_to_vert_count(shadowGeometry.fType);
+    }
+
+    return rrect_type_to_vert_count(shadowGeometry.fType);
+}
+
+int getIndexCountForGeometry(const Geometry& shadowGeometry) {
+    if (shadowGeometry.fIsCircle) {
+        return circle_type_to_index_count(kStroke_RRectType == shadowGeometry.fType);
+    }
+
+    return rrect_type_to_index_count(shadowGeometry.fType);
+}
+
+void fillVerticesForGeometry(const Geometry& shadowGeometry, int /* vertexCount */,
+                             Mesh::VertexArray<vec2> position, Mesh::VertexArray<vec4> shadowColor,
+                             Mesh::VertexArray<vec3> shadowParams) {
+    if (shadowGeometry.fIsCircle) {
+        fillInCircleVerts(shadowGeometry, shadowGeometry.fIsStroked, position, shadowColor,
+                          shadowParams);
+    } else {
+        fillInRRectVerts(shadowGeometry, position, shadowColor, shadowParams);
+    }
+}
+
+void fillIndicesForGeometry(const Geometry& shadowGeometry, int indexCount,
+                            int startingVertexOffset, uint16_t* indices) {
+    if (shadowGeometry.fIsCircle) {
+        const uint16_t* primIndices = circle_type_to_indices(shadowGeometry.fIsStroked);
+        for (int i = 0; i < indexCount; ++i) {
+            indices[i] = primIndices[i] + startingVertexOffset;
+        }
+    } else {
+        const uint16_t* primIndices = rrect_type_to_indices(shadowGeometry.fType);
+        for (int i = 0; i < indexCount; ++i) {
+            indices[i] = primIndices[i] + startingVertexOffset;
+        }
+    }
+}
+
+inline void GetSpotParams(float occluderZ, float lightX, float lightY, float lightZ,
+                          float lightRadius, float& blurRadius, float& scale, vec2& translate) {
+    float zRatio = divide_and_pin(occluderZ, lightZ - occluderZ, 0.0f, 0.95f);
+    blurRadius = lightRadius * zRatio;
+    scale = divide_and_pin(lightZ, lightZ - occluderZ, 1.0f, 1.95f);
+    translate.x = -zRatio * lightX;
+    translate.y = -zRatio * lightY;
+}
+
+static std::unique_ptr<Geometry> getShadowGeometry(const vec4& color, const FloatRect& devRect,
+                                                   float devRadius, float blurRadius,
+                                                   float insetWidth) {
+    // An insetWidth > 1/2 rect width or height indicates a simple fill.
+    const bool isCircle = ((devRadius >= devRect.getWidth()) && (devRadius >= devRect.getHeight()));
+
+    FloatRect bounds = devRect;
+    float innerRadius = 0.0f;
+    float outerRadius = devRadius;
+    float umbraInset;
+
+    RRectType type = kFill_RRectType;
+    if (isCircle) {
+        umbraInset = 0;
+    } else {
+        umbraInset = std::max(outerRadius, blurRadius);
+    }
+
+    // If stroke is greater than width or height, this is still a fill,
+    // otherwise we compute stroke params.
+    if (isCircle) {
+        innerRadius = devRadius - insetWidth;
+        type = innerRadius > 0 ? kStroke_RRectType : kFill_RRectType;
+    } else {
+        if (insetWidth <= 0.5f * std::min(devRect.getWidth(), devRect.getHeight())) {
+            // We don't worry about a real inner radius, we just need to know if we
+            // need to create overstroke vertices.
+            innerRadius = std::max(insetWidth - umbraInset, 0.0f);
+            type = innerRadius > 0 ? kOverstroke_RRectType : kStroke_RRectType;
+        }
+    }
+    const bool isStroked = (kStroke_RRectType == type);
+    return std::make_unique<Geometry>(Geometry{color, outerRadius, umbraInset, innerRadius,
+                                               blurRadius, bounds, type, isCircle, isStroked});
+}
+
+std::unique_ptr<Geometry> getAmbientShadowGeometry(const FloatRect& casterRect,
+                                                   float casterCornerRadius, float casterZ,
+                                                   bool casterIsTranslucent,
+                                                   const vec4& ambientColor) {
+    float devSpaceInsetWidth = AmbientBlurRadius(casterZ);
+    const float umbraRecipAlpha = AmbientRecipAlpha(casterZ);
+    const float devSpaceAmbientBlur = devSpaceInsetWidth * umbraRecipAlpha;
+
+    // Outset the shadow rrect to the border of the penumbra
+    float ambientPathOutset = devSpaceInsetWidth;
+    FloatRect outsetRect(casterRect);
+    outsetRect.left -= ambientPathOutset;
+    outsetRect.top -= ambientPathOutset;
+    outsetRect.right += ambientPathOutset;
+    outsetRect.bottom += ambientPathOutset;
+
+    float outsetRad = casterCornerRadius + ambientPathOutset;
+    if (casterIsTranslucent) {
+        // set a large inset to force a fill
+        devSpaceInsetWidth = outsetRect.getWidth();
+    }
+
+    return getShadowGeometry(ambientColor, outsetRect, std::abs(outsetRad), devSpaceAmbientBlur,
+                             std::abs(devSpaceInsetWidth));
+}
+
+std::unique_ptr<Geometry> getSpotShadowGeometry(const FloatRect& casterRect,
+                                                float casterCornerRadius, float casterZ,
+                                                bool casterIsTranslucent, const vec4& spotColor,
+                                                const vec3& lightPosition, float lightRadius) {
+    float devSpaceSpotBlur;
+    float spotScale;
+    vec2 spotOffset;
+    GetSpotParams(casterZ, lightPosition.x, lightPosition.y, lightPosition.z, lightRadius,
+                  devSpaceSpotBlur, spotScale, spotOffset);
+    // handle scale of radius due to CTM
+    const float srcSpaceSpotBlur = devSpaceSpotBlur;
+
+    // Adjust translate for the effect of the scale.
+    spotOffset.x += spotScale;
+    spotOffset.y += spotScale;
+
+    // Compute the transformed shadow rect
+    ui::Transform shadowTransform;
+    shadowTransform.set(spotOffset.x, spotOffset.y);
+    shadowTransform.set(spotScale, 0, 0, spotScale);
+    FloatRect spotShadowRect = shadowTransform.transform(casterRect);
+    float spotShadowRadius = casterCornerRadius * spotScale;
+
+    // Compute the insetWidth
+    float blurOutset = srcSpaceSpotBlur;
+    float insetWidth = blurOutset;
+    if (casterIsTranslucent) {
+        // If transparent, just do a fill
+        insetWidth += spotShadowRect.getWidth();
+    } else {
+        // For shadows, instead of using a stroke we specify an inset from the penumbra
+        // border. We want to extend this inset area so that it meets up with the caster
+        // geometry. The inset geometry will by default already be inset by the blur width.
+        //
+        // We compare the min and max corners inset by the radius between the original
+        // rrect and the shadow rrect. The distance between the two plus the difference
+        // between the scaled radius and the original radius gives the distance from the
+        // transformed shadow shape to the original shape in that corner. The max
+        // of these gives the maximum distance we need to cover.
+        //
+        // Since we are outsetting by 1/2 the blur distance, we just add the maxOffset to
+        // that to get the full insetWidth.
+        float maxOffset;
+        if (casterCornerRadius <= 0.f) {
+            // Manhattan distance works better for rects
+            maxOffset = std::max(std::max(std::abs(spotShadowRect.left - casterRect.left),
+                                          std::abs(spotShadowRect.top - casterRect.top)),
+                                 std::max(std::abs(spotShadowRect.right - casterRect.right),
+                                          std::abs(spotShadowRect.bottom - casterRect.bottom)));
+        } else {
+            float dr = spotShadowRadius - casterCornerRadius;
+            vec2 upperLeftOffset = vec2(spotShadowRect.left - casterRect.left + dr,
+                                        spotShadowRect.top - casterRect.top + dr);
+            vec2 lowerRightOffset = vec2(spotShadowRect.right - casterRect.right - dr,
+                                         spotShadowRect.bottom - casterRect.bottom - dr);
+            maxOffset = sqrt(std::max(dot(upperLeftOffset, lowerRightOffset),
+                                      dot(lowerRightOffset, lowerRightOffset))) +
+                    dr;
+        }
+        insetWidth += std::max(blurOutset, maxOffset);
+    }
+
+    // Outset the shadow rrect to the border of the penumbra
+    spotShadowRadius += blurOutset;
+    spotShadowRect.left -= blurOutset;
+    spotShadowRect.top -= blurOutset;
+    spotShadowRect.right += blurOutset;
+    spotShadowRect.bottom += blurOutset;
+
+    return getShadowGeometry(spotColor, spotShadowRect, std::abs(spotShadowRadius),
+                             2.0f * devSpaceSpotBlur, std::abs(insetWidth));
+}
+
+void fillShadowTextureData(uint8_t* data, size_t shadowTextureWidth) {
+    for (int i = 0; i < shadowTextureWidth; i++) {
+        const float d = 1 - i / ((shadowTextureWidth * 1.0f) - 1.0f);
+        data[i] = static_cast<uint8_t>((exp(-4.0f * d * d) - 0.018f) * 255);
+    }
+}
+
+} // namespace gl
+} // namespace renderengine
+} // namespace android
diff --git a/media/libstagefright/renderfright/gl/GLSkiaShadowPort.h b/media/libstagefright/renderfright/gl/GLSkiaShadowPort.h
new file mode 100644
index 0000000..912c8bb
--- /dev/null
+++ b/media/libstagefright/renderfright/gl/GLSkiaShadowPort.h
@@ -0,0 +1,96 @@
+/*
+ * Copyright 2019 The Android Open Source Project
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ *      http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+#pragma once
+
+#include <math/vec4.h>
+#include <renderengine/Mesh.h>
+#include <ui/Rect.h>
+
+namespace android {
+namespace renderengine {
+namespace gl {
+
+/**
+ * The shadow geometry logic and vertex generation code has been ported from skia shadow
+ * fast path OpenGL implementation to draw shadows around rects and rounded rects including
+ * circles.
+ *
+ * path: skia/src/gpu/GrRenderTargetContext.cpp GrRenderTargetContext::drawFastShadow
+ *
+ * Modifications made:
+ * - Switched to using std lib math functions
+ * - Fall off function is implemented in vertex shader rather than a shadow texture
+ * - Removed transformations applied on the caster rect since the caster will be in local
+ *   coordinate space and will be transformed by the vertex shader.
+ */
+
+enum RRectType {
+    kFill_RRectType,
+    kStroke_RRectType,
+    kOverstroke_RRectType,
+};
+
+struct Geometry {
+    vec4 fColor;
+    float fOuterRadius;
+    float fUmbraInset;
+    float fInnerRadius;
+    float fBlurRadius;
+    FloatRect fDevBounds;
+    RRectType fType;
+    bool fIsCircle;
+    bool fIsStroked;
+};
+
+std::unique_ptr<Geometry> getSpotShadowGeometry(const FloatRect& casterRect,
+                                                float casterCornerRadius, float casterZ,
+                                                bool casterIsTranslucent, const vec4& spotColor,
+                                                const vec3& lightPosition, float lightRadius);
+
+std::unique_ptr<Geometry> getAmbientShadowGeometry(const FloatRect& casterRect,
+                                                   float casterCornerRadius, float casterZ,
+                                                   bool casterIsTranslucent,
+                                                   const vec4& ambientColor);
+
+int getVertexCountForGeometry(const Geometry& shadowGeometry);
+
+int getIndexCountForGeometry(const Geometry& shadowGeometry);
+
+void fillVerticesForGeometry(const Geometry& shadowGeometry, int vertexCount,
+                             Mesh::VertexArray<vec2> position, Mesh::VertexArray<vec4> shadowColor,
+                             Mesh::VertexArray<vec3> shadowParams);
+
+void fillIndicesForGeometry(const Geometry& shadowGeometry, int indexCount,
+                            int startingVertexOffset, uint16_t* indices);
+
+/**
+ * Maps shadow geometry 'alpha' varying (1 for darkest, 0 for transparent) to
+ * darkness at that spot. Values are determined by an exponential falloff
+ * function provided by UX.
+ *
+ * The texture is used for quick lookup in theshadow shader.
+ *
+ * textureData - filled with shadow texture data that needs to be at least of
+ *               size textureWidth
+ *
+ * textureWidth - width of the texture, height is always 1
+ */
+void fillShadowTextureData(uint8_t* textureData, size_t textureWidth);
+
+} // namespace gl
+} // namespace renderengine
+} // namespace android
diff --git a/media/libstagefright/renderfright/gl/GLVertexBuffer.cpp b/media/libstagefright/renderfright/gl/GLVertexBuffer.cpp
new file mode 100644
index 0000000..e50c471
--- /dev/null
+++ b/media/libstagefright/renderfright/gl/GLVertexBuffer.cpp
@@ -0,0 +1,55 @@
+/*
+ * Copyright 2020 The Android Open Source Project
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ *      http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+#define ATRACE_TAG ATRACE_TAG_GRAPHICS
+
+#include "GLVertexBuffer.h"
+
+#include <GLES/gl.h>
+#include <GLES2/gl2.h>
+#include <nativebase/nativebase.h>
+#include <utils/Trace.h>
+
+namespace android {
+namespace renderengine {
+namespace gl {
+
+GLVertexBuffer::GLVertexBuffer() {
+    glGenBuffers(1, &mBufferName);
+}
+
+GLVertexBuffer::~GLVertexBuffer() {
+    glDeleteBuffers(1, &mBufferName);
+}
+
+void GLVertexBuffer::allocateBuffers(const GLfloat data[], const GLuint size) {
+    ATRACE_CALL();
+    bind();
+    glBufferData(GL_ARRAY_BUFFER, size * sizeof(GLfloat), data, GL_STATIC_DRAW);
+    unbind();
+}
+
+void GLVertexBuffer::bind() const {
+    glBindBuffer(GL_ARRAY_BUFFER, mBufferName);
+}
+
+void GLVertexBuffer::unbind() const {
+    glBindBuffer(GL_ARRAY_BUFFER, 0);
+}
+
+} // namespace gl
+} // namespace renderengine
+} // namespace android
diff --git a/media/libstagefright/renderfright/gl/GLVertexBuffer.h b/media/libstagefright/renderfright/gl/GLVertexBuffer.h
new file mode 100644
index 0000000..c0fd0c1
--- /dev/null
+++ b/media/libstagefright/renderfright/gl/GLVertexBuffer.h
@@ -0,0 +1,49 @@
+/*
+ * Copyright 2020 The Android Open Source Project
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ *      http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+#pragma once
+
+#include <cstdint>
+
+#include <EGL/egl.h>
+#include <EGL/eglext.h>
+#include <GLES2/gl2.h>
+
+struct ANativeWindowBuffer;
+
+namespace android {
+namespace renderengine {
+namespace gl {
+
+class GLESRenderEngine;
+
+class GLVertexBuffer {
+public:
+    explicit GLVertexBuffer();
+    ~GLVertexBuffer();
+
+    void allocateBuffers(const GLfloat data[], const GLuint size);
+    uint32_t getBufferName() const { return mBufferName; }
+    void bind() const;
+    void unbind() const;
+
+private:
+    uint32_t mBufferName;
+};
+
+} // namespace gl
+} // namespace renderengine
+} // namespace android
diff --git a/media/libstagefright/renderfright/gl/ImageManager.cpp b/media/libstagefright/renderfright/gl/ImageManager.cpp
new file mode 100644
index 0000000..6256649
--- /dev/null
+++ b/media/libstagefright/renderfright/gl/ImageManager.cpp
@@ -0,0 +1,148 @@
+/*
+ * Copyright 2019 The Android Open Source Project
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ *      http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+//#define LOG_NDEBUG 0
+#undef LOG_TAG
+#define LOG_TAG "RenderEngine"
+#define ATRACE_TAG ATRACE_TAG_GRAPHICS
+
+#include <pthread.h>
+
+#include <processgroup/sched_policy.h>
+#include <utils/Trace.h>
+#include "GLESRenderEngine.h"
+#include "ImageManager.h"
+
+namespace android {
+namespace renderengine {
+namespace gl {
+
+ImageManager::ImageManager(GLESRenderEngine* engine) : mEngine(engine) {}
+
+void ImageManager::initThread() {
+    mThread = std::thread([this]() { threadMain(); });
+    pthread_setname_np(mThread.native_handle(), "ImageManager");
+    // Use SCHED_FIFO to minimize jitter
+    struct sched_param param = {0};
+    param.sched_priority = 2;
+    if (pthread_setschedparam(mThread.native_handle(), SCHED_FIFO, &param) != 0) {
+        ALOGE("Couldn't set SCHED_FIFO for ImageManager");
+    }
+}
+
+ImageManager::~ImageManager() {
+    {
+        std::lock_guard<std::mutex> lock(mMutex);
+        mRunning = false;
+    }
+    mCondition.notify_all();
+    if (mThread.joinable()) {
+        mThread.join();
+    }
+}
+
+void ImageManager::cacheAsync(const sp<GraphicBuffer>& buffer,
+                              const std::shared_ptr<Barrier>& barrier) {
+    if (buffer == nullptr) {
+        {
+            std::lock_guard<std::mutex> lock(barrier->mutex);
+            barrier->isOpen = true;
+            barrier->result = BAD_VALUE;
+        }
+        barrier->condition.notify_one();
+        return;
+    }
+    ATRACE_CALL();
+    QueueEntry entry = {QueueEntry::Operation::Insert, buffer, buffer->getId(), barrier};
+    queueOperation(std::move(entry));
+}
+
+status_t ImageManager::cache(const sp<GraphicBuffer>& buffer) {
+    ATRACE_CALL();
+    auto barrier = std::make_shared<Barrier>();
+    cacheAsync(buffer, barrier);
+    std::lock_guard<std::mutex> lock(barrier->mutex);
+    barrier->condition.wait(barrier->mutex,
+                            [&]() REQUIRES(barrier->mutex) { return barrier->isOpen; });
+    return barrier->result;
+}
+
+void ImageManager::releaseAsync(uint64_t bufferId, const std::shared_ptr<Barrier>& barrier) {
+    ATRACE_CALL();
+    QueueEntry entry = {QueueEntry::Operation::Delete, nullptr, bufferId, barrier};
+    queueOperation(std::move(entry));
+}
+
+void ImageManager::queueOperation(const QueueEntry&& entry) {
+    {
+        std::lock_guard<std::mutex> lock(mMutex);
+        mQueue.emplace(entry);
+        ATRACE_INT("ImageManagerQueueDepth", mQueue.size());
+    }
+    mCondition.notify_one();
+}
+
+void ImageManager::threadMain() {
+    set_sched_policy(0, SP_FOREGROUND);
+    bool run;
+    {
+        std::lock_guard<std::mutex> lock(mMutex);
+        run = mRunning;
+    }
+    while (run) {
+        QueueEntry entry;
+        {
+            std::lock_guard<std::mutex> lock(mMutex);
+            mCondition.wait(mMutex,
+                            [&]() REQUIRES(mMutex) { return !mQueue.empty() || !mRunning; });
+            run = mRunning;
+
+            if (!mRunning) {
+                // if mRunning is false, then ImageManager is being destroyed, so
+                // bail out now.
+                break;
+            }
+
+            entry = mQueue.front();
+            mQueue.pop();
+            ATRACE_INT("ImageManagerQueueDepth", mQueue.size());
+        }
+
+        status_t result = NO_ERROR;
+        switch (entry.op) {
+            case QueueEntry::Operation::Delete:
+                mEngine->unbindExternalTextureBufferInternal(entry.bufferId);
+                break;
+            case QueueEntry::Operation::Insert:
+                result = mEngine->cacheExternalTextureBufferInternal(entry.buffer);
+                break;
+        }
+        if (entry.barrier != nullptr) {
+            {
+                std::lock_guard<std::mutex> entryLock(entry.barrier->mutex);
+                entry.barrier->result = result;
+                entry.barrier->isOpen = true;
+            }
+            entry.barrier->condition.notify_one();
+        }
+    }
+
+    ALOGD("Reached end of threadMain, terminating ImageManager thread!");
+}
+
+} // namespace gl
+} // namespace renderengine
+} // namespace android
diff --git a/media/libstagefright/renderfright/gl/ImageManager.h b/media/libstagefright/renderfright/gl/ImageManager.h
new file mode 100644
index 0000000..be67de8
--- /dev/null
+++ b/media/libstagefright/renderfright/gl/ImageManager.h
@@ -0,0 +1,74 @@
+/*
+ * Copyright 2019 The Android Open Source Project
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ *      http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+#pragma once
+
+#include <condition_variable>
+#include <mutex>
+#include <queue>
+#include <thread>
+
+#include <ui/GraphicBuffer.h>
+
+namespace android {
+namespace renderengine {
+namespace gl {
+
+class GLESRenderEngine;
+
+class ImageManager {
+public:
+    struct Barrier {
+        std::mutex mutex;
+        std::condition_variable_any condition;
+        bool isOpen GUARDED_BY(mutex) = false;
+        status_t result GUARDED_BY(mutex) = NO_ERROR;
+    };
+    ImageManager(GLESRenderEngine* engine);
+    ~ImageManager();
+    // Starts the background thread for the ImageManager
+    // We need this to guarantee that the class is fully-constructed before the
+    // thread begins running.
+    void initThread();
+    void cacheAsync(const sp<GraphicBuffer>& buffer, const std::shared_ptr<Barrier>& barrier)
+            EXCLUDES(mMutex);
+    status_t cache(const sp<GraphicBuffer>& buffer);
+    void releaseAsync(uint64_t bufferId, const std::shared_ptr<Barrier>& barrier) EXCLUDES(mMutex);
+
+private:
+    struct QueueEntry {
+        enum class Operation { Delete, Insert };
+
+        Operation op = Operation::Delete;
+        sp<GraphicBuffer> buffer = nullptr;
+        uint64_t bufferId = 0;
+        std::shared_ptr<Barrier> barrier = nullptr;
+    };
+
+    void queueOperation(const QueueEntry&& entry);
+    void threadMain();
+    GLESRenderEngine* const mEngine;
+    std::thread mThread;
+    std::condition_variable_any mCondition;
+    std::mutex mMutex;
+    std::queue<QueueEntry> mQueue GUARDED_BY(mMutex);
+
+    bool mRunning GUARDED_BY(mMutex) = true;
+};
+
+} // namespace gl
+} // namespace renderengine
+} // namespace android
diff --git a/media/libstagefright/renderfright/gl/Program.cpp b/media/libstagefright/renderfright/gl/Program.cpp
new file mode 100644
index 0000000..f4fbf35
--- /dev/null
+++ b/media/libstagefright/renderfright/gl/Program.cpp
@@ -0,0 +1,163 @@
+/*Gluint
+ * Copyright 2013 The Android Open Source Project
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ *      http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+#include "Program.h"
+
+#include <stdint.h>
+
+#include <log/log.h>
+#include <math/mat4.h>
+#include <utils/String8.h>
+#include "ProgramCache.h"
+
+namespace android {
+namespace renderengine {
+namespace gl {
+
+Program::Program(const ProgramCache::Key& /*needs*/, const char* vertex, const char* fragment)
+      : mInitialized(false) {
+    GLuint vertexId = buildShader(vertex, GL_VERTEX_SHADER);
+    GLuint fragmentId = buildShader(fragment, GL_FRAGMENT_SHADER);
+    GLuint programId = glCreateProgram();
+    glAttachShader(programId, vertexId);
+    glAttachShader(programId, fragmentId);
+    glBindAttribLocation(programId, position, "position");
+    glBindAttribLocation(programId, texCoords, "texCoords");
+    glBindAttribLocation(programId, cropCoords, "cropCoords");
+    glBindAttribLocation(programId, shadowColor, "shadowColor");
+    glBindAttribLocation(programId, shadowParams, "shadowParams");
+    glLinkProgram(programId);
+
+    GLint status;
+    glGetProgramiv(programId, GL_LINK_STATUS, &status);
+    if (status != GL_TRUE) {
+        ALOGE("Error while linking shaders:");
+        GLint infoLen = 0;
+        glGetProgramiv(programId, GL_INFO_LOG_LENGTH, &infoLen);
+        if (infoLen > 1) {
+            GLchar log[infoLen];
+            glGetProgramInfoLog(programId, infoLen, 0, &log[0]);
+            ALOGE("%s", log);
+        }
+        glDetachShader(programId, vertexId);
+        glDetachShader(programId, fragmentId);
+        glDeleteShader(vertexId);
+        glDeleteShader(fragmentId);
+        glDeleteProgram(programId);
+    } else {
+        mProgram = programId;
+        mVertexShader = vertexId;
+        mFragmentShader = fragmentId;
+        mInitialized = true;
+        mProjectionMatrixLoc = glGetUniformLocation(programId, "projection");
+        mTextureMatrixLoc = glGetUniformLocation(programId, "texture");
+        mSamplerLoc = glGetUniformLocation(programId, "sampler");
+        mColorLoc = glGetUniformLocation(programId, "color");
+        mDisplayMaxLuminanceLoc = glGetUniformLocation(programId, "displayMaxLuminance");
+        mMaxMasteringLuminanceLoc = glGetUniformLocation(programId, "maxMasteringLuminance");
+        mMaxContentLuminanceLoc = glGetUniformLocation(programId, "maxContentLuminance");
+        mInputTransformMatrixLoc = glGetUniformLocation(programId, "inputTransformMatrix");
+        mOutputTransformMatrixLoc = glGetUniformLocation(programId, "outputTransformMatrix");
+        mCornerRadiusLoc = glGetUniformLocation(programId, "cornerRadius");
+        mCropCenterLoc = glGetUniformLocation(programId, "cropCenter");
+
+        // set-up the default values for our uniforms
+        glUseProgram(programId);
+        glUniformMatrix4fv(mProjectionMatrixLoc, 1, GL_FALSE, mat4().asArray());
+        glEnableVertexAttribArray(0);
+    }
+}
+
+bool Program::isValid() const {
+    return mInitialized;
+}
+
+void Program::use() {
+    glUseProgram(mProgram);
+}
+
+GLuint Program::getAttrib(const char* name) const {
+    // TODO: maybe use a local cache
+    return glGetAttribLocation(mProgram, name);
+}
+
+GLint Program::getUniform(const char* name) const {
+    // TODO: maybe use a local cache
+    return glGetUniformLocation(mProgram, name);
+}
+
+GLuint Program::buildShader(const char* source, GLenum type) {
+    GLuint shader = glCreateShader(type);
+    glShaderSource(shader, 1, &source, 0);
+    glCompileShader(shader);
+    GLint status;
+    glGetShaderiv(shader, GL_COMPILE_STATUS, &status);
+    if (status != GL_TRUE) {
+        // Some drivers return wrong values for GL_INFO_LOG_LENGTH
+        // use a fixed size instead
+        GLchar log[512];
+        glGetShaderInfoLog(shader, sizeof(log), 0, log);
+        ALOGE("Error while compiling shader: \n%s\n%s", source, log);
+        glDeleteShader(shader);
+        return 0;
+    }
+    return shader;
+}
+
+void Program::setUniforms(const Description& desc) {
+    // TODO: we should have a mechanism here to not always reset uniforms that
+    // didn't change for this program.
+
+    if (mSamplerLoc >= 0) {
+        glUniform1i(mSamplerLoc, 0);
+        glUniformMatrix4fv(mTextureMatrixLoc, 1, GL_FALSE, desc.texture.getMatrix().asArray());
+    }
+    if (mColorLoc >= 0) {
+        const float color[4] = {desc.color.r, desc.color.g, desc.color.b, desc.color.a};
+        glUniform4fv(mColorLoc, 1, color);
+    }
+    if (mInputTransformMatrixLoc >= 0) {
+        mat4 inputTransformMatrix = desc.inputTransformMatrix;
+        glUniformMatrix4fv(mInputTransformMatrixLoc, 1, GL_FALSE, inputTransformMatrix.asArray());
+    }
+    if (mOutputTransformMatrixLoc >= 0) {
+        // The output transform matrix and color matrix can be combined as one matrix
+        // that is applied right before applying OETF.
+        mat4 outputTransformMatrix = desc.colorMatrix * desc.outputTransformMatrix;
+        glUniformMatrix4fv(mOutputTransformMatrixLoc, 1, GL_FALSE, outputTransformMatrix.asArray());
+    }
+    if (mDisplayMaxLuminanceLoc >= 0) {
+        glUniform1f(mDisplayMaxLuminanceLoc, desc.displayMaxLuminance);
+    }
+    if (mMaxMasteringLuminanceLoc >= 0) {
+        glUniform1f(mMaxMasteringLuminanceLoc, desc.maxMasteringLuminance);
+    }
+    if (mMaxContentLuminanceLoc >= 0) {
+        glUniform1f(mMaxContentLuminanceLoc, desc.maxContentLuminance);
+    }
+    if (mCornerRadiusLoc >= 0) {
+        glUniform1f(mCornerRadiusLoc, desc.cornerRadius);
+    }
+    if (mCropCenterLoc >= 0) {
+        glUniform2f(mCropCenterLoc, desc.cropSize.x / 2.0f, desc.cropSize.y / 2.0f);
+    }
+    // these uniforms are always present
+    glUniformMatrix4fv(mProjectionMatrixLoc, 1, GL_FALSE, desc.projectionMatrix.asArray());
+}
+
+} // namespace gl
+} // namespace renderengine
+} // namespace android
diff --git a/media/libstagefright/renderfright/gl/Program.h b/media/libstagefright/renderfright/gl/Program.h
new file mode 100644
index 0000000..fc3755e
--- /dev/null
+++ b/media/libstagefright/renderfright/gl/Program.h
@@ -0,0 +1,119 @@
+/*
+ * Copyright 2013 The Android Open Source Project
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ *      http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+#ifndef SF_RENDER_ENGINE_PROGRAM_H
+#define SF_RENDER_ENGINE_PROGRAM_H
+
+#include <stdint.h>
+
+#include <GLES2/gl2.h>
+#include <renderengine/private/Description.h>
+#include "ProgramCache.h"
+
+namespace android {
+
+class String8;
+
+namespace renderengine {
+namespace gl {
+
+/*
+ * Abstracts a GLSL program comprising a vertex and fragment shader
+ */
+class Program {
+public:
+    // known locations for position and texture coordinates
+    enum {
+        /* position of each vertex for vertex shader */
+        position = 0,
+
+        /* UV coordinates for texture mapping */
+        texCoords = 1,
+
+        /* Crop coordinates, in pixels */
+        cropCoords = 2,
+
+        /* Shadow color */
+        shadowColor = 3,
+
+        /* Shadow params */
+        shadowParams = 4,
+    };
+
+    Program(const ProgramCache::Key& needs, const char* vertex, const char* fragment);
+    ~Program() = default;
+
+    /* whether this object is usable */
+    bool isValid() const;
+
+    /* Binds this program to the GLES context */
+    void use();
+
+    /* Returns the location of the specified attribute */
+    GLuint getAttrib(const char* name) const;
+
+    /* Returns the location of the specified uniform */
+    GLint getUniform(const char* name) const;
+
+    /* set-up uniforms from the description */
+    void setUniforms(const Description& desc);
+
+private:
+    GLuint buildShader(const char* source, GLenum type);
+
+    // whether the initialization succeeded
+    bool mInitialized;
+
+    // Name of the OpenGL program and shaders
+    GLuint mProgram;
+    GLuint mVertexShader;
+    GLuint mFragmentShader;
+
+    /* location of the projection matrix uniform */
+    GLint mProjectionMatrixLoc;
+
+    /* location of the texture matrix uniform */
+    GLint mTextureMatrixLoc;
+
+    /* location of the sampler uniform */
+    GLint mSamplerLoc;
+
+    /* location of the color uniform */
+    GLint mColorLoc;
+
+    /* location of display luminance uniform */
+    GLint mDisplayMaxLuminanceLoc;
+    /* location of max mastering luminance uniform */
+    GLint mMaxMasteringLuminanceLoc;
+    /* location of max content luminance uniform */
+    GLint mMaxContentLuminanceLoc;
+
+    /* location of transform matrix */
+    GLint mInputTransformMatrixLoc;
+    GLint mOutputTransformMatrixLoc;
+
+    /* location of corner radius uniform */
+    GLint mCornerRadiusLoc;
+
+    /* location of surface crop origin uniform, for rounded corner clipping */
+    GLint mCropCenterLoc;
+};
+
+} // namespace gl
+} // namespace renderengine
+} // namespace android
+
+#endif /* SF_RENDER_ENGINE_PROGRAM_H */
diff --git a/media/libstagefright/renderfright/gl/ProgramCache.cpp b/media/libstagefright/renderfright/gl/ProgramCache.cpp
new file mode 100644
index 0000000..3ae35ec
--- /dev/null
+++ b/media/libstagefright/renderfright/gl/ProgramCache.cpp
@@ -0,0 +1,800 @@
+/*
+ * Copyright 2013 The Android Open Source Project
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ *      http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+#define ATRACE_TAG ATRACE_TAG_GRAPHICS
+
+#include "ProgramCache.h"
+
+#include <GLES2/gl2.h>
+#include <GLES2/gl2ext.h>
+#include <log/log.h>
+#include <renderengine/private/Description.h>
+#include <utils/String8.h>
+#include <utils/Trace.h>
+#include "Program.h"
+
+ANDROID_SINGLETON_STATIC_INSTANCE(android::renderengine::gl::ProgramCache)
+
+namespace android {
+namespace renderengine {
+namespace gl {
+
+/*
+ * A simple formatter class to automatically add the endl and
+ * manage the indentation.
+ */
+
+class Formatter;
+static Formatter& indent(Formatter& f);
+static Formatter& dedent(Formatter& f);
+
+class Formatter {
+    String8 mString;
+    int mIndent;
+    typedef Formatter& (*FormaterManipFunc)(Formatter&);
+    friend Formatter& indent(Formatter& f);
+    friend Formatter& dedent(Formatter& f);
+
+public:
+    Formatter() : mIndent(0) {}
+
+    String8 getString() const { return mString; }
+
+    friend Formatter& operator<<(Formatter& out, const char* in) {
+        for (int i = 0; i < out.mIndent; i++) {
+            out.mString.append("    ");
+        }
+        out.mString.append(in);
+        out.mString.append("\n");
+        return out;
+    }
+    friend inline Formatter& operator<<(Formatter& out, const String8& in) {
+        return operator<<(out, in.string());
+    }
+    friend inline Formatter& operator<<(Formatter& to, FormaterManipFunc func) {
+        return (*func)(to);
+    }
+};
+Formatter& indent(Formatter& f) {
+    f.mIndent++;
+    return f;
+}
+Formatter& dedent(Formatter& f) {
+    f.mIndent--;
+    return f;
+}
+
+void ProgramCache::primeCache(
+        EGLContext context, bool useColorManagement, bool toneMapperShaderOnly) {
+    auto& cache = mCaches[context];
+    uint32_t shaderCount = 0;
+
+    if (toneMapperShaderOnly) {
+        Key shaderKey;
+        // base settings used by HDR->SDR tonemap only
+        shaderKey.set(Key::BLEND_MASK | Key::INPUT_TRANSFORM_MATRIX_MASK |
+                      Key::OUTPUT_TRANSFORM_MATRIX_MASK | Key::OUTPUT_TF_MASK |
+                      Key::OPACITY_MASK | Key::ALPHA_MASK |
+                      Key::ROUNDED_CORNERS_MASK | Key::TEXTURE_MASK,
+                      Key::BLEND_NORMAL | Key::INPUT_TRANSFORM_MATRIX_ON |
+                      Key::OUTPUT_TRANSFORM_MATRIX_ON | Key::OUTPUT_TF_SRGB |
+                      Key::OPACITY_OPAQUE | Key::ALPHA_EQ_ONE |
+                      Key::ROUNDED_CORNERS_OFF | Key::TEXTURE_EXT);
+        for (int i = 0; i < 4; i++) {
+            // Cache input transfer for HLG & ST2084
+            shaderKey.set(Key::INPUT_TF_MASK, (i & 1) ?
+                    Key::INPUT_TF_HLG : Key::INPUT_TF_ST2084);
+
+            // Cache Y410 input on or off
+            shaderKey.set(Key::Y410_BT2020_MASK, (i & 2) ?
+                    Key::Y410_BT2020_ON : Key::Y410_BT2020_OFF);
+            if (cache.count(shaderKey) == 0) {
+                cache.emplace(shaderKey, generateProgram(shaderKey));
+                shaderCount++;
+            }
+        }
+        return;
+    }
+
+    uint32_t keyMask = Key::BLEND_MASK | Key::OPACITY_MASK | Key::ALPHA_MASK | Key::TEXTURE_MASK
+        | Key::ROUNDED_CORNERS_MASK;
+    // Prime the cache for all combinations of the above masks,
+    // leaving off the experimental color matrix mask options.
+
+    nsecs_t timeBefore = systemTime();
+    for (uint32_t keyVal = 0; keyVal <= keyMask; keyVal++) {
+        Key shaderKey;
+        shaderKey.set(keyMask, keyVal);
+        uint32_t tex = shaderKey.getTextureTarget();
+        if (tex != Key::TEXTURE_OFF && tex != Key::TEXTURE_EXT && tex != Key::TEXTURE_2D) {
+            continue;
+        }
+        if (cache.count(shaderKey) == 0) {
+            cache.emplace(shaderKey, generateProgram(shaderKey));
+            shaderCount++;
+        }
+    }
+
+    // Prime for sRGB->P3 conversion
+    if (useColorManagement) {
+        Key shaderKey;
+        shaderKey.set(Key::BLEND_MASK | Key::OUTPUT_TRANSFORM_MATRIX_MASK | Key::INPUT_TF_MASK |
+                              Key::OUTPUT_TF_MASK,
+                      Key::BLEND_PREMULT | Key::OUTPUT_TRANSFORM_MATRIX_ON | Key::INPUT_TF_SRGB |
+                              Key::OUTPUT_TF_SRGB);
+        for (int i = 0; i < 16; i++) {
+            shaderKey.set(Key::OPACITY_MASK,
+                          (i & 1) ? Key::OPACITY_OPAQUE : Key::OPACITY_TRANSLUCENT);
+            shaderKey.set(Key::ALPHA_MASK, (i & 2) ? Key::ALPHA_LT_ONE : Key::ALPHA_EQ_ONE);
+
+            // Cache rounded corners
+            shaderKey.set(Key::ROUNDED_CORNERS_MASK,
+                          (i & 4) ? Key::ROUNDED_CORNERS_ON : Key::ROUNDED_CORNERS_OFF);
+
+            // Cache texture off option for window transition
+            shaderKey.set(Key::TEXTURE_MASK, (i & 8) ? Key::TEXTURE_EXT : Key::TEXTURE_OFF);
+            if (cache.count(shaderKey) == 0) {
+                cache.emplace(shaderKey, generateProgram(shaderKey));
+                shaderCount++;
+            }
+        }
+    }
+
+    nsecs_t timeAfter = systemTime();
+    float compileTimeMs = static_cast<float>(timeAfter - timeBefore) / 1.0E6;
+    ALOGD("shader cache generated - %u shaders in %f ms\n", shaderCount, compileTimeMs);
+}
+
+ProgramCache::Key ProgramCache::computeKey(const Description& description) {
+    Key needs;
+    needs.set(Key::TEXTURE_MASK,
+              !description.textureEnabled
+                      ? Key::TEXTURE_OFF
+                      : description.texture.getTextureTarget() == GL_TEXTURE_EXTERNAL_OES
+                              ? Key::TEXTURE_EXT
+                              : description.texture.getTextureTarget() == GL_TEXTURE_2D
+                                      ? Key::TEXTURE_2D
+                                      : Key::TEXTURE_OFF)
+            .set(Key::ALPHA_MASK, (description.color.a < 1) ? Key::ALPHA_LT_ONE : Key::ALPHA_EQ_ONE)
+            .set(Key::BLEND_MASK,
+                 description.isPremultipliedAlpha ? Key::BLEND_PREMULT : Key::BLEND_NORMAL)
+            .set(Key::OPACITY_MASK,
+                 description.isOpaque ? Key::OPACITY_OPAQUE : Key::OPACITY_TRANSLUCENT)
+            .set(Key::Key::INPUT_TRANSFORM_MATRIX_MASK,
+                 description.hasInputTransformMatrix() ? Key::INPUT_TRANSFORM_MATRIX_ON
+                                                       : Key::INPUT_TRANSFORM_MATRIX_OFF)
+            .set(Key::Key::OUTPUT_TRANSFORM_MATRIX_MASK,
+                 description.hasOutputTransformMatrix() || description.hasColorMatrix()
+                         ? Key::OUTPUT_TRANSFORM_MATRIX_ON
+                         : Key::OUTPUT_TRANSFORM_MATRIX_OFF)
+            .set(Key::ROUNDED_CORNERS_MASK,
+                 description.cornerRadius > 0 ? Key::ROUNDED_CORNERS_ON : Key::ROUNDED_CORNERS_OFF)
+            .set(Key::SHADOW_MASK, description.drawShadows ? Key::SHADOW_ON : Key::SHADOW_OFF);
+    needs.set(Key::Y410_BT2020_MASK,
+              description.isY410BT2020 ? Key::Y410_BT2020_ON : Key::Y410_BT2020_OFF);
+
+    if (needs.hasTransformMatrix() ||
+        (description.inputTransferFunction != description.outputTransferFunction)) {
+        switch (description.inputTransferFunction) {
+            case Description::TransferFunction::LINEAR:
+            default:
+                needs.set(Key::INPUT_TF_MASK, Key::INPUT_TF_LINEAR);
+                break;
+            case Description::TransferFunction::SRGB:
+                needs.set(Key::INPUT_TF_MASK, Key::INPUT_TF_SRGB);
+                break;
+            case Description::TransferFunction::ST2084:
+                needs.set(Key::INPUT_TF_MASK, Key::INPUT_TF_ST2084);
+                break;
+            case Description::TransferFunction::HLG:
+                needs.set(Key::INPUT_TF_MASK, Key::INPUT_TF_HLG);
+                break;
+        }
+
+        switch (description.outputTransferFunction) {
+            case Description::TransferFunction::LINEAR:
+            default:
+                needs.set(Key::OUTPUT_TF_MASK, Key::OUTPUT_TF_LINEAR);
+                break;
+            case Description::TransferFunction::SRGB:
+                needs.set(Key::OUTPUT_TF_MASK, Key::OUTPUT_TF_SRGB);
+                break;
+            case Description::TransferFunction::ST2084:
+                needs.set(Key::OUTPUT_TF_MASK, Key::OUTPUT_TF_ST2084);
+                break;
+            case Description::TransferFunction::HLG:
+                needs.set(Key::OUTPUT_TF_MASK, Key::OUTPUT_TF_HLG);
+                break;
+        }
+    }
+
+    return needs;
+}
+
+// Generate EOTF that converts signal values to relative display light,
+// both normalized to [0, 1].
+void ProgramCache::generateEOTF(Formatter& fs, const Key& needs) {
+    switch (needs.getInputTF()) {
+        case Key::INPUT_TF_SRGB:
+            fs << R"__SHADER__(
+                float EOTF_sRGB(float srgb) {
+                    return srgb <= 0.04045 ? srgb / 12.92 : pow((srgb + 0.055) / 1.055, 2.4);
+                }
+
+                vec3 EOTF_sRGB(const vec3 srgb) {
+                    return vec3(EOTF_sRGB(srgb.r), EOTF_sRGB(srgb.g), EOTF_sRGB(srgb.b));
+                }
+
+                vec3 EOTF(const vec3 srgb) {
+                    return sign(srgb.rgb) * EOTF_sRGB(abs(srgb.rgb));
+                }
+            )__SHADER__";
+            break;
+        case Key::INPUT_TF_ST2084:
+            fs << R"__SHADER__(
+                vec3 EOTF(const highp vec3 color) {
+                    const highp float m1 = (2610.0 / 4096.0) / 4.0;
+                    const highp float m2 = (2523.0 / 4096.0) * 128.0;
+                    const highp float c1 = (3424.0 / 4096.0);
+                    const highp float c2 = (2413.0 / 4096.0) * 32.0;
+                    const highp float c3 = (2392.0 / 4096.0) * 32.0;
+
+                    highp vec3 tmp = pow(clamp(color, 0.0, 1.0), 1.0 / vec3(m2));
+                    tmp = max(tmp - c1, 0.0) / (c2 - c3 * tmp);
+                    return pow(tmp, 1.0 / vec3(m1));
+                }
+            )__SHADER__";
+            break;
+        case Key::INPUT_TF_HLG:
+            fs << R"__SHADER__(
+                highp float EOTF_channel(const highp float channel) {
+                    const highp float a = 0.17883277;
+                    const highp float b = 0.28466892;
+                    const highp float c = 0.55991073;
+                    return channel <= 0.5 ? channel * channel / 3.0 :
+                            (exp((channel - c) / a) + b) / 12.0;
+                }
+
+                vec3 EOTF(const highp vec3 color) {
+                    return vec3(EOTF_channel(color.r), EOTF_channel(color.g),
+                            EOTF_channel(color.b));
+                }
+            )__SHADER__";
+            break;
+        default:
+            fs << R"__SHADER__(
+                vec3 EOTF(const vec3 linear) {
+                    return linear;
+                }
+            )__SHADER__";
+            break;
+    }
+}
+
+void ProgramCache::generateToneMappingProcess(Formatter& fs, const Key& needs) {
+    // Convert relative light to absolute light.
+    switch (needs.getInputTF()) {
+        case Key::INPUT_TF_ST2084:
+            fs << R"__SHADER__(
+                highp vec3 ScaleLuminance(highp vec3 color) {
+                    return color * 10000.0;
+                }
+            )__SHADER__";
+            break;
+        case Key::INPUT_TF_HLG:
+            fs << R"__SHADER__(
+                highp vec3 ScaleLuminance(highp vec3 color) {
+                    // The formula is:
+                    // alpha * pow(Y, gamma - 1.0) * color + beta;
+                    // where alpha is 1000.0, gamma is 1.2, beta is 0.0.
+                    return color * 1000.0 * pow(color.y, 0.2);
+                }
+            )__SHADER__";
+            break;
+        default:
+            fs << R"__SHADER__(
+                highp vec3 ScaleLuminance(highp vec3 color) {
+                    return color * displayMaxLuminance;
+                }
+            )__SHADER__";
+            break;
+    }
+
+    // Tone map absolute light to display luminance range.
+    switch (needs.getInputTF()) {
+        case Key::INPUT_TF_ST2084:
+        case Key::INPUT_TF_HLG:
+            switch (needs.getOutputTF()) {
+                case Key::OUTPUT_TF_HLG:
+                    // Right now when mixed PQ and HLG contents are presented,
+                    // HLG content will always be converted to PQ. However, for
+                    // completeness, we simply clamp the value to [0.0, 1000.0].
+                    fs << R"__SHADER__(
+                        highp vec3 ToneMap(highp vec3 color) {
+                            return clamp(color, 0.0, 1000.0);
+                        }
+                    )__SHADER__";
+                    break;
+                case Key::OUTPUT_TF_ST2084:
+                    fs << R"__SHADER__(
+                        highp vec3 ToneMap(highp vec3 color) {
+                            return color;
+                        }
+                    )__SHADER__";
+                    break;
+                default:
+                    fs << R"__SHADER__(
+                        highp vec3 ToneMap(highp vec3 color) {
+                            float maxMasteringLumi = maxMasteringLuminance;
+                            float maxContentLumi = maxContentLuminance;
+                            float maxInLumi = min(maxMasteringLumi, maxContentLumi);
+                            float maxOutLumi = displayMaxLuminance;
+
+                            float nits = color.y;
+
+                            // clamp to max input luminance
+                            nits = clamp(nits, 0.0, maxInLumi);
+
+                            // scale [0.0, maxInLumi] to [0.0, maxOutLumi]
+                            if (maxInLumi <= maxOutLumi) {
+                                return color * (maxOutLumi / maxInLumi);
+                            } else {
+                                // three control points
+                                const float x0 = 10.0;
+                                const float y0 = 17.0;
+                                float x1 = maxOutLumi * 0.75;
+                                float y1 = x1;
+                                float x2 = x1 + (maxInLumi - x1) / 2.0;
+                                float y2 = y1 + (maxOutLumi - y1) * 0.75;
+
+                                // horizontal distances between the last three control points
+                                float h12 = x2 - x1;
+                                float h23 = maxInLumi - x2;
+                                // tangents at the last three control points
+                                float m1 = (y2 - y1) / h12;
+                                float m3 = (maxOutLumi - y2) / h23;
+                                float m2 = (m1 + m3) / 2.0;
+
+                                if (nits < x0) {
+                                    // scale [0.0, x0] to [0.0, y0] linearly
+                                    float slope = y0 / x0;
+                                    return color * slope;
+                                } else if (nits < x1) {
+                                    // scale [x0, x1] to [y0, y1] linearly
+                                    float slope = (y1 - y0) / (x1 - x0);
+                                    nits = y0 + (nits - x0) * slope;
+                                } else if (nits < x2) {
+                                    // scale [x1, x2] to [y1, y2] using Hermite interp
+                                    float t = (nits - x1) / h12;
+                                    nits = (y1 * (1.0 + 2.0 * t) + h12 * m1 * t) * (1.0 - t) * (1.0 - t) +
+                                            (y2 * (3.0 - 2.0 * t) + h12 * m2 * (t - 1.0)) * t * t;
+                                } else {
+                                    // scale [x2, maxInLumi] to [y2, maxOutLumi] using Hermite interp
+                                    float t = (nits - x2) / h23;
+                                    nits = (y2 * (1.0 + 2.0 * t) + h23 * m2 * t) * (1.0 - t) * (1.0 - t) +
+                                            (maxOutLumi * (3.0 - 2.0 * t) + h23 * m3 * (t - 1.0)) * t * t;
+                                }
+                            }
+
+                            // color.y is greater than x0 and is thus non-zero
+                            return color * (nits / color.y);
+                        }
+                    )__SHADER__";
+                    break;
+            }
+            break;
+        default:
+            // inverse tone map; the output luminance can be up to maxOutLumi.
+            fs << R"__SHADER__(
+                highp vec3 ToneMap(highp vec3 color) {
+                    const float maxOutLumi = 3000.0;
+
+                    const float x0 = 5.0;
+                    const float y0 = 2.5;
+                    float x1 = displayMaxLuminance * 0.7;
+                    float y1 = maxOutLumi * 0.15;
+                    float x2 = displayMaxLuminance * 0.9;
+                    float y2 = maxOutLumi * 0.45;
+                    float x3 = displayMaxLuminance;
+                    float y3 = maxOutLumi;
+
+                    float c1 = y1 / 3.0;
+                    float c2 = y2 / 2.0;
+                    float c3 = y3 / 1.5;
+
+                    float nits = color.y;
+
+                    float scale;
+                    if (nits <= x0) {
+                        // scale [0.0, x0] to [0.0, y0] linearly
+                        const float slope = y0 / x0;
+                        return color * slope;
+                    } else if (nits <= x1) {
+                        // scale [x0, x1] to [y0, y1] using a curve
+                        float t = (nits - x0) / (x1 - x0);
+                        nits = (1.0 - t) * (1.0 - t) * y0 + 2.0 * (1.0 - t) * t * c1 + t * t * y1;
+                    } else if (nits <= x2) {
+                        // scale [x1, x2] to [y1, y2] using a curve
+                        float t = (nits - x1) / (x2 - x1);
+                        nits = (1.0 - t) * (1.0 - t) * y1 + 2.0 * (1.0 - t) * t * c2 + t * t * y2;
+                    } else {
+                        // scale [x2, x3] to [y2, y3] using a curve
+                        float t = (nits - x2) / (x3 - x2);
+                        nits = (1.0 - t) * (1.0 - t) * y2 + 2.0 * (1.0 - t) * t * c3 + t * t * y3;
+                    }
+
+                    // color.y is greater than x0 and is thus non-zero
+                    return color * (nits / color.y);
+                }
+            )__SHADER__";
+            break;
+    }
+
+    // convert absolute light to relative light.
+    switch (needs.getOutputTF()) {
+        case Key::OUTPUT_TF_ST2084:
+            fs << R"__SHADER__(
+                highp vec3 NormalizeLuminance(highp vec3 color) {
+                    return color / 10000.0;
+                }
+            )__SHADER__";
+            break;
+        case Key::OUTPUT_TF_HLG:
+            fs << R"__SHADER__(
+                highp vec3 NormalizeLuminance(highp vec3 color) {
+                    return color / 1000.0 * pow(color.y / 1000.0, -0.2 / 1.2);
+                }
+            )__SHADER__";
+            break;
+        default:
+            fs << R"__SHADER__(
+                highp vec3 NormalizeLuminance(highp vec3 color) {
+                    return color / displayMaxLuminance;
+                }
+            )__SHADER__";
+            break;
+    }
+}
+
+// Generate OOTF that modifies the relative scence light to relative display light.
+void ProgramCache::generateOOTF(Formatter& fs, const ProgramCache::Key& needs) {
+    if (!needs.needsToneMapping()) {
+        fs << R"__SHADER__(
+            highp vec3 OOTF(const highp vec3 color) {
+                return color;
+            }
+        )__SHADER__";
+    } else {
+        generateToneMappingProcess(fs, needs);
+        fs << R"__SHADER__(
+            highp vec3 OOTF(const highp vec3 color) {
+                return NormalizeLuminance(ToneMap(ScaleLuminance(color)));
+            }
+        )__SHADER__";
+    }
+}
+
+// Generate OETF that converts relative display light to signal values,
+// both normalized to [0, 1]
+void ProgramCache::generateOETF(Formatter& fs, const Key& needs) {
+    switch (needs.getOutputTF()) {
+        case Key::OUTPUT_TF_SRGB:
+            fs << R"__SHADER__(
+                float OETF_sRGB(const float linear) {
+                    return linear <= 0.0031308 ?
+                            linear * 12.92 : (pow(linear, 1.0 / 2.4) * 1.055) - 0.055;
+                }
+
+                vec3 OETF_sRGB(const vec3 linear) {
+                    return vec3(OETF_sRGB(linear.r), OETF_sRGB(linear.g), OETF_sRGB(linear.b));
+                }
+
+                vec3 OETF(const vec3 linear) {
+                    return sign(linear.rgb) * OETF_sRGB(abs(linear.rgb));
+                }
+            )__SHADER__";
+            break;
+        case Key::OUTPUT_TF_ST2084:
+            fs << R"__SHADER__(
+                vec3 OETF(const vec3 linear) {
+                    const highp float m1 = (2610.0 / 4096.0) / 4.0;
+                    const highp float m2 = (2523.0 / 4096.0) * 128.0;
+                    const highp float c1 = (3424.0 / 4096.0);
+                    const highp float c2 = (2413.0 / 4096.0) * 32.0;
+                    const highp float c3 = (2392.0 / 4096.0) * 32.0;
+
+                    highp vec3 tmp = pow(linear, vec3(m1));
+                    tmp = (c1 + c2 * tmp) / (1.0 + c3 * tmp);
+                    return pow(tmp, vec3(m2));
+                }
+            )__SHADER__";
+            break;
+        case Key::OUTPUT_TF_HLG:
+            fs << R"__SHADER__(
+                highp float OETF_channel(const highp float channel) {
+                    const highp float a = 0.17883277;
+                    const highp float b = 0.28466892;
+                    const highp float c = 0.55991073;
+                    return channel <= 1.0 / 12.0 ? sqrt(3.0 * channel) :
+                            a * log(12.0 * channel - b) + c;
+                }
+
+                vec3 OETF(const highp vec3 color) {
+                    return vec3(OETF_channel(color.r), OETF_channel(color.g),
+                            OETF_channel(color.b));
+                }
+            )__SHADER__";
+            break;
+        default:
+            fs << R"__SHADER__(
+                vec3 OETF(const vec3 linear) {
+                    return linear;
+                }
+            )__SHADER__";
+            break;
+    }
+}
+
+String8 ProgramCache::generateVertexShader(const Key& needs) {
+    Formatter vs;
+    if (needs.hasTextureCoords()) {
+        vs << "attribute vec4 texCoords;"
+           << "varying vec2 outTexCoords;";
+    }
+    if (needs.hasRoundedCorners()) {
+        vs << "attribute lowp vec4 cropCoords;";
+        vs << "varying lowp vec2 outCropCoords;";
+    }
+    if (needs.drawShadows()) {
+        vs << "attribute lowp vec4 shadowColor;";
+        vs << "varying lowp vec4 outShadowColor;";
+        vs << "attribute lowp vec4 shadowParams;";
+        vs << "varying lowp vec3 outShadowParams;";
+    }
+    vs << "attribute vec4 position;"
+       << "uniform mat4 projection;"
+       << "uniform mat4 texture;"
+       << "void main(void) {" << indent << "gl_Position = projection * position;";
+    if (needs.hasTextureCoords()) {
+        vs << "outTexCoords = (texture * texCoords).st;";
+    }
+    if (needs.hasRoundedCorners()) {
+        vs << "outCropCoords = cropCoords.st;";
+    }
+    if (needs.drawShadows()) {
+        vs << "outShadowColor = shadowColor;";
+        vs << "outShadowParams = shadowParams.xyz;";
+    }
+    vs << dedent << "}";
+    return vs.getString();
+}
+
+String8 ProgramCache::generateFragmentShader(const Key& needs) {
+    Formatter fs;
+    if (needs.getTextureTarget() == Key::TEXTURE_EXT) {
+        fs << "#extension GL_OES_EGL_image_external : require";
+    }
+
+    // default precision is required-ish in fragment shaders
+    fs << "precision mediump float;";
+
+    if (needs.getTextureTarget() == Key::TEXTURE_EXT) {
+        fs << "uniform samplerExternalOES sampler;";
+    } else if (needs.getTextureTarget() == Key::TEXTURE_2D) {
+        fs << "uniform sampler2D sampler;";
+    }
+
+    if (needs.hasTextureCoords()) {
+        fs << "varying vec2 outTexCoords;";
+    }
+
+    if (needs.hasRoundedCorners()) {
+        // Rounded corners implementation using a signed distance function.
+        fs << R"__SHADER__(
+            uniform float cornerRadius;
+            uniform vec2 cropCenter;
+            varying vec2 outCropCoords;
+
+            /**
+             * This function takes the current crop coordinates and calculates an alpha value based
+             * on the corner radius and distance from the crop center.
+             */
+            float applyCornerRadius(vec2 cropCoords)
+            {
+                vec2 position = cropCoords - cropCenter;
+                // Scale down the dist vector here, as otherwise large corner
+                // radii can cause floating point issues when computing the norm
+                vec2 dist = (abs(position) - cropCenter + vec2(cornerRadius)) / 16.0;
+                // Once we've found the norm, then scale back up.
+                float plane = length(max(dist, vec2(0.0))) * 16.0;
+                return 1.0 - clamp(plane - cornerRadius, 0.0, 1.0);
+            }
+            )__SHADER__";
+    }
+
+    if (needs.drawShadows()) {
+        fs << R"__SHADER__(
+            varying lowp vec4 outShadowColor;
+            varying lowp vec3 outShadowParams;
+
+            /**
+             * Returns the shadow color.
+             */
+            vec4 getShadowColor()
+            {
+                lowp float d = length(outShadowParams.xy);
+                vec2 uv = vec2(outShadowParams.z * (1.0 - d), 0.5);
+                lowp float factor = texture2D(sampler, uv).a;
+                return outShadowColor * factor;
+            }
+            )__SHADER__";
+    }
+
+    if (needs.getTextureTarget() == Key::TEXTURE_OFF || needs.hasAlpha()) {
+        fs << "uniform vec4 color;";
+    }
+
+    if (needs.isY410BT2020()) {
+        fs << R"__SHADER__(
+            vec3 convertY410BT2020(const vec3 color) {
+                const vec3 offset = vec3(0.0625, 0.5, 0.5);
+                const mat3 transform = mat3(
+                    vec3(1.1678,  1.1678, 1.1678),
+                    vec3(   0.0, -0.1878, 2.1481),
+                    vec3(1.6836, -0.6523,   0.0));
+                // Y is in G, U is in R, and V is in B
+                return clamp(transform * (color.grb - offset), 0.0, 1.0);
+            }
+            )__SHADER__";
+    }
+
+    if (needs.hasTransformMatrix() || (needs.getInputTF() != needs.getOutputTF())) {
+        if (needs.needsToneMapping()) {
+            fs << "uniform float displayMaxLuminance;";
+            fs << "uniform float maxMasteringLuminance;";
+            fs << "uniform float maxContentLuminance;";
+        }
+
+        if (needs.hasInputTransformMatrix()) {
+            fs << "uniform mat4 inputTransformMatrix;";
+            fs << R"__SHADER__(
+                highp vec3 InputTransform(const highp vec3 color) {
+                    return clamp(vec3(inputTransformMatrix * vec4(color, 1.0)), 0.0, 1.0);
+                }
+            )__SHADER__";
+        } else {
+            fs << R"__SHADER__(
+                highp vec3 InputTransform(const highp vec3 color) {
+                    return color;
+                }
+            )__SHADER__";
+        }
+
+        // the transformation from a wider colorspace to a narrower one can
+        // result in >1.0 or <0.0 pixel values
+        if (needs.hasOutputTransformMatrix()) {
+            fs << "uniform mat4 outputTransformMatrix;";
+            fs << R"__SHADER__(
+                highp vec3 OutputTransform(const highp vec3 color) {
+                    return clamp(vec3(outputTransformMatrix * vec4(color, 1.0)), 0.0, 1.0);
+                }
+            )__SHADER__";
+        } else {
+            fs << R"__SHADER__(
+                highp vec3 OutputTransform(const highp vec3 color) {
+                    return clamp(color, 0.0, 1.0);
+                }
+            )__SHADER__";
+        }
+
+        generateEOTF(fs, needs);
+        generateOOTF(fs, needs);
+        generateOETF(fs, needs);
+    }
+
+    fs << "void main(void) {" << indent;
+    if (needs.drawShadows()) {
+        fs << "gl_FragColor = getShadowColor();";
+    } else {
+        if (needs.isTexturing()) {
+            fs << "gl_FragColor = texture2D(sampler, outTexCoords);";
+            if (needs.isY410BT2020()) {
+                fs << "gl_FragColor.rgb = convertY410BT2020(gl_FragColor.rgb);";
+            }
+        } else {
+            fs << "gl_FragColor.rgb = color.rgb;";
+            fs << "gl_FragColor.a = 1.0;";
+        }
+        if (needs.isOpaque()) {
+            fs << "gl_FragColor.a = 1.0;";
+        }
+        if (needs.hasAlpha()) {
+            // modulate the current alpha value with alpha set
+            if (needs.isPremultiplied()) {
+                // ... and the color too if we're premultiplied
+                fs << "gl_FragColor *= color.a;";
+            } else {
+                fs << "gl_FragColor.a *= color.a;";
+            }
+        }
+    }
+
+    if (needs.hasTransformMatrix() || (needs.getInputTF() != needs.getOutputTF())) {
+        if (!needs.isOpaque() && needs.isPremultiplied()) {
+            // un-premultiply if needed before linearization
+            // avoid divide by 0 by adding 0.5/256 to the alpha channel
+            fs << "gl_FragColor.rgb = gl_FragColor.rgb / (gl_FragColor.a + 0.0019);";
+        }
+        fs << "gl_FragColor.rgb = "
+              "OETF(OutputTransform(OOTF(InputTransform(EOTF(gl_FragColor.rgb)))));";
+        if (!needs.isOpaque() && needs.isPremultiplied()) {
+            // and re-premultiply if needed after gamma correction
+            fs << "gl_FragColor.rgb = gl_FragColor.rgb * (gl_FragColor.a + 0.0019);";
+        }
+    }
+
+    if (needs.hasRoundedCorners()) {
+        if (needs.isPremultiplied()) {
+            fs << "gl_FragColor *= vec4(applyCornerRadius(outCropCoords));";
+        } else {
+            fs << "gl_FragColor.a *= applyCornerRadius(outCropCoords);";
+        }
+    }
+
+    fs << dedent << "}";
+    return fs.getString();
+}
+
+std::unique_ptr<Program> ProgramCache::generateProgram(const Key& needs) {
+    ATRACE_CALL();
+
+    // vertex shader
+    String8 vs = generateVertexShader(needs);
+
+    // fragment shader
+    String8 fs = generateFragmentShader(needs);
+
+    return std::make_unique<Program>(needs, vs.string(), fs.string());
+}
+
+void ProgramCache::useProgram(EGLContext context, const Description& description) {
+    // generate the key for the shader based on the description
+    Key needs(computeKey(description));
+
+    // look-up the program in the cache
+    auto& cache = mCaches[context];
+    auto it = cache.find(needs);
+    if (it == cache.end()) {
+        // we didn't find our program, so generate one...
+        nsecs_t time = systemTime();
+        it = cache.emplace(needs, generateProgram(needs)).first;
+        time = systemTime() - time;
+
+        ALOGV(">>> generated new program for context %p: needs=%08X, time=%u ms (%zu programs)",
+              context, needs.mKey, uint32_t(ns2ms(time)), cache.size());
+    }
+
+    // here we have a suitable program for this description
+    std::unique_ptr<Program>& program = it->second;
+    if (program->isValid()) {
+        program->use();
+        program->setUniforms(description);
+    }
+}
+
+} // namespace gl
+} // namespace renderengine
+} // namespace android
diff --git a/media/libstagefright/renderfright/gl/ProgramCache.h b/media/libstagefright/renderfright/gl/ProgramCache.h
new file mode 100644
index 0000000..901e631
--- /dev/null
+++ b/media/libstagefright/renderfright/gl/ProgramCache.h
@@ -0,0 +1,228 @@
+/*
+ * Copyright 2013 The Android Open Source Project
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ *      http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+#ifndef SF_RENDER_ENGINE_PROGRAMCACHE_H
+#define SF_RENDER_ENGINE_PROGRAMCACHE_H
+
+#include <memory>
+#include <unordered_map>
+
+#include <EGL/egl.h>
+#include <GLES2/gl2.h>
+#include <renderengine/private/Description.h>
+#include <utils/Singleton.h>
+#include <utils/TypeHelpers.h>
+
+namespace android {
+
+class String8;
+
+namespace renderengine {
+
+struct Description;
+
+namespace gl {
+
+class Formatter;
+class Program;
+
+/*
+ * This class generates GLSL programs suitable to handle a given
+ * Description. It's responsible for figuring out what to
+ * generate from a Description.
+ * It also maintains a cache of these Programs.
+ */
+class ProgramCache : public Singleton<ProgramCache> {
+public:
+    /*
+     * Key is used to retrieve a Program in the cache.
+     * A Key is generated from a Description.
+     */
+    class Key {
+        friend class ProgramCache;
+        typedef uint32_t key_t;
+        key_t mKey;
+
+    public:
+        enum {
+            BLEND_SHIFT = 0,
+            BLEND_MASK = 1 << BLEND_SHIFT,
+            BLEND_PREMULT = 1 << BLEND_SHIFT,
+            BLEND_NORMAL = 0 << BLEND_SHIFT,
+
+            OPACITY_SHIFT = 1,
+            OPACITY_MASK = 1 << OPACITY_SHIFT,
+            OPACITY_OPAQUE = 1 << OPACITY_SHIFT,
+            OPACITY_TRANSLUCENT = 0 << OPACITY_SHIFT,
+
+            ALPHA_SHIFT = 2,
+            ALPHA_MASK = 1 << ALPHA_SHIFT,
+            ALPHA_LT_ONE = 1 << ALPHA_SHIFT,
+            ALPHA_EQ_ONE = 0 << ALPHA_SHIFT,
+
+            TEXTURE_SHIFT = 3,
+            TEXTURE_MASK = 3 << TEXTURE_SHIFT,
+            TEXTURE_OFF = 0 << TEXTURE_SHIFT,
+            TEXTURE_EXT = 1 << TEXTURE_SHIFT,
+            TEXTURE_2D = 2 << TEXTURE_SHIFT,
+
+            ROUNDED_CORNERS_SHIFT = 5,
+            ROUNDED_CORNERS_MASK = 1 << ROUNDED_CORNERS_SHIFT,
+            ROUNDED_CORNERS_OFF = 0 << ROUNDED_CORNERS_SHIFT,
+            ROUNDED_CORNERS_ON = 1 << ROUNDED_CORNERS_SHIFT,
+
+            INPUT_TRANSFORM_MATRIX_SHIFT = 6,
+            INPUT_TRANSFORM_MATRIX_MASK = 1 << INPUT_TRANSFORM_MATRIX_SHIFT,
+            INPUT_TRANSFORM_MATRIX_OFF = 0 << INPUT_TRANSFORM_MATRIX_SHIFT,
+            INPUT_TRANSFORM_MATRIX_ON = 1 << INPUT_TRANSFORM_MATRIX_SHIFT,
+
+            OUTPUT_TRANSFORM_MATRIX_SHIFT = 7,
+            OUTPUT_TRANSFORM_MATRIX_MASK = 1 << OUTPUT_TRANSFORM_MATRIX_SHIFT,
+            OUTPUT_TRANSFORM_MATRIX_OFF = 0 << OUTPUT_TRANSFORM_MATRIX_SHIFT,
+            OUTPUT_TRANSFORM_MATRIX_ON = 1 << OUTPUT_TRANSFORM_MATRIX_SHIFT,
+
+            INPUT_TF_SHIFT = 8,
+            INPUT_TF_MASK = 3 << INPUT_TF_SHIFT,
+            INPUT_TF_LINEAR = 0 << INPUT_TF_SHIFT,
+            INPUT_TF_SRGB = 1 << INPUT_TF_SHIFT,
+            INPUT_TF_ST2084 = 2 << INPUT_TF_SHIFT,
+            INPUT_TF_HLG = 3 << INPUT_TF_SHIFT,
+
+            OUTPUT_TF_SHIFT = 10,
+            OUTPUT_TF_MASK = 3 << OUTPUT_TF_SHIFT,
+            OUTPUT_TF_LINEAR = 0 << OUTPUT_TF_SHIFT,
+            OUTPUT_TF_SRGB = 1 << OUTPUT_TF_SHIFT,
+            OUTPUT_TF_ST2084 = 2 << OUTPUT_TF_SHIFT,
+            OUTPUT_TF_HLG = 3 << OUTPUT_TF_SHIFT,
+
+            Y410_BT2020_SHIFT = 12,
+            Y410_BT2020_MASK = 1 << Y410_BT2020_SHIFT,
+            Y410_BT2020_OFF = 0 << Y410_BT2020_SHIFT,
+            Y410_BT2020_ON = 1 << Y410_BT2020_SHIFT,
+
+            SHADOW_SHIFT = 13,
+            SHADOW_MASK = 1 << SHADOW_SHIFT,
+            SHADOW_OFF = 0 << SHADOW_SHIFT,
+            SHADOW_ON = 1 << SHADOW_SHIFT,
+        };
+
+        inline Key() : mKey(0) {}
+        inline Key(const Key& rhs) : mKey(rhs.mKey) {}
+
+        inline Key& set(key_t mask, key_t value) {
+            mKey = (mKey & ~mask) | value;
+            return *this;
+        }
+
+        inline bool isTexturing() const { return (mKey & TEXTURE_MASK) != TEXTURE_OFF; }
+        inline bool hasTextureCoords() const { return isTexturing() && !drawShadows(); }
+        inline int getTextureTarget() const { return (mKey & TEXTURE_MASK); }
+        inline bool isPremultiplied() const { return (mKey & BLEND_MASK) == BLEND_PREMULT; }
+        inline bool isOpaque() const { return (mKey & OPACITY_MASK) == OPACITY_OPAQUE; }
+        inline bool hasAlpha() const { return (mKey & ALPHA_MASK) == ALPHA_LT_ONE; }
+        inline bool hasRoundedCorners() const {
+            return (mKey & ROUNDED_CORNERS_MASK) == ROUNDED_CORNERS_ON;
+        }
+        inline bool drawShadows() const { return (mKey & SHADOW_MASK) == SHADOW_ON; }
+        inline bool hasInputTransformMatrix() const {
+            return (mKey & INPUT_TRANSFORM_MATRIX_MASK) == INPUT_TRANSFORM_MATRIX_ON;
+        }
+        inline bool hasOutputTransformMatrix() const {
+            return (mKey & OUTPUT_TRANSFORM_MATRIX_MASK) == OUTPUT_TRANSFORM_MATRIX_ON;
+        }
+        inline bool hasTransformMatrix() const {
+            return hasInputTransformMatrix() || hasOutputTransformMatrix();
+        }
+        inline int getInputTF() const { return (mKey & INPUT_TF_MASK); }
+        inline int getOutputTF() const { return (mKey & OUTPUT_TF_MASK); }
+
+        // When HDR and non-HDR contents are mixed, or different types of HDR contents are
+        // mixed, we will do a tone mapping process to tone map the input content to output
+        // content. Currently, the following conversions handled, they are:
+        // * SDR -> HLG
+        // * SDR -> PQ
+        // * HLG -> PQ
+        inline bool needsToneMapping() const {
+            int inputTF = getInputTF();
+            int outputTF = getOutputTF();
+
+            // Return false when converting from SDR to SDR.
+            if (inputTF == Key::INPUT_TF_SRGB && outputTF == Key::OUTPUT_TF_LINEAR) {
+                return false;
+            }
+            if (inputTF == Key::INPUT_TF_LINEAR && outputTF == Key::OUTPUT_TF_SRGB) {
+                return false;
+            }
+
+            inputTF >>= Key::INPUT_TF_SHIFT;
+            outputTF >>= Key::OUTPUT_TF_SHIFT;
+            return inputTF != outputTF;
+        }
+        inline bool isY410BT2020() const { return (mKey & Y410_BT2020_MASK) == Y410_BT2020_ON; }
+
+        // for use by std::unordered_map
+
+        bool operator==(const Key& other) const { return mKey == other.mKey; }
+
+        struct Hash {
+            size_t operator()(const Key& key) const { return static_cast<size_t>(key.mKey); }
+        };
+    };
+
+    ProgramCache() = default;
+    ~ProgramCache() = default;
+
+    // Generate shaders to populate the cache
+    void primeCache(const EGLContext context, bool useColorManagement, bool toneMapperShaderOnly);
+
+    size_t getSize(const EGLContext context) { return mCaches[context].size(); }
+
+    // useProgram lookup a suitable program in the cache or generates one
+    // if none can be found.
+    void useProgram(const EGLContext context, const Description& description);
+
+private:
+    // compute a cache Key from a Description
+    static Key computeKey(const Description& description);
+    // Generate EOTF based from Key.
+    static void generateEOTF(Formatter& fs, const Key& needs);
+    // Generate necessary tone mapping methods for OOTF.
+    static void generateToneMappingProcess(Formatter& fs, const Key& needs);
+    // Generate OOTF based from Key.
+    static void generateOOTF(Formatter& fs, const Key& needs);
+    // Generate OETF based from Key.
+    static void generateOETF(Formatter& fs, const Key& needs);
+    // generates a program from the Key
+    static std::unique_ptr<Program> generateProgram(const Key& needs);
+    // generates the vertex shader from the Key
+    static String8 generateVertexShader(const Key& needs);
+    // generates the fragment shader from the Key
+    static String8 generateFragmentShader(const Key& needs);
+
+    // Key/Value map used for caching Programs. Currently the cache
+    // is never shrunk (and the GL program objects are never deleted).
+    std::unordered_map<EGLContext, std::unordered_map<Key, std::unique_ptr<Program>, Key::Hash>>
+            mCaches;
+};
+
+} // namespace gl
+} // namespace renderengine
+
+ANDROID_BASIC_TYPES_TRAITS(renderengine::gl::ProgramCache::Key)
+
+} // namespace android
+
+#endif /* SF_RENDER_ENGINE_PROGRAMCACHE_H */
diff --git a/media/libstagefright/renderfright/gl/filters/BlurFilter.cpp b/media/libstagefright/renderfright/gl/filters/BlurFilter.cpp
new file mode 100644
index 0000000..19f18c0
--- /dev/null
+++ b/media/libstagefright/renderfright/gl/filters/BlurFilter.cpp
@@ -0,0 +1,268 @@
+/*
+ * Copyright 2019 The Android Open Source Project
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ *      http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+#define ATRACE_TAG ATRACE_TAG_GRAPHICS
+
+#include "BlurFilter.h"
+#include <EGL/egl.h>
+#include <EGL/eglext.h>
+#include <GLES3/gl3.h>
+#include <GLES3/gl3ext.h>
+#include <ui/GraphicTypes.h>
+#include <cstdint>
+
+#include <utils/Trace.h>
+
+namespace android {
+namespace renderengine {
+namespace gl {
+
+BlurFilter::BlurFilter(GLESRenderEngine& engine)
+      : mEngine(engine),
+        mCompositionFbo(engine),
+        mPingFbo(engine),
+        mPongFbo(engine),
+        mMixProgram(engine),
+        mBlurProgram(engine) {
+    mMixProgram.compile(getVertexShader(), getMixFragShader());
+    mMPosLoc = mMixProgram.getAttributeLocation("aPosition");
+    mMUvLoc = mMixProgram.getAttributeLocation("aUV");
+    mMTextureLoc = mMixProgram.getUniformLocation("uTexture");
+    mMCompositionTextureLoc = mMixProgram.getUniformLocation("uCompositionTexture");
+    mMMixLoc = mMixProgram.getUniformLocation("uMix");
+
+    mBlurProgram.compile(getVertexShader(), getFragmentShader());
+    mBPosLoc = mBlurProgram.getAttributeLocation("aPosition");
+    mBUvLoc = mBlurProgram.getAttributeLocation("aUV");
+    mBTextureLoc = mBlurProgram.getUniformLocation("uTexture");
+    mBOffsetLoc = mBlurProgram.getUniformLocation("uOffset");
+
+    static constexpr auto size = 2.0f;
+    static constexpr auto translation = 1.0f;
+    const GLfloat vboData[] = {
+        // Vertex data
+        translation - size, -translation - size,
+        translation - size, -translation + size,
+        translation + size, -translation + size,
+        // UV data
+        0.0f, 0.0f - translation,
+        0.0f, size - translation,
+        size, size - translation
+    };
+    mMeshBuffer.allocateBuffers(vboData, 12 /* size */);
+}
+
+status_t BlurFilter::setAsDrawTarget(const DisplaySettings& display, uint32_t radius) {
+    ATRACE_NAME("BlurFilter::setAsDrawTarget");
+    mRadius = radius;
+    mDisplayX = display.physicalDisplay.left;
+    mDisplayY = display.physicalDisplay.top;
+
+    if (mDisplayWidth < display.physicalDisplay.width() ||
+        mDisplayHeight < display.physicalDisplay.height()) {
+        ATRACE_NAME("BlurFilter::allocatingTextures");
+
+        mDisplayWidth = display.physicalDisplay.width();
+        mDisplayHeight = display.physicalDisplay.height();
+        mCompositionFbo.allocateBuffers(mDisplayWidth, mDisplayHeight);
+
+        const uint32_t fboWidth = floorf(mDisplayWidth * kFboScale);
+        const uint32_t fboHeight = floorf(mDisplayHeight * kFboScale);
+        mPingFbo.allocateBuffers(fboWidth, fboHeight);
+        mPongFbo.allocateBuffers(fboWidth, fboHeight);
+
+        if (mPingFbo.getStatus() != GL_FRAMEBUFFER_COMPLETE) {
+            ALOGE("Invalid ping buffer");
+            return mPingFbo.getStatus();
+        }
+        if (mPongFbo.getStatus() != GL_FRAMEBUFFER_COMPLETE) {
+            ALOGE("Invalid pong buffer");
+            return mPongFbo.getStatus();
+        }
+        if (mCompositionFbo.getStatus() != GL_FRAMEBUFFER_COMPLETE) {
+            ALOGE("Invalid composition buffer");
+            return mCompositionFbo.getStatus();
+        }
+        if (!mBlurProgram.isValid()) {
+            ALOGE("Invalid shader");
+            return GL_INVALID_OPERATION;
+        }
+    }
+
+    mCompositionFbo.bind();
+    glViewport(0, 0, mCompositionFbo.getBufferWidth(), mCompositionFbo.getBufferHeight());
+    return NO_ERROR;
+}
+
+void BlurFilter::drawMesh(GLuint uv, GLuint position) {
+
+    glEnableVertexAttribArray(uv);
+    glEnableVertexAttribArray(position);
+    mMeshBuffer.bind();
+    glVertexAttribPointer(position, 2 /* size */, GL_FLOAT, GL_FALSE,
+                          2 * sizeof(GLfloat) /* stride */, 0 /* offset */);
+    glVertexAttribPointer(uv, 2 /* size */, GL_FLOAT, GL_FALSE, 0 /* stride */,
+                          (GLvoid*)(6 * sizeof(GLfloat)) /* offset */);
+    mMeshBuffer.unbind();
+
+    // draw mesh
+    glDrawArrays(GL_TRIANGLES, 0 /* first */, 3 /* count */);
+}
+
+status_t BlurFilter::prepare() {
+    ATRACE_NAME("BlurFilter::prepare");
+
+    // Kawase is an approximation of Gaussian, but it behaves differently from it.
+    // A radius transformation is required for approximating them, and also to introduce
+    // non-integer steps, necessary to smoothly interpolate large radii.
+    const auto radius = mRadius / 6.0f;
+
+    // Calculate how many passes we'll do, based on the radius.
+    // Too many passes will make the operation expensive.
+    const auto passes = min(kMaxPasses, (uint32_t)ceil(radius));
+
+    const float radiusByPasses = radius / (float)passes;
+    const float stepX = radiusByPasses / (float)mCompositionFbo.getBufferWidth();
+    const float stepY = radiusByPasses / (float)mCompositionFbo.getBufferHeight();
+
+    // Let's start by downsampling and blurring the composited frame simultaneously.
+    mBlurProgram.useProgram();
+    glActiveTexture(GL_TEXTURE0);
+    glUniform1i(mBTextureLoc, 0);
+    glBindTexture(GL_TEXTURE_2D, mCompositionFbo.getTextureName());
+    glUniform2f(mBOffsetLoc, stepX, stepY);
+    glViewport(0, 0, mPingFbo.getBufferWidth(), mPingFbo.getBufferHeight());
+    mPingFbo.bind();
+    drawMesh(mBUvLoc, mBPosLoc);
+
+    // And now we'll ping pong between our textures, to accumulate the result of various offsets.
+    GLFramebuffer* read = &mPingFbo;
+    GLFramebuffer* draw = &mPongFbo;
+    glViewport(0, 0, draw->getBufferWidth(), draw->getBufferHeight());
+    for (auto i = 1; i < passes; i++) {
+        ATRACE_NAME("BlurFilter::renderPass");
+        draw->bind();
+
+        glBindTexture(GL_TEXTURE_2D, read->getTextureName());
+        glUniform2f(mBOffsetLoc, stepX * i, stepY * i);
+
+        drawMesh(mBUvLoc, mBPosLoc);
+
+        // Swap buffers for next iteration
+        auto tmp = draw;
+        draw = read;
+        read = tmp;
+    }
+    mLastDrawTarget = read;
+
+    return NO_ERROR;
+}
+
+status_t BlurFilter::render(bool multiPass) {
+    ATRACE_NAME("BlurFilter::render");
+
+    // Now let's scale our blur up. It will be interpolated with the larger composited
+    // texture for the first frames, to hide downscaling artifacts.
+    GLfloat mix = fmin(1.0, mRadius / kMaxCrossFadeRadius);
+
+    // When doing multiple passes, we cannot try to read mCompositionFbo, given that we'll
+    // be writing onto it. Let's disable the crossfade, otherwise we'd need 1 extra frame buffer,
+    // as large as the screen size.
+    if (mix >= 1 || multiPass) {
+        mLastDrawTarget->bindAsReadBuffer();
+        glBlitFramebuffer(0, 0, mLastDrawTarget->getBufferWidth(),
+                          mLastDrawTarget->getBufferHeight(), mDisplayX, mDisplayY, mDisplayWidth,
+                          mDisplayHeight, GL_COLOR_BUFFER_BIT, GL_LINEAR);
+        return NO_ERROR;
+    }
+
+    mMixProgram.useProgram();
+    glUniform1f(mMMixLoc, mix);
+    glActiveTexture(GL_TEXTURE0);
+    glBindTexture(GL_TEXTURE_2D, mLastDrawTarget->getTextureName());
+    glUniform1i(mMTextureLoc, 0);
+    glActiveTexture(GL_TEXTURE1);
+    glBindTexture(GL_TEXTURE_2D, mCompositionFbo.getTextureName());
+    glUniform1i(mMCompositionTextureLoc, 1);
+
+    drawMesh(mMUvLoc, mMPosLoc);
+
+    glUseProgram(0);
+    glActiveTexture(GL_TEXTURE0);
+    mEngine.checkErrors("Drawing blur mesh");
+    return NO_ERROR;
+}
+
+string BlurFilter::getVertexShader() const {
+    return R"SHADER(#version 310 es
+        precision mediump float;
+
+        in vec2 aPosition;
+        in highp vec2 aUV;
+        out highp vec2 vUV;
+
+        void main() {
+            vUV = aUV;
+            gl_Position = vec4(aPosition, 0.0, 1.0);
+        }
+    )SHADER";
+}
+
+string BlurFilter::getFragmentShader() const {
+    return R"SHADER(#version 310 es
+        precision mediump float;
+
+        uniform sampler2D uTexture;
+        uniform vec2 uOffset;
+
+        in highp vec2 vUV;
+        out vec4 fragColor;
+
+        void main() {
+            fragColor  = texture(uTexture, vUV, 0.0);
+            fragColor += texture(uTexture, vUV + vec2( uOffset.x,  uOffset.y), 0.0);
+            fragColor += texture(uTexture, vUV + vec2( uOffset.x, -uOffset.y), 0.0);
+            fragColor += texture(uTexture, vUV + vec2(-uOffset.x,  uOffset.y), 0.0);
+            fragColor += texture(uTexture, vUV + vec2(-uOffset.x, -uOffset.y), 0.0);
+
+            fragColor = vec4(fragColor.rgb * 0.2, 1.0);
+        }
+    )SHADER";
+}
+
+string BlurFilter::getMixFragShader() const {
+    string shader = R"SHADER(#version 310 es
+        precision mediump float;
+
+        in highp vec2 vUV;
+        out vec4 fragColor;
+
+        uniform sampler2D uCompositionTexture;
+        uniform sampler2D uTexture;
+        uniform float uMix;
+
+        void main() {
+            vec4 blurred = texture(uTexture, vUV);
+            vec4 composition = texture(uCompositionTexture, vUV);
+            fragColor = mix(composition, blurred, uMix);
+        }
+    )SHADER";
+    return shader;
+}
+
+} // namespace gl
+} // namespace renderengine
+} // namespace android
diff --git a/media/libstagefright/renderfright/gl/filters/BlurFilter.h b/media/libstagefright/renderfright/gl/filters/BlurFilter.h
new file mode 100644
index 0000000..593a8fd
--- /dev/null
+++ b/media/libstagefright/renderfright/gl/filters/BlurFilter.h
@@ -0,0 +1,95 @@
+/*
+ * Copyright 2019 The Android Open Source Project
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ *      http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+#pragma once
+
+#include <ui/GraphicTypes.h>
+#include "../GLESRenderEngine.h"
+#include "../GLFramebuffer.h"
+#include "../GLVertexBuffer.h"
+#include "GenericProgram.h"
+
+using namespace std;
+
+namespace android {
+namespace renderengine {
+namespace gl {
+
+/**
+ * This is an implementation of a Kawase blur, as described in here:
+ * https://community.arm.com/cfs-file/__key/communityserver-blogs-components-weblogfiles/
+ * 00-00-00-20-66/siggraph2015_2D00_mmg_2D00_marius_2D00_notes.pdf
+ */
+class BlurFilter {
+public:
+    // Downsample FBO to improve performance
+    static constexpr float kFboScale = 0.25f;
+    // Maximum number of render passes
+    static constexpr uint32_t kMaxPasses = 4;
+    // To avoid downscaling artifacts, we interpolate the blurred fbo with the full composited
+    // image, up to this radius.
+    static constexpr float kMaxCrossFadeRadius = 30.0f;
+
+    explicit BlurFilter(GLESRenderEngine& engine);
+    virtual ~BlurFilter(){};
+
+    // Set up render targets, redirecting output to offscreen texture.
+    status_t setAsDrawTarget(const DisplaySettings&, uint32_t radius);
+    // Execute blur passes, rendering to offscreen texture.
+    status_t prepare();
+    // Render blur to the bound framebuffer (screen).
+    status_t render(bool multiPass);
+
+private:
+    uint32_t mRadius;
+    void drawMesh(GLuint uv, GLuint position);
+    string getVertexShader() const;
+    string getFragmentShader() const;
+    string getMixFragShader() const;
+
+    GLESRenderEngine& mEngine;
+    // Frame buffer holding the composited background.
+    GLFramebuffer mCompositionFbo;
+    // Frame buffers holding the blur passes.
+    GLFramebuffer mPingFbo;
+    GLFramebuffer mPongFbo;
+    uint32_t mDisplayWidth = 0;
+    uint32_t mDisplayHeight = 0;
+    uint32_t mDisplayX = 0;
+    uint32_t mDisplayY = 0;
+    // Buffer holding the final blur pass.
+    GLFramebuffer* mLastDrawTarget;
+
+    // VBO containing vertex and uv data of a fullscreen triangle.
+    GLVertexBuffer mMeshBuffer;
+
+    GenericProgram mMixProgram;
+    GLuint mMPosLoc;
+    GLuint mMUvLoc;
+    GLuint mMMixLoc;
+    GLuint mMTextureLoc;
+    GLuint mMCompositionTextureLoc;
+
+    GenericProgram mBlurProgram;
+    GLuint mBPosLoc;
+    GLuint mBUvLoc;
+    GLuint mBTextureLoc;
+    GLuint mBOffsetLoc;
+};
+
+} // namespace gl
+} // namespace renderengine
+} // namespace android
diff --git a/media/libstagefright/renderfright/gl/filters/GenericProgram.cpp b/media/libstagefright/renderfright/gl/filters/GenericProgram.cpp
new file mode 100644
index 0000000..bb35889
--- /dev/null
+++ b/media/libstagefright/renderfright/gl/filters/GenericProgram.cpp
@@ -0,0 +1,122 @@
+/*
+ * Copyright 2019 The Android Open Source Project
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ *      http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+#include "GenericProgram.h"
+
+#include <GLES/gl.h>
+#include <GLES/glext.h>
+#include <GLES2/gl2.h>
+#include <GLES2/gl2ext.h>
+
+namespace android {
+namespace renderengine {
+namespace gl {
+
+GenericProgram::GenericProgram(GLESRenderEngine& engine) : mEngine(engine) {}
+
+GenericProgram::~GenericProgram() {
+    if (mVertexShaderHandle != 0) {
+        if (mProgramHandle != 0) {
+            glDetachShader(mProgramHandle, mVertexShaderHandle);
+        }
+        glDeleteShader(mVertexShaderHandle);
+    }
+
+    if (mFragmentShaderHandle != 0) {
+        if (mProgramHandle != 0) {
+            glDetachShader(mProgramHandle, mFragmentShaderHandle);
+        }
+        glDeleteShader(mFragmentShaderHandle);
+    }
+
+    if (mProgramHandle != 0) {
+        glDeleteProgram(mProgramHandle);
+    }
+}
+
+void GenericProgram::compile(string vertexShader, string fragmentShader) {
+    mVertexShaderHandle = compileShader(GL_VERTEX_SHADER, vertexShader);
+    mFragmentShaderHandle = compileShader(GL_FRAGMENT_SHADER, fragmentShader);
+    if (mVertexShaderHandle == 0 || mFragmentShaderHandle == 0) {
+        ALOGE("Aborting program creation.");
+        return;
+    }
+    mProgramHandle = createAndLink(mVertexShaderHandle, mFragmentShaderHandle);
+    mEngine.checkErrors("Linking program");
+}
+
+void GenericProgram::useProgram() const {
+    glUseProgram(mProgramHandle);
+}
+
+GLuint GenericProgram::compileShader(GLuint type, string src) const {
+    const GLuint shader = glCreateShader(type);
+    if (shader == 0) {
+        mEngine.checkErrors("Creating shader");
+        return 0;
+    }
+    const GLchar* charSrc = (const GLchar*)src.c_str();
+    glShaderSource(shader, 1, &charSrc, nullptr);
+    glCompileShader(shader);
+
+    GLint isCompiled = 0;
+    glGetShaderiv(shader, GL_COMPILE_STATUS, &isCompiled);
+    if (isCompiled == GL_FALSE) {
+        GLint maxLength = 0;
+        glGetShaderiv(shader, GL_INFO_LOG_LENGTH, &maxLength);
+        string errorLog;
+        errorLog.reserve(maxLength);
+        glGetShaderInfoLog(shader, maxLength, &maxLength, errorLog.data());
+        glDeleteShader(shader);
+        ALOGE("Error compiling shader: %s", errorLog.c_str());
+        return 0;
+    }
+    return shader;
+}
+GLuint GenericProgram::createAndLink(GLuint vertexShader, GLuint fragmentShader) const {
+    const GLuint program = glCreateProgram();
+    mEngine.checkErrors("Creating program");
+
+    glAttachShader(program, vertexShader);
+    glAttachShader(program, fragmentShader);
+    glLinkProgram(program);
+    mEngine.checkErrors("Linking program");
+    return program;
+}
+
+GLuint GenericProgram::getUniformLocation(const string name) const {
+    if (mProgramHandle == 0) {
+        ALOGE("Can't get location of %s on an invalid program.", name.c_str());
+        return -1;
+    }
+    return glGetUniformLocation(mProgramHandle, (const GLchar*)name.c_str());
+}
+
+GLuint GenericProgram::getAttributeLocation(const string name) const {
+    if (mProgramHandle == 0) {
+        ALOGE("Can't get location of %s on an invalid program.", name.c_str());
+        return -1;
+    }
+    return glGetAttribLocation(mProgramHandle, (const GLchar*)name.c_str());
+}
+
+bool GenericProgram::isValid() const {
+    return mProgramHandle != 0;
+}
+
+} // namespace gl
+} // namespace renderengine
+} // namespace android
diff --git a/media/libstagefright/renderfright/gl/filters/GenericProgram.h b/media/libstagefright/renderfright/gl/filters/GenericProgram.h
new file mode 100644
index 0000000..6da2a5a
--- /dev/null
+++ b/media/libstagefright/renderfright/gl/filters/GenericProgram.h
@@ -0,0 +1,51 @@
+/*
+ * Copyright 2019 The Android Open Source Project
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ *      http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+#pragma once
+
+#include <ui/GraphicTypes.h>
+#include "../GLESRenderEngine.h"
+#include "../GLFramebuffer.h"
+
+using namespace std;
+
+namespace android {
+namespace renderengine {
+namespace gl {
+
+class GenericProgram {
+public:
+    explicit GenericProgram(GLESRenderEngine& renderEngine);
+    ~GenericProgram();
+    void compile(string vertexShader, string fragmentShader);
+    bool isValid() const;
+    void useProgram() const;
+    GLuint getAttributeLocation(const string name) const;
+    GLuint getUniformLocation(const string name) const;
+
+private:
+    GLuint compileShader(GLuint type, const string src) const;
+    GLuint createAndLink(GLuint vertexShader, GLuint fragmentShader) const;
+
+    GLESRenderEngine& mEngine;
+    GLuint mVertexShaderHandle = 0;
+    GLuint mFragmentShaderHandle = 0;
+    GLuint mProgramHandle = 0;
+};
+
+} // namespace gl
+} // namespace renderengine
+} // namespace android
diff --git a/media/libstagefright/renderfright/include/renderengine/DisplaySettings.h b/media/libstagefright/renderfright/include/renderengine/DisplaySettings.h
new file mode 100644
index 0000000..ca16d2c
--- /dev/null
+++ b/media/libstagefright/renderfright/include/renderengine/DisplaySettings.h
@@ -0,0 +1,90 @@
+/*
+ * Copyright 2018 The Android Open Source Project
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ *      http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+#pragma once
+
+#include <iosfwd>
+
+#include <math/mat4.h>
+#include <ui/GraphicTypes.h>
+#include <ui/Rect.h>
+#include <ui/Region.h>
+#include <ui/Transform.h>
+
+namespace android {
+namespace renderengine {
+
+// DisplaySettings contains the settings that are applicable when drawing all
+// layers for a given display.
+struct DisplaySettings {
+    // Rectangle describing the physical display. We will project from the
+    // logical clip onto this rectangle.
+    Rect physicalDisplay = Rect::INVALID_RECT;
+
+    // Rectangle bounded by the x,y- clipping planes in the logical display, so
+    // that the orthographic projection matrix can be computed. When
+    // constructing this matrix, z-coordinate bound are assumed to be at z=0 and
+    // z=1.
+    Rect clip = Rect::INVALID_RECT;
+
+    // Maximum luminance pulled from the display's HDR capabilities.
+    float maxLuminance = 1.0f;
+
+    // Output dataspace that will be populated if wide color gamut is used, or
+    // DataSpace::UNKNOWN otherwise.
+    ui::Dataspace outputDataspace = ui::Dataspace::UNKNOWN;
+
+    // Additional color transform to apply in linear space after transforming
+    // to the output dataspace.
+    mat4 colorTransform = mat4();
+
+    // Region that will be cleared to (0, 0, 0, 1) prior to rendering.
+    // This is specified in layer-stack space.
+    Region clearRegion = Region::INVALID_REGION;
+
+    // An additional orientation flag to be applied after clipping the output.
+    // By way of example, this may be used for supporting fullscreen screenshot
+    // capture of a device in landscape while the buffer is in portrait
+    // orientation.
+    uint32_t orientation = ui::Transform::ROT_0;
+};
+
+static inline bool operator==(const DisplaySettings& lhs, const DisplaySettings& rhs) {
+    return lhs.physicalDisplay == rhs.physicalDisplay && lhs.clip == rhs.clip &&
+            lhs.maxLuminance == rhs.maxLuminance && lhs.outputDataspace == rhs.outputDataspace &&
+            lhs.colorTransform == rhs.colorTransform &&
+            lhs.clearRegion.hasSameRects(rhs.clearRegion) && lhs.orientation == rhs.orientation;
+}
+
+// Defining PrintTo helps with Google Tests.
+static inline void PrintTo(const DisplaySettings& settings, ::std::ostream* os) {
+    *os << "DisplaySettings {";
+    *os << "\n    .physicalDisplay = ";
+    PrintTo(settings.physicalDisplay, os);
+    *os << "\n    .clip = ";
+    PrintTo(settings.clip, os);
+    *os << "\n    .maxLuminance = " << settings.maxLuminance;
+    *os << "\n    .outputDataspace = ";
+    PrintTo(settings.outputDataspace, os);
+    *os << "\n    .colorTransform = " << settings.colorTransform;
+    *os << "\n    .clearRegion = ";
+    PrintTo(settings.clearRegion, os);
+    *os << "\n    .orientation = " << settings.orientation;
+    *os << "\n}";
+}
+
+} // namespace renderengine
+} // namespace android
diff --git a/media/libstagefright/renderfright/include/renderengine/Framebuffer.h b/media/libstagefright/renderfright/include/renderengine/Framebuffer.h
new file mode 100644
index 0000000..6511127
--- /dev/null
+++ b/media/libstagefright/renderfright/include/renderengine/Framebuffer.h
@@ -0,0 +1,35 @@
+/*
+ * Copyright 2018 The Android Open Source Project
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ *      http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+#pragma once
+
+#include <cstdint>
+
+struct ANativeWindowBuffer;
+
+namespace android {
+namespace renderengine {
+
+class Framebuffer {
+public:
+    virtual ~Framebuffer() = default;
+
+    virtual bool setNativeWindowBuffer(ANativeWindowBuffer* nativeBuffer, bool isProtected,
+                                       const bool useFramebufferCache) = 0;
+};
+
+} // namespace renderengine
+} // namespace android
diff --git a/media/libstagefright/renderfright/include/renderengine/Image.h b/media/libstagefright/renderfright/include/renderengine/Image.h
new file mode 100644
index 0000000..3bb4731
--- /dev/null
+++ b/media/libstagefright/renderfright/include/renderengine/Image.h
@@ -0,0 +1,31 @@
+/*
+ * Copyright 2017 The Android Open Source Project
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ *      http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+#pragma once
+
+struct ANativeWindowBuffer;
+
+namespace android {
+namespace renderengine {
+
+class Image {
+public:
+    virtual ~Image() = default;
+    virtual bool setNativeWindowBuffer(ANativeWindowBuffer* buffer, bool isProtected) = 0;
+};
+
+} // namespace renderengine
+} // namespace android
diff --git a/media/libstagefright/renderfright/include/renderengine/LayerSettings.h b/media/libstagefright/renderfright/include/renderengine/LayerSettings.h
new file mode 100644
index 0000000..95e9367
--- /dev/null
+++ b/media/libstagefright/renderfright/include/renderengine/LayerSettings.h
@@ -0,0 +1,258 @@
+/*
+ * Copyright 2018 The Android Open Source Project
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ *      http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+#pragma once
+
+#include <iosfwd>
+
+#include <math/mat4.h>
+#include <math/vec3.h>
+#include <renderengine/Texture.h>
+#include <ui/Fence.h>
+#include <ui/FloatRect.h>
+#include <ui/GraphicBuffer.h>
+#include <ui/GraphicTypes.h>
+#include <ui/Rect.h>
+#include <ui/Region.h>
+#include <ui/Transform.h>
+
+namespace android {
+namespace renderengine {
+
+// Metadata describing the input buffer to render from.
+struct Buffer {
+    // Buffer containing the image that we will render.
+    // If buffer == nullptr, then the rest of the fields in this struct will be
+    // ignored.
+    sp<GraphicBuffer> buffer = nullptr;
+
+    // Fence that will fire when the buffer is ready to be bound.
+    sp<Fence> fence = nullptr;
+
+    // Texture identifier to bind the external texture to.
+    // TODO(alecmouri): This is GL-specific...make the type backend-agnostic.
+    uint32_t textureName = 0;
+
+    // Whether to use filtering when rendering the texture.
+    bool useTextureFiltering = false;
+
+    // Transform matrix to apply to texture coordinates.
+    mat4 textureTransform = mat4();
+
+    // Whether to use pre-multiplied alpha.
+    bool usePremultipliedAlpha = true;
+
+    // Override flag that alpha for each pixel in the buffer *must* be 1.0.
+    // LayerSettings::alpha is still used if isOpaque==true - this flag only
+    // overrides the alpha channel of the buffer.
+    bool isOpaque = false;
+
+    // HDR color-space setting for Y410.
+    bool isY410BT2020 = false;
+    float maxMasteringLuminance = 0.0;
+    float maxContentLuminance = 0.0;
+};
+
+// Metadata describing the layer geometry.
+struct Geometry {
+    // Boundaries of the layer.
+    FloatRect boundaries = FloatRect();
+
+    // Transform matrix to apply to mesh coordinates.
+    mat4 positionTransform = mat4();
+
+    // Radius of rounded corners, if greater than 0. Otherwise, this layer's
+    // corners are not rounded.
+    // Having corner radius will force GPU composition on the layer and its children, drawing it
+    // with a special shader. The shader will receive the radius and the crop rectangle as input,
+    // modifying the opacity of the destination texture, multiplying it by a number between 0 and 1.
+    // We query Layer#getRoundedCornerState() to retrieve the radius as well as the rounded crop
+    // rectangle to figure out how to apply the radius for this layer. The crop rectangle will be
+    // in local layer coordinate space, so we have to take the layer transform into account when
+    // walking up the tree.
+    float roundedCornersRadius = 0.0;
+
+    // Rectangle within which corners will be rounded.
+    FloatRect roundedCornersCrop = FloatRect();
+};
+
+// Descriptor of the source pixels for this layer.
+struct PixelSource {
+    // Source buffer
+    Buffer buffer = Buffer();
+
+    // The solid color with which to fill the layer.
+    // This should only be populated if we don't render from an application
+    // buffer.
+    half3 solidColor = half3(0.0f, 0.0f, 0.0f);
+};
+
+/*
+ * Contains the configuration for the shadows drawn by single layer. Shadow follows
+ * material design guidelines.
+ */
+struct ShadowSettings {
+    // Color to the ambient shadow. The alpha is premultiplied.
+    vec4 ambientColor = vec4();
+
+    // Color to the spot shadow. The alpha is premultiplied. The position of the spot shadow
+    // depends on the light position.
+    vec4 spotColor = vec4();
+
+    // Position of the light source used to cast the spot shadow.
+    vec3 lightPos = vec3();
+
+    // Radius of the spot light source. Smaller radius will have sharper edges,
+    // larger radius will have softer shadows
+    float lightRadius = 0.f;
+
+    // Length of the cast shadow. If length is <= 0.f no shadows will be drawn.
+    float length = 0.f;
+
+    // If true fill in the casting layer is translucent and the shadow needs to fill the bounds.
+    // Otherwise the shadow will only be drawn around the edges of the casting layer.
+    bool casterIsTranslucent = false;
+};
+
+// The settings that RenderEngine requires for correctly rendering a Layer.
+struct LayerSettings {
+    // Geometry information
+    Geometry geometry = Geometry();
+
+    // Source pixels for this layer.
+    PixelSource source = PixelSource();
+
+    // Alpha option to blend with the source pixels
+    half alpha = half(0.0);
+
+    // Color space describing how the source pixels should be interpreted.
+    ui::Dataspace sourceDataspace = ui::Dataspace::UNKNOWN;
+
+    // Additional layer-specific color transform to be applied before the global
+    // transform.
+    mat4 colorTransform = mat4();
+
+    // True if blending will be forced to be disabled.
+    bool disableBlending = false;
+
+    ShadowSettings shadow;
+
+    int backgroundBlurRadius = 0;
+};
+
+// Keep in sync with custom comparison function in
+// compositionengine/impl/ClientCompositionRequestCache.cpp
+static inline bool operator==(const Buffer& lhs, const Buffer& rhs) {
+    return lhs.buffer == rhs.buffer && lhs.fence == rhs.fence &&
+            lhs.textureName == rhs.textureName &&
+            lhs.useTextureFiltering == rhs.useTextureFiltering &&
+            lhs.textureTransform == rhs.textureTransform &&
+            lhs.usePremultipliedAlpha == rhs.usePremultipliedAlpha &&
+            lhs.isOpaque == rhs.isOpaque && lhs.isY410BT2020 == rhs.isY410BT2020 &&
+            lhs.maxMasteringLuminance == rhs.maxMasteringLuminance &&
+            lhs.maxContentLuminance == rhs.maxContentLuminance;
+}
+
+static inline bool operator==(const Geometry& lhs, const Geometry& rhs) {
+    return lhs.boundaries == rhs.boundaries && lhs.positionTransform == rhs.positionTransform &&
+            lhs.roundedCornersRadius == rhs.roundedCornersRadius &&
+            lhs.roundedCornersCrop == rhs.roundedCornersCrop;
+}
+
+static inline bool operator==(const PixelSource& lhs, const PixelSource& rhs) {
+    return lhs.buffer == rhs.buffer && lhs.solidColor == rhs.solidColor;
+}
+
+static inline bool operator==(const ShadowSettings& lhs, const ShadowSettings& rhs) {
+    return lhs.ambientColor == rhs.ambientColor && lhs.spotColor == rhs.spotColor &&
+            lhs.lightPos == rhs.lightPos && lhs.lightRadius == rhs.lightRadius &&
+            lhs.length == rhs.length && lhs.casterIsTranslucent == rhs.casterIsTranslucent;
+}
+
+static inline bool operator==(const LayerSettings& lhs, const LayerSettings& rhs) {
+    return lhs.geometry == rhs.geometry && lhs.source == rhs.source && lhs.alpha == rhs.alpha &&
+            lhs.sourceDataspace == rhs.sourceDataspace &&
+            lhs.colorTransform == rhs.colorTransform &&
+            lhs.disableBlending == rhs.disableBlending && lhs.shadow == rhs.shadow &&
+            lhs.backgroundBlurRadius == rhs.backgroundBlurRadius;
+}
+
+// Defining PrintTo helps with Google Tests.
+
+static inline void PrintTo(const Buffer& settings, ::std::ostream* os) {
+    *os << "Buffer {";
+    *os << "\n    .buffer = " << settings.buffer.get();
+    *os << "\n    .fence = " << settings.fence.get();
+    *os << "\n    .textureName = " << settings.textureName;
+    *os << "\n    .useTextureFiltering = " << settings.useTextureFiltering;
+    *os << "\n    .textureTransform = " << settings.textureTransform;
+    *os << "\n    .usePremultipliedAlpha = " << settings.usePremultipliedAlpha;
+    *os << "\n    .isOpaque = " << settings.isOpaque;
+    *os << "\n    .isY410BT2020 = " << settings.isY410BT2020;
+    *os << "\n    .maxMasteringLuminance = " << settings.maxMasteringLuminance;
+    *os << "\n    .maxContentLuminance = " << settings.maxContentLuminance;
+    *os << "\n}";
+}
+
+static inline void PrintTo(const Geometry& settings, ::std::ostream* os) {
+    *os << "Geometry {";
+    *os << "\n    .boundaries = ";
+    PrintTo(settings.boundaries, os);
+    *os << "\n    .positionTransform = " << settings.positionTransform;
+    *os << "\n    .roundedCornersRadius = " << settings.roundedCornersRadius;
+    *os << "\n    .roundedCornersCrop = ";
+    PrintTo(settings.roundedCornersCrop, os);
+    *os << "\n}";
+}
+
+static inline void PrintTo(const PixelSource& settings, ::std::ostream* os) {
+    *os << "PixelSource {";
+    *os << "\n    .buffer = ";
+    PrintTo(settings.buffer, os);
+    *os << "\n    .solidColor = " << settings.solidColor;
+    *os << "\n}";
+}
+
+static inline void PrintTo(const ShadowSettings& settings, ::std::ostream* os) {
+    *os << "ShadowSettings {";
+    *os << "\n    .ambientColor = " << settings.ambientColor;
+    *os << "\n    .spotColor = " << settings.spotColor;
+    *os << "\n    .lightPos = " << settings.lightPos;
+    *os << "\n    .lightRadius = " << settings.lightRadius;
+    *os << "\n    .length = " << settings.length;
+    *os << "\n    .casterIsTranslucent = " << settings.casterIsTranslucent;
+    *os << "\n}";
+}
+
+static inline void PrintTo(const LayerSettings& settings, ::std::ostream* os) {
+    *os << "LayerSettings {";
+    *os << "\n    .geometry = ";
+    PrintTo(settings.geometry, os);
+    *os << "\n    .source = ";
+    PrintTo(settings.source, os);
+    *os << "\n    .alpha = " << settings.alpha;
+    *os << "\n    .sourceDataspace = ";
+    PrintTo(settings.sourceDataspace, os);
+    *os << "\n    .colorTransform = " << settings.colorTransform;
+    *os << "\n    .disableBlending = " << settings.disableBlending;
+    *os << "\n    .backgroundBlurRadius = " << settings.backgroundBlurRadius;
+    *os << "\n    .shadow = ";
+    PrintTo(settings.shadow, os);
+    *os << "\n}";
+}
+
+} // namespace renderengine
+} // namespace android
diff --git a/media/libstagefright/renderfright/include/renderengine/Mesh.h b/media/libstagefright/renderfright/include/renderengine/Mesh.h
new file mode 100644
index 0000000..167f13f
--- /dev/null
+++ b/media/libstagefright/renderfright/include/renderengine/Mesh.h
@@ -0,0 +1,205 @@
+/*
+ * Copyright 2013 The Android Open Source Project
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ *      http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+#ifndef SF_RENDER_ENGINE_MESH_H
+#define SF_RENDER_ENGINE_MESH_H
+
+#include <vector>
+
+#include <stdint.h>
+
+namespace android {
+namespace renderengine {
+
+class Mesh {
+public:
+    class Builder;
+
+    enum Primitive {
+        TRIANGLES = 0x0004,      // GL_TRIANGLES
+        TRIANGLE_STRIP = 0x0005, // GL_TRIANGLE_STRIP
+        TRIANGLE_FAN = 0x0006    // GL_TRIANGLE_FAN
+    };
+
+    ~Mesh() = default;
+
+    /*
+     * VertexArray handles the stride automatically.
+     */
+    template <typename TYPE>
+    class VertexArray {
+        friend class Mesh;
+        float* mData;
+        size_t mStride;
+        size_t mOffset = 0;
+        VertexArray(float* data, size_t stride) : mData(data), mStride(stride) {}
+
+    public:
+        // Returns a vertex array at an offset so its easier to append attributes from
+        // multiple sources.
+        VertexArray(VertexArray<TYPE>& other, size_t offset)
+              : mData(other.mData), mStride(other.mStride), mOffset(offset) {}
+
+        TYPE& operator[](size_t index) {
+            return *reinterpret_cast<TYPE*>(&mData[(index + mOffset) * mStride]);
+        }
+        TYPE const& operator[](size_t index) const {
+            return *reinterpret_cast<TYPE const*>(&mData[(index + mOffset) * mStride]);
+        }
+    };
+
+    template <typename TYPE>
+    VertexArray<TYPE> getPositionArray() {
+        return VertexArray<TYPE>(getPositions(), mStride);
+    }
+
+    template <typename TYPE>
+    VertexArray<TYPE> getTexCoordArray() {
+        return VertexArray<TYPE>(getTexCoords(), mStride);
+    }
+
+    template <typename TYPE>
+    VertexArray<TYPE> getCropCoordArray() {
+        return VertexArray<TYPE>(getCropCoords(), mStride);
+    }
+
+    template <typename TYPE>
+    VertexArray<TYPE> getShadowColorArray() {
+        return VertexArray<TYPE>(getShadowColor(), mStride);
+    }
+
+    template <typename TYPE>
+    VertexArray<TYPE> getShadowParamsArray() {
+        return VertexArray<TYPE>(getShadowParams(), mStride);
+    }
+
+    uint16_t* getIndicesArray() { return getIndices(); }
+
+    Primitive getPrimitive() const;
+
+    // returns a pointer to the vertices positions
+    float const* getPositions() const;
+
+    // returns a pointer to the vertices texture coordinates
+    float const* getTexCoords() const;
+
+    // returns a pointer to the vertices crop coordinates
+    float const* getCropCoords() const;
+
+    // returns a pointer to colors
+    float const* getShadowColor() const;
+
+    // returns a pointer to the shadow params
+    float const* getShadowParams() const;
+
+    // returns a pointer to indices
+    uint16_t const* getIndices() const;
+
+    // number of vertices in this mesh
+    size_t getVertexCount() const;
+
+    // dimension of vertices
+    size_t getVertexSize() const;
+
+    // dimension of texture coordinates
+    size_t getTexCoordsSize() const;
+
+    size_t getShadowParamsSize() const;
+
+    size_t getShadowColorSize() const;
+
+    size_t getIndexCount() const;
+
+    // return stride in bytes
+    size_t getByteStride() const;
+
+    // return stride in floats
+    size_t getStride() const;
+
+private:
+    Mesh(Primitive primitive, size_t vertexCount, size_t vertexSize, size_t texCoordSize,
+         size_t cropCoordsSize, size_t shadowColorSize, size_t shadowParamsSize, size_t indexCount);
+    Mesh(const Mesh&);
+    Mesh& operator=(const Mesh&);
+    Mesh const& operator=(const Mesh&) const;
+
+    float* getPositions();
+    float* getTexCoords();
+    float* getCropCoords();
+    float* getShadowColor();
+    float* getShadowParams();
+    uint16_t* getIndices();
+
+    std::vector<float> mVertices;
+    size_t mVertexCount;
+    size_t mVertexSize;
+    size_t mTexCoordsSize;
+    size_t mCropCoordsSize;
+    size_t mShadowColorSize;
+    size_t mShadowParamsSize;
+    size_t mStride;
+    Primitive mPrimitive;
+    std::vector<uint16_t> mIndices;
+    size_t mIndexCount;
+};
+
+class Mesh::Builder {
+public:
+    Builder& setPrimitive(Primitive primitive) {
+        mPrimitive = primitive;
+        return *this;
+    };
+    Builder& setVertices(size_t vertexCount, size_t vertexSize) {
+        mVertexCount = vertexCount;
+        mVertexSize = vertexSize;
+        return *this;
+    };
+    Builder& setTexCoords(size_t texCoordsSize) {
+        mTexCoordsSize = texCoordsSize;
+        return *this;
+    };
+    Builder& setCropCoords(size_t cropCoordsSize) {
+        mCropCoordsSize = cropCoordsSize;
+        return *this;
+    };
+    Builder& setShadowAttrs() {
+        mShadowParamsSize = 3;
+        mShadowColorSize = 4;
+        return *this;
+    };
+    Builder& setIndices(size_t indexCount) {
+        mIndexCount = indexCount;
+        return *this;
+    };
+    Mesh build() const {
+        return Mesh{mPrimitive,      mVertexCount,     mVertexSize,       mTexCoordsSize,
+                    mCropCoordsSize, mShadowColorSize, mShadowParamsSize, mIndexCount};
+    }
+
+private:
+    size_t mVertexCount = 0;
+    size_t mVertexSize = 0;
+    size_t mTexCoordsSize = 0;
+    size_t mCropCoordsSize = 0;
+    size_t mShadowColorSize = 0;
+    size_t mShadowParamsSize = 0;
+    size_t mIndexCount = 0;
+    Primitive mPrimitive;
+};
+
+} // namespace renderengine
+} // namespace android
+#endif /* SF_RENDER_ENGINE_MESH_H */
diff --git a/media/libstagefright/renderfright/include/renderengine/RenderEngine.h b/media/libstagefright/renderfright/include/renderengine/RenderEngine.h
new file mode 100644
index 0000000..09a0f65
--- /dev/null
+++ b/media/libstagefright/renderfright/include/renderengine/RenderEngine.h
@@ -0,0 +1,324 @@
+/*
+ * Copyright 2013 The Android Open Source Project
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ *      http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+#ifndef SF_RENDERENGINE_H_
+#define SF_RENDERENGINE_H_
+
+#include <stdint.h>
+#include <sys/types.h>
+#include <memory>
+
+#include <android-base/unique_fd.h>
+#include <math/mat4.h>
+#include <renderengine/DisplaySettings.h>
+#include <renderengine/Framebuffer.h>
+#include <renderengine/Image.h>
+#include <renderengine/LayerSettings.h>
+#include <ui/GraphicTypes.h>
+#include <ui/Transform.h>
+
+/**
+ * Allows to set RenderEngine backend to GLES (default) or Vulkan (NOT yet supported).
+ */
+#define PROPERTY_DEBUG_RENDERENGINE_BACKEND "debug.renderengine.backend"
+
+struct ANativeWindowBuffer;
+
+namespace android {
+
+class Rect;
+class Region;
+
+namespace renderengine {
+
+class BindNativeBufferAsFramebuffer;
+class Image;
+class Mesh;
+class Texture;
+struct RenderEngineCreationArgs;
+
+namespace threaded {
+class RenderEngineThreaded;
+}
+
+namespace impl {
+class RenderEngine;
+}
+
+enum class Protection {
+    UNPROTECTED = 1,
+    PROTECTED = 2,
+};
+
+class RenderEngine {
+public:
+    enum class ContextPriority {
+        LOW = 1,
+        MEDIUM = 2,
+        HIGH = 3,
+    };
+
+    enum class RenderEngineType {
+        GLES = 1,
+        THREADED = 2,
+    };
+
+    static std::unique_ptr<RenderEngine> create(const RenderEngineCreationArgs& args);
+
+    virtual ~RenderEngine() = 0;
+
+    // ----- BEGIN DEPRECATED INTERFACE -----
+    // This interface, while still in use until a suitable replacement is built,
+    // should be considered deprecated, minus some methods which still may be
+    // used to support legacy behavior.
+    virtual void primeCache() const = 0;
+
+    // dump the extension strings. always call the base class.
+    virtual void dump(std::string& result) = 0;
+
+    virtual bool useNativeFenceSync() const = 0;
+    virtual bool useWaitSync() const = 0;
+    virtual void genTextures(size_t count, uint32_t* names) = 0;
+    virtual void deleteTextures(size_t count, uint32_t const* names) = 0;
+    virtual void bindExternalTextureImage(uint32_t texName, const Image& image) = 0;
+    // Legacy public method used by devices that don't support native fence
+    // synchronization in their GPU driver, as this method provides implicit
+    // synchronization for latching buffers.
+    virtual status_t bindExternalTextureBuffer(uint32_t texName, const sp<GraphicBuffer>& buffer,
+                                               const sp<Fence>& fence) = 0;
+    // Caches Image resources for this buffer, but does not bind the buffer to
+    // a particular texture.
+    // Note that work is deferred to an additional thread, i.e. this call
+    // is made asynchronously, but the caller can expect that cache/unbind calls
+    // are performed in a manner that's conflict serializable, i.e. unbinding
+    // a buffer should never occur before binding the buffer if the caller
+    // called {bind, cache}ExternalTextureBuffer before calling unbind.
+    virtual void cacheExternalTextureBuffer(const sp<GraphicBuffer>& buffer) = 0;
+    // Removes internal resources referenced by the bufferId. This method should be
+    // invoked when the caller will no longer hold a reference to a GraphicBuffer
+    // and needs to clean up its resources.
+    // Note that work is deferred to an additional thread, i.e. this call
+    // is made asynchronously, but the caller can expect that cache/unbind calls
+    // are performed in a manner that's conflict serializable, i.e. unbinding
+    // a buffer should never occur before binding the buffer if the caller
+    // called {bind, cache}ExternalTextureBuffer before calling unbind.
+    virtual void unbindExternalTextureBuffer(uint64_t bufferId) = 0;
+    // When binding a native buffer, it must be done before setViewportAndProjection
+    // Returns NO_ERROR when binds successfully, NO_MEMORY when there's no memory for allocation.
+    virtual status_t bindFrameBuffer(Framebuffer* framebuffer) = 0;
+    virtual void unbindFrameBuffer(Framebuffer* framebuffer) = 0;
+
+    enum class CleanupMode {
+        CLEAN_OUTPUT_RESOURCES,
+        CLEAN_ALL,
+    };
+    // Clean-up method that should be called on the main thread after the
+    // drawFence returned by drawLayers fires. This method will free up
+    // resources used by the most recently drawn frame. If the frame is still
+    // being drawn, then this call is silently ignored.
+    //
+    // If mode is CLEAN_OUTPUT_RESOURCES, then only resources related to the
+    // output framebuffer are cleaned up, including the sibling texture.
+    //
+    // If mode is CLEAN_ALL, then we also cleanup resources related to any input
+    // buffers.
+    //
+    // Returns true if resources were cleaned up, and false if we didn't need to
+    // do any work.
+    virtual bool cleanupPostRender(CleanupMode mode = CleanupMode::CLEAN_OUTPUT_RESOURCES) = 0;
+
+    // queries
+    virtual size_t getMaxTextureSize() const = 0;
+    virtual size_t getMaxViewportDims() const = 0;
+
+    // ----- END DEPRECATED INTERFACE -----
+
+    // ----- BEGIN NEW INTERFACE -----
+
+    virtual bool isProtected() const = 0;
+    virtual bool supportsProtectedContent() const = 0;
+    virtual bool useProtectedContext(bool useProtectedContext) = 0;
+
+    // Renders layers for a particular display via GPU composition. This method
+    // should be called for every display that needs to be rendered via the GPU.
+    // @param display The display-wide settings that should be applied prior to
+    // drawing any layers.
+    //
+    // Assumptions when calling this method:
+    // 1. There is exactly one caller - i.e. multi-threading is not supported.
+    // 2. Additional threads may be calling the {bind,cache}ExternalTexture
+    // methods above. But the main thread is responsible for holding resources
+    // such that Image destruction does not occur while this method is called.
+    //
+    // TODO(b/136806342): This should behavior should ideally be fixed since
+    // the above two assumptions are brittle, as conditional thread safetyness
+    // may be insufficient when maximizing rendering performance in the future.
+    //
+    // @param layers The layers to draw onto the display, in Z-order.
+    // @param buffer The buffer which will be drawn to. This buffer will be
+    // ready once drawFence fires.
+    // @param useFramebufferCache True if the framebuffer cache should be used.
+    // If an implementation does not cache output framebuffers, then this
+    // parameter does nothing.
+    // @param bufferFence Fence signalling that the buffer is ready to be drawn
+    // to.
+    // @param drawFence A pointer to a fence, which will fire when the buffer
+    // has been drawn to and is ready to be examined. The fence will be
+    // initialized by this method. The caller will be responsible for owning the
+    // fence.
+    // @return An error code indicating whether drawing was successful. For
+    // now, this always returns NO_ERROR.
+    virtual status_t drawLayers(const DisplaySettings& display,
+                                const std::vector<const LayerSettings*>& layers,
+                                const sp<GraphicBuffer>& buffer, const bool useFramebufferCache,
+                                base::unique_fd&& bufferFence, base::unique_fd* drawFence) = 0;
+
+protected:
+    // Gets a framebuffer to render to. This framebuffer may or may not be
+    // cached depending on the implementation.
+    //
+    // Note that this method does not transfer ownership, so the caller most not
+    // live longer than RenderEngine.
+    virtual Framebuffer* getFramebufferForDrawing() = 0;
+    friend class BindNativeBufferAsFramebuffer;
+    friend class threaded::RenderEngineThreaded;
+};
+
+struct RenderEngineCreationArgs {
+    int pixelFormat;
+    uint32_t imageCacheSize;
+    bool useColorManagement;
+    bool enableProtectedContext;
+    bool precacheToneMapperShaderOnly;
+    bool supportsBackgroundBlur;
+    RenderEngine::ContextPriority contextPriority;
+    RenderEngine::RenderEngineType renderEngineType;
+
+    struct Builder;
+
+private:
+    // must be created by Builder via constructor with full argument list
+    RenderEngineCreationArgs(int _pixelFormat, uint32_t _imageCacheSize, bool _useColorManagement,
+                             bool _enableProtectedContext, bool _precacheToneMapperShaderOnly,
+                             bool _supportsBackgroundBlur,
+                             RenderEngine::ContextPriority _contextPriority,
+                             RenderEngine::RenderEngineType _renderEngineType)
+          : pixelFormat(_pixelFormat),
+            imageCacheSize(_imageCacheSize),
+            useColorManagement(_useColorManagement),
+            enableProtectedContext(_enableProtectedContext),
+            precacheToneMapperShaderOnly(_precacheToneMapperShaderOnly),
+            supportsBackgroundBlur(_supportsBackgroundBlur),
+            contextPriority(_contextPriority),
+            renderEngineType(_renderEngineType) {}
+    RenderEngineCreationArgs() = delete;
+};
+
+struct RenderEngineCreationArgs::Builder {
+    Builder() {}
+
+    Builder& setPixelFormat(int pixelFormat) {
+        this->pixelFormat = pixelFormat;
+        return *this;
+    }
+    Builder& setImageCacheSize(uint32_t imageCacheSize) {
+        this->imageCacheSize = imageCacheSize;
+        return *this;
+    }
+    Builder& setUseColorManagerment(bool useColorManagement) {
+        this->useColorManagement = useColorManagement;
+        return *this;
+    }
+    Builder& setEnableProtectedContext(bool enableProtectedContext) {
+        this->enableProtectedContext = enableProtectedContext;
+        return *this;
+    }
+    Builder& setPrecacheToneMapperShaderOnly(bool precacheToneMapperShaderOnly) {
+        this->precacheToneMapperShaderOnly = precacheToneMapperShaderOnly;
+        return *this;
+    }
+    Builder& setSupportsBackgroundBlur(bool supportsBackgroundBlur) {
+        this->supportsBackgroundBlur = supportsBackgroundBlur;
+        return *this;
+    }
+    Builder& setContextPriority(RenderEngine::ContextPriority contextPriority) {
+        this->contextPriority = contextPriority;
+        return *this;
+    }
+    Builder& setRenderEngineType(RenderEngine::RenderEngineType renderEngineType) {
+        this->renderEngineType = renderEngineType;
+        return *this;
+    }
+    RenderEngineCreationArgs build() const {
+        return RenderEngineCreationArgs(pixelFormat, imageCacheSize, useColorManagement,
+                                        enableProtectedContext, precacheToneMapperShaderOnly,
+                                        supportsBackgroundBlur, contextPriority, renderEngineType);
+    }
+
+private:
+    // 1 means RGBA_8888
+    int pixelFormat = 1;
+    uint32_t imageCacheSize = 0;
+    bool useColorManagement = true;
+    bool enableProtectedContext = false;
+    bool precacheToneMapperShaderOnly = false;
+    bool supportsBackgroundBlur = false;
+    RenderEngine::ContextPriority contextPriority = RenderEngine::ContextPriority::MEDIUM;
+    RenderEngine::RenderEngineType renderEngineType = RenderEngine::RenderEngineType::GLES;
+};
+
+class BindNativeBufferAsFramebuffer {
+public:
+    BindNativeBufferAsFramebuffer(RenderEngine& engine, ANativeWindowBuffer* buffer,
+                                  const bool useFramebufferCache)
+          : mEngine(engine), mFramebuffer(mEngine.getFramebufferForDrawing()), mStatus(NO_ERROR) {
+        mStatus = mFramebuffer->setNativeWindowBuffer(buffer, mEngine.isProtected(),
+                                                      useFramebufferCache)
+                ? mEngine.bindFrameBuffer(mFramebuffer)
+                : NO_MEMORY;
+    }
+    ~BindNativeBufferAsFramebuffer() {
+        mFramebuffer->setNativeWindowBuffer(nullptr, false, /*arbitrary*/ true);
+        mEngine.unbindFrameBuffer(mFramebuffer);
+    }
+    status_t getStatus() const { return mStatus; }
+
+private:
+    RenderEngine& mEngine;
+    Framebuffer* mFramebuffer;
+    status_t mStatus;
+};
+
+namespace impl {
+
+// impl::RenderEngine contains common implementation that is graphics back-end agnostic.
+class RenderEngine : public renderengine::RenderEngine {
+public:
+    virtual ~RenderEngine() = 0;
+
+    bool useNativeFenceSync() const override;
+    bool useWaitSync() const override;
+
+protected:
+    RenderEngine(const RenderEngineCreationArgs& args);
+    const RenderEngineCreationArgs mArgs;
+};
+
+} // namespace impl
+} // namespace renderengine
+} // namespace android
+
+#endif /* SF_RENDERENGINE_H_ */
diff --git a/media/libstagefright/renderfright/include/renderengine/Texture.h b/media/libstagefright/renderfright/include/renderengine/Texture.h
new file mode 100644
index 0000000..c69ace0
--- /dev/null
+++ b/media/libstagefright/renderfright/include/renderengine/Texture.h
@@ -0,0 +1,60 @@
+/*
+ * Copyright 2013 The Android Open Source Project
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ *      http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+#ifndef SF_RENDER_ENGINE_TEXTURE_H
+#define SF_RENDER_ENGINE_TEXTURE_H
+
+#include <stdint.h>
+
+#include <math/mat4.h>
+
+namespace android {
+namespace renderengine {
+
+class Texture {
+public:
+    enum Target { TEXTURE_2D = 0x0DE1, TEXTURE_EXTERNAL = 0x8D65 };
+
+    Texture();
+    Texture(Target textureTarget, uint32_t textureName);
+    ~Texture();
+
+    void init(Target textureTarget, uint32_t textureName);
+
+    void setMatrix(float const* matrix);
+    void setFiltering(bool enabled);
+    void setDimensions(size_t width, size_t height);
+
+    uint32_t getTextureName() const;
+    uint32_t getTextureTarget() const;
+
+    const mat4& getMatrix() const;
+    bool getFiltering() const;
+    size_t getWidth() const;
+    size_t getHeight() const;
+
+private:
+    uint32_t mTextureName;
+    uint32_t mTextureTarget;
+    size_t mWidth;
+    size_t mHeight;
+    bool mFiltering;
+    mat4 mTextureMatrix;
+};
+
+} // namespace renderengine
+} // namespace android
+#endif /* SF_RENDER_ENGINE_TEXTURE_H */
diff --git a/media/libstagefright/renderfright/include/renderengine/mock/Framebuffer.h b/media/libstagefright/renderfright/include/renderengine/mock/Framebuffer.h
new file mode 100644
index 0000000..dfb6a4e
--- /dev/null
+++ b/media/libstagefright/renderfright/include/renderengine/mock/Framebuffer.h
@@ -0,0 +1,36 @@
+/*
+ * Copyright 2018 The Android Open Source Project
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ *      http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+#pragma once
+
+#include <gmock/gmock.h>
+#include <renderengine/Framebuffer.h>
+
+namespace android {
+namespace renderengine {
+namespace mock {
+
+class Framebuffer : public renderengine::Framebuffer {
+public:
+    Framebuffer();
+    ~Framebuffer() override;
+
+    MOCK_METHOD3(setNativeWindowBuffer, bool(ANativeWindowBuffer*, bool, const bool));
+};
+
+} // namespace mock
+} // namespace renderengine
+} // namespace android
diff --git a/media/libstagefright/renderfright/include/renderengine/mock/Image.h b/media/libstagefright/renderfright/include/renderengine/mock/Image.h
new file mode 100644
index 0000000..2b0eed1
--- /dev/null
+++ b/media/libstagefright/renderfright/include/renderengine/mock/Image.h
@@ -0,0 +1,36 @@
+/*
+ * Copyright 2018 The Android Open Source Project
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ *      http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+#pragma once
+
+#include <gmock/gmock.h>
+#include <renderengine/Image.h>
+
+namespace android {
+namespace renderengine {
+namespace mock {
+
+class Image : public renderengine::Image {
+public:
+    Image();
+    ~Image() override;
+
+    MOCK_METHOD2(setNativeWindowBuffer, bool(ANativeWindowBuffer* buffer, bool isProtected));
+};
+
+} // namespace mock
+} // namespace renderengine
+} // namespace android
diff --git a/media/libstagefright/renderfright/include/renderengine/mock/RenderEngine.h b/media/libstagefright/renderfright/include/renderengine/mock/RenderEngine.h
new file mode 100644
index 0000000..e03dd58
--- /dev/null
+++ b/media/libstagefright/renderfright/include/renderengine/mock/RenderEngine.h
@@ -0,0 +1,68 @@
+/*
+ * Copyright 2018 The Android Open Source Project
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ *      http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+#pragma once
+
+#include <gmock/gmock.h>
+#include <renderengine/DisplaySettings.h>
+#include <renderengine/LayerSettings.h>
+#include <renderengine/Mesh.h>
+#include <renderengine/RenderEngine.h>
+#include <renderengine/Texture.h>
+#include <ui/Fence.h>
+#include <ui/GraphicBuffer.h>
+#include <ui/Region.h>
+
+namespace android {
+namespace renderengine {
+namespace mock {
+
+class RenderEngine : public renderengine::RenderEngine {
+public:
+    RenderEngine();
+    ~RenderEngine() override;
+
+    MOCK_METHOD0(getFramebufferForDrawing, Framebuffer*());
+    MOCK_CONST_METHOD0(primeCache, void());
+    MOCK_METHOD1(dump, void(std::string&));
+    MOCK_CONST_METHOD0(useNativeFenceSync, bool());
+    MOCK_CONST_METHOD0(useWaitSync, bool());
+    MOCK_CONST_METHOD0(isCurrent, bool());
+    MOCK_METHOD2(genTextures, void(size_t, uint32_t*));
+    MOCK_METHOD2(deleteTextures, void(size_t, uint32_t const*));
+    MOCK_METHOD2(bindExternalTextureImage, void(uint32_t, const renderengine::Image&));
+    MOCK_METHOD1(cacheExternalTextureBuffer, void(const sp<GraphicBuffer>&));
+    MOCK_METHOD3(bindExternalTextureBuffer,
+                 status_t(uint32_t, const sp<GraphicBuffer>&, const sp<Fence>&));
+    MOCK_METHOD1(unbindExternalTextureBuffer, void(uint64_t));
+    MOCK_METHOD1(bindFrameBuffer, status_t(renderengine::Framebuffer*));
+    MOCK_METHOD1(unbindFrameBuffer, void(renderengine::Framebuffer*));
+    MOCK_METHOD1(drawMesh, void(const renderengine::Mesh&));
+    MOCK_CONST_METHOD0(getMaxTextureSize, size_t());
+    MOCK_CONST_METHOD0(getMaxViewportDims, size_t());
+    MOCK_CONST_METHOD0(isProtected, bool());
+    MOCK_CONST_METHOD0(supportsProtectedContent, bool());
+    MOCK_METHOD1(useProtectedContext, bool(bool));
+    MOCK_METHOD1(cleanupPostRender, bool(CleanupMode mode));
+    MOCK_METHOD6(drawLayers,
+                 status_t(const DisplaySettings&, const std::vector<const LayerSettings*>&,
+                          const sp<GraphicBuffer>&, const bool, base::unique_fd&&,
+                          base::unique_fd*));
+};
+
+} // namespace mock
+} // namespace renderengine
+} // namespace android
diff --git a/media/libstagefright/renderfright/include/renderengine/private/Description.h b/media/libstagefright/renderfright/include/renderengine/private/Description.h
new file mode 100644
index 0000000..a62161a
--- /dev/null
+++ b/media/libstagefright/renderfright/include/renderengine/private/Description.h
@@ -0,0 +1,92 @@
+/*
+ * Copyright 2013 The Android Open Source Project
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ *      http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+#ifndef SF_RENDER_ENGINE_DESCRIPTION_H_
+#define SF_RENDER_ENGINE_DESCRIPTION_H_
+
+#include <renderengine/Texture.h>
+#include <ui/GraphicTypes.h>
+
+namespace android {
+namespace renderengine {
+
+/*
+ * This is the structure that holds the state of the rendering engine.
+ * This class is used to generate a corresponding GLSL program and set the
+ * appropriate uniform.
+ */
+struct Description {
+    enum class TransferFunction : int {
+        LINEAR,
+        SRGB,
+        ST2084,
+        HLG, // Hybrid Log-Gamma for HDR.
+    };
+
+    static TransferFunction dataSpaceToTransferFunction(ui::Dataspace dataSpace);
+
+    Description() = default;
+    ~Description() = default;
+
+    bool hasInputTransformMatrix() const;
+    bool hasOutputTransformMatrix() const;
+    bool hasColorMatrix() const;
+
+    // whether textures are premultiplied
+    bool isPremultipliedAlpha = false;
+    // whether this layer is marked as opaque
+    bool isOpaque = true;
+
+    // corner radius of the layer
+    float cornerRadius = 0;
+
+    // Size of the rounded rectangle we are cropping to
+    half2 cropSize;
+
+    // Texture this layer uses
+    Texture texture;
+    bool textureEnabled = false;
+
+    // color used when texturing is disabled or when setting alpha.
+    half4 color;
+
+    // true if the sampled pixel values are in Y410/BT2020 rather than RGBA
+    bool isY410BT2020 = false;
+
+    // transfer functions for the input/output
+    TransferFunction inputTransferFunction = TransferFunction::LINEAR;
+    TransferFunction outputTransferFunction = TransferFunction::LINEAR;
+
+    float displayMaxLuminance;
+    float maxMasteringLuminance;
+    float maxContentLuminance;
+
+    // projection matrix
+    mat4 projectionMatrix;
+
+    // The color matrix will be applied in linear space right before OETF.
+    mat4 colorMatrix;
+    mat4 inputTransformMatrix;
+    mat4 outputTransformMatrix;
+
+    // True if this layer will draw a shadow.
+    bool drawShadows = false;
+};
+
+} // namespace renderengine
+} // namespace android
+
+#endif /* SF_RENDER_ENGINE_DESCRIPTION_H_ */
diff --git a/media/libstagefright/renderfright/mock/Framebuffer.cpp b/media/libstagefright/renderfright/mock/Framebuffer.cpp
new file mode 100644
index 0000000..fbdcaab
--- /dev/null
+++ b/media/libstagefright/renderfright/mock/Framebuffer.cpp
@@ -0,0 +1,30 @@
+/*
+ * Copyright 2018 The Android Open Source Project
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ *      http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+#include <renderengine/mock/Framebuffer.h>
+
+namespace android {
+namespace renderengine {
+namespace mock {
+
+// The Google Mock documentation recommends explicit non-header instantiations
+// for better compile time performance.
+Framebuffer::Framebuffer() = default;
+Framebuffer::~Framebuffer() = default;
+
+} // namespace mock
+} // namespace renderengine
+} // namespace android
diff --git a/media/libstagefright/renderfright/mock/Image.cpp b/media/libstagefright/renderfright/mock/Image.cpp
new file mode 100644
index 0000000..57f4346
--- /dev/null
+++ b/media/libstagefright/renderfright/mock/Image.cpp
@@ -0,0 +1,30 @@
+/*
+ * Copyright 2018 The Android Open Source Project
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ *      http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+#include <renderengine/mock/Image.h>
+
+namespace android {
+namespace renderengine {
+namespace mock {
+
+// The Google Mock documentation recommends explicit non-header instantiations
+// for better compile time performance.
+Image::Image() = default;
+Image::~Image() = default;
+
+} // namespace mock
+} // namespace renderengine
+} // namespace android
diff --git a/media/libstagefright/renderfright/mock/RenderEngine.cpp b/media/libstagefright/renderfright/mock/RenderEngine.cpp
new file mode 100644
index 0000000..261636d
--- /dev/null
+++ b/media/libstagefright/renderfright/mock/RenderEngine.cpp
@@ -0,0 +1,30 @@
+/*
+ * Copyright 2018 The Android Open Source Project
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ *      http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+#include <renderengine/mock/RenderEngine.h>
+
+namespace android {
+namespace renderengine {
+namespace mock {
+
+// The Google Mock documentation recommends explicit non-header instantiations
+// for better compile time performance.
+RenderEngine::RenderEngine() = default;
+RenderEngine::~RenderEngine() = default;
+
+} // namespace mock
+} // namespace renderengine
+} // namespace android
diff --git a/media/libstagefright/renderfright/tests/Android.bp b/media/libstagefright/renderfright/tests/Android.bp
new file mode 100644
index 0000000..9fee646
--- /dev/null
+++ b/media/libstagefright/renderfright/tests/Android.bp
@@ -0,0 +1,41 @@
+// Copyright 2018 The Android Open Source Project
+//
+// Licensed under the Apache License, Version 2.0 (the "License");
+// you may not use this file except in compliance with the License.
+// You may obtain a copy of the License at
+//
+//      http://www.apache.org/licenses/LICENSE-2.0
+//
+// Unless required by applicable law or agreed to in writing, software
+// distributed under the License is distributed on an "AS IS" BASIS,
+// WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+// See the License for the specific language governing permissions and
+// limitations under the License.
+
+cc_test {
+    name: "librenderfright_test",
+    defaults: ["surfaceflinger_defaults"],
+    test_suites: ["device-tests"],
+    srcs: [
+        "RenderEngineTest.cpp",
+        "RenderEngineThreadedTest.cpp",
+    ],
+    static_libs: [
+        "libgmock",
+        "librenderfright",
+        "librenderfright_mocks",
+    ],
+    shared_libs: [
+        "libbase",
+        "libcutils",
+        "libEGL",
+        "libGLESv2",
+        "libgui",
+        "liblog",
+        "libnativewindow",
+        "libprocessgroup",
+        "libsync",
+        "libui",
+        "libutils",
+    ],
+}
diff --git a/media/libstagefright/renderfright/tests/RenderEngineTest.cpp b/media/libstagefright/renderfright/tests/RenderEngineTest.cpp
new file mode 100644
index 0000000..730f606
--- /dev/null
+++ b/media/libstagefright/renderfright/tests/RenderEngineTest.cpp
@@ -0,0 +1,1469 @@
+/*
+ * Copyright 2018 The Android Open Source Project
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ *      http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+// TODO(b/129481165): remove the #pragma below and fix conversion issues
+#pragma clang diagnostic push
+#pragma clang diagnostic ignored "-Wconversion"
+
+#include <chrono>
+#include <condition_variable>
+#include <fstream>
+
+#include <cutils/properties.h>
+#include <gtest/gtest.h>
+#include <renderengine/RenderEngine.h>
+#include <sync/sync.h>
+#include <ui/PixelFormat.h>
+#include "../gl/GLESRenderEngine.h"
+#include "../threaded/RenderEngineThreaded.h"
+
+constexpr int DEFAULT_DISPLAY_WIDTH = 128;
+constexpr int DEFAULT_DISPLAY_HEIGHT = 256;
+constexpr int DEFAULT_DISPLAY_OFFSET = 64;
+constexpr bool WRITE_BUFFER_TO_FILE_ON_FAILURE = false;
+
+namespace android {
+
+struct RenderEngineTest : public ::testing::Test {
+    static void SetUpTestSuite() {
+        sRE = renderengine::gl::GLESRenderEngine::create(
+                renderengine::RenderEngineCreationArgs::Builder()
+                        .setPixelFormat(static_cast<int>(ui::PixelFormat::RGBA_8888))
+                        .setImageCacheSize(1)
+                        .setUseColorManagerment(false)
+                        .setEnableProtectedContext(false)
+                        .setPrecacheToneMapperShaderOnly(false)
+                        .setSupportsBackgroundBlur(true)
+                        .setContextPriority(renderengine::RenderEngine::ContextPriority::MEDIUM)
+                        .setRenderEngineType(renderengine::RenderEngine::RenderEngineType::GLES)
+                        .build());
+    }
+
+    static void TearDownTestSuite() {
+        // The ordering here is important - sCurrentBuffer must live longer
+        // than RenderEngine to avoid a null reference on tear-down.
+        sRE = nullptr;
+        sCurrentBuffer = nullptr;
+    }
+
+    static sp<GraphicBuffer> allocateDefaultBuffer() {
+        return new GraphicBuffer(DEFAULT_DISPLAY_WIDTH, DEFAULT_DISPLAY_HEIGHT,
+                                 HAL_PIXEL_FORMAT_RGBA_8888, 1,
+                                 GRALLOC_USAGE_SW_READ_OFTEN | GRALLOC_USAGE_SW_WRITE_OFTEN |
+                                         GRALLOC_USAGE_HW_RENDER,
+                                 "output");
+    }
+
+    // Allocates a 1x1 buffer to fill with a solid color
+    static sp<GraphicBuffer> allocateSourceBuffer(uint32_t width, uint32_t height) {
+        return new GraphicBuffer(width, height, HAL_PIXEL_FORMAT_RGBA_8888, 1,
+                                 GRALLOC_USAGE_SW_READ_OFTEN | GRALLOC_USAGE_SW_WRITE_OFTEN |
+                                         GRALLOC_USAGE_HW_TEXTURE,
+                                 "input");
+    }
+
+    RenderEngineTest() { mBuffer = allocateDefaultBuffer(); }
+
+    ~RenderEngineTest() {
+        if (WRITE_BUFFER_TO_FILE_ON_FAILURE && ::testing::Test::HasFailure()) {
+            writeBufferToFile("/data/texture_out_");
+        }
+        for (uint32_t texName : mTexNames) {
+            sRE->deleteTextures(1, &texName);
+            EXPECT_FALSE(sRE->isTextureNameKnownForTesting(texName));
+        }
+    }
+
+    void writeBufferToFile(const char* basename) {
+        std::string filename(basename);
+        filename.append(::testing::UnitTest::GetInstance()->current_test_info()->name());
+        filename.append(".ppm");
+        std::ofstream file(filename.c_str(), std::ios::binary);
+        if (!file.is_open()) {
+            ALOGE("Unable to open file: %s", filename.c_str());
+            ALOGE("You may need to do: \"adb shell setenforce 0\" to enable "
+                  "surfaceflinger to write debug images");
+            return;
+        }
+
+        uint8_t* pixels;
+        mBuffer->lock(GRALLOC_USAGE_SW_READ_OFTEN | GRALLOC_USAGE_SW_WRITE_OFTEN,
+                      reinterpret_cast<void**>(&pixels));
+
+        file << "P6\n";
+        file << mBuffer->getWidth() << "\n";
+        file << mBuffer->getHeight() << "\n";
+        file << 255 << "\n";
+
+        std::vector<uint8_t> outBuffer(mBuffer->getWidth() * mBuffer->getHeight() * 3);
+        auto outPtr = reinterpret_cast<uint8_t*>(outBuffer.data());
+
+        for (int32_t j = 0; j < mBuffer->getHeight(); j++) {
+            const uint8_t* src = pixels + (mBuffer->getStride() * j) * 4;
+            for (int32_t i = 0; i < mBuffer->getWidth(); i++) {
+                // Only copy R, G and B components
+                outPtr[0] = src[0];
+                outPtr[1] = src[1];
+                outPtr[2] = src[2];
+                outPtr += 3;
+
+                src += 4;
+            }
+        }
+        file.write(reinterpret_cast<char*>(outBuffer.data()), outBuffer.size());
+        mBuffer->unlock();
+    }
+
+    void expectBufferColor(const Region& region, uint8_t r, uint8_t g, uint8_t b, uint8_t a) {
+        size_t c;
+        Rect const* rect = region.getArray(&c);
+        for (size_t i = 0; i < c; i++, rect++) {
+            expectBufferColor(*rect, r, g, b, a);
+        }
+    }
+
+    void expectBufferColor(const Rect& rect, uint8_t r, uint8_t g, uint8_t b, uint8_t a,
+                           uint8_t tolerance = 0) {
+        auto colorCompare = [tolerance](const uint8_t* colorA, const uint8_t* colorB) {
+            auto colorBitCompare = [tolerance](uint8_t a, uint8_t b) {
+                uint8_t tmp = a >= b ? a - b : b - a;
+                return tmp <= tolerance;
+            };
+            return std::equal(colorA, colorA + 4, colorB, colorBitCompare);
+        };
+
+        expectBufferColor(rect, r, g, b, a, colorCompare);
+    }
+
+    void expectBufferColor(const Rect& region, uint8_t r, uint8_t g, uint8_t b, uint8_t a,
+                           std::function<bool(const uint8_t* a, const uint8_t* b)> colorCompare) {
+        uint8_t* pixels;
+        mBuffer->lock(GRALLOC_USAGE_SW_READ_OFTEN | GRALLOC_USAGE_SW_WRITE_OFTEN,
+                      reinterpret_cast<void**>(&pixels));
+        int32_t maxFails = 10;
+        int32_t fails = 0;
+        for (int32_t j = 0; j < region.getHeight(); j++) {
+            const uint8_t* src =
+                    pixels + (mBuffer->getStride() * (region.top + j) + region.left) * 4;
+            for (int32_t i = 0; i < region.getWidth(); i++) {
+                const uint8_t expected[4] = {r, g, b, a};
+                bool equal = colorCompare(src, expected);
+                EXPECT_TRUE(equal)
+                        << "pixel @ (" << region.left + i << ", " << region.top + j << "): "
+                        << "expected (" << static_cast<uint32_t>(r) << ", "
+                        << static_cast<uint32_t>(g) << ", " << static_cast<uint32_t>(b) << ", "
+                        << static_cast<uint32_t>(a) << "), "
+                        << "got (" << static_cast<uint32_t>(src[0]) << ", "
+                        << static_cast<uint32_t>(src[1]) << ", " << static_cast<uint32_t>(src[2])
+                        << ", " << static_cast<uint32_t>(src[3]) << ")";
+                src += 4;
+                if (!equal && ++fails >= maxFails) {
+                    break;
+                }
+            }
+            if (fails >= maxFails) {
+                break;
+            }
+        }
+        mBuffer->unlock();
+    }
+
+    void expectAlpha(const Rect& rect, uint8_t a) {
+        auto colorCompare = [](const uint8_t* colorA, const uint8_t* colorB) {
+            return colorA[3] == colorB[3];
+        };
+        expectBufferColor(rect, 0.0f /* r */, 0.0f /*g */, 0.0f /* b */, a, colorCompare);
+    }
+
+    void expectShadowColor(const renderengine::LayerSettings& castingLayer,
+                           const renderengine::ShadowSettings& shadow, const ubyte4& casterColor,
+                           const ubyte4& backgroundColor) {
+        const Rect casterRect(castingLayer.geometry.boundaries);
+        Region casterRegion = Region(casterRect);
+        const float casterCornerRadius = castingLayer.geometry.roundedCornersRadius;
+        if (casterCornerRadius > 0.0f) {
+            // ignore the corners if a corner radius is set
+            Rect cornerRect(casterCornerRadius, casterCornerRadius);
+            casterRegion.subtractSelf(cornerRect.offsetTo(casterRect.left, casterRect.top));
+            casterRegion.subtractSelf(
+                    cornerRect.offsetTo(casterRect.right - casterCornerRadius, casterRect.top));
+            casterRegion.subtractSelf(
+                    cornerRect.offsetTo(casterRect.left, casterRect.bottom - casterCornerRadius));
+            casterRegion.subtractSelf(cornerRect.offsetTo(casterRect.right - casterCornerRadius,
+                                                          casterRect.bottom - casterCornerRadius));
+        }
+
+        const float shadowInset = shadow.length * -1.0f;
+        const Rect casterWithShadow =
+                Rect(casterRect).inset(shadowInset, shadowInset, shadowInset, shadowInset);
+        const Region shadowRegion = Region(casterWithShadow).subtractSelf(casterRect);
+        const Region backgroundRegion = Region(fullscreenRect()).subtractSelf(casterWithShadow);
+
+        // verify casting layer
+        expectBufferColor(casterRegion, casterColor.r, casterColor.g, casterColor.b, casterColor.a);
+
+        // verify shadows by testing just the alpha since its difficult to validate the shadow color
+        size_t c;
+        Rect const* r = shadowRegion.getArray(&c);
+        for (size_t i = 0; i < c; i++, r++) {
+            expectAlpha(*r, 255);
+        }
+
+        // verify background
+        expectBufferColor(backgroundRegion, backgroundColor.r, backgroundColor.g, backgroundColor.b,
+                          backgroundColor.a);
+    }
+
+    static renderengine::ShadowSettings getShadowSettings(const vec2& casterPos, float shadowLength,
+                                                          bool casterIsTranslucent) {
+        renderengine::ShadowSettings shadow;
+        shadow.ambientColor = {0.0f, 0.0f, 0.0f, 0.039f};
+        shadow.spotColor = {0.0f, 0.0f, 0.0f, 0.19f};
+        shadow.lightPos = vec3(casterPos.x, casterPos.y, 0);
+        shadow.lightRadius = 0.0f;
+        shadow.length = shadowLength;
+        shadow.casterIsTranslucent = casterIsTranslucent;
+        return shadow;
+    }
+
+    static Rect fullscreenRect() { return Rect(DEFAULT_DISPLAY_WIDTH, DEFAULT_DISPLAY_HEIGHT); }
+
+    static Rect offsetRect() {
+        return Rect(DEFAULT_DISPLAY_OFFSET, DEFAULT_DISPLAY_OFFSET, DEFAULT_DISPLAY_WIDTH,
+                    DEFAULT_DISPLAY_HEIGHT);
+    }
+
+    static Rect offsetRectAtZero() {
+        return Rect(DEFAULT_DISPLAY_WIDTH - DEFAULT_DISPLAY_OFFSET,
+                    DEFAULT_DISPLAY_HEIGHT - DEFAULT_DISPLAY_OFFSET);
+    }
+
+    void invokeDraw(renderengine::DisplaySettings settings,
+                    std::vector<const renderengine::LayerSettings*> layers,
+                    sp<GraphicBuffer> buffer) {
+        base::unique_fd fence;
+        status_t status =
+                sRE->drawLayers(settings, layers, buffer, true, base::unique_fd(), &fence);
+        sCurrentBuffer = buffer;
+
+        int fd = fence.release();
+        if (fd >= 0) {
+            sync_wait(fd, -1);
+            close(fd);
+        }
+
+        ASSERT_EQ(NO_ERROR, status);
+        if (layers.size() > 0) {
+            ASSERT_TRUE(sRE->isFramebufferImageCachedForTesting(buffer->getId()));
+        }
+    }
+
+    void drawEmptyLayers() {
+        renderengine::DisplaySettings settings;
+        std::vector<const renderengine::LayerSettings*> layers;
+        // Meaningless buffer since we don't do any drawing
+        sp<GraphicBuffer> buffer = new GraphicBuffer();
+        invokeDraw(settings, layers, buffer);
+    }
+
+    template <typename SourceVariant>
+    void fillBuffer(half r, half g, half b, half a);
+
+    template <typename SourceVariant>
+    void fillRedBuffer();
+
+    template <typename SourceVariant>
+    void fillGreenBuffer();
+
+    template <typename SourceVariant>
+    void fillBlueBuffer();
+
+    template <typename SourceVariant>
+    void fillRedTransparentBuffer();
+
+    template <typename SourceVariant>
+    void fillRedOffsetBuffer();
+
+    template <typename SourceVariant>
+    void fillBufferPhysicalOffset();
+
+    template <typename SourceVariant>
+    void fillBufferCheckers(uint32_t rotation);
+
+    template <typename SourceVariant>
+    void fillBufferCheckersRotate0();
+
+    template <typename SourceVariant>
+    void fillBufferCheckersRotate90();
+
+    template <typename SourceVariant>
+    void fillBufferCheckersRotate180();
+
+    template <typename SourceVariant>
+    void fillBufferCheckersRotate270();
+
+    template <typename SourceVariant>
+    void fillBufferWithLayerTransform();
+
+    template <typename SourceVariant>
+    void fillBufferLayerTransform();
+
+    template <typename SourceVariant>
+    void fillBufferWithColorTransform();
+
+    template <typename SourceVariant>
+    void fillBufferColorTransform();
+
+    template <typename SourceVariant>
+    void fillRedBufferWithRoundedCorners();
+
+    template <typename SourceVariant>
+    void fillBufferWithRoundedCorners();
+
+    template <typename SourceVariant>
+    void fillBufferAndBlurBackground();
+
+    template <typename SourceVariant>
+    void overlayCorners();
+
+    void fillRedBufferTextureTransform();
+
+    void fillBufferTextureTransform();
+
+    void fillRedBufferWithPremultiplyAlpha();
+
+    void fillBufferWithPremultiplyAlpha();
+
+    void fillRedBufferWithoutPremultiplyAlpha();
+
+    void fillBufferWithoutPremultiplyAlpha();
+
+    void fillGreenColorBufferThenClearRegion();
+
+    void clearLeftRegion();
+
+    void clearRegion();
+
+    template <typename SourceVariant>
+    void drawShadow(const renderengine::LayerSettings& castingLayer,
+                    const renderengine::ShadowSettings& shadow, const ubyte4& casterColor,
+                    const ubyte4& backgroundColor);
+
+    // Keep around the same renderengine object to save on initialization time.
+    // For now, exercise the GL backend directly so that some caching specifics
+    // can be tested without changing the interface.
+    static std::unique_ptr<renderengine::gl::GLESRenderEngine> sRE;
+    // Hack to avoid NPE in the EGL driver: the GraphicBuffer needs to
+    // be freed *after* RenderEngine is destroyed, so that the EGL image is
+    // destroyed first.
+    static sp<GraphicBuffer> sCurrentBuffer;
+
+    sp<GraphicBuffer> mBuffer;
+
+    std::vector<uint32_t> mTexNames;
+};
+
+std::unique_ptr<renderengine::gl::GLESRenderEngine> RenderEngineTest::sRE = nullptr;
+sp<GraphicBuffer> RenderEngineTest::sCurrentBuffer = nullptr;
+
+struct ColorSourceVariant {
+    static void fillColor(renderengine::LayerSettings& layer, half r, half g, half b,
+                          RenderEngineTest* /*fixture*/) {
+        layer.source.solidColor = half3(r, g, b);
+    }
+};
+
+struct RelaxOpaqueBufferVariant {
+    static void setOpaqueBit(renderengine::LayerSettings& layer) {
+        layer.source.buffer.isOpaque = false;
+    }
+
+    static uint8_t getAlphaChannel() { return 255; }
+};
+
+struct ForceOpaqueBufferVariant {
+    static void setOpaqueBit(renderengine::LayerSettings& layer) {
+        layer.source.buffer.isOpaque = true;
+    }
+
+    static uint8_t getAlphaChannel() {
+        // The isOpaque bit will override the alpha channel, so this should be
+        // arbitrary.
+        return 10;
+    }
+};
+
+template <typename OpaquenessVariant>
+struct BufferSourceVariant {
+    static void fillColor(renderengine::LayerSettings& layer, half r, half g, half b,
+                          RenderEngineTest* fixture) {
+        sp<GraphicBuffer> buf = RenderEngineTest::allocateSourceBuffer(1, 1);
+        uint32_t texName;
+        fixture->sRE->genTextures(1, &texName);
+        fixture->mTexNames.push_back(texName);
+
+        uint8_t* pixels;
+        buf->lock(GRALLOC_USAGE_SW_READ_OFTEN | GRALLOC_USAGE_SW_WRITE_OFTEN,
+                  reinterpret_cast<void**>(&pixels));
+
+        for (int32_t j = 0; j < buf->getHeight(); j++) {
+            uint8_t* iter = pixels + (buf->getStride() * j) * 4;
+            for (int32_t i = 0; i < buf->getWidth(); i++) {
+                iter[0] = uint8_t(r * 255);
+                iter[1] = uint8_t(g * 255);
+                iter[2] = uint8_t(b * 255);
+                iter[3] = OpaquenessVariant::getAlphaChannel();
+                iter += 4;
+            }
+        }
+
+        buf->unlock();
+
+        layer.source.buffer.buffer = buf;
+        layer.source.buffer.textureName = texName;
+        OpaquenessVariant::setOpaqueBit(layer);
+    }
+};
+
+template <typename SourceVariant>
+void RenderEngineTest::fillBuffer(half r, half g, half b, half a) {
+    renderengine::DisplaySettings settings;
+    settings.physicalDisplay = fullscreenRect();
+    settings.clip = fullscreenRect();
+
+    std::vector<const renderengine::LayerSettings*> layers;
+
+    renderengine::LayerSettings layer;
+    layer.geometry.boundaries = fullscreenRect().toFloatRect();
+    SourceVariant::fillColor(layer, r, g, b, this);
+    layer.alpha = a;
+
+    layers.push_back(&layer);
+
+    invokeDraw(settings, layers, mBuffer);
+}
+
+template <typename SourceVariant>
+void RenderEngineTest::fillRedBuffer() {
+    fillBuffer<SourceVariant>(1.0f, 0.0f, 0.0f, 1.0f);
+    expectBufferColor(fullscreenRect(), 255, 0, 0, 255);
+}
+
+template <typename SourceVariant>
+void RenderEngineTest::fillGreenBuffer() {
+    fillBuffer<SourceVariant>(0.0f, 1.0f, 0.0f, 1.0f);
+    expectBufferColor(fullscreenRect(), 0, 255, 0, 255);
+}
+
+template <typename SourceVariant>
+void RenderEngineTest::fillBlueBuffer() {
+    fillBuffer<SourceVariant>(0.0f, 0.0f, 1.0f, 1.0f);
+    expectBufferColor(fullscreenRect(), 0, 0, 255, 255);
+}
+
+template <typename SourceVariant>
+void RenderEngineTest::fillRedTransparentBuffer() {
+    fillBuffer<SourceVariant>(1.0f, 0.0f, 0.0f, .2f);
+    expectBufferColor(fullscreenRect(), 51, 0, 0, 51);
+}
+
+template <typename SourceVariant>
+void RenderEngineTest::fillRedOffsetBuffer() {
+    renderengine::DisplaySettings settings;
+    settings.physicalDisplay = offsetRect();
+    settings.clip = offsetRectAtZero();
+
+    std::vector<const renderengine::LayerSettings*> layers;
+
+    renderengine::LayerSettings layer;
+    layer.geometry.boundaries = offsetRectAtZero().toFloatRect();
+    SourceVariant::fillColor(layer, 1.0f, 0.0f, 0.0f, this);
+    layer.alpha = 1.0f;
+
+    layers.push_back(&layer);
+    invokeDraw(settings, layers, mBuffer);
+}
+
+template <typename SourceVariant>
+void RenderEngineTest::fillBufferPhysicalOffset() {
+    fillRedOffsetBuffer<SourceVariant>();
+
+    expectBufferColor(Rect(DEFAULT_DISPLAY_OFFSET, DEFAULT_DISPLAY_OFFSET, DEFAULT_DISPLAY_WIDTH,
+                           DEFAULT_DISPLAY_HEIGHT),
+                      255, 0, 0, 255);
+    Rect offsetRegionLeft(DEFAULT_DISPLAY_OFFSET, DEFAULT_DISPLAY_HEIGHT);
+    Rect offsetRegionTop(DEFAULT_DISPLAY_WIDTH, DEFAULT_DISPLAY_OFFSET);
+
+    expectBufferColor(offsetRegionLeft, 0, 0, 0, 0);
+    expectBufferColor(offsetRegionTop, 0, 0, 0, 0);
+}
+
+template <typename SourceVariant>
+void RenderEngineTest::fillBufferCheckers(uint32_t orientationFlag) {
+    renderengine::DisplaySettings settings;
+    settings.physicalDisplay = fullscreenRect();
+    // Here logical space is 2x2
+    settings.clip = Rect(2, 2);
+    settings.orientation = orientationFlag;
+
+    std::vector<const renderengine::LayerSettings*> layers;
+
+    renderengine::LayerSettings layerOne;
+    Rect rectOne(0, 0, 1, 1);
+    layerOne.geometry.boundaries = rectOne.toFloatRect();
+    SourceVariant::fillColor(layerOne, 1.0f, 0.0f, 0.0f, this);
+    layerOne.alpha = 1.0f;
+
+    renderengine::LayerSettings layerTwo;
+    Rect rectTwo(0, 1, 1, 2);
+    layerTwo.geometry.boundaries = rectTwo.toFloatRect();
+    SourceVariant::fillColor(layerTwo, 0.0f, 1.0f, 0.0f, this);
+    layerTwo.alpha = 1.0f;
+
+    renderengine::LayerSettings layerThree;
+    Rect rectThree(1, 0, 2, 1);
+    layerThree.geometry.boundaries = rectThree.toFloatRect();
+    SourceVariant::fillColor(layerThree, 0.0f, 0.0f, 1.0f, this);
+    layerThree.alpha = 1.0f;
+
+    layers.push_back(&layerOne);
+    layers.push_back(&layerTwo);
+    layers.push_back(&layerThree);
+
+    invokeDraw(settings, layers, mBuffer);
+}
+
+template <typename SourceVariant>
+void RenderEngineTest::fillBufferCheckersRotate0() {
+    fillBufferCheckers<SourceVariant>(ui::Transform::ROT_0);
+    expectBufferColor(Rect(0, 0, DEFAULT_DISPLAY_WIDTH / 2, DEFAULT_DISPLAY_HEIGHT / 2), 255, 0, 0,
+                      255);
+    expectBufferColor(Rect(DEFAULT_DISPLAY_WIDTH / 2, 0, DEFAULT_DISPLAY_WIDTH,
+                           DEFAULT_DISPLAY_HEIGHT / 2),
+                      0, 0, 255, 255);
+    expectBufferColor(Rect(DEFAULT_DISPLAY_WIDTH / 2, DEFAULT_DISPLAY_HEIGHT / 2,
+                           DEFAULT_DISPLAY_WIDTH, DEFAULT_DISPLAY_HEIGHT),
+                      0, 0, 0, 0);
+    expectBufferColor(Rect(0, DEFAULT_DISPLAY_HEIGHT / 2, DEFAULT_DISPLAY_WIDTH / 2,
+                           DEFAULT_DISPLAY_HEIGHT),
+                      0, 255, 0, 255);
+}
+
+template <typename SourceVariant>
+void RenderEngineTest::fillBufferCheckersRotate90() {
+    fillBufferCheckers<SourceVariant>(ui::Transform::ROT_90);
+    expectBufferColor(Rect(0, 0, DEFAULT_DISPLAY_WIDTH / 2, DEFAULT_DISPLAY_HEIGHT / 2), 0, 255, 0,
+                      255);
+    expectBufferColor(Rect(DEFAULT_DISPLAY_WIDTH / 2, 0, DEFAULT_DISPLAY_WIDTH,
+                           DEFAULT_DISPLAY_HEIGHT / 2),
+                      255, 0, 0, 255);
+    expectBufferColor(Rect(DEFAULT_DISPLAY_WIDTH / 2, DEFAULT_DISPLAY_HEIGHT / 2,
+                           DEFAULT_DISPLAY_WIDTH, DEFAULT_DISPLAY_HEIGHT),
+                      0, 0, 255, 255);
+    expectBufferColor(Rect(0, DEFAULT_DISPLAY_HEIGHT / 2, DEFAULT_DISPLAY_WIDTH / 2,
+                           DEFAULT_DISPLAY_HEIGHT),
+                      0, 0, 0, 0);
+}
+
+template <typename SourceVariant>
+void RenderEngineTest::fillBufferCheckersRotate180() {
+    fillBufferCheckers<SourceVariant>(ui::Transform::ROT_180);
+    expectBufferColor(Rect(0, 0, DEFAULT_DISPLAY_WIDTH / 2, DEFAULT_DISPLAY_HEIGHT / 2), 0, 0, 0,
+                      0);
+    expectBufferColor(Rect(DEFAULT_DISPLAY_WIDTH / 2, 0, DEFAULT_DISPLAY_WIDTH,
+                           DEFAULT_DISPLAY_HEIGHT / 2),
+                      0, 255, 0, 255);
+    expectBufferColor(Rect(DEFAULT_DISPLAY_WIDTH / 2, DEFAULT_DISPLAY_HEIGHT / 2,
+                           DEFAULT_DISPLAY_WIDTH, DEFAULT_DISPLAY_HEIGHT),
+                      255, 0, 0, 255);
+    expectBufferColor(Rect(0, DEFAULT_DISPLAY_HEIGHT / 2, DEFAULT_DISPLAY_WIDTH / 2,
+                           DEFAULT_DISPLAY_HEIGHT),
+                      0, 0, 255, 255);
+}
+
+template <typename SourceVariant>
+void RenderEngineTest::fillBufferCheckersRotate270() {
+    fillBufferCheckers<SourceVariant>(ui::Transform::ROT_270);
+    expectBufferColor(Rect(0, 0, DEFAULT_DISPLAY_WIDTH / 2, DEFAULT_DISPLAY_HEIGHT / 2), 0, 0, 255,
+                      255);
+    expectBufferColor(Rect(DEFAULT_DISPLAY_WIDTH / 2, 0, DEFAULT_DISPLAY_WIDTH,
+                           DEFAULT_DISPLAY_HEIGHT / 2),
+                      0, 0, 0, 0);
+    expectBufferColor(Rect(DEFAULT_DISPLAY_WIDTH / 2, DEFAULT_DISPLAY_HEIGHT / 2,
+                           DEFAULT_DISPLAY_WIDTH, DEFAULT_DISPLAY_HEIGHT),
+                      0, 255, 0, 255);
+    expectBufferColor(Rect(0, DEFAULT_DISPLAY_HEIGHT / 2, DEFAULT_DISPLAY_WIDTH / 2,
+                           DEFAULT_DISPLAY_HEIGHT),
+                      255, 0, 0, 255);
+}
+
+template <typename SourceVariant>
+void RenderEngineTest::fillBufferWithLayerTransform() {
+    renderengine::DisplaySettings settings;
+    settings.physicalDisplay = fullscreenRect();
+    // Here logical space is 2x2
+    settings.clip = Rect(2, 2);
+
+    std::vector<const renderengine::LayerSettings*> layers;
+
+    renderengine::LayerSettings layer;
+    layer.geometry.boundaries = Rect(1, 1).toFloatRect();
+    // Translate one pixel diagonally
+    layer.geometry.positionTransform = mat4(1, 0, 0, 0, 0, 1, 0, 0, 0, 0, 1, 0, 1, 1, 0, 1);
+    SourceVariant::fillColor(layer, 1.0f, 0.0f, 0.0f, this);
+    layer.source.solidColor = half3(1.0f, 0.0f, 0.0f);
+    layer.alpha = 1.0f;
+
+    layers.push_back(&layer);
+
+    invokeDraw(settings, layers, mBuffer);
+}
+
+template <typename SourceVariant>
+void RenderEngineTest::fillBufferLayerTransform() {
+    fillBufferWithLayerTransform<SourceVariant>();
+    expectBufferColor(Rect(0, 0, DEFAULT_DISPLAY_WIDTH, DEFAULT_DISPLAY_HEIGHT / 2), 0, 0, 0, 0);
+    expectBufferColor(Rect(0, 0, DEFAULT_DISPLAY_WIDTH / 2, DEFAULT_DISPLAY_HEIGHT), 0, 0, 0, 0);
+    expectBufferColor(Rect(DEFAULT_DISPLAY_WIDTH / 2, DEFAULT_DISPLAY_HEIGHT / 2,
+                           DEFAULT_DISPLAY_WIDTH, DEFAULT_DISPLAY_HEIGHT),
+                      255, 0, 0, 255);
+}
+
+template <typename SourceVariant>
+void RenderEngineTest::fillBufferWithColorTransform() {
+    renderengine::DisplaySettings settings;
+    settings.physicalDisplay = fullscreenRect();
+    settings.clip = Rect(1, 1);
+
+    std::vector<const renderengine::LayerSettings*> layers;
+
+    renderengine::LayerSettings layer;
+    layer.geometry.boundaries = Rect(1, 1).toFloatRect();
+    SourceVariant::fillColor(layer, 0.5f, 0.25f, 0.125f, this);
+    layer.alpha = 1.0f;
+
+    // construct a fake color matrix
+    // annihilate green and blue channels
+    settings.colorTransform = mat4::scale(vec4(1, 0, 0, 1));
+    // set red channel to red + green
+    layer.colorTransform = mat4(1, 0, 0, 0, 1, 1, 0, 0, 0, 0, 1, 0, 0, 0, 0, 1);
+
+    layer.alpha = 1.0f;
+    layer.geometry.boundaries = Rect(1, 1).toFloatRect();
+
+    layers.push_back(&layer);
+
+    invokeDraw(settings, layers, mBuffer);
+}
+
+template <typename SourceVariant>
+void RenderEngineTest::fillBufferColorTransform() {
+    fillBufferWithColorTransform<SourceVariant>();
+    expectBufferColor(fullscreenRect(), 191, 0, 0, 255);
+}
+
+template <typename SourceVariant>
+void RenderEngineTest::fillRedBufferWithRoundedCorners() {
+    renderengine::DisplaySettings settings;
+    settings.physicalDisplay = fullscreenRect();
+    settings.clip = fullscreenRect();
+
+    std::vector<const renderengine::LayerSettings*> layers;
+
+    renderengine::LayerSettings layer;
+    layer.geometry.boundaries = fullscreenRect().toFloatRect();
+    layer.geometry.roundedCornersRadius = 5.0f;
+    layer.geometry.roundedCornersCrop = fullscreenRect().toFloatRect();
+    SourceVariant::fillColor(layer, 1.0f, 0.0f, 0.0f, this);
+    layer.alpha = 1.0f;
+
+    layers.push_back(&layer);
+
+    invokeDraw(settings, layers, mBuffer);
+}
+
+template <typename SourceVariant>
+void RenderEngineTest::fillBufferWithRoundedCorners() {
+    fillRedBufferWithRoundedCorners<SourceVariant>();
+    // Corners should be ignored...
+    expectBufferColor(Rect(0, 0, 1, 1), 0, 0, 0, 0);
+    expectBufferColor(Rect(DEFAULT_DISPLAY_WIDTH - 1, 0, DEFAULT_DISPLAY_WIDTH, 1), 0, 0, 0, 0);
+    expectBufferColor(Rect(0, DEFAULT_DISPLAY_HEIGHT - 1, 1, DEFAULT_DISPLAY_HEIGHT), 0, 0, 0, 0);
+    expectBufferColor(Rect(DEFAULT_DISPLAY_WIDTH - 1, DEFAULT_DISPLAY_HEIGHT - 1,
+                           DEFAULT_DISPLAY_WIDTH, DEFAULT_DISPLAY_HEIGHT),
+                      0, 0, 0, 0);
+    // ...And the non-rounded portion should be red.
+    // Other pixels may be anti-aliased, so let's not check those.
+    expectBufferColor(Rect(5, 5, DEFAULT_DISPLAY_WIDTH - 5, DEFAULT_DISPLAY_HEIGHT - 5), 255, 0, 0,
+                      255);
+}
+
+template <typename SourceVariant>
+void RenderEngineTest::fillBufferAndBlurBackground() {
+        char value[PROPERTY_VALUE_MAX];
+    property_get("ro.surface_flinger.supports_background_blur", value, "0");
+    if (!atoi(value)) {
+        // This device doesn't support blurs, no-op.
+        return;
+    }
+
+    auto blurRadius = 50;
+    auto center = DEFAULT_DISPLAY_WIDTH / 2;
+
+    renderengine::DisplaySettings settings;
+    settings.physicalDisplay = fullscreenRect();
+    settings.clip = fullscreenRect();
+
+    std::vector<const renderengine::LayerSettings*> layers;
+
+    renderengine::LayerSettings backgroundLayer;
+    backgroundLayer.geometry.boundaries = fullscreenRect().toFloatRect();
+    SourceVariant::fillColor(backgroundLayer, 0.0f, 1.0f, 0.0f, this);
+    backgroundLayer.alpha = 1.0f;
+    layers.push_back(&backgroundLayer);
+
+    renderengine::LayerSettings leftLayer;
+    leftLayer.geometry.boundaries =
+            Rect(DEFAULT_DISPLAY_WIDTH / 2, DEFAULT_DISPLAY_HEIGHT).toFloatRect();
+    SourceVariant::fillColor(leftLayer, 1.0f, 0.0f, 0.0f, this);
+    leftLayer.alpha = 1.0f;
+    layers.push_back(&leftLayer);
+
+    renderengine::LayerSettings blurLayer;
+    blurLayer.geometry.boundaries = fullscreenRect().toFloatRect();
+    blurLayer.backgroundBlurRadius = blurRadius;
+    blurLayer.alpha = 0;
+    layers.push_back(&blurLayer);
+
+    invokeDraw(settings, layers, mBuffer);
+
+    expectBufferColor(Rect(center - 1, center - 5, center, center + 5), 150, 150, 0, 255,
+                      50 /* tolerance */);
+    expectBufferColor(Rect(center, center - 5, center + 1, center + 5), 150, 150, 0, 255,
+                      50 /* tolerance */);
+}
+
+template <typename SourceVariant>
+void RenderEngineTest::overlayCorners() {
+    renderengine::DisplaySettings settings;
+    settings.physicalDisplay = fullscreenRect();
+    settings.clip = fullscreenRect();
+
+    std::vector<const renderengine::LayerSettings*> layersFirst;
+
+    renderengine::LayerSettings layerOne;
+    layerOne.geometry.boundaries =
+            FloatRect(0, 0, DEFAULT_DISPLAY_WIDTH / 3.0, DEFAULT_DISPLAY_HEIGHT / 3.0);
+    SourceVariant::fillColor(layerOne, 1.0f, 0.0f, 0.0f, this);
+    layerOne.alpha = 0.2;
+
+    layersFirst.push_back(&layerOne);
+    invokeDraw(settings, layersFirst, mBuffer);
+    expectBufferColor(Rect(DEFAULT_DISPLAY_WIDTH / 3, DEFAULT_DISPLAY_HEIGHT / 3), 51, 0, 0, 51);
+    expectBufferColor(Rect(DEFAULT_DISPLAY_WIDTH / 3 + 1, DEFAULT_DISPLAY_HEIGHT / 3 + 1,
+                           DEFAULT_DISPLAY_WIDTH, DEFAULT_DISPLAY_HEIGHT),
+                      0, 0, 0, 0);
+
+    std::vector<const renderengine::LayerSettings*> layersSecond;
+    renderengine::LayerSettings layerTwo;
+    layerTwo.geometry.boundaries =
+            FloatRect(DEFAULT_DISPLAY_WIDTH / 3.0, DEFAULT_DISPLAY_HEIGHT / 3.0,
+                      DEFAULT_DISPLAY_WIDTH, DEFAULT_DISPLAY_HEIGHT);
+    SourceVariant::fillColor(layerTwo, 0.0f, 1.0f, 0.0f, this);
+    layerTwo.alpha = 1.0f;
+
+    layersSecond.push_back(&layerTwo);
+    invokeDraw(settings, layersSecond, mBuffer);
+
+    expectBufferColor(Rect(DEFAULT_DISPLAY_WIDTH / 3, DEFAULT_DISPLAY_HEIGHT / 3), 0, 0, 0, 0);
+    expectBufferColor(Rect(DEFAULT_DISPLAY_WIDTH / 3 + 1, DEFAULT_DISPLAY_HEIGHT / 3 + 1,
+                           DEFAULT_DISPLAY_WIDTH, DEFAULT_DISPLAY_HEIGHT),
+                      0, 255, 0, 255);
+}
+
+void RenderEngineTest::fillRedBufferTextureTransform() {
+    renderengine::DisplaySettings settings;
+    settings.physicalDisplay = fullscreenRect();
+    settings.clip = Rect(1, 1);
+
+    std::vector<const renderengine::LayerSettings*> layers;
+
+    renderengine::LayerSettings layer;
+    // Here will allocate a checker board texture, but transform texture
+    // coordinates so that only the upper left is applied.
+    sp<GraphicBuffer> buf = allocateSourceBuffer(2, 2);
+    uint32_t texName;
+    RenderEngineTest::sRE->genTextures(1, &texName);
+    this->mTexNames.push_back(texName);
+
+    uint8_t* pixels;
+    buf->lock(GRALLOC_USAGE_SW_READ_OFTEN | GRALLOC_USAGE_SW_WRITE_OFTEN,
+              reinterpret_cast<void**>(&pixels));
+    // Red top left, Green top right, Blue bottom left, Black bottom right
+    pixels[0] = 255;
+    pixels[1] = 0;
+    pixels[2] = 0;
+    pixels[3] = 255;
+    pixels[4] = 0;
+    pixels[5] = 255;
+    pixels[6] = 0;
+    pixels[7] = 255;
+    pixels[8] = 0;
+    pixels[9] = 0;
+    pixels[10] = 255;
+    pixels[11] = 255;
+    buf->unlock();
+
+    layer.source.buffer.buffer = buf;
+    layer.source.buffer.textureName = texName;
+    // Transform coordinates to only be inside the red quadrant.
+    layer.source.buffer.textureTransform = mat4::scale(vec4(0.2, 0.2, 1, 1));
+    layer.alpha = 1.0f;
+    layer.geometry.boundaries = Rect(1, 1).toFloatRect();
+
+    layers.push_back(&layer);
+
+    invokeDraw(settings, layers, mBuffer);
+}
+
+void RenderEngineTest::fillBufferTextureTransform() {
+    fillRedBufferTextureTransform();
+    expectBufferColor(fullscreenRect(), 255, 0, 0, 255);
+}
+
+void RenderEngineTest::fillRedBufferWithPremultiplyAlpha() {
+    renderengine::DisplaySettings settings;
+    settings.physicalDisplay = fullscreenRect();
+    // Here logical space is 1x1
+    settings.clip = Rect(1, 1);
+
+    std::vector<const renderengine::LayerSettings*> layers;
+
+    renderengine::LayerSettings layer;
+    sp<GraphicBuffer> buf = allocateSourceBuffer(1, 1);
+    uint32_t texName;
+    RenderEngineTest::sRE->genTextures(1, &texName);
+    this->mTexNames.push_back(texName);
+
+    uint8_t* pixels;
+    buf->lock(GRALLOC_USAGE_SW_READ_OFTEN | GRALLOC_USAGE_SW_WRITE_OFTEN,
+              reinterpret_cast<void**>(&pixels));
+    pixels[0] = 255;
+    pixels[1] = 0;
+    pixels[2] = 0;
+    pixels[3] = 255;
+    buf->unlock();
+
+    layer.source.buffer.buffer = buf;
+    layer.source.buffer.textureName = texName;
+    layer.source.buffer.usePremultipliedAlpha = true;
+    layer.alpha = 0.5f;
+    layer.geometry.boundaries = Rect(1, 1).toFloatRect();
+
+    layers.push_back(&layer);
+
+    invokeDraw(settings, layers, mBuffer);
+}
+
+void RenderEngineTest::fillBufferWithPremultiplyAlpha() {
+    fillRedBufferWithPremultiplyAlpha();
+    expectBufferColor(fullscreenRect(), 128, 0, 0, 128);
+}
+
+void RenderEngineTest::fillRedBufferWithoutPremultiplyAlpha() {
+    renderengine::DisplaySettings settings;
+    settings.physicalDisplay = fullscreenRect();
+    // Here logical space is 1x1
+    settings.clip = Rect(1, 1);
+
+    std::vector<const renderengine::LayerSettings*> layers;
+
+    renderengine::LayerSettings layer;
+    sp<GraphicBuffer> buf = allocateSourceBuffer(1, 1);
+    uint32_t texName;
+    RenderEngineTest::sRE->genTextures(1, &texName);
+    this->mTexNames.push_back(texName);
+
+    uint8_t* pixels;
+    buf->lock(GRALLOC_USAGE_SW_READ_OFTEN | GRALLOC_USAGE_SW_WRITE_OFTEN,
+              reinterpret_cast<void**>(&pixels));
+    pixels[0] = 255;
+    pixels[1] = 0;
+    pixels[2] = 0;
+    pixels[3] = 255;
+    buf->unlock();
+
+    layer.source.buffer.buffer = buf;
+    layer.source.buffer.textureName = texName;
+    layer.source.buffer.usePremultipliedAlpha = false;
+    layer.alpha = 0.5f;
+    layer.geometry.boundaries = Rect(1, 1).toFloatRect();
+
+    layers.push_back(&layer);
+
+    invokeDraw(settings, layers, mBuffer);
+}
+
+void RenderEngineTest::fillBufferWithoutPremultiplyAlpha() {
+    fillRedBufferWithoutPremultiplyAlpha();
+    expectBufferColor(fullscreenRect(), 128, 0, 0, 64, 1);
+}
+
+void RenderEngineTest::clearLeftRegion() {
+    renderengine::DisplaySettings settings;
+    settings.physicalDisplay = fullscreenRect();
+    // Here logical space is 4x4
+    settings.clip = Rect(4, 4);
+    settings.clearRegion = Region(Rect(2, 4));
+    std::vector<const renderengine::LayerSettings*> layers;
+    // fake layer, without bounds should not render anything
+    renderengine::LayerSettings layer;
+    layers.push_back(&layer);
+    invokeDraw(settings, layers, mBuffer);
+}
+
+void RenderEngineTest::clearRegion() {
+    // Reuse mBuffer
+    clearLeftRegion();
+    expectBufferColor(Rect(DEFAULT_DISPLAY_WIDTH / 2, DEFAULT_DISPLAY_HEIGHT), 0, 0, 0, 255);
+    expectBufferColor(Rect(DEFAULT_DISPLAY_WIDTH / 2, 0, DEFAULT_DISPLAY_WIDTH,
+                           DEFAULT_DISPLAY_HEIGHT),
+                      0, 0, 0, 0);
+}
+
+template <typename SourceVariant>
+void RenderEngineTest::drawShadow(const renderengine::LayerSettings& castingLayer,
+                                  const renderengine::ShadowSettings& shadow,
+                                  const ubyte4& casterColor, const ubyte4& backgroundColor) {
+    renderengine::DisplaySettings settings;
+    settings.physicalDisplay = fullscreenRect();
+    settings.clip = fullscreenRect();
+
+    std::vector<const renderengine::LayerSettings*> layers;
+
+    // add background layer
+    renderengine::LayerSettings bgLayer;
+    bgLayer.geometry.boundaries = fullscreenRect().toFloatRect();
+    ColorSourceVariant::fillColor(bgLayer, backgroundColor.r / 255.0f, backgroundColor.g / 255.0f,
+                                  backgroundColor.b / 255.0f, this);
+    bgLayer.alpha = backgroundColor.a / 255.0f;
+    layers.push_back(&bgLayer);
+
+    // add shadow layer
+    renderengine::LayerSettings shadowLayer;
+    shadowLayer.geometry.boundaries = castingLayer.geometry.boundaries;
+    shadowLayer.alpha = castingLayer.alpha;
+    shadowLayer.shadow = shadow;
+    layers.push_back(&shadowLayer);
+
+    // add layer casting the shadow
+    renderengine::LayerSettings layer = castingLayer;
+    SourceVariant::fillColor(layer, casterColor.r / 255.0f, casterColor.g / 255.0f,
+                             casterColor.b / 255.0f, this);
+    layers.push_back(&layer);
+
+    invokeDraw(settings, layers, mBuffer);
+}
+
+TEST_F(RenderEngineTest, drawLayers_noLayersToDraw) {
+    drawEmptyLayers();
+}
+
+TEST_F(RenderEngineTest, drawLayers_nullOutputBuffer) {
+    renderengine::DisplaySettings settings;
+    std::vector<const renderengine::LayerSettings*> layers;
+    renderengine::LayerSettings layer;
+    layer.geometry.boundaries = fullscreenRect().toFloatRect();
+    BufferSourceVariant<ForceOpaqueBufferVariant>::fillColor(layer, 1.0f, 0.0f, 0.0f, this);
+    layers.push_back(&layer);
+    base::unique_fd fence;
+    status_t status = sRE->drawLayers(settings, layers, nullptr, true, base::unique_fd(), &fence);
+
+    ASSERT_EQ(BAD_VALUE, status);
+}
+
+TEST_F(RenderEngineTest, drawLayers_nullOutputFence) {
+    renderengine::DisplaySettings settings;
+    settings.physicalDisplay = fullscreenRect();
+    settings.clip = fullscreenRect();
+
+    std::vector<const renderengine::LayerSettings*> layers;
+    renderengine::LayerSettings layer;
+    layer.geometry.boundaries = fullscreenRect().toFloatRect();
+    BufferSourceVariant<ForceOpaqueBufferVariant>::fillColor(layer, 1.0f, 0.0f, 0.0f, this);
+    layer.alpha = 1.0;
+    layers.push_back(&layer);
+
+    status_t status = sRE->drawLayers(settings, layers, mBuffer, true, base::unique_fd(), nullptr);
+    sCurrentBuffer = mBuffer;
+    ASSERT_EQ(NO_ERROR, status);
+    expectBufferColor(fullscreenRect(), 255, 0, 0, 255);
+}
+
+TEST_F(RenderEngineTest, drawLayers_doesNotCacheFramebuffer) {
+    renderengine::DisplaySettings settings;
+    settings.physicalDisplay = fullscreenRect();
+    settings.clip = fullscreenRect();
+
+    std::vector<const renderengine::LayerSettings*> layers;
+    renderengine::LayerSettings layer;
+    layer.geometry.boundaries = fullscreenRect().toFloatRect();
+    BufferSourceVariant<ForceOpaqueBufferVariant>::fillColor(layer, 1.0f, 0.0f, 0.0f, this);
+    layer.alpha = 1.0;
+    layers.push_back(&layer);
+
+    status_t status = sRE->drawLayers(settings, layers, mBuffer, false, base::unique_fd(), nullptr);
+    sCurrentBuffer = mBuffer;
+    ASSERT_EQ(NO_ERROR, status);
+    ASSERT_FALSE(sRE->isFramebufferImageCachedForTesting(mBuffer->getId()));
+    expectBufferColor(fullscreenRect(), 255, 0, 0, 255);
+}
+
+TEST_F(RenderEngineTest, drawLayers_fillRedBuffer_colorSource) {
+    fillRedBuffer<ColorSourceVariant>();
+}
+
+TEST_F(RenderEngineTest, drawLayers_fillGreenBuffer_colorSource) {
+    fillGreenBuffer<ColorSourceVariant>();
+}
+
+TEST_F(RenderEngineTest, drawLayers_fillBlueBuffer_colorSource) {
+    fillBlueBuffer<ColorSourceVariant>();
+}
+
+TEST_F(RenderEngineTest, drawLayers_fillRedTransparentBuffer_colorSource) {
+    fillRedTransparentBuffer<ColorSourceVariant>();
+}
+
+TEST_F(RenderEngineTest, drawLayers_fillBufferPhysicalOffset_colorSource) {
+    fillBufferPhysicalOffset<ColorSourceVariant>();
+}
+
+TEST_F(RenderEngineTest, drawLayers_fillBufferCheckersRotate0_colorSource) {
+    fillBufferCheckersRotate0<ColorSourceVariant>();
+}
+
+TEST_F(RenderEngineTest, drawLayers_fillBufferCheckersRotate90_colorSource) {
+    fillBufferCheckersRotate90<ColorSourceVariant>();
+}
+
+TEST_F(RenderEngineTest, drawLayers_fillBufferCheckersRotate180_colorSource) {
+    fillBufferCheckersRotate180<ColorSourceVariant>();
+}
+
+TEST_F(RenderEngineTest, drawLayers_fillBufferCheckersRotate270_colorSource) {
+    fillBufferCheckersRotate270<ColorSourceVariant>();
+}
+
+TEST_F(RenderEngineTest, drawLayers_fillBufferLayerTransform_colorSource) {
+    fillBufferLayerTransform<ColorSourceVariant>();
+}
+
+TEST_F(RenderEngineTest, drawLayers_fillBufferColorTransform_colorSource) {
+    fillBufferLayerTransform<ColorSourceVariant>();
+}
+
+TEST_F(RenderEngineTest, drawLayers_fillBufferRoundedCorners_colorSource) {
+    fillBufferWithRoundedCorners<ColorSourceVariant>();
+}
+
+TEST_F(RenderEngineTest, drawLayers_fillBufferAndBlurBackground_colorSource) {
+    fillBufferAndBlurBackground<ColorSourceVariant>();
+}
+
+TEST_F(RenderEngineTest, drawLayers_overlayCorners_colorSource) {
+    overlayCorners<ColorSourceVariant>();
+}
+
+TEST_F(RenderEngineTest, drawLayers_fillRedBuffer_opaqueBufferSource) {
+    fillRedBuffer<BufferSourceVariant<ForceOpaqueBufferVariant>>();
+}
+
+TEST_F(RenderEngineTest, drawLayers_fillGreenBuffer_opaqueBufferSource) {
+    fillGreenBuffer<BufferSourceVariant<ForceOpaqueBufferVariant>>();
+}
+
+TEST_F(RenderEngineTest, drawLayers_fillBlueBuffer_opaqueBufferSource) {
+    fillBlueBuffer<BufferSourceVariant<ForceOpaqueBufferVariant>>();
+}
+
+TEST_F(RenderEngineTest, drawLayers_fillRedTransparentBuffer_opaqueBufferSource) {
+    fillRedTransparentBuffer<BufferSourceVariant<ForceOpaqueBufferVariant>>();
+}
+
+TEST_F(RenderEngineTest, drawLayers_fillBufferPhysicalOffset_opaqueBufferSource) {
+    fillBufferPhysicalOffset<BufferSourceVariant<ForceOpaqueBufferVariant>>();
+}
+
+TEST_F(RenderEngineTest, drawLayers_fillBufferCheckersRotate0_opaqueBufferSource) {
+    fillBufferCheckersRotate0<BufferSourceVariant<ForceOpaqueBufferVariant>>();
+}
+
+TEST_F(RenderEngineTest, drawLayers_fillBufferCheckersRotate90_opaqueBufferSource) {
+    fillBufferCheckersRotate90<BufferSourceVariant<ForceOpaqueBufferVariant>>();
+}
+
+TEST_F(RenderEngineTest, drawLayers_fillBufferCheckersRotate180_opaqueBufferSource) {
+    fillBufferCheckersRotate180<BufferSourceVariant<ForceOpaqueBufferVariant>>();
+}
+
+TEST_F(RenderEngineTest, drawLayers_fillBufferCheckersRotate270_opaqueBufferSource) {
+    fillBufferCheckersRotate270<BufferSourceVariant<ForceOpaqueBufferVariant>>();
+}
+
+TEST_F(RenderEngineTest, drawLayers_fillBufferLayerTransform_opaqueBufferSource) {
+    fillBufferLayerTransform<BufferSourceVariant<ForceOpaqueBufferVariant>>();
+}
+
+TEST_F(RenderEngineTest, drawLayers_fillBufferColorTransform_opaqueBufferSource) {
+    fillBufferLayerTransform<BufferSourceVariant<ForceOpaqueBufferVariant>>();
+}
+
+TEST_F(RenderEngineTest, drawLayers_fillBufferRoundedCorners_opaqueBufferSource) {
+    fillBufferWithRoundedCorners<BufferSourceVariant<ForceOpaqueBufferVariant>>();
+}
+
+TEST_F(RenderEngineTest, drawLayers_fillBufferAndBlurBackground_opaqueBufferSource) {
+    fillBufferAndBlurBackground<BufferSourceVariant<ForceOpaqueBufferVariant>>();
+}
+
+TEST_F(RenderEngineTest, drawLayers_overlayCorners_opaqueBufferSource) {
+    overlayCorners<BufferSourceVariant<ForceOpaqueBufferVariant>>();
+}
+
+TEST_F(RenderEngineTest, drawLayers_fillRedBuffer_bufferSource) {
+    fillRedBuffer<BufferSourceVariant<RelaxOpaqueBufferVariant>>();
+}
+
+TEST_F(RenderEngineTest, drawLayers_fillGreenBuffer_bufferSource) {
+    fillGreenBuffer<BufferSourceVariant<RelaxOpaqueBufferVariant>>();
+}
+
+TEST_F(RenderEngineTest, drawLayers_fillBlueBuffer_bufferSource) {
+    fillBlueBuffer<BufferSourceVariant<RelaxOpaqueBufferVariant>>();
+}
+
+TEST_F(RenderEngineTest, drawLayers_fillRedTransparentBuffer_bufferSource) {
+    fillRedTransparentBuffer<BufferSourceVariant<RelaxOpaqueBufferVariant>>();
+}
+
+TEST_F(RenderEngineTest, drawLayers_fillBufferPhysicalOffset_bufferSource) {
+    fillBufferPhysicalOffset<BufferSourceVariant<RelaxOpaqueBufferVariant>>();
+}
+
+TEST_F(RenderEngineTest, drawLayers_fillBufferCheckersRotate0_bufferSource) {
+    fillBufferCheckersRotate0<BufferSourceVariant<RelaxOpaqueBufferVariant>>();
+}
+
+TEST_F(RenderEngineTest, drawLayers_fillBufferCheckersRotate90_bufferSource) {
+    fillBufferCheckersRotate90<BufferSourceVariant<RelaxOpaqueBufferVariant>>();
+}
+
+TEST_F(RenderEngineTest, drawLayers_fillBufferCheckersRotate180_bufferSource) {
+    fillBufferCheckersRotate180<BufferSourceVariant<RelaxOpaqueBufferVariant>>();
+}
+
+TEST_F(RenderEngineTest, drawLayers_fillBufferCheckersRotate270_bufferSource) {
+    fillBufferCheckersRotate270<BufferSourceVariant<RelaxOpaqueBufferVariant>>();
+}
+
+TEST_F(RenderEngineTest, drawLayers_fillBufferLayerTransform_bufferSource) {
+    fillBufferLayerTransform<BufferSourceVariant<RelaxOpaqueBufferVariant>>();
+}
+
+TEST_F(RenderEngineTest, drawLayers_fillBufferColorTransform_bufferSource) {
+    fillBufferLayerTransform<BufferSourceVariant<RelaxOpaqueBufferVariant>>();
+}
+
+TEST_F(RenderEngineTest, drawLayers_fillBufferRoundedCorners_bufferSource) {
+    fillBufferWithRoundedCorners<BufferSourceVariant<RelaxOpaqueBufferVariant>>();
+}
+
+TEST_F(RenderEngineTest, drawLayers_fillBufferAndBlurBackground_bufferSource) {
+    fillBufferAndBlurBackground<BufferSourceVariant<RelaxOpaqueBufferVariant>>();
+}
+
+TEST_F(RenderEngineTest, drawLayers_overlayCorners_bufferSource) {
+    overlayCorners<BufferSourceVariant<RelaxOpaqueBufferVariant>>();
+}
+
+TEST_F(RenderEngineTest, drawLayers_fillBufferTextureTransform) {
+    fillBufferTextureTransform();
+}
+
+TEST_F(RenderEngineTest, drawLayers_fillBuffer_premultipliesAlpha) {
+    fillBufferWithPremultiplyAlpha();
+}
+
+TEST_F(RenderEngineTest, drawLayers_fillBuffer_withoutPremultiplyingAlpha) {
+    fillBufferWithoutPremultiplyAlpha();
+}
+
+TEST_F(RenderEngineTest, drawLayers_clearRegion) {
+    clearRegion();
+}
+
+TEST_F(RenderEngineTest, drawLayers_fillsBufferAndCachesImages) {
+    renderengine::DisplaySettings settings;
+    settings.physicalDisplay = fullscreenRect();
+    settings.clip = fullscreenRect();
+
+    std::vector<const renderengine::LayerSettings*> layers;
+
+    renderengine::LayerSettings layer;
+    layer.geometry.boundaries = fullscreenRect().toFloatRect();
+    BufferSourceVariant<ForceOpaqueBufferVariant>::fillColor(layer, 1.0f, 0.0f, 0.0f, this);
+
+    layers.push_back(&layer);
+    invokeDraw(settings, layers, mBuffer);
+    uint64_t bufferId = layer.source.buffer.buffer->getId();
+    EXPECT_TRUE(sRE->isImageCachedForTesting(bufferId));
+    std::shared_ptr<renderengine::gl::ImageManager::Barrier> barrier =
+            sRE->unbindExternalTextureBufferForTesting(bufferId);
+    std::lock_guard<std::mutex> lock(barrier->mutex);
+    ASSERT_TRUE(barrier->condition.wait_for(barrier->mutex, std::chrono::seconds(5),
+                                            [&]() REQUIRES(barrier->mutex) {
+                                                return barrier->isOpen;
+                                            }));
+    EXPECT_FALSE(sRE->isImageCachedForTesting(bufferId));
+    EXPECT_EQ(NO_ERROR, barrier->result);
+}
+
+TEST_F(RenderEngineTest, bindExternalBuffer_withNullBuffer) {
+    status_t result = sRE->bindExternalTextureBuffer(0, nullptr, nullptr);
+    ASSERT_EQ(BAD_VALUE, result);
+}
+
+TEST_F(RenderEngineTest, bindExternalBuffer_cachesImages) {
+    sp<GraphicBuffer> buf = allocateSourceBuffer(1, 1);
+    uint32_t texName;
+    sRE->genTextures(1, &texName);
+    mTexNames.push_back(texName);
+
+    sRE->bindExternalTextureBuffer(texName, buf, nullptr);
+    uint64_t bufferId = buf->getId();
+    EXPECT_TRUE(sRE->isImageCachedForTesting(bufferId));
+    std::shared_ptr<renderengine::gl::ImageManager::Barrier> barrier =
+            sRE->unbindExternalTextureBufferForTesting(bufferId);
+    std::lock_guard<std::mutex> lock(barrier->mutex);
+    ASSERT_TRUE(barrier->condition.wait_for(barrier->mutex, std::chrono::seconds(5),
+                                            [&]() REQUIRES(barrier->mutex) {
+                                                return barrier->isOpen;
+                                            }));
+    EXPECT_EQ(NO_ERROR, barrier->result);
+    EXPECT_FALSE(sRE->isImageCachedForTesting(bufferId));
+}
+
+TEST_F(RenderEngineTest, cacheExternalBuffer_withNullBuffer) {
+    std::shared_ptr<renderengine::gl::ImageManager::Barrier> barrier =
+            sRE->cacheExternalTextureBufferForTesting(nullptr);
+    std::lock_guard<std::mutex> lock(barrier->mutex);
+    ASSERT_TRUE(barrier->condition.wait_for(barrier->mutex, std::chrono::seconds(5),
+                                            [&]() REQUIRES(barrier->mutex) {
+                                                return barrier->isOpen;
+                                            }));
+    EXPECT_TRUE(barrier->isOpen);
+    EXPECT_EQ(BAD_VALUE, barrier->result);
+}
+
+TEST_F(RenderEngineTest, cacheExternalBuffer_cachesImages) {
+    sp<GraphicBuffer> buf = allocateSourceBuffer(1, 1);
+    uint64_t bufferId = buf->getId();
+    std::shared_ptr<renderengine::gl::ImageManager::Barrier> barrier =
+            sRE->cacheExternalTextureBufferForTesting(buf);
+    {
+        std::lock_guard<std::mutex> lock(barrier->mutex);
+        ASSERT_TRUE(barrier->condition.wait_for(barrier->mutex, std::chrono::seconds(5),
+                                                [&]() REQUIRES(barrier->mutex) {
+                                                    return barrier->isOpen;
+                                                }));
+        EXPECT_EQ(NO_ERROR, barrier->result);
+    }
+    EXPECT_TRUE(sRE->isImageCachedForTesting(bufferId));
+    barrier = sRE->unbindExternalTextureBufferForTesting(bufferId);
+    {
+        std::lock_guard<std::mutex> lock(barrier->mutex);
+        ASSERT_TRUE(barrier->condition.wait_for(barrier->mutex, std::chrono::seconds(5),
+                                                [&]() REQUIRES(barrier->mutex) {
+                                                    return barrier->isOpen;
+                                                }));
+        EXPECT_EQ(NO_ERROR, barrier->result);
+    }
+    EXPECT_FALSE(sRE->isImageCachedForTesting(bufferId));
+}
+
+TEST_F(RenderEngineTest, drawLayers_fillShadow_casterLayerMinSize) {
+    const ubyte4 casterColor(255, 0, 0, 255);
+    const ubyte4 backgroundColor(255, 255, 255, 255);
+    const float shadowLength = 5.0f;
+    Rect casterBounds(1, 1);
+    casterBounds.offsetBy(shadowLength + 1, shadowLength + 1);
+    renderengine::LayerSettings castingLayer;
+    castingLayer.geometry.boundaries = casterBounds.toFloatRect();
+    castingLayer.alpha = 1.0f;
+    renderengine::ShadowSettings settings =
+            getShadowSettings(vec2(casterBounds.left, casterBounds.top), shadowLength,
+                              false /* casterIsTranslucent */);
+
+    drawShadow<ColorSourceVariant>(castingLayer, settings, casterColor, backgroundColor);
+    expectShadowColor(castingLayer, settings, casterColor, backgroundColor);
+}
+
+TEST_F(RenderEngineTest, drawLayers_fillShadow_casterColorLayer) {
+    const ubyte4 casterColor(255, 0, 0, 255);
+    const ubyte4 backgroundColor(255, 255, 255, 255);
+    const float shadowLength = 5.0f;
+    Rect casterBounds(DEFAULT_DISPLAY_WIDTH / 3.0f, DEFAULT_DISPLAY_HEIGHT / 3.0f);
+    casterBounds.offsetBy(shadowLength + 1, shadowLength + 1);
+    renderengine::LayerSettings castingLayer;
+    castingLayer.geometry.boundaries = casterBounds.toFloatRect();
+    castingLayer.alpha = 1.0f;
+    renderengine::ShadowSettings settings =
+            getShadowSettings(vec2(casterBounds.left, casterBounds.top), shadowLength,
+                              false /* casterIsTranslucent */);
+
+    drawShadow<ColorSourceVariant>(castingLayer, settings, casterColor, backgroundColor);
+    expectShadowColor(castingLayer, settings, casterColor, backgroundColor);
+}
+
+TEST_F(RenderEngineTest, drawLayers_fillShadow_casterOpaqueBufferLayer) {
+    const ubyte4 casterColor(255, 0, 0, 255);
+    const ubyte4 backgroundColor(255, 255, 255, 255);
+    const float shadowLength = 5.0f;
+    Rect casterBounds(DEFAULT_DISPLAY_WIDTH / 3.0f, DEFAULT_DISPLAY_HEIGHT / 3.0f);
+    casterBounds.offsetBy(shadowLength + 1, shadowLength + 1);
+    renderengine::LayerSettings castingLayer;
+    castingLayer.geometry.boundaries = casterBounds.toFloatRect();
+    castingLayer.alpha = 1.0f;
+    renderengine::ShadowSettings settings =
+            getShadowSettings(vec2(casterBounds.left, casterBounds.top), shadowLength,
+                              false /* casterIsTranslucent */);
+
+    drawShadow<BufferSourceVariant<ForceOpaqueBufferVariant>>(castingLayer, settings, casterColor,
+                                                              backgroundColor);
+    expectShadowColor(castingLayer, settings, casterColor, backgroundColor);
+}
+
+TEST_F(RenderEngineTest, drawLayers_fillShadow_casterWithRoundedCorner) {
+    const ubyte4 casterColor(255, 0, 0, 255);
+    const ubyte4 backgroundColor(255, 255, 255, 255);
+    const float shadowLength = 5.0f;
+    Rect casterBounds(DEFAULT_DISPLAY_WIDTH / 3.0f, DEFAULT_DISPLAY_HEIGHT / 3.0f);
+    casterBounds.offsetBy(shadowLength + 1, shadowLength + 1);
+    renderengine::LayerSettings castingLayer;
+    castingLayer.geometry.boundaries = casterBounds.toFloatRect();
+    castingLayer.geometry.roundedCornersRadius = 3.0f;
+    castingLayer.geometry.roundedCornersCrop = casterBounds.toFloatRect();
+    castingLayer.alpha = 1.0f;
+    renderengine::ShadowSettings settings =
+            getShadowSettings(vec2(casterBounds.left, casterBounds.top), shadowLength,
+                              false /* casterIsTranslucent */);
+
+    drawShadow<BufferSourceVariant<ForceOpaqueBufferVariant>>(castingLayer, settings, casterColor,
+                                                              backgroundColor);
+    expectShadowColor(castingLayer, settings, casterColor, backgroundColor);
+}
+
+TEST_F(RenderEngineTest, drawLayers_fillShadow_translucentCasterWithAlpha) {
+    const ubyte4 casterColor(255, 0, 0, 255);
+    const ubyte4 backgroundColor(255, 255, 255, 255);
+    const float shadowLength = 5.0f;
+    Rect casterBounds(DEFAULT_DISPLAY_WIDTH / 3.0f, DEFAULT_DISPLAY_HEIGHT / 3.0f);
+    casterBounds.offsetBy(shadowLength + 1, shadowLength + 1);
+    renderengine::LayerSettings castingLayer;
+    castingLayer.geometry.boundaries = casterBounds.toFloatRect();
+    castingLayer.alpha = 0.5f;
+    renderengine::ShadowSettings settings =
+            getShadowSettings(vec2(casterBounds.left, casterBounds.top), shadowLength,
+                              true /* casterIsTranslucent */);
+
+    drawShadow<BufferSourceVariant<RelaxOpaqueBufferVariant>>(castingLayer, settings, casterColor,
+                                                              backgroundColor);
+
+    // verify only the background since the shadow will draw behind the caster
+    const float shadowInset = settings.length * -1.0f;
+    const Rect casterWithShadow =
+            Rect(casterBounds).inset(shadowInset, shadowInset, shadowInset, shadowInset);
+    const Region backgroundRegion = Region(fullscreenRect()).subtractSelf(casterWithShadow);
+    expectBufferColor(backgroundRegion, backgroundColor.r, backgroundColor.g, backgroundColor.b,
+                      backgroundColor.a);
+}
+
+TEST_F(RenderEngineTest, cleanupPostRender_cleansUpOnce) {
+    renderengine::DisplaySettings settings;
+    settings.physicalDisplay = fullscreenRect();
+    settings.clip = fullscreenRect();
+
+    std::vector<const renderengine::LayerSettings*> layers;
+    renderengine::LayerSettings layer;
+    layer.geometry.boundaries = fullscreenRect().toFloatRect();
+    BufferSourceVariant<ForceOpaqueBufferVariant>::fillColor(layer, 1.0f, 0.0f, 0.0f, this);
+    layer.alpha = 1.0;
+    layers.push_back(&layer);
+
+    base::unique_fd fenceOne;
+    sRE->drawLayers(settings, layers, mBuffer, true, base::unique_fd(), &fenceOne);
+    base::unique_fd fenceTwo;
+    sRE->drawLayers(settings, layers, mBuffer, true, std::move(fenceOne), &fenceTwo);
+
+    const int fd = fenceTwo.get();
+    if (fd >= 0) {
+        sync_wait(fd, -1);
+    }
+    // Only cleanup the first time.
+    EXPECT_TRUE(sRE->cleanupPostRender(
+            renderengine::RenderEngine::CleanupMode::CLEAN_OUTPUT_RESOURCES));
+    EXPECT_FALSE(sRE->cleanupPostRender(
+            renderengine::RenderEngine::CleanupMode::CLEAN_OUTPUT_RESOURCES));
+}
+
+TEST_F(RenderEngineTest, cleanupPostRender_whenCleaningAll_replacesTextureMemory) {
+    renderengine::DisplaySettings settings;
+    settings.physicalDisplay = fullscreenRect();
+    settings.clip = fullscreenRect();
+
+    std::vector<const renderengine::LayerSettings*> layers;
+    renderengine::LayerSettings layer;
+    layer.geometry.boundaries = fullscreenRect().toFloatRect();
+    BufferSourceVariant<ForceOpaqueBufferVariant>::fillColor(layer, 1.0f, 0.0f, 0.0f, this);
+    layer.alpha = 1.0;
+    layers.push_back(&layer);
+
+    base::unique_fd fence;
+    sRE->drawLayers(settings, layers, mBuffer, true, base::unique_fd(), &fence);
+
+    const int fd = fence.get();
+    if (fd >= 0) {
+        sync_wait(fd, -1);
+    }
+
+    uint64_t bufferId = layer.source.buffer.buffer->getId();
+    uint32_t texName = layer.source.buffer.textureName;
+    EXPECT_TRUE(sRE->isImageCachedForTesting(bufferId));
+    EXPECT_EQ(bufferId, sRE->getBufferIdForTextureNameForTesting(texName));
+
+    EXPECT_TRUE(sRE->cleanupPostRender(renderengine::RenderEngine::CleanupMode::CLEAN_ALL));
+
+    // Now check that our view of memory is good.
+    EXPECT_FALSE(sRE->isImageCachedForTesting(bufferId));
+    EXPECT_EQ(std::nullopt, sRE->getBufferIdForTextureNameForTesting(bufferId));
+    EXPECT_TRUE(sRE->isTextureNameKnownForTesting(texName));
+}
+
+} // namespace android
+
+// TODO(b/129481165): remove the #pragma below and fix conversion issues
+#pragma clang diagnostic pop // ignored "-Wconversion"
diff --git a/media/libstagefright/renderfright/tests/RenderEngineThreadedTest.cpp b/media/libstagefright/renderfright/tests/RenderEngineThreadedTest.cpp
new file mode 100644
index 0000000..97c7442
--- /dev/null
+++ b/media/libstagefright/renderfright/tests/RenderEngineThreadedTest.cpp
@@ -0,0 +1,216 @@
+/*
+ * Copyright 2020 The Android Open Source Project
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ *      http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+#include <cutils/properties.h>
+#include <gmock/gmock.h>
+#include <gtest/gtest.h>
+#include <renderengine/mock/RenderEngine.h>
+#include "../threaded/RenderEngineThreaded.h"
+
+namespace android {
+
+using testing::_;
+using testing::Eq;
+using testing::Mock;
+using testing::Return;
+
+struct RenderEngineThreadedTest : public ::testing::Test {
+    ~RenderEngineThreadedTest() {}
+
+    void SetUp() override {
+        mThreadedRE = renderengine::threaded::RenderEngineThreaded::create(
+                [this]() { return std::unique_ptr<renderengine::RenderEngine>(mRenderEngine); });
+    }
+
+    std::unique_ptr<renderengine::threaded::RenderEngineThreaded> mThreadedRE;
+    renderengine::mock::RenderEngine* mRenderEngine = new renderengine::mock::RenderEngine();
+};
+
+TEST_F(RenderEngineThreadedTest, dump) {
+    std::string testString = "XYZ";
+    EXPECT_CALL(*mRenderEngine, dump(_));
+    mThreadedRE->dump(testString);
+}
+
+TEST_F(RenderEngineThreadedTest, primeCache) {
+    EXPECT_CALL(*mRenderEngine, primeCache());
+    mThreadedRE->primeCache();
+}
+
+TEST_F(RenderEngineThreadedTest, genTextures) {
+    uint32_t texName;
+    EXPECT_CALL(*mRenderEngine, genTextures(1, &texName));
+    mThreadedRE->genTextures(1, &texName);
+}
+
+TEST_F(RenderEngineThreadedTest, deleteTextures) {
+    uint32_t texName;
+    EXPECT_CALL(*mRenderEngine, deleteTextures(1, &texName));
+    mThreadedRE->deleteTextures(1, &texName);
+}
+
+TEST_F(RenderEngineThreadedTest, bindExternalBuffer_nullptrBuffer) {
+    EXPECT_CALL(*mRenderEngine, bindExternalTextureBuffer(0, Eq(nullptr), Eq(nullptr)))
+            .WillOnce(Return(BAD_VALUE));
+    status_t result = mThreadedRE->bindExternalTextureBuffer(0, nullptr, nullptr);
+    ASSERT_EQ(BAD_VALUE, result);
+}
+
+TEST_F(RenderEngineThreadedTest, bindExternalBuffer_withBuffer) {
+    sp<GraphicBuffer> buf = new GraphicBuffer();
+    EXPECT_CALL(*mRenderEngine, bindExternalTextureBuffer(0, buf, Eq(nullptr)))
+            .WillOnce(Return(NO_ERROR));
+    status_t result = mThreadedRE->bindExternalTextureBuffer(0, buf, nullptr);
+    ASSERT_EQ(NO_ERROR, result);
+}
+
+TEST_F(RenderEngineThreadedTest, cacheExternalTextureBuffer_nullptr) {
+    EXPECT_CALL(*mRenderEngine, cacheExternalTextureBuffer(Eq(nullptr)));
+    mThreadedRE->cacheExternalTextureBuffer(nullptr);
+}
+
+TEST_F(RenderEngineThreadedTest, cacheExternalTextureBuffer_withBuffer) {
+    sp<GraphicBuffer> buf = new GraphicBuffer();
+    EXPECT_CALL(*mRenderEngine, cacheExternalTextureBuffer(buf));
+    mThreadedRE->cacheExternalTextureBuffer(buf);
+}
+
+TEST_F(RenderEngineThreadedTest, unbindExternalTextureBuffer) {
+    EXPECT_CALL(*mRenderEngine, unbindExternalTextureBuffer(0x0));
+    mThreadedRE->unbindExternalTextureBuffer(0x0);
+}
+
+TEST_F(RenderEngineThreadedTest, bindFrameBuffer_returnsBadValue) {
+    std::unique_ptr<renderengine::Framebuffer> framebuffer;
+    EXPECT_CALL(*mRenderEngine, bindFrameBuffer(framebuffer.get())).WillOnce(Return(BAD_VALUE));
+    status_t result = mThreadedRE->bindFrameBuffer(framebuffer.get());
+    ASSERT_EQ(BAD_VALUE, result);
+}
+
+TEST_F(RenderEngineThreadedTest, bindFrameBuffer_returnsNoError) {
+    std::unique_ptr<renderengine::Framebuffer> framebuffer;
+    EXPECT_CALL(*mRenderEngine, bindFrameBuffer(framebuffer.get())).WillOnce(Return(NO_ERROR));
+    status_t result = mThreadedRE->bindFrameBuffer(framebuffer.get());
+    ASSERT_EQ(NO_ERROR, result);
+}
+
+TEST_F(RenderEngineThreadedTest, unbindFrameBuffer) {
+    std::unique_ptr<renderengine::Framebuffer> framebuffer;
+    EXPECT_CALL(*mRenderEngine, unbindFrameBuffer(framebuffer.get()));
+    mThreadedRE->unbindFrameBuffer(framebuffer.get());
+}
+
+TEST_F(RenderEngineThreadedTest, getMaxTextureSize_returns20) {
+    size_t size = 20;
+    EXPECT_CALL(*mRenderEngine, getMaxTextureSize()).WillOnce(Return(size));
+    size_t result = mThreadedRE->getMaxTextureSize();
+    ASSERT_EQ(size, result);
+}
+
+TEST_F(RenderEngineThreadedTest, getMaxTextureSize_returns0) {
+    size_t size = 0;
+    EXPECT_CALL(*mRenderEngine, getMaxTextureSize()).WillOnce(Return(size));
+    size_t result = mThreadedRE->getMaxTextureSize();
+    ASSERT_EQ(size, result);
+}
+
+TEST_F(RenderEngineThreadedTest, getMaxViewportDims_returns20) {
+    size_t dims = 20;
+    EXPECT_CALL(*mRenderEngine, getMaxViewportDims()).WillOnce(Return(dims));
+    size_t result = mThreadedRE->getMaxViewportDims();
+    ASSERT_EQ(dims, result);
+}
+
+TEST_F(RenderEngineThreadedTest, getMaxViewportDims_returns0) {
+    size_t dims = 0;
+    EXPECT_CALL(*mRenderEngine, getMaxViewportDims()).WillOnce(Return(dims));
+    size_t result = mThreadedRE->getMaxViewportDims();
+    ASSERT_EQ(dims, result);
+}
+
+TEST_F(RenderEngineThreadedTest, isProtected_returnsFalse) {
+    EXPECT_CALL(*mRenderEngine, isProtected()).WillOnce(Return(false));
+    status_t result = mThreadedRE->isProtected();
+    ASSERT_EQ(false, result);
+}
+
+TEST_F(RenderEngineThreadedTest, isProtected_returnsTrue) {
+    EXPECT_CALL(*mRenderEngine, isProtected()).WillOnce(Return(true));
+    size_t result = mThreadedRE->isProtected();
+    ASSERT_EQ(true, result);
+}
+
+TEST_F(RenderEngineThreadedTest, supportsProtectedContent_returnsFalse) {
+    EXPECT_CALL(*mRenderEngine, supportsProtectedContent()).WillOnce(Return(false));
+    status_t result = mThreadedRE->supportsProtectedContent();
+    ASSERT_EQ(false, result);
+}
+
+TEST_F(RenderEngineThreadedTest, supportsProtectedContent_returnsTrue) {
+    EXPECT_CALL(*mRenderEngine, supportsProtectedContent()).WillOnce(Return(true));
+    status_t result = mThreadedRE->supportsProtectedContent();
+    ASSERT_EQ(true, result);
+}
+
+TEST_F(RenderEngineThreadedTest, useProtectedContext_returnsFalse) {
+    EXPECT_CALL(*mRenderEngine, useProtectedContext(false)).WillOnce(Return(false));
+    status_t result = mThreadedRE->useProtectedContext(false);
+    ASSERT_EQ(false, result);
+}
+
+TEST_F(RenderEngineThreadedTest, useProtectedContext_returnsTrue) {
+    EXPECT_CALL(*mRenderEngine, useProtectedContext(false)).WillOnce(Return(true));
+    status_t result = mThreadedRE->useProtectedContext(false);
+    ASSERT_EQ(true, result);
+}
+
+TEST_F(RenderEngineThreadedTest, cleanupPostRender_returnsFalse) {
+    EXPECT_CALL(*mRenderEngine,
+                cleanupPostRender(renderengine::RenderEngine::CleanupMode::CLEAN_ALL))
+            .WillOnce(Return(false));
+    status_t result =
+            mThreadedRE->cleanupPostRender(renderengine::RenderEngine::CleanupMode::CLEAN_ALL);
+    ASSERT_EQ(false, result);
+}
+
+TEST_F(RenderEngineThreadedTest, cleanupPostRender_returnsTrue) {
+    EXPECT_CALL(*mRenderEngine,
+                cleanupPostRender(renderengine::RenderEngine::CleanupMode::CLEAN_ALL))
+            .WillOnce(Return(true));
+    status_t result =
+            mThreadedRE->cleanupPostRender(renderengine::RenderEngine::CleanupMode::CLEAN_ALL);
+    ASSERT_EQ(true, result);
+}
+
+TEST_F(RenderEngineThreadedTest, drawLayers) {
+    renderengine::DisplaySettings settings;
+    std::vector<const renderengine::LayerSettings*> layers;
+    sp<GraphicBuffer> buffer = new GraphicBuffer();
+    base::unique_fd bufferFence;
+    base::unique_fd drawFence;
+
+    EXPECT_CALL(*mRenderEngine, drawLayers)
+            .WillOnce([](const renderengine::DisplaySettings&,
+                         const std::vector<const renderengine::LayerSettings*>&,
+                         const sp<GraphicBuffer>&, const bool, base::unique_fd&&,
+                         base::unique_fd*) -> status_t { return NO_ERROR; });
+
+    status_t result = mThreadedRE->drawLayers(settings, layers, buffer, false,
+                                              std::move(bufferFence), &drawFence);
+    ASSERT_EQ(NO_ERROR, result);
+}
+
+} // namespace android
diff --git a/media/libstagefright/renderfright/threaded/RenderEngineThreaded.cpp b/media/libstagefright/renderfright/threaded/RenderEngineThreaded.cpp
new file mode 100644
index 0000000..d4184fd
--- /dev/null
+++ b/media/libstagefright/renderfright/threaded/RenderEngineThreaded.cpp
@@ -0,0 +1,403 @@
+/*
+ * Copyright 2020 The Android Open Source Project
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ *      http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+#define ATRACE_TAG ATRACE_TAG_GRAPHICS
+
+#include "RenderEngineThreaded.h"
+
+#include <sched.h>
+#include <chrono>
+#include <future>
+
+#include <android-base/stringprintf.h>
+#include <private/gui/SyncFeatures.h>
+#include <utils/Trace.h>
+
+#include "gl/GLESRenderEngine.h"
+
+using namespace std::chrono_literals;
+
+namespace android {
+namespace renderengine {
+namespace threaded {
+
+std::unique_ptr<RenderEngineThreaded> RenderEngineThreaded::create(CreateInstanceFactory factory) {
+    return std::make_unique<RenderEngineThreaded>(std::move(factory));
+}
+
+RenderEngineThreaded::RenderEngineThreaded(CreateInstanceFactory factory) {
+    ATRACE_CALL();
+
+    std::lock_guard lockThread(mThreadMutex);
+    mThread = std::thread(&RenderEngineThreaded::threadMain, this, factory);
+}
+
+RenderEngineThreaded::~RenderEngineThreaded() {
+    {
+        std::lock_guard lock(mThreadMutex);
+        mRunning = false;
+        mCondition.notify_one();
+    }
+
+    if (mThread.joinable()) {
+        mThread.join();
+    }
+}
+
+// NO_THREAD_SAFETY_ANALYSIS is because std::unique_lock presently lacks thread safety annotations.
+void RenderEngineThreaded::threadMain(CreateInstanceFactory factory) NO_THREAD_SAFETY_ANALYSIS {
+    ATRACE_CALL();
+
+    struct sched_param param = {0};
+    param.sched_priority = 2;
+    if (sched_setscheduler(0, SCHED_FIFO, &param) != 0) {
+        ALOGE("Couldn't set SCHED_FIFO");
+    }
+
+    mRenderEngine = factory();
+
+    std::unique_lock<std::mutex> lock(mThreadMutex);
+    pthread_setname_np(pthread_self(), mThreadName);
+
+    while (mRunning) {
+        if (!mFunctionCalls.empty()) {
+            auto task = mFunctionCalls.front();
+            mFunctionCalls.pop();
+            task(*mRenderEngine);
+        }
+        mCondition.wait(lock, [this]() REQUIRES(mThreadMutex) {
+            return !mRunning || !mFunctionCalls.empty();
+        });
+    }
+}
+
+void RenderEngineThreaded::primeCache() const {
+    std::promise<void> resultPromise;
+    std::future<void> resultFuture = resultPromise.get_future();
+    {
+        std::lock_guard lock(mThreadMutex);
+        mFunctionCalls.push([&resultPromise](renderengine::RenderEngine& instance) {
+            ATRACE_NAME("REThreaded::primeCache");
+            instance.primeCache();
+            resultPromise.set_value();
+        });
+    }
+    mCondition.notify_one();
+    resultFuture.wait();
+}
+
+void RenderEngineThreaded::dump(std::string& result) {
+    std::promise<std::string> resultPromise;
+    std::future<std::string> resultFuture = resultPromise.get_future();
+    {
+        std::lock_guard lock(mThreadMutex);
+        mFunctionCalls.push([&resultPromise, &result](renderengine::RenderEngine& instance) {
+            ATRACE_NAME("REThreaded::dump");
+            std::string localResult = result;
+            instance.dump(localResult);
+            resultPromise.set_value(std::move(localResult));
+        });
+    }
+    mCondition.notify_one();
+    // Note: This is an rvalue.
+    result.assign(resultFuture.get());
+}
+
+bool RenderEngineThreaded::useNativeFenceSync() const {
+    std::promise<bool> resultPromise;
+    std::future<bool> resultFuture = resultPromise.get_future();
+    {
+        std::lock_guard lock(mThreadMutex);
+        mFunctionCalls.push([&resultPromise](renderengine::RenderEngine& /*instance*/) {
+            ATRACE_NAME("REThreaded::useNativeFenceSync");
+            bool returnValue = SyncFeatures::getInstance().useNativeFenceSync();
+            resultPromise.set_value(returnValue);
+        });
+    }
+    mCondition.notify_one();
+    return resultFuture.get();
+}
+
+bool RenderEngineThreaded::useWaitSync() const {
+    std::promise<bool> resultPromise;
+    std::future<bool> resultFuture = resultPromise.get_future();
+    {
+        std::lock_guard lock(mThreadMutex);
+        mFunctionCalls.push([&resultPromise](renderengine::RenderEngine& /*instance*/) {
+            ATRACE_NAME("REThreaded::useWaitSync");
+            bool returnValue = SyncFeatures::getInstance().useWaitSync();
+            resultPromise.set_value(returnValue);
+        });
+    }
+    mCondition.notify_one();
+    return resultFuture.get();
+}
+
+void RenderEngineThreaded::genTextures(size_t count, uint32_t* names) {
+    std::promise<void> resultPromise;
+    std::future<void> resultFuture = resultPromise.get_future();
+    {
+        std::lock_guard lock(mThreadMutex);
+        mFunctionCalls.push([&resultPromise, count, names](renderengine::RenderEngine& instance) {
+            ATRACE_NAME("REThreaded::genTextures");
+            instance.genTextures(count, names);
+            resultPromise.set_value();
+        });
+    }
+    mCondition.notify_one();
+    resultFuture.wait();
+}
+
+void RenderEngineThreaded::deleteTextures(size_t count, uint32_t const* names) {
+    std::promise<void> resultPromise;
+    std::future<void> resultFuture = resultPromise.get_future();
+    {
+        std::lock_guard lock(mThreadMutex);
+        mFunctionCalls.push([&resultPromise, count, &names](renderengine::RenderEngine& instance) {
+            ATRACE_NAME("REThreaded::deleteTextures");
+            instance.deleteTextures(count, names);
+            resultPromise.set_value();
+        });
+    }
+    mCondition.notify_one();
+    resultFuture.wait();
+}
+
+void RenderEngineThreaded::bindExternalTextureImage(uint32_t texName, const Image& image) {
+    std::promise<void> resultPromise;
+    std::future<void> resultFuture = resultPromise.get_future();
+    {
+        std::lock_guard lock(mThreadMutex);
+        mFunctionCalls.push(
+                [&resultPromise, texName, &image](renderengine::RenderEngine& instance) {
+                    ATRACE_NAME("REThreaded::bindExternalTextureImage");
+                    instance.bindExternalTextureImage(texName, image);
+                    resultPromise.set_value();
+                });
+    }
+    mCondition.notify_one();
+    resultFuture.wait();
+}
+
+status_t RenderEngineThreaded::bindExternalTextureBuffer(uint32_t texName,
+                                                         const sp<GraphicBuffer>& buffer,
+                                                         const sp<Fence>& fence) {
+    std::promise<status_t> resultPromise;
+    std::future<status_t> resultFuture = resultPromise.get_future();
+    {
+        std::lock_guard lock(mThreadMutex);
+        mFunctionCalls.push(
+                [&resultPromise, texName, &buffer, &fence](renderengine::RenderEngine& instance) {
+                    ATRACE_NAME("REThreaded::bindExternalTextureBuffer");
+                    status_t status = instance.bindExternalTextureBuffer(texName, buffer, fence);
+                    resultPromise.set_value(status);
+                });
+    }
+    mCondition.notify_one();
+    return resultFuture.get();
+}
+
+void RenderEngineThreaded::cacheExternalTextureBuffer(const sp<GraphicBuffer>& buffer) {
+    std::promise<void> resultPromise;
+    std::future<void> resultFuture = resultPromise.get_future();
+    {
+        std::lock_guard lock(mThreadMutex);
+        mFunctionCalls.push([&resultPromise, &buffer](renderengine::RenderEngine& instance) {
+            ATRACE_NAME("REThreaded::cacheExternalTextureBuffer");
+            instance.cacheExternalTextureBuffer(buffer);
+            resultPromise.set_value();
+        });
+    }
+    mCondition.notify_one();
+    resultFuture.wait();
+}
+
+void RenderEngineThreaded::unbindExternalTextureBuffer(uint64_t bufferId) {
+    std::promise<void> resultPromise;
+    std::future<void> resultFuture = resultPromise.get_future();
+    {
+        std::lock_guard lock(mThreadMutex);
+        mFunctionCalls.push([&resultPromise, &bufferId](renderengine::RenderEngine& instance) {
+            ATRACE_NAME("REThreaded::unbindExternalTextureBuffer");
+            instance.unbindExternalTextureBuffer(bufferId);
+            resultPromise.set_value();
+        });
+    }
+    mCondition.notify_one();
+    resultFuture.wait();
+}
+
+status_t RenderEngineThreaded::bindFrameBuffer(Framebuffer* framebuffer) {
+    std::promise<status_t> resultPromise;
+    std::future<status_t> resultFuture = resultPromise.get_future();
+    {
+        std::lock_guard lock(mThreadMutex);
+        mFunctionCalls.push([&resultPromise, &framebuffer](renderengine::RenderEngine& instance) {
+            ATRACE_NAME("REThreaded::bindFrameBuffer");
+            status_t status = instance.bindFrameBuffer(framebuffer);
+            resultPromise.set_value(status);
+        });
+    }
+    mCondition.notify_one();
+    return resultFuture.get();
+}
+
+void RenderEngineThreaded::unbindFrameBuffer(Framebuffer* framebuffer) {
+    std::promise<void> resultPromise;
+    std::future<void> resultFuture = resultPromise.get_future();
+    {
+        std::lock_guard lock(mThreadMutex);
+        mFunctionCalls.push([&resultPromise, &framebuffer](renderengine::RenderEngine& instance) {
+            ATRACE_NAME("REThreaded::unbindFrameBuffer");
+            instance.unbindFrameBuffer(framebuffer);
+            resultPromise.set_value();
+        });
+    }
+    mCondition.notify_one();
+    resultFuture.wait();
+}
+
+size_t RenderEngineThreaded::getMaxTextureSize() const {
+    std::promise<size_t> resultPromise;
+    std::future<size_t> resultFuture = resultPromise.get_future();
+    {
+        std::lock_guard lock(mThreadMutex);
+        mFunctionCalls.push([&resultPromise](renderengine::RenderEngine& instance) {
+            ATRACE_NAME("REThreaded::getMaxTextureSize");
+            size_t size = instance.getMaxTextureSize();
+            resultPromise.set_value(size);
+        });
+    }
+    mCondition.notify_one();
+    return resultFuture.get();
+}
+
+size_t RenderEngineThreaded::getMaxViewportDims() const {
+    std::promise<size_t> resultPromise;
+    std::future<size_t> resultFuture = resultPromise.get_future();
+    {
+        std::lock_guard lock(mThreadMutex);
+        mFunctionCalls.push([&resultPromise](renderengine::RenderEngine& instance) {
+            ATRACE_NAME("REThreaded::getMaxViewportDims");
+            size_t size = instance.getMaxViewportDims();
+            resultPromise.set_value(size);
+        });
+    }
+    mCondition.notify_one();
+    return resultFuture.get();
+}
+
+bool RenderEngineThreaded::isProtected() const {
+    std::promise<bool> resultPromise;
+    std::future<bool> resultFuture = resultPromise.get_future();
+    {
+        std::lock_guard lock(mThreadMutex);
+        mFunctionCalls.push([&resultPromise](renderengine::RenderEngine& instance) {
+            ATRACE_NAME("REThreaded::isProtected");
+            bool returnValue = instance.isProtected();
+            resultPromise.set_value(returnValue);
+        });
+    }
+    mCondition.notify_one();
+    return resultFuture.get();
+}
+
+bool RenderEngineThreaded::supportsProtectedContent() const {
+    std::promise<bool> resultPromise;
+    std::future<bool> resultFuture = resultPromise.get_future();
+    {
+        std::lock_guard lock(mThreadMutex);
+        mFunctionCalls.push([&resultPromise](renderengine::RenderEngine& instance) {
+            ATRACE_NAME("REThreaded::supportsProtectedContent");
+            bool returnValue = instance.supportsProtectedContent();
+            resultPromise.set_value(returnValue);
+        });
+    }
+    mCondition.notify_one();
+    return resultFuture.get();
+}
+
+bool RenderEngineThreaded::useProtectedContext(bool useProtectedContext) {
+    std::promise<bool> resultPromise;
+    std::future<bool> resultFuture = resultPromise.get_future();
+    {
+        std::lock_guard lock(mThreadMutex);
+        mFunctionCalls.push(
+                [&resultPromise, useProtectedContext](renderengine::RenderEngine& instance) {
+                    ATRACE_NAME("REThreaded::useProtectedContext");
+                    bool returnValue = instance.useProtectedContext(useProtectedContext);
+                    resultPromise.set_value(returnValue);
+                });
+    }
+    mCondition.notify_one();
+    return resultFuture.get();
+}
+
+Framebuffer* RenderEngineThreaded::getFramebufferForDrawing() {
+    std::promise<Framebuffer*> resultPromise;
+    std::future<Framebuffer*> resultFuture = resultPromise.get_future();
+    {
+        std::lock_guard lock(mThreadMutex);
+        mFunctionCalls.push([&resultPromise](renderengine::RenderEngine& instance) {
+            ATRACE_NAME("REThreaded::getFramebufferForDrawing");
+            Framebuffer* framebuffer = instance.getFramebufferForDrawing();
+            resultPromise.set_value(framebuffer);
+        });
+    }
+    mCondition.notify_one();
+    return resultFuture.get();
+}
+
+bool RenderEngineThreaded::cleanupPostRender(CleanupMode mode) {
+    std::promise<bool> resultPromise;
+    std::future<bool> resultFuture = resultPromise.get_future();
+    {
+        std::lock_guard lock(mThreadMutex);
+        mFunctionCalls.push([&resultPromise, mode](renderengine::RenderEngine& instance) {
+            ATRACE_NAME("REThreaded::cleanupPostRender");
+            bool returnValue = instance.cleanupPostRender(mode);
+            resultPromise.set_value(returnValue);
+        });
+    }
+    mCondition.notify_one();
+    return resultFuture.get();
+}
+
+status_t RenderEngineThreaded::drawLayers(const DisplaySettings& display,
+                                          const std::vector<const LayerSettings*>& layers,
+                                          const sp<GraphicBuffer>& buffer,
+                                          const bool useFramebufferCache,
+                                          base::unique_fd&& bufferFence,
+                                          base::unique_fd* drawFence) {
+    std::promise<status_t> resultPromise;
+    std::future<status_t> resultFuture = resultPromise.get_future();
+    {
+        std::lock_guard lock(mThreadMutex);
+        mFunctionCalls.push([&resultPromise, &display, &layers, &buffer, useFramebufferCache,
+                             &bufferFence, &drawFence](renderengine::RenderEngine& instance) {
+            ATRACE_NAME("REThreaded::drawLayers");
+            status_t status = instance.drawLayers(display, layers, buffer, useFramebufferCache,
+                                                  std::move(bufferFence), drawFence);
+            resultPromise.set_value(status);
+        });
+    }
+    mCondition.notify_one();
+    return resultFuture.get();
+}
+
+} // namespace threaded
+} // namespace renderengine
+} // namespace android
diff --git a/media/libstagefright/renderfright/threaded/RenderEngineThreaded.h b/media/libstagefright/renderfright/threaded/RenderEngineThreaded.h
new file mode 100644
index 0000000..86a49e9
--- /dev/null
+++ b/media/libstagefright/renderfright/threaded/RenderEngineThreaded.h
@@ -0,0 +1,97 @@
+/*
+ * Copyright 2020 The Android Open Source Project
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ *      http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+#pragma once
+
+#include <android-base/thread_annotations.h>
+#include <condition_variable>
+#include <mutex>
+#include <queue>
+#include <thread>
+
+#include "renderengine/RenderEngine.h"
+
+namespace android {
+namespace renderengine {
+namespace threaded {
+
+using CreateInstanceFactory = std::function<std::unique_ptr<renderengine::RenderEngine>()>;
+
+/**
+ * This class extends a basic RenderEngine class. It contains a thread. Each time a function of
+ * this class is called, we create a lambda function that is put on a queue. The main thread then
+ * executes the functions in order.
+ */
+class RenderEngineThreaded : public RenderEngine {
+public:
+    static std::unique_ptr<RenderEngineThreaded> create(CreateInstanceFactory factory);
+
+    RenderEngineThreaded(CreateInstanceFactory factory);
+    ~RenderEngineThreaded() override;
+    void primeCache() const override;
+
+    void dump(std::string& result) override;
+
+    bool useNativeFenceSync() const override;
+    bool useWaitSync() const override;
+    void genTextures(size_t count, uint32_t* names) override;
+    void deleteTextures(size_t count, uint32_t const* names) override;
+    void bindExternalTextureImage(uint32_t texName, const Image& image) override;
+    status_t bindExternalTextureBuffer(uint32_t texName, const sp<GraphicBuffer>& buffer,
+                                       const sp<Fence>& fence) override;
+    void cacheExternalTextureBuffer(const sp<GraphicBuffer>& buffer) override;
+    void unbindExternalTextureBuffer(uint64_t bufferId) override;
+    status_t bindFrameBuffer(Framebuffer* framebuffer) override;
+    void unbindFrameBuffer(Framebuffer* framebuffer) override;
+    size_t getMaxTextureSize() const override;
+    size_t getMaxViewportDims() const override;
+
+    bool isProtected() const override;
+    bool supportsProtectedContent() const override;
+    bool useProtectedContext(bool useProtectedContext) override;
+    bool cleanupPostRender(CleanupMode mode) override;
+
+    status_t drawLayers(const DisplaySettings& display,
+                        const std::vector<const LayerSettings*>& layers,
+                        const sp<GraphicBuffer>& buffer, const bool useFramebufferCache,
+                        base::unique_fd&& bufferFence, base::unique_fd* drawFence) override;
+
+protected:
+    Framebuffer* getFramebufferForDrawing() override;
+
+private:
+    void threadMain(CreateInstanceFactory factory);
+
+    /* ------------------------------------------------------------------------
+     * Threading
+     */
+    const char* const mThreadName = "RenderEngineThread";
+    // Protects the creation and destruction of mThread.
+    mutable std::mutex mThreadMutex;
+    std::thread mThread GUARDED_BY(mThreadMutex);
+    bool mRunning GUARDED_BY(mThreadMutex) = true;
+    mutable std::queue<std::function<void(renderengine::RenderEngine& instance)>> mFunctionCalls
+            GUARDED_BY(mThreadMutex);
+    mutable std::condition_variable mCondition;
+
+    /* ------------------------------------------------------------------------
+     * Render Engine
+     */
+    std::unique_ptr<renderengine::RenderEngine> mRenderEngine;
+};
+} // namespace threaded
+} // namespace renderengine
+} // namespace android
diff --git a/media/libstagefright/tests/HEVC/Android.bp b/media/libstagefright/tests/HEVC/Android.bp
index 7a6b959..3762553 100644
--- a/media/libstagefright/tests/HEVC/Android.bp
+++ b/media/libstagefright/tests/HEVC/Android.bp
@@ -16,6 +16,7 @@
 
 cc_test {
     name: "HEVCUtilsUnitTest",
+    test_suites: ["device-tests"],
     gtest: true,
 
     srcs: [
diff --git a/media/libstagefright/timedtext/TEST_MAPPING b/media/libstagefright/timedtext/TEST_MAPPING
index 185f824..35a5b11 100644
--- a/media/libstagefright/timedtext/TEST_MAPPING
+++ b/media/libstagefright/timedtext/TEST_MAPPING
@@ -1,7 +1,9 @@
 // mappings for frameworks/av/media/libstagefright/timedtext
 {
-  "presubmit": [
-    // TODO(b/148094059): unit tests not allowed to download content
-    //{ "name": "TimedTextUnitTest" }
+  // tests which require dynamic content
+  // invoke with: atest -- --enable-module-dynamic-download=true
+  // TODO(b/148094059): unit tests not allowed to download content
+  "dynamic-presubmit": [
+    { "name": "TimedTextUnitTest" }
   ]
 }
diff --git a/media/libstagefright/timedtext/test/Android.bp b/media/libstagefright/timedtext/test/Android.bp
index 36f8891..11e5077 100644
--- a/media/libstagefright/timedtext/test/Android.bp
+++ b/media/libstagefright/timedtext/test/Android.bp
@@ -16,6 +16,7 @@
 
 cc_test {
     name: "TimedTextUnitTest",
+    test_suites: ["device-tests"],
     gtest: true,
 
     srcs: [
diff --git a/media/mtp/Android.bp b/media/mtp/Android.bp
index 66a3139..e572249 100644
--- a/media/mtp/Android.bp
+++ b/media/mtp/Android.bp
@@ -52,5 +52,6 @@
         "liblog",
         "libusbhost",
     ],
+    header_libs: ["libcutils_headers"],
 }
 
diff --git a/media/ndk/NdkMediaCodec.cpp b/media/ndk/NdkMediaCodec.cpp
index af21a99..d771095 100644
--- a/media/ndk/NdkMediaCodec.cpp
+++ b/media/ndk/NdkMediaCodec.cpp
@@ -45,6 +45,10 @@
         return AMEDIA_OK;
     } else if (err == -EAGAIN) {
         return (media_status_t) AMEDIACODEC_INFO_TRY_AGAIN_LATER;
+    } else if (err == NO_MEMORY) {
+        return AMEDIACODEC_ERROR_INSUFFICIENT_RESOURCE;
+    } else if (err == DEAD_OBJECT) {
+        return AMEDIACODEC_ERROR_RECLAIMED;
     }
     ALOGE("sf error code: %d", err);
     return AMEDIA_ERROR_UNKNOWN;
@@ -255,7 +259,7 @@
                          break;
                      }
                      msg->findString("detail", &detail);
-                     ALOGE("Decoder reported error(0x%x), actionCode(%d), detail(%s)",
+                     ALOGE("Codec reported error(0x%x), actionCode(%d), detail(%s)",
                            err, actionCode, detail.c_str());
 
                      Mutex::Autolock _l(mCodec->mAsyncCallbackLock);
diff --git a/media/ndk/NdkMediaFormat.cpp b/media/ndk/NdkMediaFormat.cpp
index 8680641..73c52a9 100644
--- a/media/ndk/NdkMediaFormat.cpp
+++ b/media/ndk/NdkMediaFormat.cpp
@@ -364,6 +364,7 @@
 EXPORT const char* AMEDIAFORMAT_KEY_SAR_WIDTH = "sar-width";
 EXPORT const char* AMEDIAFORMAT_KEY_SEI = "sei";
 EXPORT const char* AMEDIAFORMAT_KEY_SLICE_HEIGHT = "slice-height";
+EXPORT const char* AMEDIAFORMAT_KEY_SLOW_MOTION_MARKERS = "slow-motion-markers";
 EXPORT const char* AMEDIAFORMAT_KEY_STRIDE = "stride";
 EXPORT const char* AMEDIAFORMAT_KEY_TARGET_TIME = "target-time";
 EXPORT const char* AMEDIAFORMAT_KEY_TEMPORAL_LAYER_COUNT = "temporal-layer-count";
diff --git a/media/ndk/include/media/NdkMediaFormat.h b/media/ndk/include/media/NdkMediaFormat.h
index 6371de4..394b972 100644
--- a/media/ndk/include/media/NdkMediaFormat.h
+++ b/media/ndk/include/media/NdkMediaFormat.h
@@ -322,6 +322,10 @@
 extern const char* AMEDIAFORMAT_KEY_LOW_LATENCY __INTRODUCED_IN(30);
 #endif /* __ANDROID_API__ >= 30 */
 
+#if __ANDROID_API__ >= 31
+extern const char* AMEDIAFORMAT_KEY_SLOW_MOTION_MARKERS __INTRODUCED_IN(31);
+#endif /* __ANDROID_API__ >= 31 */
+
 __END_DECLS
 
 #endif // _NDK_MEDIA_FORMAT_H
diff --git a/media/ndk/libmediandk.map.txt b/media/ndk/libmediandk.map.txt
index 29f1da8..bd3337e 100644
--- a/media/ndk/libmediandk.map.txt
+++ b/media/ndk/libmediandk.map.txt
@@ -131,6 +131,7 @@
     AMEDIAFORMAT_KEY_SAR_WIDTH; # var introduced=29
     AMEDIAFORMAT_KEY_SEI; # var introduced=28
     AMEDIAFORMAT_KEY_SLICE_HEIGHT; # var introduced=28
+    AMEDIAFORMAT_KEY_SLOW_MOTION_MARKERS; # var introduced=31
     AMEDIAFORMAT_KEY_STRIDE; # var introduced=21
     AMEDIAFORMAT_KEY_TARGET_TIME; # var introduced=29
     AMEDIAFORMAT_KEY_TEMPORAL_LAYER_COUNT; # var introduced=29
diff --git a/media/utils/ProcessInfo.cpp b/media/utils/ProcessInfo.cpp
index 113e4a7..19225d3 100644
--- a/media/utils/ProcessInfo.cpp
+++ b/media/utils/ProcessInfo.cpp
@@ -27,6 +27,9 @@
 
 namespace android {
 
+static constexpr int32_t INVALID_ADJ = -10000;
+static constexpr int32_t NATIVE_ADJ = -1000;
+
 ProcessInfo::ProcessInfo() {}
 
 bool ProcessInfo::getPriority(int pid, int* priority) {
@@ -35,8 +38,6 @@
 
     size_t length = 1;
     int32_t state;
-    static const int32_t INVALID_ADJ = -10000;
-    static const int32_t NATIVE_ADJ = -1000;
     int32_t score = INVALID_ADJ;
     status_t err = service->getProcessStatesAndOomScoresFromPids(length, &pid, &state, &score);
     if (err != OK) {
@@ -45,8 +46,17 @@
     }
     ALOGV("pid %d state %d score %d", pid, state, score);
     if (score <= NATIVE_ADJ) {
-        ALOGE("pid %d invalid OOM adjustments value %d", pid, score);
-        return false;
+        std::scoped_lock lock{mOverrideLock};
+
+        // If this process if not tracked by ActivityManagerService, look for overrides.
+        auto it = mOverrideMap.find(pid);
+        if (it != mOverrideMap.end()) {
+            ALOGI("pid %d invalid OOM score %d, override to %d", pid, score, it->second.oomScore);
+            score = it->second.oomScore;
+        } else {
+            ALOGE("pid %d invalid OOM score %d", pid, score);
+            return false;
+        }
     }
 
     // Use OOM adjustments value as the priority. Lower the value, higher the priority.
@@ -61,6 +71,26 @@
     return (callingPid == getpid()) || (callingPid == pid) || (callingUid == AID_MEDIA);
 }
 
+bool ProcessInfo::overrideProcessInfo(int pid, int procState, int oomScore) {
+    std::scoped_lock lock{mOverrideLock};
+
+    mOverrideMap.erase(pid);
+
+    // Disable the override if oomScore is set to NATIVE_ADJ or below.
+    if (oomScore <= NATIVE_ADJ) {
+        return false;
+    }
+
+    mOverrideMap.emplace(pid, ProcessInfoOverride{procState, oomScore});
+    return true;
+}
+
+void ProcessInfo::removeProcessInfoOverride(int pid) {
+    std::scoped_lock lock{mOverrideLock};
+
+    mOverrideMap.erase(pid);
+}
+
 ProcessInfo::~ProcessInfo() {}
 
 }  // namespace android
diff --git a/services/audioflinger/AudioFlinger.cpp b/services/audioflinger/AudioFlinger.cpp
index 34bdac5..fe45221 100644
--- a/services/audioflinger/AudioFlinger.cpp
+++ b/services/audioflinger/AudioFlinger.cpp
@@ -855,7 +855,8 @@
                                       input.notificationsPerBuffer, input.speed,
                                       input.sharedBuffer, sessionId, &output.flags,
                                       callingPid, input.clientInfo.clientTid, clientUid,
-                                      &lStatus, portId, input.audioTrackCallback);
+                                      &lStatus, portId, input.audioTrackCallback,
+                                      input.opPackageName);
         LOG_ALWAYS_FATAL_IF((lStatus == NO_ERROR) && (track == 0));
         // we don't abort yet if lStatus != NO_ERROR; there is still work to be done regardless
 
@@ -2071,8 +2072,8 @@
         Mutex::Autolock _l(mLock);
         RecordThread *thread = checkRecordThread_l(output.inputId);
         if (thread == NULL) {
-            ALOGE("createRecord() checkRecordThread_l failed, input handle %d", output.inputId);
-            lStatus = BAD_VALUE;
+            ALOGW("createRecord() checkRecordThread_l failed, input handle %d", output.inputId);
+            lStatus = FAILED_TRANSACTION;
             goto Exit;
         }
 
diff --git a/services/audioflinger/PlaybackTracks.h b/services/audioflinger/PlaybackTracks.h
index d05c8b8..a4b8650 100644
--- a/services/audioflinger/PlaybackTracks.h
+++ b/services/audioflinger/PlaybackTracks.h
@@ -26,10 +26,11 @@
     bool hasOpPlayAudio() const;
 
     static sp<OpPlayAudioMonitor> createIfNeeded(
-            uid_t uid, const audio_attributes_t& attr, int id, audio_stream_type_t streamType);
+            uid_t uid, const audio_attributes_t& attr, int id, audio_stream_type_t streamType,
+            const std::string& opPackageName);
 
 private:
-    OpPlayAudioMonitor(uid_t uid, audio_usage_t usage, int id);
+    OpPlayAudioMonitor(uid_t uid, audio_usage_t usage, int id, const String16& opPackageName);
     void onFirstRef() override;
     static void getPackagesForUid(uid_t uid, Vector<String16>& packages);
 
@@ -49,10 +50,10 @@
     void checkPlayAudioForUsage();
 
     std::atomic_bool mHasOpPlayAudio;
-    Vector<String16> mPackages;
     const uid_t mUid;
     const int32_t mUsage; // on purpose not audio_usage_t because always checked in appOps as int32_t
     const int mId; // for logging purposes only
+    const String16 mOpPackageName;
 };
 
 // playback track
@@ -77,7 +78,8 @@
                                 audio_port_handle_t portId = AUDIO_PORT_HANDLE_NONE,
                                 /** default behaviour is to start when there are as many frames
                                   * ready as possible (aka. Buffer is full). */
-                                size_t frameCountToBeReady = SIZE_MAX);
+                                size_t frameCountToBeReady = SIZE_MAX,
+                                const std::string opPackageName = "");
     virtual             ~Track();
     virtual status_t    initCheck() const;
 
diff --git a/services/audioflinger/Threads.cpp b/services/audioflinger/Threads.cpp
index affc09e..1e0bcac 100644
--- a/services/audioflinger/Threads.cpp
+++ b/services/audioflinger/Threads.cpp
@@ -2080,7 +2080,8 @@
         uid_t uid,
         status_t *status,
         audio_port_handle_t portId,
-        const sp<media::IAudioTrackCallback>& callback)
+        const sp<media::IAudioTrackCallback>& callback,
+        const std::string& opPackageName)
 {
     size_t frameCount = *pFrameCount;
     size_t notificationFrameCount = *pNotificationFrameCount;
@@ -2371,7 +2372,8 @@
         track = new Track(this, client, streamType, attr, sampleRate, format,
                           channelMask, frameCount,
                           nullptr /* buffer */, (size_t)0 /* bufferSize */, sharedBuffer,
-                          sessionId, creatorPid, uid, trackFlags, TrackBase::TYPE_DEFAULT, portId);
+                          sessionId, creatorPid, uid, trackFlags, TrackBase::TYPE_DEFAULT, portId,
+                          SIZE_MAX /*frameCountToBeReady*/, opPackageName);
 
         lStatus = track != 0 ? track->initCheck() : (status_t) NO_MEMORY;
         if (lStatus != NO_ERROR) {
@@ -2383,7 +2385,7 @@
         {
             Mutex::Autolock _atCbL(mAudioTrackCbLock);
             if (callback.get() != nullptr) {
-                mAudioTrackCallbacks.emplace(callback);
+                mAudioTrackCallbacks.emplace(track, callback);
             }
         }
 
@@ -2617,6 +2619,10 @@
     mLocalLog.log("removeTrack_l (%p) %s", track.get(), result.string());
 
     mTracks.remove(track);
+    {
+        Mutex::Autolock _atCbL(mAudioTrackCbLock);
+        mAudioTrackCallbacks.erase(track);
+    }
     if (track->isFastTrack()) {
         int index = track->mFastIndex;
         ALOG_ASSERT(0 < index && index < (int)FastMixerState::sMaxFastTracks);
@@ -2712,8 +2718,8 @@
                     audio_utils::metadata::byteStringFromData(metadata);
             std::vector metadataVec(metaDataStr.begin(), metaDataStr.end());
             Mutex::Autolock _l(mAudioTrackCbLock);
-            for (const auto& callback : mAudioTrackCallbacks) {
-                callback->onCodecFormatChanged(metadataVec);
+            for (const auto& callbackPair : mAudioTrackCallbacks) {
+                callbackPair.second->onCodecFormatChanged(metadataVec);
             }
     }).detach();
 }
@@ -7911,7 +7917,8 @@
         AutoMutex lock(mLock);
         if (recordTrack->isInvalid()) {
             recordTrack->clearSyncStartEvent();
-            return INVALID_OPERATION;
+            ALOGW("%s track %d: invalidated before startInput", __func__, recordTrack->portId());
+            return DEAD_OBJECT;
         }
         if (mActiveTracks.indexOf(recordTrack) >= 0) {
             if (recordTrack->mState == TrackBase::PAUSING) {
@@ -7941,7 +7948,8 @@
                     recordTrack->mState = TrackBase::STARTING_2;
                     // STARTING_2 forces destroy to call stopInput.
                 }
-                return INVALID_OPERATION;
+                ALOGW("%s track %d: invalidated after startInput", __func__, recordTrack->portId());
+                return DEAD_OBJECT;
             }
             if (recordTrack->mState != TrackBase::STARTING_1) {
                 ALOGW("%s(%d): unsynchronized mState:%d change",
@@ -8773,7 +8781,6 @@
 
 AudioFlinger::MmapThread::~MmapThread()
 {
-    releaseWakeLock_l();
 }
 
 void AudioFlinger::MmapThread::onFirstRef()
@@ -8823,7 +8830,6 @@
         return NO_INIT;
     }
     mStandby = true;
-    acquireWakeLock();
     return mHalStream->createMmapBuffer(minSizeFrames, info);
 }
 
@@ -8862,8 +8868,12 @@
     status_t ret;
 
     if (*handle == mPortId) {
-        // for the first track, reuse portId and session allocated when the stream was opened
-        return exitStandby();
+        // For the first track, reuse portId and session allocated when the stream was opened.
+        ret = exitStandby();
+        if (ret == NO_ERROR) {
+            acquireWakeLock();
+        }
+        return ret;
     }
 
     audio_port_handle_t portId = AUDIO_PORT_HANDLE_NONE;
@@ -8984,6 +8994,7 @@
 
     if (handle == mPortId) {
         mHalStream->stop();
+        releaseWakeLock();
         return NO_ERROR;
     }
 
diff --git a/services/audioflinger/Threads.h b/services/audioflinger/Threads.h
index ac41e82..7db7c86 100644
--- a/services/audioflinger/Threads.h
+++ b/services/audioflinger/Threads.h
@@ -884,7 +884,8 @@
                                 uid_t uid,
                                 status_t *status /*non-NULL*/,
                                 audio_port_handle_t portId,
-                                const sp<media::IAudioTrackCallback>& callback);
+                                const sp<media::IAudioTrackCallback>& callback,
+                                const std::string& opPackageName);
 
                 AudioStreamOut* getOutput() const;
                 AudioStreamOut* clearOutput();
@@ -1218,7 +1219,7 @@
 
     Mutex                                    mAudioTrackCbLock;
     // Record of IAudioTrackCallback
-    std::set<sp<media::IAudioTrackCallback>> mAudioTrackCallbacks;
+    std::map<sp<Track>, sp<media::IAudioTrackCallback>> mAudioTrackCallbacks;
 
 private:
     // The HAL output sink is treated as non-blocking, but current implementation is blocking
diff --git a/services/audioflinger/Tracks.cpp b/services/audioflinger/Tracks.cpp
index c92bce5..fbfe077 100644
--- a/services/audioflinger/Tracks.cpp
+++ b/services/audioflinger/Tracks.cpp
@@ -386,11 +386,12 @@
 // static
 sp<AudioFlinger::PlaybackThread::OpPlayAudioMonitor>
 AudioFlinger::PlaybackThread::OpPlayAudioMonitor::createIfNeeded(
-            uid_t uid, const audio_attributes_t& attr, int id, audio_stream_type_t streamType)
+            uid_t uid, const audio_attributes_t& attr, int id, audio_stream_type_t streamType,
+            const std::string& opPackageName)
 {
+    Vector <String16> packages;
+    getPackagesForUid(uid, packages);
     if (isServiceUid(uid)) {
-        Vector <String16> packages;
-        getPackagesForUid(uid, packages);
         if (packages.isEmpty()) {
             ALOGD("OpPlayAudio: not muting track:%d usage:%d for service UID %d",
                   id,
@@ -410,12 +411,32 @@
             id, attr.flags);
         return nullptr;
     }
-    return new OpPlayAudioMonitor(uid, attr.usage, id);
+
+    String16 opPackageNameStr(opPackageName.c_str());
+    if (opPackageName.empty()) {
+        // If no package name is provided by the client, use the first associated with the uid
+        if (!packages.isEmpty()) {
+            opPackageNameStr = packages[0];
+        }
+    } else {
+        // If the provided package name is invalid, we force app ops denial by clearing the package
+        // name passed to OpPlayAudioMonitor
+        if (std::find_if(packages.begin(), packages.end(),
+                [&opPackageNameStr](const auto& package) {
+                return opPackageNameStr == package; }) == packages.end()) {
+            ALOGW("The package name(%s) provided does not correspond to the uid %d, "
+                  "force muting the track", opPackageName.c_str(), uid);
+            // Set package name as an empty string so that hasOpPlayAudio will always return false.
+            opPackageNameStr = String16("");
+        }
+    }
+    return new OpPlayAudioMonitor(uid, attr.usage, id, opPackageNameStr);
 }
 
 AudioFlinger::PlaybackThread::OpPlayAudioMonitor::OpPlayAudioMonitor(
-        uid_t uid, audio_usage_t usage, int id)
-        : mHasOpPlayAudio(true), mUid(uid), mUsage((int32_t) usage), mId(id)
+        uid_t uid, audio_usage_t usage, int id, const String16& opPackageName)
+        : mHasOpPlayAudio(true), mUid(uid), mUsage((int32_t) usage), mId(id),
+          mOpPackageName(opPackageName)
 {
 }
 
@@ -429,11 +450,10 @@
 
 void AudioFlinger::PlaybackThread::OpPlayAudioMonitor::onFirstRef()
 {
-    getPackagesForUid(mUid, mPackages);
     checkPlayAudioForUsage();
-    if (!mPackages.isEmpty()) {
+    if (mOpPackageName.size() != 0) {
         mOpCallback = new PlayAudioOpCallback(this);
-        mAppOpsManager.startWatchingMode(AppOpsManager::OP_PLAY_AUDIO, mPackages[0], mOpCallback);
+        mAppOpsManager.startWatchingMode(AppOpsManager::OP_PLAY_AUDIO, mOpPackageName, mOpCallback);
     }
 }
 
@@ -446,18 +466,11 @@
 // - not called from PlayAudioOpCallback because the callback is not installed in this case
 void AudioFlinger::PlaybackThread::OpPlayAudioMonitor::checkPlayAudioForUsage()
 {
-    if (mPackages.isEmpty()) {
+    if (mOpPackageName.size() == 0) {
         mHasOpPlayAudio.store(false);
     } else {
-        bool hasIt = true;
-        for (const String16& packageName : mPackages) {
-            const int32_t mode = mAppOpsManager.checkAudioOpNoThrow(AppOpsManager::OP_PLAY_AUDIO,
-                    mUsage, mUid, packageName);
-            if (mode != AppOpsManager::MODE_ALLOWED) {
-                hasIt = false;
-                break;
-            }
-        }
+        bool hasIt = mAppOpsManager.checkAudioOpNoThrow(AppOpsManager::OP_PLAY_AUDIO,
+                    mUsage, mUid, mOpPackageName) == AppOpsManager::MODE_ALLOWED;
         ALOGD("OpPlayAudio: track:%d usage:%d %smuted", mId, mUsage, hasIt ? "not " : "");
         mHasOpPlayAudio.store(hasIt);
     }
@@ -511,7 +524,8 @@
             audio_output_flags_t flags,
             track_type type,
             audio_port_handle_t portId,
-            size_t frameCountToBeReady)
+            size_t frameCountToBeReady,
+            const std::string opPackageName)
     :   TrackBase(thread, client, attr, sampleRate, format, channelMask, frameCount,
                   // TODO: Using unsecurePointer() has some associated security pitfalls
                   //       (see declaration for details).
@@ -534,7 +548,8 @@
     mPresentationCompleteFrames(0),
     mFrameMap(16 /* sink-frame-to-track-frame map memory */),
     mVolumeHandler(new media::VolumeHandler(sampleRate)),
-    mOpPlayAudioMonitor(OpPlayAudioMonitor::createIfNeeded(uid, attr, id(), streamType)),
+    mOpPlayAudioMonitor(OpPlayAudioMonitor::createIfNeeded(
+            uid, attr, id(), streamType, opPackageName)),
     // mSinkTimestamp
     mFrameCountToBeReady(frameCountToBeReady),
     mFastIndex(-1),
@@ -601,7 +616,7 @@
         // external vibration is always created for all tracks attached to haptic playback thread.
         mAudioVibrationController = new AudioVibrationController(this);
         mExternalVibration = new os::ExternalVibration(
-                mUid, "" /* pkg */, mAttr, mAudioVibrationController);
+                mUid, opPackageName, mAttr, mAudioVibrationController);
     }
 
     // Once this item is logged by the server, the client can add properties.
@@ -2229,7 +2244,8 @@
         RecordThread *recordThread = (RecordThread *)thread.get();
         return recordThread->start(this, event, triggerSession);
     } else {
-        return BAD_VALUE;
+        ALOGW("%s track %d: thread was destroyed", __func__, portId());
+        return DEAD_OBJECT;
     }
 }
 
diff --git a/services/audiopolicy/AudioPolicyInterface.h b/services/audiopolicy/AudioPolicyInterface.h
index 0f3ed14..93819f5 100644
--- a/services/audiopolicy/AudioPolicyInterface.h
+++ b/services/audiopolicy/AudioPolicyInterface.h
@@ -306,6 +306,25 @@
     virtual status_t getDevicesForRoleAndStrategy(product_strategy_t strategy,
                                                   device_role_t role,
                                                   AudioDeviceTypeAddrVector &devices) = 0;
+
+    virtual status_t setDevicesRoleForCapturePreset(audio_source_t audioSource,
+                                                    device_role_t role,
+                                                    const AudioDeviceTypeAddrVector &devices) = 0;
+
+    virtual status_t addDevicesRoleForCapturePreset(audio_source_t audioSource,
+                                                    device_role_t role,
+                                                    const AudioDeviceTypeAddrVector &devices) = 0;
+
+    virtual status_t removeDevicesRoleForCapturePreset(
+            audio_source_t audioSource, device_role_t role,
+            const AudioDeviceTypeAddrVector& devices) = 0;
+
+    virtual status_t clearDevicesRoleForCapturePreset(audio_source_t audioSource,
+                                                      device_role_t role) = 0;
+
+    virtual status_t getDevicesForRoleAndCapturePreset(audio_source_t audioSource,
+                                                       device_role_t role,
+                                                       AudioDeviceTypeAddrVector &devices) = 0;
 };
 
 
diff --git a/services/audiopolicy/common/managerdefinitions/include/ClientDescriptor.h b/services/audiopolicy/common/managerdefinitions/include/ClientDescriptor.h
index 923310c..80afe9d 100644
--- a/services/audiopolicy/common/managerdefinitions/include/ClientDescriptor.h
+++ b/services/audiopolicy/common/managerdefinitions/include/ClientDescriptor.h
@@ -113,6 +113,9 @@
     const sp<AudioPolicyMix> getPrimaryMix() const {
         return mPrimaryMix.promote();
     };
+    bool hasLostPrimaryMix() const {
+        return mPrimaryMix.unsafe_get() && !mPrimaryMix.promote();
+    }
 
     void setActive(bool active) override
     {
diff --git a/services/audiopolicy/config/audio_policy_configuration.xml b/services/audiopolicy/config/audio_policy_configuration.xml
index b28381b..dcdc035 100644
--- a/services/audiopolicy/config/audio_policy_configuration.xml
+++ b/services/audiopolicy/config/audio_policy_configuration.xml
@@ -91,7 +91,7 @@
                 <!-- Output devices declaration, i.e. Sink DEVICE PORT -->
                 <devicePort tagName="Earpiece" type="AUDIO_DEVICE_OUT_EARPIECE" role="sink">
                    <profile name="" format="AUDIO_FORMAT_PCM_16_BIT"
-                            samplingRates="48000" channelMasks="AUDIO_CHANNEL_IN_MONO"/>
+                            samplingRates="48000" channelMasks="AUDIO_CHANNEL_OUT_MONO"/>
                 </devicePort>
                 <devicePort tagName="Speaker" role="sink" type="AUDIO_DEVICE_OUT_SPEAKER" address="">
                     <profile name="" format="AUDIO_FORMAT_PCM_16_BIT"
diff --git a/services/audiopolicy/config/audio_policy_configuration_7_0.xml b/services/audiopolicy/config/audio_policy_configuration_7_0.xml
index 6087bf2..a9ecff3 100644
--- a/services/audiopolicy/config/audio_policy_configuration_7_0.xml
+++ b/services/audiopolicy/config/audio_policy_configuration_7_0.xml
@@ -91,7 +91,7 @@
                 <!-- Output devices declaration, i.e. Sink DEVICE PORT -->
                 <devicePort tagName="Earpiece" type="AUDIO_DEVICE_OUT_EARPIECE" role="sink">
                    <profile name="" format="AUDIO_FORMAT_PCM_16_BIT"
-                            samplingRates="48000" channelMasks="AUDIO_CHANNEL_IN_MONO"/>
+                            samplingRates="48000" channelMasks="AUDIO_CHANNEL_OUT_MONO"/>
                 </devicePort>
                 <devicePort tagName="Speaker" role="sink" type="AUDIO_DEVICE_OUT_SPEAKER" address="">
                     <profile name="" format="AUDIO_FORMAT_PCM_16_BIT"
diff --git a/services/audiopolicy/engine/common/Android.bp b/services/audiopolicy/engine/common/Android.bp
old mode 100755
new mode 100644
diff --git a/services/audiopolicy/engine/common/include/EngineBase.h b/services/audiopolicy/engine/common/include/EngineBase.h
old mode 100755
new mode 100644
index 804a802..4510f63
--- a/services/audiopolicy/engine/common/include/EngineBase.h
+++ b/services/audiopolicy/engine/common/include/EngineBase.h
@@ -127,11 +127,36 @@
 
     status_t restoreOriginVolumeCurve(audio_stream_type_t stream);
 
+    status_t setDevicesRoleForCapturePreset(audio_source_t audioSource, device_role_t role,
+            const AudioDeviceTypeAddrVector &devices) override;
+
+    status_t addDevicesRoleForCapturePreset(audio_source_t audioSource, device_role_t role,
+            const AudioDeviceTypeAddrVector &devices) override;
+
+    /**
+     * Remove devices role for capture preset. When `forceMatched` is true, the devices to be
+     * removed must all show as role for the capture preset. Otherwise, only devices that has shown
+     * as role for the capture preset will be remove.
+     */
+    status_t doRemoveDevicesRoleForCapturePreset(audio_source_t audioSource,
+            device_role_t role, const AudioDeviceTypeAddrVector& devices,
+            bool forceMatched=true);
+
+    status_t removeDevicesRoleForCapturePreset(audio_source_t audioSource,
+            device_role_t role, const AudioDeviceTypeAddrVector& devices) override;
+
+    status_t clearDevicesRoleForCapturePreset(audio_source_t audioSource,
+            device_role_t role) override;
+
+    status_t getDevicesForRoleAndCapturePreset(audio_source_t audioSource,
+            device_role_t role, AudioDeviceTypeAddrVector &devices) const override;
+
 private:
     AudioPolicyManagerObserver *mApmObserver = nullptr;
 
     ProductStrategyMap mProductStrategies;
     ProductStrategyPreferredRoutingMap mProductStrategyPreferredDevices;
+    CapturePresetDevicesRoleMap mCapturePresetDevicesRole;
     VolumeGroupMap mVolumeGroups;
     LastRemovableMediaDevices mLastRemovableMediaDevices;
     audio_mode_t mPhoneState = AUDIO_MODE_NORMAL;  /**< current phone state. */
diff --git a/services/audiopolicy/engine/common/include/LastRemovableMediaDevices.h b/services/audiopolicy/engine/common/include/LastRemovableMediaDevices.h
old mode 100755
new mode 100644
diff --git a/services/audiopolicy/engine/common/src/EngineBase.cpp b/services/audiopolicy/engine/common/src/EngineBase.cpp
index ae4f7f4..1875c10 100644
--- a/services/audiopolicy/engine/common/src/EngineBase.cpp
+++ b/services/audiopolicy/engine/common/src/EngineBase.cpp
@@ -19,6 +19,7 @@
 
 #include "EngineBase.h"
 #include "EngineDefaultConfig.h"
+#include "../include/EngineBase.h"
 #include <TypeConverter.h>
 
 namespace android {
@@ -423,6 +424,171 @@
     return NO_ERROR;
 }
 
+status_t EngineBase::setDevicesRoleForCapturePreset(audio_source_t audioSource, device_role_t role,
+        const AudioDeviceTypeAddrVector &devices)
+{
+    // verify if the audio source is valid
+    if (!audio_is_valid_audio_source(audioSource)) {
+        ALOGE("%s unknown audio source %u", __func__, audioSource);
+    }
+
+    switch (role) {
+    case DEVICE_ROLE_PREFERRED:
+        mCapturePresetDevicesRole[audioSource][role] = devices;
+        // When the devices are set as preferred devices, remove them from the disabled devices.
+        doRemoveDevicesRoleForCapturePreset(
+                audioSource, DEVICE_ROLE_DISABLED, devices, false /*forceMatched*/);
+        break;
+    case DEVICE_ROLE_DISABLED:
+        // TODO: support setting devices role as disabled for capture preset.
+        ALOGI("%s no implemented for role as %d", __func__, role);
+        break;
+    case DEVICE_ROLE_NONE:
+        // Intentionally fall-through as it is no need to set device role as none
+    default:
+        ALOGE("%s invalid role %d", __func__, role);
+        return BAD_VALUE;
+    }
+    return NO_ERROR;
+}
+
+status_t EngineBase::addDevicesRoleForCapturePreset(audio_source_t audioSource, device_role_t role,
+        const AudioDeviceTypeAddrVector &devices)
+{
+    // verify if the audio source is valid
+    if (!audio_is_valid_audio_source(audioSource)) {
+        ALOGE("%s unknown audio source %u", __func__, audioSource);
+    }
+
+    switch (role) {
+    case DEVICE_ROLE_PREFERRED:
+        mCapturePresetDevicesRole[audioSource][role] = excludeDeviceTypeAddrsFrom(
+                mCapturePresetDevicesRole[audioSource][role], devices);
+        for (const auto& device : devices) {
+            mCapturePresetDevicesRole[audioSource][role].push_back(device);
+        }
+        // When the devices are set as preferred devices, remove them from the disabled devices.
+        doRemoveDevicesRoleForCapturePreset(
+                audioSource, DEVICE_ROLE_DISABLED, devices, false /*forceMatched*/);
+        break;
+    case DEVICE_ROLE_DISABLED:
+        // TODO: support setting devices role as disabled for capture preset.
+        ALOGI("%s no implemented for role as %d", __func__, role);
+        break;
+    case DEVICE_ROLE_NONE:
+        // Intentionally fall-through as it is no need to set device role as none
+    default:
+        ALOGE("%s invalid role %d", __func__, role);
+        return BAD_VALUE;
+    }
+    return NO_ERROR;
+}
+
+status_t EngineBase::removeDevicesRoleForCapturePreset(
+        audio_source_t audioSource, device_role_t role, const AudioDeviceTypeAddrVector& devices) {
+    return doRemoveDevicesRoleForCapturePreset(audioSource, role, devices);
+}
+
+status_t EngineBase::doRemoveDevicesRoleForCapturePreset(audio_source_t audioSource,
+        device_role_t role, const AudioDeviceTypeAddrVector& devices, bool forceMatched)
+{
+    // verify if the audio source is valid
+    if (!audio_is_valid_audio_source(audioSource)) {
+        ALOGE("%s unknown audio source %u", __func__, audioSource);
+    }
+
+    switch (role) {
+    case DEVICE_ROLE_PREFERRED:
+    case DEVICE_ROLE_DISABLED: {
+        if (mCapturePresetDevicesRole.count(audioSource) == 0 ||
+                mCapturePresetDevicesRole[audioSource].count(role) == 0) {
+            return NAME_NOT_FOUND;
+        }
+        AudioDeviceTypeAddrVector remainingDevices = excludeDeviceTypeAddrsFrom(
+                mCapturePresetDevicesRole[audioSource][role], devices);
+        if (forceMatched && remainingDevices.size() !=
+                mCapturePresetDevicesRole[audioSource][role].size() - devices.size()) {
+            // There are some devices from `devicesToRemove` that are not shown in the cached record
+            return BAD_VALUE;
+        }
+        mCapturePresetDevicesRole[audioSource][role] = remainingDevices;
+        if (mCapturePresetDevicesRole[audioSource][role].empty()) {
+            // Remove the role when device list is empty
+            mCapturePresetDevicesRole[audioSource].erase(role);
+        }
+    } break;
+    case DEVICE_ROLE_NONE:
+        // Intentionally fall-through as it makes no sense to remove devices with
+        // role as DEVICE_ROLE_NONE
+    default:
+        ALOGE("%s invalid role %d", __func__, role);
+        return BAD_VALUE;
+    }
+    return NO_ERROR;
+}
+
+status_t EngineBase::clearDevicesRoleForCapturePreset(audio_source_t audioSource,
+                                                      device_role_t role)
+{
+    // verify if the audio source is valid
+    if (!audio_is_valid_audio_source(audioSource)) {
+        ALOGE("%s unknown audio source %u", __func__, audioSource);
+    }
+
+    switch (role) {
+    case DEVICE_ROLE_PREFERRED:
+        if (mCapturePresetDevicesRole.count(audioSource) == 0 ||
+                mCapturePresetDevicesRole[audioSource].erase(role) == 0) {
+            // no preferred device for the given audio source
+            return NAME_NOT_FOUND;
+        }
+        break;
+    case DEVICE_ROLE_DISABLED:
+        // TODO: support remove devices role as disabled for strategy.
+        ALOGI("%s no implemented for role as %d", __func__, role);
+        break;
+    case DEVICE_ROLE_NONE:
+        // Intentionally fall-through as it makes no sense to remove devices with
+        // role as DEVICE_ROLE_NONE for a strategy
+    default:
+        ALOGE("%s invalid role %d", __func__, role);
+        return BAD_VALUE;
+    }
+    return NO_ERROR;
+}
+
+status_t EngineBase::getDevicesForRoleAndCapturePreset(audio_source_t audioSource,
+        device_role_t role, AudioDeviceTypeAddrVector &devices) const
+{
+    // verify if the audio source is valid
+    if (!audio_is_valid_audio_source(audioSource)) {
+        ALOGE("%s unknown audio source %u", __func__, audioSource);
+        return BAD_VALUE;
+    }
+
+    switch (role) {
+    case DEVICE_ROLE_PREFERRED:
+    case DEVICE_ROLE_DISABLED: {
+        if (mCapturePresetDevicesRole.count(audioSource) == 0) {
+            return NAME_NOT_FOUND;
+        }
+        auto devIt = mCapturePresetDevicesRole.at(audioSource).find(role);
+        if (devIt == mCapturePresetDevicesRole.at(audioSource).end()) {
+            ALOGV("%s no devices role(%d) for capture preset %u", __func__, role, audioSource);
+            return NAME_NOT_FOUND;
+        }
+
+        devices = devIt->second;
+    } break;
+    case DEVICE_ROLE_NONE:
+        // Intentionally fall-through as the DEVICE_ROLE_NONE is never set
+    default:
+        ALOGE("%s invalid role %d", __func__, role);
+        return BAD_VALUE;
+    }
+    return NO_ERROR;
+}
+
 void EngineBase::dump(String8 *dst) const
 {
     mProductStrategies.dump(dst, 2);
diff --git a/services/audiopolicy/engine/common/src/LastRemovableMediaDevices.cpp b/services/audiopolicy/engine/common/src/LastRemovableMediaDevices.cpp
old mode 100755
new mode 100644
diff --git a/services/audiopolicy/engine/interface/EngineInterface.h b/services/audiopolicy/engine/interface/EngineInterface.h
index d45e71c..f64608d 100644
--- a/services/audiopolicy/engine/interface/EngineInterface.h
+++ b/services/audiopolicy/engine/interface/EngineInterface.h
@@ -34,6 +34,8 @@
 using DeviceStrategyMap = std::map<product_strategy_t, DeviceVector>;
 using StrategyVector = std::vector<product_strategy_t>;
 using VolumeGroupVector = std::vector<volume_group_t>;
+using CapturePresetDevicesRoleMap =
+        std::map<audio_source_t, std::map<device_role_t, AudioDeviceTypeAddrVector>>;
 
 /**
  * This interface is dedicated to the policy manager that a Policy Engine shall implement.
@@ -332,6 +334,75 @@
     virtual status_t getDevicesForRoleAndStrategy(product_strategy_t strategy, device_role_t role,
             AudioDeviceTypeAddrVector &devices) const = 0;
 
+    /**
+     * @brief setDevicesRoleForCapturePreset sets devices role for a capture preset when available.
+     * To remove devices role, removeDevicesRoleForCapturePreset must be called. Calling
+     * clearDevicesRoleForCapturePreset will remove all devices as role. When devices role is set
+     * successfully, previously set devices for the same role and capture preset will be removed.
+     * @param audioSource the audio capture preset whose routing will be affected
+     * @param role the role of the devices for the capture preset. All device roles are defined at
+     *             system/media/audio/include/system/audio_policy.h. DEVICE_ROLE_NONE is invalid
+     *             for setting.
+     * @param devices the audio devices to be set
+     * @return BAD_VALUE if the capture preset or role is invalid,
+     *     or NO_ERROR if the role of the devices for capture preset was set
+     */
+    virtual status_t setDevicesRoleForCapturePreset(audio_source_t audioSource, device_role_t role,
+            const AudioDeviceTypeAddrVector &devices) = 0;
+
+    /**
+     * @brief addDevicesRoleForCapturePreset adds devices role for a capture preset when available.
+     * To remove devices role, removeDevicesRoleForCapturePreset must be called. Calling
+     * clearDevicesRoleForCapturePreset will remove all devices as role.
+     * @param audioSource the audio capture preset whose routing will be affected
+     * @param role the role of the devices for the capture preset. All device roles are defined at
+     *             system/media/audio/include/system/audio_policy.h. DEVICE_ROLE_NONE is invalid
+     *             for setting.
+     * @param devices the audio devices to be added
+     * @return BAD_VALUE if the capture preset or role is invalid,
+     *     or NO_ERROR if the role of the devices for capture preset was added
+     */
+    virtual status_t addDevicesRoleForCapturePreset(audio_source_t audioSource, device_role_t role,
+            const AudioDeviceTypeAddrVector &devices) = 0;
+
+    /**
+     * @brief removeDevicesRoleForCapturePreset removes the role of device(s) previously set
+     * for the given capture preset
+     * @param audioSource the audio capture preset whose routing will be affected
+     * @param role the role of the devices for the capture preset
+     * @param devices the devices to be removed
+     * @return BAD_VALUE if 1) the capture preset is invalid, 2) role is invalid or 3) the list of
+     *     devices to be removed are not all present as role for a capture preset
+     *     or NO_ERROR if the devices for this role was removed
+     */
+    virtual status_t removeDevicesRoleForCapturePreset(audio_source_t audioSource,
+            device_role_t role, const AudioDeviceTypeAddrVector& devices) = 0;
+
+    /**
+     * @brief clearDevicesRoleForCapturePreset removes the role of all device(s) previously set
+     * for the given capture preset
+     * @param audioSource the audio capture preset whose routing will be affected
+     * @param role the role of the devices for the capture preset
+     * @return BAD_VALUE if the capture preset or role is invalid,
+     *     or NO_ERROR if the devices for this role was removed
+     */
+    virtual status_t clearDevicesRoleForCapturePreset(audio_source_t audioSource,
+            device_role_t role);
+
+    /**
+     * @brief getDevicesForRoleAndCapturePreset queries which devices have the specified role for
+     * the specified capture preset
+     * @param audioSource the capture preset to query
+     * @param role the role of the devices to query
+     * @param devices returns list of devices with matching role for the specified capture preset.
+     *                DEVICE_ROLE_NONE is invalid as input.
+     * @return BAD_VALUE if the capture preset or role is invalid,
+     *     or NAME_NOT_FOUND if no device for the role and capture preset was set
+     *     or NO_ERROR if the devices parameter contains a list of devices
+     */
+    virtual status_t getDevicesForRoleAndCapturePreset(audio_source_t audioSource,
+            device_role_t role, AudioDeviceTypeAddrVector &devices) const = 0;
+
 
     virtual void dump(String8 *dst) const = 0;
 
diff --git a/services/audiopolicy/engineconfigurable/tools/buildCommonTypesStructureFile.py b/services/audiopolicy/engineconfigurable/tools/buildCommonTypesStructureFile.py
index 9a7fa8f..f060d45 100755
--- a/services/audiopolicy/engineconfigurable/tools/buildCommonTypesStructureFile.py
+++ b/services/audiopolicy/engineconfigurable/tools/buildCommonTypesStructureFile.py
@@ -52,13 +52,19 @@
 def findBitPos(decimal):
     pos = 0
     i = 1
-    while i != decimal:
+    while i < decimal:
         i = i << 1
         pos = pos + 1
         if pos == 32:
             return -1
-    return pos
 
+    # TODO: b/168065706. This is just to fix the build. That the problem of devices with
+    # multiple bits set must be addressed more generally in the configurable audio policy
+    # and parameter framework.
+    if i > decimal:
+        logging.info("Device:{} which has multiple bits set is skipped. b/168065706".format(decimal))
+        return -2
+    return pos
 
 def generateXmlStructureFile(componentTypeDict, structureTypesFile, outputFile):
 
@@ -74,10 +80,12 @@
                 if bitparameters_node is not None:
                     ordered_values = OrderedDict(sorted(values_dict.items(), key=lambda x: x[1]))
                     for key, value in ordered_values.items():
-                        value_node = ET.SubElement(bitparameters_node, "BitParameter")
-                        value_node.set('Name', key)
-                        value_node.set('Size', "1")
-                        value_node.set('Pos', str(findBitPos(value)))
+                        pos = findBitPos(value)
+                        if pos >= 0:
+                            value_node = ET.SubElement(bitparameters_node, "BitParameter")
+                            value_node.set('Name', key)
+                            value_node.set('Size', "1")
+                            value_node.set('Pos', str(pos))
 
                 enum_parameter_node = component_type.find("EnumParameter")
                 if enum_parameter_node is not None:
diff --git a/services/audiopolicy/enginedefault/src/Engine.cpp b/services/audiopolicy/enginedefault/src/Engine.cpp
old mode 100755
new mode 100644
diff --git a/services/audiopolicy/managerdefault/AudioPolicyManager.cpp b/services/audiopolicy/managerdefault/AudioPolicyManager.cpp
index 84687fd..fc3b2a2 100644
--- a/services/audiopolicy/managerdefault/AudioPolicyManager.cpp
+++ b/services/audiopolicy/managerdefault/AudioPolicyManager.cpp
@@ -2281,7 +2281,7 @@
     sp<AudioInputDescriptor> inputDesc = mInputs.getInputForClient(portId);
     if (inputDesc == 0) {
         ALOGW("%s no input for client %d", __FUNCTION__, portId);
-        return BAD_VALUE;
+        return DEAD_OBJECT;
     }
     audio_io_handle_t input = inputDesc->mIoHandle;
     sp<RecordClientDescriptor> client = inputDesc->getClient(portId);
@@ -3116,7 +3116,7 @@
                 devices[i].mType, devices[i].getAddress(), String8(),
                 AUDIO_FORMAT_DEFAULT, false /*allowToCreate*/, true /*matchAddress*/);
         if (devDesc == nullptr || (predicate != nullptr && !predicate(devices[i].mType))) {
-            ALOGE("%s: device type %#x address %s not supported or not an output device",
+            ALOGE("%s: device type %#x address %s not supported or not match predicate",
                     context, devices[i].mType, devices[i].getAddress());
             return false;
         }
@@ -3228,6 +3228,72 @@
     return mEngine->getDevicesForRoleAndStrategy(strategy, role, devices);
 }
 
+status_t AudioPolicyManager::setDevicesRoleForCapturePreset(
+        audio_source_t audioSource, device_role_t role, const AudioDeviceTypeAddrVector &devices) {
+    ALOGV("%s() audioSource=%d role=%d %s", __func__, audioSource, role,
+            dumpAudioDeviceTypeAddrVector(devices).c_str());
+
+    if (!areAllDevicesSupported(devices, audio_is_input_device, __func__)) {
+        return BAD_VALUE;
+    }
+    status_t status = mEngine->setDevicesRoleForCapturePreset(audioSource, role, devices);
+    ALOGW_IF(status != NO_ERROR,
+            "Engine could not set preferred devices %s for audio source %d role %d",
+            dumpAudioDeviceTypeAddrVector(devices).c_str(), audioSource, role);
+
+    return status;
+}
+
+status_t AudioPolicyManager::addDevicesRoleForCapturePreset(
+        audio_source_t audioSource, device_role_t role, const AudioDeviceTypeAddrVector &devices) {
+    ALOGV("%s() audioSource=%d role=%d %s", __func__, audioSource, role,
+            dumpAudioDeviceTypeAddrVector(devices).c_str());
+
+    if (!areAllDevicesSupported(devices, audio_is_input_device, __func__)) {
+        return BAD_VALUE;
+    }
+    status_t status = mEngine->addDevicesRoleForCapturePreset(audioSource, role, devices);
+    ALOGW_IF(status != NO_ERROR,
+            "Engine could not add preferred devices %s for audio source %d role %d",
+            dumpAudioDeviceTypeAddrVector(devices).c_str(), audioSource, role);
+
+    return status;
+}
+
+status_t AudioPolicyManager::removeDevicesRoleForCapturePreset(
+        audio_source_t audioSource, device_role_t role, const AudioDeviceTypeAddrVector& devices)
+{
+    ALOGV("%s() audioSource=%d role=%d devices=%s", __func__, audioSource, role,
+            dumpAudioDeviceTypeAddrVector(devices).c_str());
+
+    if (!areAllDevicesSupported(devices, audio_is_input_device, __func__)) {
+        return BAD_VALUE;
+    }
+
+    status_t status = mEngine->removeDevicesRoleForCapturePreset(
+            audioSource, role, devices);
+    ALOGW_IF(status != NO_ERROR,
+            "Engine could not remove devices role (%d) for capture preset %d", role, audioSource);
+
+    return status;
+}
+
+status_t AudioPolicyManager::clearDevicesRoleForCapturePreset(audio_source_t audioSource,
+                                                              device_role_t role) {
+    ALOGV("%s() audioSource=%d role=%d", __func__, audioSource, role);
+
+    status_t status = mEngine->clearDevicesRoleForCapturePreset(audioSource, role);
+    ALOGW_IF(status != NO_ERROR,
+            "Engine could not clear devices role (%d) for capture preset %d", role, audioSource);
+
+    return status;
+}
+
+status_t AudioPolicyManager::getDevicesForRoleAndCapturePreset(
+        audio_source_t audioSource, device_role_t role, AudioDeviceTypeAddrVector &devices) {
+    return mEngine->getDevicesForRoleAndCapturePreset(audioSource, role, devices);
+}
+
 status_t AudioPolicyManager::setUserIdDeviceAffinities(int userId,
         const AudioDeviceTypeAddrVector& devices) {
     ALOGI("%s() userId=%d num devices %zu", __func__, userId, devices.size());
@@ -5288,7 +5354,7 @@
             if (status != OK) {
                 continue;
             }
-            if (client->getPrimaryMix() != primaryMix) {
+            if (client->getPrimaryMix() != primaryMix || client->hasLostPrimaryMix()) {
                 invalidate = true;
                 if (desc->isStrategyActive(psId)) {
                     maxLatency = desc->latency();
diff --git a/services/audiopolicy/managerdefault/AudioPolicyManager.h b/services/audiopolicy/managerdefault/AudioPolicyManager.h
index 11077f1..217013f 100644
--- a/services/audiopolicy/managerdefault/AudioPolicyManager.h
+++ b/services/audiopolicy/managerdefault/AudioPolicyManager.h
@@ -281,6 +281,25 @@
                                                       device_role_t role,
                                                       AudioDeviceTypeAddrVector &devices);
 
+        virtual status_t setDevicesRoleForCapturePreset(audio_source_t audioSource,
+                                                        device_role_t role,
+                                                        const AudioDeviceTypeAddrVector &devices);
+
+        virtual status_t addDevicesRoleForCapturePreset(audio_source_t audioSource,
+                                                        device_role_t role,
+                                                        const AudioDeviceTypeAddrVector &devices);
+
+        virtual status_t removeDevicesRoleForCapturePreset(
+                audio_source_t audioSource, device_role_t role,
+                const AudioDeviceTypeAddrVector& devices);
+
+        virtual status_t clearDevicesRoleForCapturePreset(audio_source_t audioSource,
+                                                          device_role_t role);
+
+        virtual status_t getDevicesForRoleAndCapturePreset(audio_source_t audioSource,
+                                                           device_role_t role,
+                                                           AudioDeviceTypeAddrVector &devices);
+
         virtual status_t startAudioSource(const struct audio_port_config *source,
                                           const audio_attributes_t *attributes,
                                           audio_port_handle_t *portId,
diff --git a/services/audiopolicy/service/AudioPolicyInterfaceImpl.cpp b/services/audiopolicy/service/AudioPolicyInterfaceImpl.cpp
index 7d1ad63..14e5236 100644
--- a/services/audiopolicy/service/AudioPolicyInterfaceImpl.cpp
+++ b/services/audiopolicy/service/AudioPolicyInterfaceImpl.cpp
@@ -1534,4 +1534,55 @@
     return NO_ERROR;
 }
 
+status_t AudioPolicyService::setDevicesRoleForCapturePreset(
+        audio_source_t audioSource, device_role_t role, const AudioDeviceTypeAddrVector &devices)
+{
+    if (mAudioPolicyManager == nullptr) {
+        return NO_INIT;
+    }
+    Mutex::Autolock _l(mLock);
+    return mAudioPolicyManager->setDevicesRoleForCapturePreset(audioSource, role, devices);
+}
+
+status_t AudioPolicyService::addDevicesRoleForCapturePreset(
+        audio_source_t audioSource, device_role_t role, const AudioDeviceTypeAddrVector &devices)
+{
+    if (mAudioPolicyManager == nullptr) {
+        return NO_INIT;
+    }
+    Mutex::Autolock _l(mLock);
+    return mAudioPolicyManager->addDevicesRoleForCapturePreset(audioSource, role, devices);
+}
+
+status_t AudioPolicyService::removeDevicesRoleForCapturePreset(
+        audio_source_t audioSource, device_role_t role, const AudioDeviceTypeAddrVector& devices)
+{
+    if (mAudioPolicyManager == nullptr) {
+        return NO_INIT;
+    }
+    Mutex::Autolock _l(mLock);
+    return mAudioPolicyManager->removeDevicesRoleForCapturePreset(audioSource, role, devices);
+}
+
+status_t AudioPolicyService::clearDevicesRoleForCapturePreset(audio_source_t audioSource,
+                                                              device_role_t role)
+{
+    if (mAudioPolicyManager == nullptr) {
+        return NO_INIT;
+    }
+    Mutex::Autolock _l(mLock);
+    return mAudioPolicyManager->clearDevicesRoleForCapturePreset(audioSource, role);
+}
+
+status_t AudioPolicyService::getDevicesForRoleAndCapturePreset(audio_source_t audioSource,
+                                                               device_role_t role,
+                                                               AudioDeviceTypeAddrVector &devices)
+{
+    if (mAudioPolicyManager == nullptr) {
+        return NO_INIT;
+    }
+    Mutex::Autolock _l(mLock);
+    return mAudioPolicyManager->getDevicesForRoleAndCapturePreset(audioSource, role, devices);
+}
+
 } // namespace android
diff --git a/services/audiopolicy/service/AudioPolicyService.h b/services/audiopolicy/service/AudioPolicyService.h
index a851863..0b218c2 100644
--- a/services/audiopolicy/service/AudioPolicyService.h
+++ b/services/audiopolicy/service/AudioPolicyService.h
@@ -240,6 +240,25 @@
                                                   device_role_t role,
                                                   AudioDeviceTypeAddrVector &devices);
 
+    virtual status_t setDevicesRoleForCapturePreset(audio_source_t audioSource,
+                                                    device_role_t role,
+                                                    const AudioDeviceTypeAddrVector &devices);
+
+    virtual status_t addDevicesRoleForCapturePreset(audio_source_t audioSource,
+                                                    device_role_t role,
+                                                    const AudioDeviceTypeAddrVector &devices);
+
+    virtual status_t removeDevicesRoleForCapturePreset(
+            audio_source_t audioSource, device_role_t role,
+            const AudioDeviceTypeAddrVector& devices);
+
+    virtual status_t clearDevicesRoleForCapturePreset(audio_source_t audioSource,
+                                                      device_role_t role);
+
+    virtual status_t getDevicesForRoleAndCapturePreset(audio_source_t audioSource,
+                                                       device_role_t role,
+                                                       AudioDeviceTypeAddrVector &devices);
+
     virtual status_t setUserIdDeviceAffinities(int userId,
             const AudioDeviceTypeAddrVector& devices);
 
diff --git a/services/audiopolicy/tests/Android.bp b/services/audiopolicy/tests/Android.bp
index efdb241..ca03e1f 100644
--- a/services/audiopolicy/tests/Android.bp
+++ b/services/audiopolicy/tests/Android.bp
@@ -18,7 +18,10 @@
         "libxml2",
     ],
 
-    static_libs: ["libaudiopolicycomponents"],
+    static_libs: [
+        "libaudiopolicycomponents",
+        "libgmock"
+    ],
 
     header_libs: [
         "libaudiopolicycommon",
diff --git a/services/audiopolicy/tests/audiopolicymanager_tests.cpp b/services/audiopolicy/tests/audiopolicymanager_tests.cpp
index a0074bc..ed9ec8c 100644
--- a/services/audiopolicy/tests/audiopolicymanager_tests.cpp
+++ b/services/audiopolicy/tests/audiopolicymanager_tests.cpp
@@ -20,6 +20,7 @@
 #include <unistd.h>
 
 #include <gtest/gtest.h>
+#include <gmock/gmock.h>
 
 #define LOG_TAG "APM_Test"
 #include <Serializer.h>
@@ -36,6 +37,7 @@
 #include "AudioPolicyTestManager.h"
 
 using namespace android;
+using testing::UnorderedElementsAre;
 
 TEST(AudioPolicyManagerTestInit, EngineFailure) {
     AudioPolicyTestClient client;
@@ -1188,3 +1190,109 @@
     EXPECT_GT(mClient->getAudioPortListUpdateCount(), prevAudioPortListUpdateCount);
     EXPECT_GT(mManager->getAudioPortGeneration(), prevAudioPortGeneration);
 }
+
+using DevicesRoleForCapturePresetParam = std::tuple<audio_source_t, device_role_t>;
+
+class AudioPolicyManagerDevicesRoleForCapturePresetTest
+        : public AudioPolicyManagerTestWithConfigurationFile,
+          public testing::WithParamInterface<DevicesRoleForCapturePresetParam> {
+protected:
+    // The `inputDevice` and `inputDevice2` indicate the audio devices type to be used for setting
+    // device role. They must be declared in the test_audio_policy_configuration.xml
+    AudioDeviceTypeAddr inputDevice = AudioDeviceTypeAddr(AUDIO_DEVICE_IN_BUILTIN_MIC, "");
+    AudioDeviceTypeAddr inputDevice2 = AudioDeviceTypeAddr(AUDIO_DEVICE_IN_HDMI, "");
+};
+
+TEST_P(AudioPolicyManagerDevicesRoleForCapturePresetTest, DevicesRoleForCapturePreset) {
+    const audio_source_t audioSource = std::get<0>(GetParam());
+    const device_role_t role = std::get<1>(GetParam());
+
+    // Test invalid device when setting
+    const AudioDeviceTypeAddr outputDevice(AUDIO_DEVICE_OUT_SPEAKER, "");
+    const AudioDeviceTypeAddrVector outputDevices = {outputDevice};
+    ASSERT_EQ(BAD_VALUE,
+              mManager->setDevicesRoleForCapturePreset(audioSource, role, outputDevices));
+    ASSERT_EQ(BAD_VALUE,
+              mManager->addDevicesRoleForCapturePreset(audioSource, role, outputDevices));
+    AudioDeviceTypeAddrVector devices;
+    ASSERT_EQ(NAME_NOT_FOUND,
+              mManager->getDevicesForRoleAndCapturePreset(audioSource, role, devices));
+    ASSERT_TRUE(devices.empty());
+    ASSERT_EQ(BAD_VALUE,
+              mManager->removeDevicesRoleForCapturePreset(audioSource, role, outputDevices));
+
+    // Without setting, call get/remove/clear must fail
+    ASSERT_EQ(NAME_NOT_FOUND,
+              mManager->getDevicesForRoleAndCapturePreset(audioSource, role, devices));
+    ASSERT_EQ(NAME_NOT_FOUND,
+              mManager->removeDevicesRoleForCapturePreset(audioSource, role, devices));
+    ASSERT_EQ(NAME_NOT_FOUND,
+              mManager->clearDevicesRoleForCapturePreset(audioSource, role));
+
+    // Test set/get devices role
+    const AudioDeviceTypeAddrVector inputDevices = {inputDevice};
+    ASSERT_EQ(NO_ERROR,
+              mManager->setDevicesRoleForCapturePreset(audioSource, role, inputDevices));
+    ASSERT_EQ(NO_ERROR, mManager->getDevicesForRoleAndCapturePreset(audioSource, role, devices));
+    EXPECT_THAT(devices, UnorderedElementsAre(inputDevice));
+
+    // Test setting will change the previously set devices
+    const AudioDeviceTypeAddrVector inputDevices2 = {inputDevice2};
+    ASSERT_EQ(NO_ERROR,
+              mManager->setDevicesRoleForCapturePreset(audioSource, role, inputDevices2));
+    devices.clear();
+    ASSERT_EQ(NO_ERROR, mManager->getDevicesForRoleAndCapturePreset(audioSource, role, devices));
+    EXPECT_THAT(devices, UnorderedElementsAre(inputDevice2));
+
+    // Test add devices
+    ASSERT_EQ(NO_ERROR,
+              mManager->addDevicesRoleForCapturePreset(audioSource, role, inputDevices));
+    devices.clear();
+    ASSERT_EQ(NO_ERROR, mManager->getDevicesForRoleAndCapturePreset(audioSource, role, devices));
+    EXPECT_THAT(devices, UnorderedElementsAre(inputDevice, inputDevice2));
+
+    // Test remove devices
+    ASSERT_EQ(NO_ERROR,
+              mManager->removeDevicesRoleForCapturePreset(audioSource, role, inputDevices));
+    devices.clear();
+    ASSERT_EQ(NO_ERROR, mManager->getDevicesForRoleAndCapturePreset(audioSource, role, devices));
+    EXPECT_THAT(devices, UnorderedElementsAre(inputDevice2));
+
+    // Test remove devices that are not set as the device role
+    ASSERT_EQ(BAD_VALUE,
+              mManager->removeDevicesRoleForCapturePreset(audioSource, role, inputDevices));
+
+    // Test clear devices
+    ASSERT_EQ(NO_ERROR,
+              mManager->clearDevicesRoleForCapturePreset(audioSource, role));
+    devices.clear();
+    ASSERT_EQ(NAME_NOT_FOUND,
+              mManager->getDevicesForRoleAndCapturePreset(audioSource, role, devices));
+}
+
+INSTANTIATE_TEST_CASE_P(
+        DevicesRoleForCapturePresetOperation,
+        AudioPolicyManagerDevicesRoleForCapturePresetTest,
+        testing::Values(
+                DevicesRoleForCapturePresetParam({AUDIO_SOURCE_MIC, DEVICE_ROLE_PREFERRED}),
+                DevicesRoleForCapturePresetParam({AUDIO_SOURCE_VOICE_UPLINK,
+                                                  DEVICE_ROLE_PREFERRED}),
+                DevicesRoleForCapturePresetParam({AUDIO_SOURCE_VOICE_DOWNLINK,
+                                                  DEVICE_ROLE_PREFERRED}),
+                DevicesRoleForCapturePresetParam({AUDIO_SOURCE_VOICE_CALL, DEVICE_ROLE_PREFERRED}),
+                DevicesRoleForCapturePresetParam({AUDIO_SOURCE_CAMCORDER, DEVICE_ROLE_PREFERRED}),
+                DevicesRoleForCapturePresetParam({AUDIO_SOURCE_VOICE_RECOGNITION,
+                                                  DEVICE_ROLE_PREFERRED}),
+                DevicesRoleForCapturePresetParam({AUDIO_SOURCE_VOICE_COMMUNICATION,
+                                                  DEVICE_ROLE_PREFERRED}),
+                DevicesRoleForCapturePresetParam({AUDIO_SOURCE_REMOTE_SUBMIX,
+                                                  DEVICE_ROLE_PREFERRED}),
+                DevicesRoleForCapturePresetParam({AUDIO_SOURCE_UNPROCESSED, DEVICE_ROLE_PREFERRED}),
+                DevicesRoleForCapturePresetParam({AUDIO_SOURCE_VOICE_PERFORMANCE,
+                                                  DEVICE_ROLE_PREFERRED}),
+                DevicesRoleForCapturePresetParam({AUDIO_SOURCE_ECHO_REFERENCE,
+                                                  DEVICE_ROLE_PREFERRED}),
+                DevicesRoleForCapturePresetParam({AUDIO_SOURCE_FM_TUNER, DEVICE_ROLE_PREFERRED}),
+                DevicesRoleForCapturePresetParam({AUDIO_SOURCE_HOTWORD, DEVICE_ROLE_PREFERRED})
+                )
+        );
diff --git a/services/camera/libcameraservice/CameraService.cpp b/services/camera/libcameraservice/CameraService.cpp
index adafbda..138e429 100644
--- a/services/camera/libcameraservice/CameraService.cpp
+++ b/services/camera/libcameraservice/CameraService.cpp
@@ -3692,9 +3692,14 @@
                 __FUNCTION__, cameraId.string());
         return;
     }
+
+    // Collect the logical cameras without holding mStatusLock in updateStatus
+    // as that can lead to a deadlock(b/162192331).
+    auto logicalCameraIds = getLogicalCameras(cameraId);
     // Update the status for this camera state, then send the onStatusChangedCallbacks to each
     // of the listeners with both the mStatusLock and mStatusListenerLock held
-    state->updateStatus(status, cameraId, rejectSourceStates, [this, &deviceKind, &supportsHAL3]
+    state->updateStatus(status, cameraId, rejectSourceStates, [this, &deviceKind, &supportsHAL3,
+                        &logicalCameraIds]
             (const String8& cameraId, StatusInternal status) {
 
             if (status != StatusInternal::ENUMERATING) {
@@ -3714,8 +3719,8 @@
             }
 
             Mutex::Autolock lock(mStatusListenerLock);
-
-            notifyPhysicalCameraStatusLocked(mapToInterface(status), cameraId, deviceKind);
+            notifyPhysicalCameraStatusLocked(mapToInterface(status), String16(cameraId),
+                    logicalCameraIds, deviceKind);
 
             for (auto& listener : mListenerList) {
                 bool isVendorListener = listener->isVendorListener();
@@ -3833,8 +3838,9 @@
     return OK;
 }
 
-void CameraService::notifyPhysicalCameraStatusLocked(int32_t status, const String8& cameraId,
-        SystemCameraKind deviceKind) {
+std::list<String16> CameraService::getLogicalCameras(
+        const String8& physicalCameraId) {
+    std::list<String16> retList;
     Mutex::Autolock lock(mCameraStatesLock);
     for (const auto& state : mCameraStates) {
         std::vector<std::string> physicalCameraIds;
@@ -3842,26 +3848,39 @@
             // This is not a logical multi-camera.
             continue;
         }
-        if (std::find(physicalCameraIds.begin(), physicalCameraIds.end(), cameraId.c_str())
+        if (std::find(physicalCameraIds.begin(), physicalCameraIds.end(), physicalCameraId.c_str())
                 == physicalCameraIds.end()) {
             // cameraId is not a physical camera of this logical multi-camera.
             continue;
         }
 
-        String16 id16(state.first), physicalId16(cameraId);
+        retList.emplace_back(String16(state.first));
+    }
+    return retList;
+}
+
+void CameraService::notifyPhysicalCameraStatusLocked(int32_t status,
+        const String16& physicalCameraId, const std::list<String16>& logicalCameraIds,
+        SystemCameraKind deviceKind) {
+    // mStatusListenerLock is expected to be locked
+    for (const auto& logicalCameraId : logicalCameraIds) {
         for (auto& listener : mListenerList) {
+            // Note: we check only the deviceKind of the physical camera id
+            // since, logical camera ids and their physical camera ids are
+            // guaranteed to have the same system camera kind.
             if (shouldSkipStatusUpdates(deviceKind, listener->isVendorListener(),
                     listener->getListenerPid(), listener->getListenerUid())) {
                 ALOGV("Skipping discovery callback for system-only camera device %s",
-                        cameraId.c_str());
+                        String8(physicalCameraId).c_str());
                 continue;
             }
             listener->getListener()->onPhysicalCameraStatusChanged(status,
-                    id16, physicalId16);
+                    logicalCameraId, physicalCameraId);
         }
     }
 }
 
+
 void CameraService::blockClientsForUid(uid_t uid) {
     const auto clients = mActiveClientManager.getAll();
     for (auto& current : clients) {
diff --git a/services/camera/libcameraservice/CameraService.h b/services/camera/libcameraservice/CameraService.h
index 3d3b7dd..6f37e9f 100644
--- a/services/camera/libcameraservice/CameraService.h
+++ b/services/camera/libcameraservice/CameraService.h
@@ -49,6 +49,7 @@
 
 #include <set>
 #include <string>
+#include <list>
 #include <map>
 #include <memory>
 #include <optional>
@@ -999,8 +1000,13 @@
             hardware::camera::common::V1_0::TorchModeStatus status);
 
     // notify physical camera status when the physical camera is public.
-    void notifyPhysicalCameraStatusLocked(int32_t status, const String8& cameraId,
-            SystemCameraKind deviceKind);
+    // Expects mStatusListenerLock to be locked.
+    void notifyPhysicalCameraStatusLocked(int32_t status, const String16& physicalCameraId,
+            const std::list<String16>& logicalCameraIds, SystemCameraKind deviceKind);
+
+    // get list of logical cameras which are backed by physicalCameraId
+    std::list<String16> getLogicalCameras(const String8& physicalCameraId);
+
 
     // IBinder::DeathRecipient implementation
     virtual void        binderDied(const wp<IBinder> &who);
diff --git a/services/camera/libcameraservice/api2/CameraDeviceClient.cpp b/services/camera/libcameraservice/api2/CameraDeviceClient.cpp
index 022d686..e80838b 100644
--- a/services/camera/libcameraservice/api2/CameraDeviceClient.cpp
+++ b/services/camera/libcameraservice/api2/CameraDeviceClient.cpp
@@ -21,6 +21,7 @@
 #include <cutils/properties.h>
 #include <utils/CameraThreadState.h>
 #include <utils/Log.h>
+#include <utils/SessionConfigurationUtils.h>
 #include <utils/Trace.h>
 #include <gui/Surface.h>
 #include <camera/camera2/CaptureRequest.h>
@@ -492,7 +493,8 @@
         return STATUS_ERROR(CameraService::ERROR_DISCONNECTED, "Camera device no longer alive");
     }
 
-    res = checkOperatingMode(operatingMode, mDevice->info(), mCameraIdStr);
+    res = SessionConfigurationUtils::checkOperatingMode(operatingMode, mDevice->info(),
+            mCameraIdStr);
     if (!res.isOk()) {
         return res;
     }
@@ -550,247 +552,6 @@
     return res;
 }
 
-binder::Status CameraDeviceClient::checkSurfaceType(size_t numBufferProducers,
-        bool deferredConsumer, int surfaceType)  {
-    if (numBufferProducers > MAX_SURFACES_PER_STREAM) {
-        ALOGE("%s: GraphicBufferProducer count %zu for stream exceeds limit of %d",
-                __FUNCTION__, numBufferProducers, MAX_SURFACES_PER_STREAM);
-        return STATUS_ERROR(CameraService::ERROR_ILLEGAL_ARGUMENT, "Surface count is too high");
-    } else if ((numBufferProducers == 0) && (!deferredConsumer)) {
-        ALOGE("%s: Number of consumers cannot be smaller than 1", __FUNCTION__);
-        return STATUS_ERROR(CameraService::ERROR_ILLEGAL_ARGUMENT, "No valid consumers.");
-    }
-
-    bool validSurfaceType = ((surfaceType == OutputConfiguration::SURFACE_TYPE_SURFACE_VIEW) ||
-            (surfaceType == OutputConfiguration::SURFACE_TYPE_SURFACE_TEXTURE));
-
-    if (deferredConsumer && !validSurfaceType) {
-        ALOGE("%s: Target surface has invalid surfaceType = %d.", __FUNCTION__, surfaceType);
-        return STATUS_ERROR(CameraService::ERROR_ILLEGAL_ARGUMENT, "Target Surface is invalid");
-    }
-
-    return binder::Status::ok();
-}
-
-binder::Status CameraDeviceClient::checkPhysicalCameraId(
-        const std::vector<std::string> &physicalCameraIds, const String8 &physicalCameraId,
-        const String8 &logicalCameraId) {
-    if (physicalCameraId.size() == 0) {
-        return binder::Status::ok();
-    }
-    if (std::find(physicalCameraIds.begin(), physicalCameraIds.end(),
-        physicalCameraId.string()) == physicalCameraIds.end()) {
-        String8 msg = String8::format("Camera %s: Camera doesn't support physicalCameraId %s.",
-                logicalCameraId.string(), physicalCameraId.string());
-        ALOGE("%s: %s", __FUNCTION__, msg.string());
-        return STATUS_ERROR(CameraService::ERROR_ILLEGAL_ARGUMENT, msg.string());
-    }
-    return binder::Status::ok();
-}
-
-binder::Status CameraDeviceClient::checkOperatingMode(int operatingMode,
-        const CameraMetadata &staticInfo, const String8 &cameraId) {
-    if (operatingMode < 0) {
-        String8 msg = String8::format(
-            "Camera %s: Invalid operating mode %d requested", cameraId.string(), operatingMode);
-        ALOGE("%s: %s", __FUNCTION__, msg.string());
-        return STATUS_ERROR(CameraService::ERROR_ILLEGAL_ARGUMENT,
-                msg.string());
-    }
-
-    bool isConstrainedHighSpeed = (operatingMode == ICameraDeviceUser::CONSTRAINED_HIGH_SPEED_MODE);
-    if (isConstrainedHighSpeed) {
-        camera_metadata_ro_entry_t entry = staticInfo.find(ANDROID_REQUEST_AVAILABLE_CAPABILITIES);
-        bool isConstrainedHighSpeedSupported = false;
-        for(size_t i = 0; i < entry.count; ++i) {
-            uint8_t capability = entry.data.u8[i];
-            if (capability == ANDROID_REQUEST_AVAILABLE_CAPABILITIES_CONSTRAINED_HIGH_SPEED_VIDEO) {
-                isConstrainedHighSpeedSupported = true;
-                break;
-            }
-        }
-        if (!isConstrainedHighSpeedSupported) {
-            String8 msg = String8::format(
-                "Camera %s: Try to create a constrained high speed configuration on a device"
-                " that doesn't support it.", cameraId.string());
-            ALOGE("%s: %s", __FUNCTION__, msg.string());
-            return STATUS_ERROR(CameraService::ERROR_ILLEGAL_ARGUMENT,
-                    msg.string());
-        }
-    }
-
-    return binder::Status::ok();
-}
-
-void CameraDeviceClient::mapStreamInfo(const OutputStreamInfo &streamInfo,
-            camera3_stream_rotation_t rotation, String8 physicalId,
-            hardware::camera::device::V3_4::Stream *stream /*out*/) {
-    if (stream == nullptr) {
-        return;
-    }
-
-    stream->v3_2.streamType = hardware::camera::device::V3_2::StreamType::OUTPUT;
-    stream->v3_2.width = streamInfo.width;
-    stream->v3_2.height = streamInfo.height;
-    stream->v3_2.format = Camera3Device::mapToPixelFormat(streamInfo.format);
-    auto u = streamInfo.consumerUsage;
-    camera3::Camera3OutputStream::applyZSLUsageQuirk(streamInfo.format, &u);
-    stream->v3_2.usage = Camera3Device::mapToConsumerUsage(u);
-    stream->v3_2.dataSpace = Camera3Device::mapToHidlDataspace(streamInfo.dataSpace);
-    stream->v3_2.rotation = Camera3Device::mapToStreamRotation(rotation);
-    stream->v3_2.id = -1; // Invalid stream id
-    stream->physicalCameraId = std::string(physicalId.string());
-    stream->bufferSize = 0;
-}
-
-binder::Status
-CameraDeviceClient::convertToHALStreamCombination(const SessionConfiguration& sessionConfiguration,
-        const String8 &logicalCameraId, const CameraMetadata &deviceInfo,
-        metadataGetter getMetadata, const std::vector<std::string> &physicalCameraIds,
-        hardware::camera::device::V3_4::StreamConfiguration &streamConfiguration,
-        bool *unsupported) {
-    auto operatingMode = sessionConfiguration.getOperatingMode();
-    binder::Status res = checkOperatingMode(operatingMode, deviceInfo, logicalCameraId);
-    if (!res.isOk()) {
-        return res;
-    }
-
-    if (unsupported == nullptr) {
-        String8 msg("unsupported nullptr");
-        ALOGE("%s: %s", __FUNCTION__, msg.string());
-        return STATUS_ERROR(CameraService::ERROR_ILLEGAL_ARGUMENT, msg.string());
-    }
-    *unsupported = false;
-    auto ret = Camera3Device::mapToStreamConfigurationMode(
-            static_cast<camera3_stream_configuration_mode_t> (operatingMode),
-            /*out*/ &streamConfiguration.operationMode);
-    if (ret != OK) {
-        String8 msg = String8::format(
-            "Camera %s: Failed mapping operating mode %d requested: %s (%d)",
-            logicalCameraId.string(), operatingMode, strerror(-ret), ret);
-        ALOGE("%s: %s", __FUNCTION__, msg.string());
-        return STATUS_ERROR(CameraService::ERROR_ILLEGAL_ARGUMENT,
-                msg.string());
-    }
-
-    bool isInputValid = (sessionConfiguration.getInputWidth() > 0) &&
-            (sessionConfiguration.getInputHeight() > 0) &&
-            (sessionConfiguration.getInputFormat() > 0);
-    auto outputConfigs = sessionConfiguration.getOutputConfigurations();
-    size_t streamCount = outputConfigs.size();
-    streamCount = isInputValid ? streamCount + 1 : streamCount;
-    streamConfiguration.streams.resize(streamCount);
-    size_t streamIdx = 0;
-    if (isInputValid) {
-        streamConfiguration.streams[streamIdx++] = {{/*streamId*/0,
-                hardware::camera::device::V3_2::StreamType::INPUT,
-                static_cast<uint32_t> (sessionConfiguration.getInputWidth()),
-                static_cast<uint32_t> (sessionConfiguration.getInputHeight()),
-                Camera3Device::mapToPixelFormat(sessionConfiguration.getInputFormat()),
-                /*usage*/ 0, HAL_DATASPACE_UNKNOWN,
-                hardware::camera::device::V3_2::StreamRotation::ROTATION_0},
-                /*physicalId*/ nullptr, /*bufferSize*/0};
-    }
-
-    for (const auto &it : outputConfigs) {
-        const std::vector<sp<IGraphicBufferProducer>>& bufferProducers =
-            it.getGraphicBufferProducers();
-        bool deferredConsumer = it.isDeferred();
-        String8 physicalCameraId = String8(it.getPhysicalCameraId());
-        size_t numBufferProducers = bufferProducers.size();
-        bool isStreamInfoValid = false;
-        OutputStreamInfo streamInfo;
-
-        res = checkSurfaceType(numBufferProducers, deferredConsumer, it.getSurfaceType());
-        if (!res.isOk()) {
-            return res;
-        }
-        res = checkPhysicalCameraId(physicalCameraIds, physicalCameraId,
-                logicalCameraId);
-        if (!res.isOk()) {
-            return res;
-        }
-
-        if (deferredConsumer) {
-            streamInfo.width = it.getWidth();
-            streamInfo.height = it.getHeight();
-            streamInfo.format = HAL_PIXEL_FORMAT_IMPLEMENTATION_DEFINED;
-            streamInfo.dataSpace = android_dataspace_t::HAL_DATASPACE_UNKNOWN;
-            auto surfaceType = it.getSurfaceType();
-            streamInfo.consumerUsage = GraphicBuffer::USAGE_HW_TEXTURE;
-            if (surfaceType == OutputConfiguration::SURFACE_TYPE_SURFACE_VIEW) {
-                streamInfo.consumerUsage |= GraphicBuffer::USAGE_HW_COMPOSER;
-            }
-            mapStreamInfo(streamInfo, CAMERA3_STREAM_ROTATION_0, physicalCameraId,
-                    &streamConfiguration.streams[streamIdx++]);
-            isStreamInfoValid = true;
-
-            if (numBufferProducers == 0) {
-                continue;
-            }
-        }
-
-        for (auto& bufferProducer : bufferProducers) {
-            sp<Surface> surface;
-            const CameraMetadata &physicalDeviceInfo = getMetadata(physicalCameraId);
-            res = createSurfaceFromGbp(streamInfo, isStreamInfoValid, surface, bufferProducer,
-                    logicalCameraId,
-                    physicalCameraId.size() > 0 ? physicalDeviceInfo : deviceInfo );
-
-            if (!res.isOk())
-                return res;
-
-            if (!isStreamInfoValid) {
-                bool isDepthCompositeStream =
-                        camera3::DepthCompositeStream::isDepthCompositeStream(surface);
-                bool isHeicCompositeStream =
-                        camera3::HeicCompositeStream::isHeicCompositeStream(surface);
-                if (isDepthCompositeStream || isHeicCompositeStream) {
-                    // We need to take in to account that composite streams can have
-                    // additional internal camera streams.
-                    std::vector<OutputStreamInfo> compositeStreams;
-                    if (isDepthCompositeStream) {
-                        ret = camera3::DepthCompositeStream::getCompositeStreamInfo(streamInfo,
-                                deviceInfo, &compositeStreams);
-                    } else {
-                        ret = camera3::HeicCompositeStream::getCompositeStreamInfo(streamInfo,
-                            deviceInfo, &compositeStreams);
-                    }
-                    if (ret != OK) {
-                        String8 msg = String8::format(
-                                "Camera %s: Failed adding composite streams: %s (%d)",
-                                logicalCameraId.string(), strerror(-ret), ret);
-                        ALOGE("%s: %s", __FUNCTION__, msg.string());
-                        return STATUS_ERROR(CameraService::ERROR_ILLEGAL_ARGUMENT, msg.string());
-                    }
-
-                    if (compositeStreams.size() == 0) {
-                        // No internal streams means composite stream not
-                        // supported.
-                        *unsupported = true;
-                        return binder::Status::ok();
-                    } else if (compositeStreams.size() > 1) {
-                        streamCount += compositeStreams.size() - 1;
-                        streamConfiguration.streams.resize(streamCount);
-                    }
-
-                    for (const auto& compositeStream : compositeStreams) {
-                        mapStreamInfo(compositeStream,
-                                static_cast<camera3_stream_rotation_t> (it.getRotation()),
-                                physicalCameraId, &streamConfiguration.streams[streamIdx++]);
-                    }
-                } else {
-                    mapStreamInfo(streamInfo,
-                            static_cast<camera3_stream_rotation_t> (it.getRotation()),
-                            physicalCameraId, &streamConfiguration.streams[streamIdx++]);
-                }
-                isStreamInfoValid = true;
-            }
-        }
-    }
-    return binder::Status::ok();
-}
-
 binder::Status CameraDeviceClient::isSessionConfigurationSupported(
         const SessionConfiguration& sessionConfiguration, bool *status /*out*/) {
     ATRACE_CALL();
@@ -806,7 +567,8 @@
     }
 
     auto operatingMode = sessionConfiguration.getOperatingMode();
-    res = checkOperatingMode(operatingMode, mDevice->info(), mCameraIdStr);
+    res = SessionConfigurationUtils::checkOperatingMode(operatingMode, mDevice->info(),
+            mCameraIdStr);
     if (!res.isOk()) {
         return res;
     }
@@ -821,8 +583,9 @@
     metadataGetter getMetadata = [this](const String8 &id) {return mDevice->infoPhysical(id);};
     std::vector<std::string> physicalCameraIds;
     mProviderManager->isLogicalCamera(mCameraIdStr.string(), &physicalCameraIds);
-    res = convertToHALStreamCombination(sessionConfiguration, mCameraIdStr,
-            mDevice->info(), getMetadata, physicalCameraIds, streamConfiguration, &earlyExit);
+    res = SessionConfigurationUtils::convertToHALStreamCombination(sessionConfiguration,
+            mCameraIdStr, mDevice->info(), getMetadata, physicalCameraIds, streamConfiguration,
+            &earlyExit);
     if (!res.isOk()) {
         return res;
     }
@@ -970,7 +733,7 @@
     String8 physicalCameraId = String8(outputConfiguration.getPhysicalCameraId());
     bool deferredConsumerOnly = deferredConsumer && numBufferProducers == 0;
 
-    res = checkSurfaceType(numBufferProducers, deferredConsumer,
+    res = SessionConfigurationUtils::checkSurfaceType(numBufferProducers, deferredConsumer,
             outputConfiguration.getSurfaceType());
     if (!res.isOk()) {
         return res;
@@ -981,7 +744,8 @@
     }
     std::vector<std::string> physicalCameraIds;
     mProviderManager->isLogicalCamera(mCameraIdStr.string(), &physicalCameraIds);
-    res = checkPhysicalCameraId(physicalCameraIds, physicalCameraId, mCameraIdStr);
+    res = SessionConfigurationUtils::checkPhysicalCameraId(physicalCameraIds, physicalCameraId,
+            mCameraIdStr);
     if (!res.isOk()) {
         return res;
     }
@@ -1009,8 +773,8 @@
         }
 
         sp<Surface> surface;
-        res = createSurfaceFromGbp(streamInfo, isStreamInfoValid, surface, bufferProducer,
-                mCameraIdStr, mDevice->infoPhysical(physicalCameraId));
+        res = SessionConfigurationUtils::createSurfaceFromGbp(streamInfo, isStreamInfoValid,
+                surface, bufferProducer, mCameraIdStr, mDevice->infoPhysical(physicalCameraId));
 
         if (!res.isOk())
             return res;
@@ -1313,8 +1077,9 @@
     for (size_t i = 0; i < newOutputsMap.size(); i++) {
         OutputStreamInfo outInfo;
         sp<Surface> surface;
-        res = createSurfaceFromGbp(outInfo, /*isStreamInfoValid*/ false, surface,
-                newOutputsMap.valueAt(i), mCameraIdStr, mDevice->infoPhysical(physicalCameraId));
+        res = SessionConfigurationUtils::createSurfaceFromGbp(outInfo, /*isStreamInfoValid*/ false,
+                surface, newOutputsMap.valueAt(i), mCameraIdStr,
+                mDevice->infoPhysical(physicalCameraId));
         if (!res.isOk())
             return res;
 
@@ -1364,226 +1129,6 @@
     return res;
 }
 
-bool CameraDeviceClient::isPublicFormat(int32_t format)
-{
-    switch(format) {
-        case HAL_PIXEL_FORMAT_RGBA_8888:
-        case HAL_PIXEL_FORMAT_RGBX_8888:
-        case HAL_PIXEL_FORMAT_RGB_888:
-        case HAL_PIXEL_FORMAT_RGB_565:
-        case HAL_PIXEL_FORMAT_BGRA_8888:
-        case HAL_PIXEL_FORMAT_YV12:
-        case HAL_PIXEL_FORMAT_Y8:
-        case HAL_PIXEL_FORMAT_Y16:
-        case HAL_PIXEL_FORMAT_RAW16:
-        case HAL_PIXEL_FORMAT_RAW10:
-        case HAL_PIXEL_FORMAT_RAW12:
-        case HAL_PIXEL_FORMAT_RAW_OPAQUE:
-        case HAL_PIXEL_FORMAT_BLOB:
-        case HAL_PIXEL_FORMAT_IMPLEMENTATION_DEFINED:
-        case HAL_PIXEL_FORMAT_YCbCr_420_888:
-        case HAL_PIXEL_FORMAT_YCbCr_422_SP:
-        case HAL_PIXEL_FORMAT_YCrCb_420_SP:
-        case HAL_PIXEL_FORMAT_YCbCr_422_I:
-            return true;
-        default:
-            return false;
-    }
-}
-
-binder::Status CameraDeviceClient::createSurfaceFromGbp(
-        OutputStreamInfo& streamInfo, bool isStreamInfoValid,
-        sp<Surface>& surface, const sp<IGraphicBufferProducer>& gbp,
-        const String8 &cameraId, const CameraMetadata &physicalCameraMetadata) {
-
-    // bufferProducer must be non-null
-    if (gbp == nullptr) {
-        String8 msg = String8::format("Camera %s: Surface is NULL", cameraId.string());
-        ALOGW("%s: %s", __FUNCTION__, msg.string());
-        return STATUS_ERROR(CameraService::ERROR_ILLEGAL_ARGUMENT, msg.string());
-    }
-    // HACK b/10949105
-    // Query consumer usage bits to set async operation mode for
-    // GLConsumer using controlledByApp parameter.
-    bool useAsync = false;
-    uint64_t consumerUsage = 0;
-    status_t err;
-    if ((err = gbp->getConsumerUsage(&consumerUsage)) != OK) {
-        String8 msg = String8::format("Camera %s: Failed to query Surface consumer usage: %s (%d)",
-                cameraId.string(), strerror(-err), err);
-        ALOGE("%s: %s", __FUNCTION__, msg.string());
-        return STATUS_ERROR(CameraService::ERROR_INVALID_OPERATION, msg.string());
-    }
-    if (consumerUsage & GraphicBuffer::USAGE_HW_TEXTURE) {
-        ALOGW("%s: Camera %s with consumer usage flag: %" PRIu64 ": Forcing asynchronous mode for stream",
-                __FUNCTION__, cameraId.string(), consumerUsage);
-        useAsync = true;
-    }
-
-    uint64_t disallowedFlags = GraphicBuffer::USAGE_HW_VIDEO_ENCODER |
-                              GRALLOC_USAGE_RENDERSCRIPT;
-    uint64_t allowedFlags = GraphicBuffer::USAGE_SW_READ_MASK |
-                           GraphicBuffer::USAGE_HW_TEXTURE |
-                           GraphicBuffer::USAGE_HW_COMPOSER;
-    bool flexibleConsumer = (consumerUsage & disallowedFlags) == 0 &&
-            (consumerUsage & allowedFlags) != 0;
-
-    surface = new Surface(gbp, useAsync);
-    ANativeWindow *anw = surface.get();
-
-    int width, height, format;
-    android_dataspace dataSpace;
-    if ((err = anw->query(anw, NATIVE_WINDOW_WIDTH, &width)) != OK) {
-        String8 msg = String8::format("Camera %s: Failed to query Surface width: %s (%d)",
-                 cameraId.string(), strerror(-err), err);
-        ALOGE("%s: %s", __FUNCTION__, msg.string());
-        return STATUS_ERROR(CameraService::ERROR_INVALID_OPERATION, msg.string());
-    }
-    if ((err = anw->query(anw, NATIVE_WINDOW_HEIGHT, &height)) != OK) {
-        String8 msg = String8::format("Camera %s: Failed to query Surface height: %s (%d)",
-                cameraId.string(), strerror(-err), err);
-        ALOGE("%s: %s", __FUNCTION__, msg.string());
-        return STATUS_ERROR(CameraService::ERROR_INVALID_OPERATION, msg.string());
-    }
-    if ((err = anw->query(anw, NATIVE_WINDOW_FORMAT, &format)) != OK) {
-        String8 msg = String8::format("Camera %s: Failed to query Surface format: %s (%d)",
-                cameraId.string(), strerror(-err), err);
-        ALOGE("%s: %s", __FUNCTION__, msg.string());
-        return STATUS_ERROR(CameraService::ERROR_INVALID_OPERATION, msg.string());
-    }
-    if ((err = anw->query(anw, NATIVE_WINDOW_DEFAULT_DATASPACE,
-            reinterpret_cast<int*>(&dataSpace))) != OK) {
-        String8 msg = String8::format("Camera %s: Failed to query Surface dataspace: %s (%d)",
-                cameraId.string(), strerror(-err), err);
-        ALOGE("%s: %s", __FUNCTION__, msg.string());
-        return STATUS_ERROR(CameraService::ERROR_INVALID_OPERATION, msg.string());
-    }
-
-    // FIXME: remove this override since the default format should be
-    //       IMPLEMENTATION_DEFINED. b/9487482 & b/35317944
-    if ((format >= HAL_PIXEL_FORMAT_RGBA_8888 && format <= HAL_PIXEL_FORMAT_BGRA_8888) &&
-            ((consumerUsage & GRALLOC_USAGE_HW_MASK) &&
-             ((consumerUsage & GRALLOC_USAGE_SW_READ_MASK) == 0))) {
-        ALOGW("%s: Camera %s: Overriding format %#x to IMPLEMENTATION_DEFINED",
-                __FUNCTION__, cameraId.string(), format);
-        format = HAL_PIXEL_FORMAT_IMPLEMENTATION_DEFINED;
-    }
-    // Round dimensions to the nearest dimensions available for this format
-    if (flexibleConsumer && isPublicFormat(format) &&
-            !CameraDeviceClient::roundBufferDimensionNearest(width, height,
-            format, dataSpace, physicalCameraMetadata, /*out*/&width, /*out*/&height)) {
-        String8 msg = String8::format("Camera %s: No supported stream configurations with "
-                "format %#x defined, failed to create output stream",
-                cameraId.string(), format);
-        ALOGE("%s: %s", __FUNCTION__, msg.string());
-        return STATUS_ERROR(CameraService::ERROR_ILLEGAL_ARGUMENT, msg.string());
-    }
-
-    if (!isStreamInfoValid) {
-        streamInfo.width = width;
-        streamInfo.height = height;
-        streamInfo.format = format;
-        streamInfo.dataSpace = dataSpace;
-        streamInfo.consumerUsage = consumerUsage;
-        return binder::Status::ok();
-    }
-    if (width != streamInfo.width) {
-        String8 msg = String8::format("Camera %s:Surface width doesn't match: %d vs %d",
-                cameraId.string(), width, streamInfo.width);
-        ALOGE("%s: %s", __FUNCTION__, msg.string());
-        return STATUS_ERROR(CameraService::ERROR_ILLEGAL_ARGUMENT, msg.string());
-    }
-    if (height != streamInfo.height) {
-        String8 msg = String8::format("Camera %s:Surface height doesn't match: %d vs %d",
-                 cameraId.string(), height, streamInfo.height);
-        ALOGE("%s: %s", __FUNCTION__, msg.string());
-        return STATUS_ERROR(CameraService::ERROR_ILLEGAL_ARGUMENT, msg.string());
-    }
-    if (format != streamInfo.format) {
-        String8 msg = String8::format("Camera %s:Surface format doesn't match: %d vs %d",
-                 cameraId.string(), format, streamInfo.format);
-        ALOGE("%s: %s", __FUNCTION__, msg.string());
-        return STATUS_ERROR(CameraService::ERROR_ILLEGAL_ARGUMENT, msg.string());
-    }
-    if (format != HAL_PIXEL_FORMAT_IMPLEMENTATION_DEFINED) {
-        if (dataSpace != streamInfo.dataSpace) {
-            String8 msg = String8::format("Camera %s:Surface dataSpace doesn't match: %d vs %d",
-                    cameraId.string(), dataSpace, streamInfo.dataSpace);
-            ALOGE("%s: %s", __FUNCTION__, msg.string());
-            return STATUS_ERROR(CameraService::ERROR_ILLEGAL_ARGUMENT, msg.string());
-        }
-        //At the native side, there isn't a way to check whether 2 surfaces come from the same
-        //surface class type. Use usage flag to approximate the comparison.
-        if (consumerUsage != streamInfo.consumerUsage) {
-            String8 msg = String8::format(
-                    "Camera %s:Surface usage flag doesn't match %" PRIu64 " vs %" PRIu64 "",
-                    cameraId.string(), consumerUsage, streamInfo.consumerUsage);
-            ALOGE("%s: %s", __FUNCTION__, msg.string());
-            return STATUS_ERROR(CameraService::ERROR_ILLEGAL_ARGUMENT, msg.string());
-        }
-    }
-    return binder::Status::ok();
-}
-
-bool CameraDeviceClient::roundBufferDimensionNearest(int32_t width, int32_t height,
-        int32_t format, android_dataspace dataSpace, const CameraMetadata& info,
-        /*out*/int32_t* outWidth, /*out*/int32_t* outHeight) {
-
-    camera_metadata_ro_entry streamConfigs =
-            (dataSpace == HAL_DATASPACE_DEPTH) ?
-            info.find(ANDROID_DEPTH_AVAILABLE_DEPTH_STREAM_CONFIGURATIONS) :
-            (dataSpace == static_cast<android_dataspace>(HAL_DATASPACE_HEIF)) ?
-            info.find(ANDROID_HEIC_AVAILABLE_HEIC_STREAM_CONFIGURATIONS) :
-            info.find(ANDROID_SCALER_AVAILABLE_STREAM_CONFIGURATIONS);
-
-    int32_t bestWidth = -1;
-    int32_t bestHeight = -1;
-
-    // Iterate through listed stream configurations and find the one with the smallest euclidean
-    // distance from the given dimensions for the given format.
-    for (size_t i = 0; i < streamConfigs.count; i += 4) {
-        int32_t fmt = streamConfigs.data.i32[i];
-        int32_t w = streamConfigs.data.i32[i + 1];
-        int32_t h = streamConfigs.data.i32[i + 2];
-
-        // Ignore input/output type for now
-        if (fmt == format) {
-            if (w == width && h == height) {
-                bestWidth = width;
-                bestHeight = height;
-                break;
-            } else if (w <= ROUNDING_WIDTH_CAP && (bestWidth == -1 ||
-                    CameraDeviceClient::euclidDistSquare(w, h, width, height) <
-                    CameraDeviceClient::euclidDistSquare(bestWidth, bestHeight, width, height))) {
-                bestWidth = w;
-                bestHeight = h;
-            }
-        }
-    }
-
-    if (bestWidth == -1) {
-        // Return false if no configurations for this format were listed
-        return false;
-    }
-
-    // Set the outputs to the closet width/height
-    if (outWidth != NULL) {
-        *outWidth = bestWidth;
-    }
-    if (outHeight != NULL) {
-        *outHeight = bestHeight;
-    }
-
-    // Return true if at least one configuration for this format was listed
-    return true;
-}
-
-int64_t CameraDeviceClient::euclidDistSquare(int32_t x0, int32_t y0, int32_t x1, int32_t y1) {
-    int64_t d0 = x0 - x1;
-    int64_t d1 = y0 - y1;
-    return d0 * d0 + d1 * d1;
-}
-
 // Create a request object from a template.
 binder::Status CameraDeviceClient::createDefaultRequest(int templateId,
         /*out*/
@@ -1896,8 +1441,9 @@
         }
 
         sp<Surface> surface;
-        res = createSurfaceFromGbp(mStreamInfoMap[streamId], true /*isStreamInfoValid*/,
-                surface, bufferProducer, mCameraIdStr, mDevice->infoPhysical(physicalId));
+        res = SessionConfigurationUtils::createSurfaceFromGbp(mStreamInfoMap[streamId],
+                true /*isStreamInfoValid*/, surface, bufferProducer, mCameraIdStr,
+                mDevice->infoPhysical(physicalId));
 
         if (!res.isOk())
             return res;
diff --git a/services/camera/libcameraservice/api2/CameraDeviceClient.h b/services/camera/libcameraservice/api2/CameraDeviceClient.h
index 5cd16ee..2807aee 100644
--- a/services/camera/libcameraservice/api2/CameraDeviceClient.h
+++ b/services/camera/libcameraservice/api2/CameraDeviceClient.h
@@ -204,16 +204,6 @@
     virtual void notifyRequestQueueEmpty();
     virtual void notifyRepeatingRequestError(long lastFrameNumber);
 
-    // utility function to convert AIDL SessionConfiguration to HIDL
-    // streamConfiguration. Also checks for validity of SessionConfiguration and
-    // returns a non-ok binder::Status if the passed in session configuration
-    // isn't valid.
-    static binder::Status
-    convertToHALStreamCombination(const SessionConfiguration& sessionConfiguration,
-            const String8 &cameraId, const CameraMetadata &deviceInfo,
-            metadataGetter getMetadata, const std::vector<std::string> &physicalCameraIds,
-            hardware::camera::device::V3_4::StreamConfiguration &streamConfiguration,
-            bool *earlyExit);
     /**
      * Interface used by independent components of CameraDeviceClient.
      */
@@ -266,18 +256,8 @@
 
     /** Utility members */
     binder::Status checkPidStatus(const char* checkLocation);
-    static binder::Status checkOperatingMode(int operatingMode, const CameraMetadata &staticInfo,
-            const String8 &cameraId);
-    static binder::Status checkSurfaceType(size_t numBufferProducers, bool deferredConsumer,
-            int surfaceType);
-    static void mapStreamInfo(const OutputStreamInfo &streamInfo,
-            camera3_stream_rotation_t rotation, String8 physicalId,
-            hardware::camera::device::V3_4::Stream *stream /*out*/);
     bool enforceRequestPermissions(CameraMetadata& metadata);
 
-    // Find the square of the euclidean distance between two points
-    static int64_t euclidDistSquare(int32_t x0, int32_t y0, int32_t x1, int32_t y1);
-
     // Create an output stream with surface deferred for future.
     binder::Status createDeferredSurfaceStreamLocked(
             const hardware::camera2::params::OutputConfiguration &outputConfiguration,
@@ -288,33 +268,11 @@
     // cases.
     binder::Status setStreamTransformLocked(int streamId);
 
-    // Find the closest dimensions for a given format in available stream configurations with
-    // a width <= ROUNDING_WIDTH_CAP
-    static const int32_t ROUNDING_WIDTH_CAP = 1920;
-    static bool roundBufferDimensionNearest(int32_t width, int32_t height, int32_t format,
-            android_dataspace dataSpace, const CameraMetadata& info,
-            /*out*/int32_t* outWidth, /*out*/int32_t* outHeight);
-
-    //check if format is not custom format
-    static bool isPublicFormat(int32_t format);
-
-    // Create a Surface from an IGraphicBufferProducer. Returns error if
-    // IGraphicBufferProducer's property doesn't match with streamInfo
-    static binder::Status createSurfaceFromGbp(OutputStreamInfo& streamInfo, bool isStreamInfoValid,
-            sp<Surface>& surface, const sp<IGraphicBufferProducer>& gbp, const String8 &cameraId,
-            const CameraMetadata &physicalCameraMetadata);
-
-
     // Utility method to insert the surface into SurfaceMap
     binder::Status insertGbpLocked(const sp<IGraphicBufferProducer>& gbp,
             /*out*/SurfaceMap* surfaceMap, /*out*/Vector<int32_t>* streamIds,
             /*out*/int32_t*  currentStreamId);
 
-    // Check that the physicalCameraId passed in is spported by the camera
-    // device.
-    static binder::Status checkPhysicalCameraId(const std::vector<std::string> &physicalCameraIds,
-            const String8 &physicalCameraId, const String8 &logicalCameraId);
-
     // IGraphicsBufferProducer binder -> Stream ID + Surface ID for output streams
     KeyedVector<sp<IBinder>, StreamSurfaceId> mStreamMap;
 
@@ -346,7 +304,6 @@
 
     KeyedVector<sp<IBinder>, sp<CompositeStream>> mCompositeStreamMap;
 
-    static const int32_t MAX_SURFACES_PER_STREAM = 4;
     sp<CameraProviderManager> mProviderManager;
 };
 
diff --git a/services/camera/libcameraservice/utils/SessionConfigurationUtils.cpp b/services/camera/libcameraservice/utils/SessionConfigurationUtils.cpp
index 888671c..ba68a63 100644
--- a/services/camera/libcameraservice/utils/SessionConfigurationUtils.cpp
+++ b/services/camera/libcameraservice/utils/SessionConfigurationUtils.cpp
@@ -14,20 +14,493 @@
  * limitations under the License.
  */
 #include "SessionConfigurationUtils.h"
-#include "../api2/CameraDeviceClient.h"
+#include "../api2/DepthCompositeStream.h"
+#include "../api2/HeicCompositeStream.h"
+#include "common/CameraDeviceBase.h"
+#include "../CameraService.h"
+#include "device3/Camera3Device.h"
+#include "device3/Camera3OutputStream.h"
+
+// Convenience methods for constructing binder::Status objects for error returns
+
+#define STATUS_ERROR(errorCode, errorString) \
+    binder::Status::fromServiceSpecificError(errorCode, \
+            String8::format("%s:%d: %s", __FUNCTION__, __LINE__, errorString))
+
+#define STATUS_ERROR_FMT(errorCode, errorString, ...) \
+    binder::Status::fromServiceSpecificError(errorCode, \
+            String8::format("%s:%d: " errorString, __FUNCTION__, __LINE__, \
+                    __VA_ARGS__))
+
+using android::camera3::OutputStreamInfo;
+using android::camera3::OutputStreamInfo;
+using android::hardware::camera2::ICameraDeviceUser;
 
 namespace android {
 
+int64_t SessionConfigurationUtils::euclidDistSquare(int32_t x0, int32_t y0, int32_t x1, int32_t y1) {
+    int64_t d0 = x0 - x1;
+    int64_t d1 = y0 - y1;
+    return d0 * d0 + d1 * d1;
+}
+
+bool SessionConfigurationUtils::roundBufferDimensionNearest(int32_t width, int32_t height,
+        int32_t format, android_dataspace dataSpace, const CameraMetadata& info,
+        /*out*/int32_t* outWidth, /*out*/int32_t* outHeight) {
+
+    camera_metadata_ro_entry streamConfigs =
+            (dataSpace == HAL_DATASPACE_DEPTH) ?
+            info.find(ANDROID_DEPTH_AVAILABLE_DEPTH_STREAM_CONFIGURATIONS) :
+            (dataSpace == static_cast<android_dataspace>(HAL_DATASPACE_HEIF)) ?
+            info.find(ANDROID_HEIC_AVAILABLE_HEIC_STREAM_CONFIGURATIONS) :
+            info.find(ANDROID_SCALER_AVAILABLE_STREAM_CONFIGURATIONS);
+
+    int32_t bestWidth = -1;
+    int32_t bestHeight = -1;
+
+    // Iterate through listed stream configurations and find the one with the smallest euclidean
+    // distance from the given dimensions for the given format.
+    for (size_t i = 0; i < streamConfigs.count; i += 4) {
+        int32_t fmt = streamConfigs.data.i32[i];
+        int32_t w = streamConfigs.data.i32[i + 1];
+        int32_t h = streamConfigs.data.i32[i + 2];
+
+        // Ignore input/output type for now
+        if (fmt == format) {
+            if (w == width && h == height) {
+                bestWidth = width;
+                bestHeight = height;
+                break;
+            } else if (w <= ROUNDING_WIDTH_CAP && (bestWidth == -1 ||
+                    SessionConfigurationUtils::euclidDistSquare(w, h, width, height) <
+                    SessionConfigurationUtils::euclidDistSquare(bestWidth, bestHeight, width,
+                            height))) {
+                bestWidth = w;
+                bestHeight = h;
+            }
+        }
+    }
+
+    if (bestWidth == -1) {
+        // Return false if no configurations for this format were listed
+        return false;
+    }
+
+    // Set the outputs to the closet width/height
+    if (outWidth != NULL) {
+        *outWidth = bestWidth;
+    }
+    if (outHeight != NULL) {
+        *outHeight = bestHeight;
+    }
+
+    // Return true if at least one configuration for this format was listed
+    return true;
+}
+
+bool SessionConfigurationUtils::isPublicFormat(int32_t format)
+{
+    switch(format) {
+        case HAL_PIXEL_FORMAT_RGBA_8888:
+        case HAL_PIXEL_FORMAT_RGBX_8888:
+        case HAL_PIXEL_FORMAT_RGB_888:
+        case HAL_PIXEL_FORMAT_RGB_565:
+        case HAL_PIXEL_FORMAT_BGRA_8888:
+        case HAL_PIXEL_FORMAT_YV12:
+        case HAL_PIXEL_FORMAT_Y8:
+        case HAL_PIXEL_FORMAT_Y16:
+        case HAL_PIXEL_FORMAT_RAW16:
+        case HAL_PIXEL_FORMAT_RAW10:
+        case HAL_PIXEL_FORMAT_RAW12:
+        case HAL_PIXEL_FORMAT_RAW_OPAQUE:
+        case HAL_PIXEL_FORMAT_BLOB:
+        case HAL_PIXEL_FORMAT_IMPLEMENTATION_DEFINED:
+        case HAL_PIXEL_FORMAT_YCbCr_420_888:
+        case HAL_PIXEL_FORMAT_YCbCr_422_SP:
+        case HAL_PIXEL_FORMAT_YCrCb_420_SP:
+        case HAL_PIXEL_FORMAT_YCbCr_422_I:
+            return true;
+        default:
+            return false;
+    }
+}
+
+binder::Status SessionConfigurationUtils::createSurfaceFromGbp(
+        OutputStreamInfo& streamInfo, bool isStreamInfoValid,
+        sp<Surface>& surface, const sp<IGraphicBufferProducer>& gbp,
+        const String8 &cameraId, const CameraMetadata &physicalCameraMetadata) {
+
+    // bufferProducer must be non-null
+    if (gbp == nullptr) {
+        String8 msg = String8::format("Camera %s: Surface is NULL", cameraId.string());
+        ALOGW("%s: %s", __FUNCTION__, msg.string());
+        return STATUS_ERROR(CameraService::ERROR_ILLEGAL_ARGUMENT, msg.string());
+    }
+    // HACK b/10949105
+    // Query consumer usage bits to set async operation mode for
+    // GLConsumer using controlledByApp parameter.
+    bool useAsync = false;
+    uint64_t consumerUsage = 0;
+    status_t err;
+    if ((err = gbp->getConsumerUsage(&consumerUsage)) != OK) {
+        String8 msg = String8::format("Camera %s: Failed to query Surface consumer usage: %s (%d)",
+                cameraId.string(), strerror(-err), err);
+        ALOGE("%s: %s", __FUNCTION__, msg.string());
+        return STATUS_ERROR(CameraService::ERROR_INVALID_OPERATION, msg.string());
+    }
+    if (consumerUsage & GraphicBuffer::USAGE_HW_TEXTURE) {
+        ALOGW("%s: Camera %s with consumer usage flag: %" PRIu64 ": Forcing asynchronous mode for"
+                "stream", __FUNCTION__, cameraId.string(), consumerUsage);
+        useAsync = true;
+    }
+
+    uint64_t disallowedFlags = GraphicBuffer::USAGE_HW_VIDEO_ENCODER |
+                              GRALLOC_USAGE_RENDERSCRIPT;
+    uint64_t allowedFlags = GraphicBuffer::USAGE_SW_READ_MASK |
+                           GraphicBuffer::USAGE_HW_TEXTURE |
+                           GraphicBuffer::USAGE_HW_COMPOSER;
+    bool flexibleConsumer = (consumerUsage & disallowedFlags) == 0 &&
+            (consumerUsage & allowedFlags) != 0;
+
+    surface = new Surface(gbp, useAsync);
+    ANativeWindow *anw = surface.get();
+
+    int width, height, format;
+    android_dataspace dataSpace;
+    if ((err = anw->query(anw, NATIVE_WINDOW_WIDTH, &width)) != OK) {
+        String8 msg = String8::format("Camera %s: Failed to query Surface width: %s (%d)",
+                 cameraId.string(), strerror(-err), err);
+        ALOGE("%s: %s", __FUNCTION__, msg.string());
+        return STATUS_ERROR(CameraService::ERROR_INVALID_OPERATION, msg.string());
+    }
+    if ((err = anw->query(anw, NATIVE_WINDOW_HEIGHT, &height)) != OK) {
+        String8 msg = String8::format("Camera %s: Failed to query Surface height: %s (%d)",
+                cameraId.string(), strerror(-err), err);
+        ALOGE("%s: %s", __FUNCTION__, msg.string());
+        return STATUS_ERROR(CameraService::ERROR_INVALID_OPERATION, msg.string());
+    }
+    if ((err = anw->query(anw, NATIVE_WINDOW_FORMAT, &format)) != OK) {
+        String8 msg = String8::format("Camera %s: Failed to query Surface format: %s (%d)",
+                cameraId.string(), strerror(-err), err);
+        ALOGE("%s: %s", __FUNCTION__, msg.string());
+        return STATUS_ERROR(CameraService::ERROR_INVALID_OPERATION, msg.string());
+    }
+    if ((err = anw->query(anw, NATIVE_WINDOW_DEFAULT_DATASPACE,
+            reinterpret_cast<int*>(&dataSpace))) != OK) {
+        String8 msg = String8::format("Camera %s: Failed to query Surface dataspace: %s (%d)",
+                cameraId.string(), strerror(-err), err);
+        ALOGE("%s: %s", __FUNCTION__, msg.string());
+        return STATUS_ERROR(CameraService::ERROR_INVALID_OPERATION, msg.string());
+    }
+
+    // FIXME: remove this override since the default format should be
+    //       IMPLEMENTATION_DEFINED. b/9487482 & b/35317944
+    if ((format >= HAL_PIXEL_FORMAT_RGBA_8888 && format <= HAL_PIXEL_FORMAT_BGRA_8888) &&
+            ((consumerUsage & GRALLOC_USAGE_HW_MASK) &&
+             ((consumerUsage & GRALLOC_USAGE_SW_READ_MASK) == 0))) {
+        ALOGW("%s: Camera %s: Overriding format %#x to IMPLEMENTATION_DEFINED",
+                __FUNCTION__, cameraId.string(), format);
+        format = HAL_PIXEL_FORMAT_IMPLEMENTATION_DEFINED;
+    }
+    // Round dimensions to the nearest dimensions available for this format
+    if (flexibleConsumer && isPublicFormat(format) &&
+            !SessionConfigurationUtils::roundBufferDimensionNearest(width, height,
+            format, dataSpace, physicalCameraMetadata, /*out*/&width, /*out*/&height)) {
+        String8 msg = String8::format("Camera %s: No supported stream configurations with "
+                "format %#x defined, failed to create output stream",
+                cameraId.string(), format);
+        ALOGE("%s: %s", __FUNCTION__, msg.string());
+        return STATUS_ERROR(CameraService::ERROR_ILLEGAL_ARGUMENT, msg.string());
+    }
+
+    if (!isStreamInfoValid) {
+        streamInfo.width = width;
+        streamInfo.height = height;
+        streamInfo.format = format;
+        streamInfo.dataSpace = dataSpace;
+        streamInfo.consumerUsage = consumerUsage;
+        return binder::Status::ok();
+    }
+    if (width != streamInfo.width) {
+        String8 msg = String8::format("Camera %s:Surface width doesn't match: %d vs %d",
+                cameraId.string(), width, streamInfo.width);
+        ALOGE("%s: %s", __FUNCTION__, msg.string());
+        return STATUS_ERROR(CameraService::ERROR_ILLEGAL_ARGUMENT, msg.string());
+    }
+    if (height != streamInfo.height) {
+        String8 msg = String8::format("Camera %s:Surface height doesn't match: %d vs %d",
+                 cameraId.string(), height, streamInfo.height);
+        ALOGE("%s: %s", __FUNCTION__, msg.string());
+        return STATUS_ERROR(CameraService::ERROR_ILLEGAL_ARGUMENT, msg.string());
+    }
+    if (format != streamInfo.format) {
+        String8 msg = String8::format("Camera %s:Surface format doesn't match: %d vs %d",
+                 cameraId.string(), format, streamInfo.format);
+        ALOGE("%s: %s", __FUNCTION__, msg.string());
+        return STATUS_ERROR(CameraService::ERROR_ILLEGAL_ARGUMENT, msg.string());
+    }
+    if (format != HAL_PIXEL_FORMAT_IMPLEMENTATION_DEFINED) {
+        if (dataSpace != streamInfo.dataSpace) {
+            String8 msg = String8::format("Camera %s:Surface dataSpace doesn't match: %d vs %d",
+                    cameraId.string(), dataSpace, streamInfo.dataSpace);
+            ALOGE("%s: %s", __FUNCTION__, msg.string());
+            return STATUS_ERROR(CameraService::ERROR_ILLEGAL_ARGUMENT, msg.string());
+        }
+        //At the native side, there isn't a way to check whether 2 surfaces come from the same
+        //surface class type. Use usage flag to approximate the comparison.
+        if (consumerUsage != streamInfo.consumerUsage) {
+            String8 msg = String8::format(
+                    "Camera %s:Surface usage flag doesn't match %" PRIu64 " vs %" PRIu64 "",
+                    cameraId.string(), consumerUsage, streamInfo.consumerUsage);
+            ALOGE("%s: %s", __FUNCTION__, msg.string());
+            return STATUS_ERROR(CameraService::ERROR_ILLEGAL_ARGUMENT, msg.string());
+        }
+    }
+    return binder::Status::ok();
+}
+
+
+void SessionConfigurationUtils::mapStreamInfo(const OutputStreamInfo &streamInfo,
+            camera3_stream_rotation_t rotation, String8 physicalId,
+            hardware::camera::device::V3_4::Stream *stream /*out*/) {
+    if (stream == nullptr) {
+        return;
+    }
+
+    stream->v3_2.streamType = hardware::camera::device::V3_2::StreamType::OUTPUT;
+    stream->v3_2.width = streamInfo.width;
+    stream->v3_2.height = streamInfo.height;
+    stream->v3_2.format = Camera3Device::mapToPixelFormat(streamInfo.format);
+    auto u = streamInfo.consumerUsage;
+    camera3::Camera3OutputStream::applyZSLUsageQuirk(streamInfo.format, &u);
+    stream->v3_2.usage = Camera3Device::mapToConsumerUsage(u);
+    stream->v3_2.dataSpace = Camera3Device::mapToHidlDataspace(streamInfo.dataSpace);
+    stream->v3_2.rotation = Camera3Device::mapToStreamRotation(rotation);
+    stream->v3_2.id = -1; // Invalid stream id
+    stream->physicalCameraId = std::string(physicalId.string());
+    stream->bufferSize = 0;
+}
+
+binder::Status SessionConfigurationUtils::checkPhysicalCameraId(
+        const std::vector<std::string> &physicalCameraIds, const String8 &physicalCameraId,
+        const String8 &logicalCameraId) {
+    if (physicalCameraId.size() == 0) {
+        return binder::Status::ok();
+    }
+    if (std::find(physicalCameraIds.begin(), physicalCameraIds.end(),
+        physicalCameraId.string()) == physicalCameraIds.end()) {
+        String8 msg = String8::format("Camera %s: Camera doesn't support physicalCameraId %s.",
+                logicalCameraId.string(), physicalCameraId.string());
+        ALOGE("%s: %s", __FUNCTION__, msg.string());
+        return STATUS_ERROR(CameraService::ERROR_ILLEGAL_ARGUMENT, msg.string());
+    }
+    return binder::Status::ok();
+}
+
+binder::Status SessionConfigurationUtils::checkSurfaceType(size_t numBufferProducers,
+        bool deferredConsumer, int surfaceType)  {
+    if (numBufferProducers > MAX_SURFACES_PER_STREAM) {
+        ALOGE("%s: GraphicBufferProducer count %zu for stream exceeds limit of %d",
+                __FUNCTION__, numBufferProducers, MAX_SURFACES_PER_STREAM);
+        return STATUS_ERROR(CameraService::ERROR_ILLEGAL_ARGUMENT, "Surface count is too high");
+    } else if ((numBufferProducers == 0) && (!deferredConsumer)) {
+        ALOGE("%s: Number of consumers cannot be smaller than 1", __FUNCTION__);
+        return STATUS_ERROR(CameraService::ERROR_ILLEGAL_ARGUMENT, "No valid consumers.");
+    }
+
+    bool validSurfaceType = ((surfaceType == OutputConfiguration::SURFACE_TYPE_SURFACE_VIEW) ||
+            (surfaceType == OutputConfiguration::SURFACE_TYPE_SURFACE_TEXTURE));
+
+    if (deferredConsumer && !validSurfaceType) {
+        ALOGE("%s: Target surface has invalid surfaceType = %d.", __FUNCTION__, surfaceType);
+        return STATUS_ERROR(CameraService::ERROR_ILLEGAL_ARGUMENT, "Target Surface is invalid");
+    }
+
+    return binder::Status::ok();
+}
+
+binder::Status SessionConfigurationUtils::checkOperatingMode(int operatingMode,
+        const CameraMetadata &staticInfo, const String8 &cameraId) {
+    if (operatingMode < 0) {
+        String8 msg = String8::format(
+            "Camera %s: Invalid operating mode %d requested", cameraId.string(), operatingMode);
+        ALOGE("%s: %s", __FUNCTION__, msg.string());
+        return STATUS_ERROR(CameraService::ERROR_ILLEGAL_ARGUMENT,
+                msg.string());
+    }
+
+    bool isConstrainedHighSpeed = (operatingMode == ICameraDeviceUser::CONSTRAINED_HIGH_SPEED_MODE);
+    if (isConstrainedHighSpeed) {
+        camera_metadata_ro_entry_t entry = staticInfo.find(ANDROID_REQUEST_AVAILABLE_CAPABILITIES);
+        bool isConstrainedHighSpeedSupported = false;
+        for(size_t i = 0; i < entry.count; ++i) {
+            uint8_t capability = entry.data.u8[i];
+            if (capability == ANDROID_REQUEST_AVAILABLE_CAPABILITIES_CONSTRAINED_HIGH_SPEED_VIDEO) {
+                isConstrainedHighSpeedSupported = true;
+                break;
+            }
+        }
+        if (!isConstrainedHighSpeedSupported) {
+            String8 msg = String8::format(
+                "Camera %s: Try to create a constrained high speed configuration on a device"
+                " that doesn't support it.", cameraId.string());
+            ALOGE("%s: %s", __FUNCTION__, msg.string());
+            return STATUS_ERROR(CameraService::ERROR_ILLEGAL_ARGUMENT,
+                    msg.string());
+        }
+    }
+
+    return binder::Status::ok();
+}
+
 binder::Status
 SessionConfigurationUtils::convertToHALStreamCombination(
         const SessionConfiguration& sessionConfiguration,
         const String8 &logicalCameraId, const CameraMetadata &deviceInfo,
         metadataGetter getMetadata, const std::vector<std::string> &physicalCameraIds,
         hardware::camera::device::V3_4::StreamConfiguration &streamConfiguration, bool *earlyExit) {
-    // TODO: http://b/148329298 Move the other dependencies from
-    // CameraDeviceClient into SessionConfigurationUtils.
-    return CameraDeviceClient::convertToHALStreamCombination(sessionConfiguration, logicalCameraId,
-            deviceInfo, getMetadata, physicalCameraIds, streamConfiguration, earlyExit);
+
+    auto operatingMode = sessionConfiguration.getOperatingMode();
+    binder::Status res = checkOperatingMode(operatingMode, deviceInfo, logicalCameraId);
+    if (!res.isOk()) {
+        return res;
+    }
+
+    if (earlyExit == nullptr) {
+        String8 msg("earlyExit nullptr");
+        ALOGE("%s: %s", __FUNCTION__, msg.string());
+        return STATUS_ERROR(CameraService::ERROR_ILLEGAL_ARGUMENT, msg.string());
+    }
+    *earlyExit = false;
+    auto ret = Camera3Device::mapToStreamConfigurationMode(
+            static_cast<camera3_stream_configuration_mode_t> (operatingMode),
+            /*out*/ &streamConfiguration.operationMode);
+    if (ret != OK) {
+        String8 msg = String8::format(
+            "Camera %s: Failed mapping operating mode %d requested: %s (%d)",
+            logicalCameraId.string(), operatingMode, strerror(-ret), ret);
+        ALOGE("%s: %s", __FUNCTION__, msg.string());
+        return STATUS_ERROR(CameraService::ERROR_ILLEGAL_ARGUMENT,
+                msg.string());
+    }
+
+    bool isInputValid = (sessionConfiguration.getInputWidth() > 0) &&
+            (sessionConfiguration.getInputHeight() > 0) &&
+            (sessionConfiguration.getInputFormat() > 0);
+    auto outputConfigs = sessionConfiguration.getOutputConfigurations();
+    size_t streamCount = outputConfigs.size();
+    streamCount = isInputValid ? streamCount + 1 : streamCount;
+    streamConfiguration.streams.resize(streamCount);
+    size_t streamIdx = 0;
+    if (isInputValid) {
+        streamConfiguration.streams[streamIdx++] = {{/*streamId*/0,
+                hardware::camera::device::V3_2::StreamType::INPUT,
+                static_cast<uint32_t> (sessionConfiguration.getInputWidth()),
+                static_cast<uint32_t> (sessionConfiguration.getInputHeight()),
+                Camera3Device::mapToPixelFormat(sessionConfiguration.getInputFormat()),
+                /*usage*/ 0, HAL_DATASPACE_UNKNOWN,
+                hardware::camera::device::V3_2::StreamRotation::ROTATION_0},
+                /*physicalId*/ nullptr, /*bufferSize*/0};
+    }
+
+    for (const auto &it : outputConfigs) {
+        const std::vector<sp<IGraphicBufferProducer>>& bufferProducers =
+            it.getGraphicBufferProducers();
+        bool deferredConsumer = it.isDeferred();
+        String8 physicalCameraId = String8(it.getPhysicalCameraId());
+        size_t numBufferProducers = bufferProducers.size();
+        bool isStreamInfoValid = false;
+        OutputStreamInfo streamInfo;
+
+        res = checkSurfaceType(numBufferProducers, deferredConsumer, it.getSurfaceType());
+        if (!res.isOk()) {
+            return res;
+        }
+        res = checkPhysicalCameraId(physicalCameraIds, physicalCameraId,
+                logicalCameraId);
+        if (!res.isOk()) {
+            return res;
+        }
+
+        if (deferredConsumer) {
+            streamInfo.width = it.getWidth();
+            streamInfo.height = it.getHeight();
+            streamInfo.format = HAL_PIXEL_FORMAT_IMPLEMENTATION_DEFINED;
+            streamInfo.dataSpace = android_dataspace_t::HAL_DATASPACE_UNKNOWN;
+            auto surfaceType = it.getSurfaceType();
+            streamInfo.consumerUsage = GraphicBuffer::USAGE_HW_TEXTURE;
+            if (surfaceType == OutputConfiguration::SURFACE_TYPE_SURFACE_VIEW) {
+                streamInfo.consumerUsage |= GraphicBuffer::USAGE_HW_COMPOSER;
+            }
+            mapStreamInfo(streamInfo, CAMERA3_STREAM_ROTATION_0, physicalCameraId,
+                    &streamConfiguration.streams[streamIdx++]);
+            isStreamInfoValid = true;
+
+            if (numBufferProducers == 0) {
+                continue;
+            }
+        }
+
+        for (auto& bufferProducer : bufferProducers) {
+            sp<Surface> surface;
+            const CameraMetadata &physicalDeviceInfo = getMetadata(physicalCameraId);
+            res = createSurfaceFromGbp(streamInfo, isStreamInfoValid, surface, bufferProducer,
+                    logicalCameraId,
+                    physicalCameraId.size() > 0 ? physicalDeviceInfo : deviceInfo );
+
+            if (!res.isOk())
+                return res;
+
+            if (!isStreamInfoValid) {
+                bool isDepthCompositeStream =
+                        camera3::DepthCompositeStream::isDepthCompositeStream(surface);
+                bool isHeicCompositeStream =
+                        camera3::HeicCompositeStream::isHeicCompositeStream(surface);
+                if (isDepthCompositeStream || isHeicCompositeStream) {
+                    // We need to take in to account that composite streams can have
+                    // additional internal camera streams.
+                    std::vector<OutputStreamInfo> compositeStreams;
+                    if (isDepthCompositeStream) {
+                        ret = camera3::DepthCompositeStream::getCompositeStreamInfo(streamInfo,
+                                deviceInfo, &compositeStreams);
+                    } else {
+                        ret = camera3::HeicCompositeStream::getCompositeStreamInfo(streamInfo,
+                            deviceInfo, &compositeStreams);
+                    }
+                    if (ret != OK) {
+                        String8 msg = String8::format(
+                                "Camera %s: Failed adding composite streams: %s (%d)",
+                                logicalCameraId.string(), strerror(-ret), ret);
+                        ALOGE("%s: %s", __FUNCTION__, msg.string());
+                        return STATUS_ERROR(CameraService::ERROR_ILLEGAL_ARGUMENT, msg.string());
+                    }
+
+                    if (compositeStreams.size() == 0) {
+                        // No internal streams means composite stream not
+                        // supported.
+                        *earlyExit = true;
+                        return binder::Status::ok();
+                    } else if (compositeStreams.size() > 1) {
+                        streamCount += compositeStreams.size() - 1;
+                        streamConfiguration.streams.resize(streamCount);
+                    }
+
+                    for (const auto& compositeStream : compositeStreams) {
+                        mapStreamInfo(compositeStream,
+                                static_cast<camera3_stream_rotation_t> (it.getRotation()),
+                                physicalCameraId, &streamConfiguration.streams[streamIdx++]);
+                    }
+                } else {
+                    mapStreamInfo(streamInfo,
+                            static_cast<camera3_stream_rotation_t> (it.getRotation()),
+                            physicalCameraId, &streamConfiguration.streams[streamIdx++]);
+                }
+                isStreamInfoValid = true;
+            }
+        }
+    }
+    return binder::Status::ok();
+
 }
 
 }// namespace android
diff --git a/services/camera/libcameraservice/utils/SessionConfigurationUtils.h b/services/camera/libcameraservice/utils/SessionConfigurationUtils.h
index cfb9f17..6ce2cd7 100644
--- a/services/camera/libcameraservice/utils/SessionConfigurationUtils.h
+++ b/services/camera/libcameraservice/utils/SessionConfigurationUtils.h
@@ -23,6 +23,9 @@
 #include <camera/camera2/SubmitInfo.h>
 #include <android/hardware/camera/device/3.4/ICameraDeviceSession.h>
 
+#include <hardware/camera3.h>
+#include <device3/Camera3StreamInterface.h>
+
 #include <stdint.h>
 
 namespace android {
@@ -31,6 +34,41 @@
 
 class SessionConfigurationUtils {
 public:
+
+    static int64_t euclidDistSquare(int32_t x0, int32_t y0, int32_t x1, int32_t y1);
+
+    // Find the closest dimensions for a given format in available stream configurations with
+    // a width <= ROUNDING_WIDTH_CAP
+    static bool roundBufferDimensionNearest(int32_t width, int32_t height, int32_t format,
+            android_dataspace dataSpace, const CameraMetadata& info,
+            /*out*/int32_t* outWidth, /*out*/int32_t* outHeight);
+
+    //check if format is not custom format
+    static bool isPublicFormat(int32_t format);
+
+    // Create a Surface from an IGraphicBufferProducer. Returns error if
+    // IGraphicBufferProducer's property doesn't match with streamInfo
+    static binder::Status createSurfaceFromGbp(
+        camera3::OutputStreamInfo& streamInfo, bool isStreamInfoValid,
+        sp<Surface>& surface, const sp<IGraphicBufferProducer>& gbp,
+        const String8 &cameraId, const CameraMetadata &physicalCameraMetadata);
+
+    static void mapStreamInfo(const camera3::OutputStreamInfo &streamInfo,
+            camera3_stream_rotation_t rotation, String8 physicalId,
+            hardware::camera::device::V3_4::Stream *stream /*out*/);
+
+    // Check that the physicalCameraId passed in is spported by the camera
+    // device.
+    static binder::Status checkPhysicalCameraId(
+        const std::vector<std::string> &physicalCameraIds, const String8 &physicalCameraId,
+        const String8 &logicalCameraId);
+
+    static binder::Status checkSurfaceType(size_t numBufferProducers,
+        bool deferredConsumer, int surfaceType);
+
+    static binder::Status checkOperatingMode(int operatingMode,
+        const CameraMetadata &staticInfo, const String8 &cameraId);
+
     // utility function to convert AIDL SessionConfiguration to HIDL
     // streamConfiguration. Also checks for validity of SessionConfiguration and
     // returns a non-ok binder::Status if the passed in session configuration
@@ -41,6 +79,10 @@
             metadataGetter getMetadata, const std::vector<std::string> &physicalCameraIds,
             hardware::camera::device::V3_4::StreamConfiguration &streamConfiguration,
             bool *earlyExit);
+
+    static const int32_t MAX_SURFACES_PER_STREAM = 4;
+
+    static const int32_t ROUNDING_WIDTH_CAP = 1920;
 };
 
 } // android
diff --git a/services/mediacodec/Android.bp b/services/mediacodec/Android.bp
index 05bbbc7..dc0773b 100644
--- a/services/mediacodec/Android.bp
+++ b/services/mediacodec/Android.bp
@@ -19,8 +19,6 @@
         "libmedia_headers",
     ],
 
-    init_rc: ["mediaswcodec.rc"],
-
     cflags: [
         "-Werror",
         "-Wall",
diff --git a/services/mediacodec/mediaswcodec.rc b/services/mediacodec/mediaswcodec.rc
deleted file mode 100644
index 3549666..0000000
--- a/services/mediacodec/mediaswcodec.rc
+++ /dev/null
@@ -1,7 +0,0 @@
-service media.swcodec /system/bin/mediaswcodec
-    class main
-    user mediacodec
-    group camera drmrpc mediadrm
-    updatable
-    ioprio rt 4
-    writepid /dev/cpuset/foreground/tasks
diff --git a/services/mediaresourcemanager/Android.bp b/services/mediaresourcemanager/Android.bp
index 0d53c5e..cdf5a4e 100644
--- a/services/mediaresourcemanager/Android.bp
+++ b/services/mediaresourcemanager/Android.bp
@@ -1,8 +1,53 @@
+filegroup {
+    name: "resourcemanager_aidl",
+    srcs: [
+        "aidl/android/media/IResourceManagerClient.aidl",
+        "aidl/android/media/IResourceManagerService.aidl",
+        "aidl/android/media/MediaResourceType.aidl",
+        "aidl/android/media/MediaResourceSubType.aidl",
+        "aidl/android/media/MediaResourceParcel.aidl",
+        "aidl/android/media/MediaResourcePolicyParcel.aidl",
+    ],
+    path: "aidl",
+}
+
+filegroup {
+    name: "resourceobserver_aidl",
+    srcs: [
+        "aidl/android/media/IResourceObserver.aidl",
+        "aidl/android/media/IResourceObserverService.aidl",
+        "aidl/android/media/MediaObservableEvent.aidl",
+        "aidl/android/media/MediaObservableFilter.aidl",
+        "aidl/android/media/MediaObservableType.aidl",
+        "aidl/android/media/MediaObservableParcel.aidl",
+    ],
+    path: "aidl",
+}
+
+aidl_interface {
+    name: "resourcemanager_aidl_interface",
+    unstable: true,
+    local_include_dir: "aidl",
+    srcs: [
+        ":resourcemanager_aidl",
+    ],
+}
+
+aidl_interface {
+    name: "resourceobserver_aidl_interface",
+    unstable: true,
+    local_include_dir: "aidl",
+    srcs: [
+        ":resourceobserver_aidl",
+    ],
+}
+
 cc_library {
     name: "libresourcemanagerservice",
 
     srcs: [
         "ResourceManagerService.cpp",
+        "ResourceObserverService.cpp",
         "ServiceLog.cpp",
     ],
 
@@ -15,6 +60,10 @@
         "liblog",
     ],
 
+    static_libs: [
+        "resourceobserver_aidl_interface-ndk_platform",
+    ],
+
     include_dirs: ["frameworks/av/include"],
 
     cflags: [
diff --git a/services/mediaresourcemanager/ResourceManagerService.cpp b/services/mediaresourcemanager/ResourceManagerService.cpp
index 3d36f8e..90a04ac 100644
--- a/services/mediaresourcemanager/ResourceManagerService.cpp
+++ b/services/mediaresourcemanager/ResourceManagerService.cpp
@@ -36,18 +36,54 @@
 #include <unistd.h>
 
 #include "ResourceManagerService.h"
+#include "ResourceObserverService.h"
 #include "ServiceLog.h"
 
 namespace android {
 
+//static
+std::mutex ResourceManagerService::sCookieLock;
+//static
+uintptr_t ResourceManagerService::sCookieCounter = 0;
+//static
+std::map<uintptr_t, sp<DeathNotifier> > ResourceManagerService::sCookieToDeathNotifierMap;
+
+class DeathNotifier : public RefBase {
+public:
+    DeathNotifier(const std::shared_ptr<ResourceManagerService> &service,
+            int pid, int64_t clientId);
+
+    virtual ~DeathNotifier() {}
+
+    // Implement death recipient
+    static void BinderDiedCallback(void* cookie);
+    virtual void binderDied();
+
+protected:
+    std::weak_ptr<ResourceManagerService> mService;
+    int mPid;
+    int64_t mClientId;
+};
+
 DeathNotifier::DeathNotifier(const std::shared_ptr<ResourceManagerService> &service,
         int pid, int64_t clientId)
     : mService(service), mPid(pid), mClientId(clientId) {}
 
 //static
 void DeathNotifier::BinderDiedCallback(void* cookie) {
-    auto thiz = static_cast<DeathNotifier*>(cookie);
-    thiz->binderDied();
+    sp<DeathNotifier> notifier;
+    {
+        std::scoped_lock lock{ResourceManagerService::sCookieLock};
+        auto it = ResourceManagerService::sCookieToDeathNotifierMap.find(
+                reinterpret_cast<uintptr_t>(cookie));
+        if (it == ResourceManagerService::sCookieToDeathNotifierMap.end()) {
+            return;
+        }
+        notifier = it->second;
+    }
+    if (notifier.get() != nullptr) {
+        notifier->binderDied();
+    }
 }
 
 void DeathNotifier::binderDied() {
@@ -61,7 +97,27 @@
     service->overridePid(mPid, -1);
     // thiz is freed in the call below, so it must be last call referring thiz
     service->removeResource(mPid, mClientId, false);
+}
 
+class OverrideProcessInfoDeathNotifier : public DeathNotifier {
+public:
+    OverrideProcessInfoDeathNotifier(const std::shared_ptr<ResourceManagerService> &service,
+            int pid) : DeathNotifier(service, pid, 0) {}
+
+    virtual ~OverrideProcessInfoDeathNotifier() {}
+
+    virtual void binderDied();
+};
+
+void OverrideProcessInfoDeathNotifier::binderDied() {
+    // Don't check for pid validity since we know it's already dead.
+    std::shared_ptr<ResourceManagerService> service = mService.lock();
+    if (service == nullptr) {
+        ALOGW("ResourceManagerService is dead as well.");
+        return;
+    }
+
+    service->removeProcessInfoOverride(mPid);
 }
 
 template <typename T>
@@ -116,6 +172,7 @@
         info.uid = uid;
         info.clientId = clientId;
         info.client = client;
+        info.cookie = 0;
         info.pendingRemoval = false;
 
         index = infos.add(clientId, info);
@@ -267,6 +324,13 @@
     if (status != STATUS_OK) {
         return;
     }
+
+    std::shared_ptr<ResourceObserverService> observerService =
+            ResourceObserverService::instantiate();
+
+    if (observerService != nullptr) {
+        service->setObserverService(observerService);
+    }
     // TODO: mediaserver main() is already starting the thread pool,
     // move this to mediaserver main() when other services in mediaserver
     // are converted to ndk-platform aidl.
@@ -275,6 +339,11 @@
 
 ResourceManagerService::~ResourceManagerService() {}
 
+void ResourceManagerService::setObserverService(
+        const std::shared_ptr<ResourceObserverService>& observerService) {
+    mObserverService = observerService;
+}
+
 Status ResourceManagerService::config(const std::vector<MediaResourcePolicyParcel>& policies) {
     String8 log = String8::format("config(%s)", getString(policies).string());
     mServiceLog->add(log);
@@ -358,6 +427,7 @@
     }
     ResourceInfos& infos = getResourceInfosForEdit(pid, mMap);
     ResourceInfo& info = getResourceInfoForEdit(uid, clientId, client, infos);
+    ResourceList resourceAdded;
 
     for (size_t i = 0; i < resources.size(); ++i) {
         const auto &res = resources[i];
@@ -379,11 +449,20 @@
         } else {
             mergeResources(info.resources[resType], res);
         }
+        // Add it to the list of added resources for observers.
+        auto it = resourceAdded.find(resType);
+        if (it == resourceAdded.end()) {
+            resourceAdded[resType] = res;
+        } else {
+            mergeResources(it->second, res);
+        }
     }
-    if (info.deathNotifier == nullptr && client != nullptr) {
-        info.deathNotifier = new DeathNotifier(ref<ResourceManagerService>(), pid, clientId);
-        AIBinder_linkToDeath(client->asBinder().get(),
-                mDeathRecipient.get(), info.deathNotifier.get());
+    if (info.cookie == 0 && client != nullptr) {
+        info.cookie = addCookieAndLink_l(client->asBinder(),
+                new DeathNotifier(ref<ResourceManagerService>(), pid, clientId));
+    }
+    if (mObserverService != nullptr && !resourceAdded.empty()) {
+        mObserverService->onResourceAdded(uid, pid, resourceAdded);
     }
     notifyResourceGranted(pid, resources);
     return Status::ok();
@@ -415,7 +494,7 @@
     }
 
     ResourceInfo &info = infos.editValueAt(index);
-
+    ResourceList resourceRemoved;
     for (size_t i = 0; i < resources.size(); ++i) {
         const auto &res = resources[i];
         const auto resType = std::tuple(res.type, res.subType, res.id);
@@ -427,14 +506,27 @@
         // ignore if we don't have it
         if (info.resources.find(resType) != info.resources.end()) {
             MediaResourceParcel &resource = info.resources[resType];
+            MediaResourceParcel actualRemoved = res;
             if (resource.value > res.value) {
                 resource.value -= res.value;
             } else {
                 onLastRemoved(res, info);
                 info.resources.erase(resType);
+                actualRemoved.value = resource.value;
+            }
+
+            // Add it to the list of removed resources for observers.
+            auto it = resourceRemoved.find(resType);
+            if (it == resourceRemoved.end()) {
+                resourceRemoved[resType] = actualRemoved;
+            } else {
+                mergeResources(it->second, actualRemoved);
             }
         }
     }
+    if (mObserverService != nullptr && !resourceRemoved.empty()) {
+        mObserverService->onResourceRemoved(info.uid, pid, resourceRemoved);
+    }
     return Status::ok();
 }
 
@@ -472,8 +564,11 @@
         onLastRemoved(it->second, info);
     }
 
-    AIBinder_unlinkToDeath(info.client->asBinder().get(),
-            mDeathRecipient.get(), info.deathNotifier.get());
+    removeCookieAndUnlink_l(info.client->asBinder(), info.cookie);
+
+    if (mObserverService != nullptr && !info.resources.empty()) {
+        mObserverService->onResourceRemoved(info.uid, pid, info.resources);
+    }
 
     infos.removeItemsAt(index);
     return Status::ok();
@@ -651,6 +746,83 @@
     return Status::ok();
 }
 
+Status ResourceManagerService::overrideProcessInfo(
+        const std::shared_ptr<IResourceManagerClient>& client,
+        int pid,
+        int procState,
+        int oomScore) {
+    String8 log = String8::format("overrideProcessInfo(pid %d, procState %d, oomScore %d)",
+            pid, procState, oomScore);
+    mServiceLog->add(log);
+
+    // Only allow the override if the caller already can access process state and oom scores.
+    int callingPid = AIBinder_getCallingPid();
+    if (callingPid != getpid() && (callingPid != pid || !checkCallingPermission(String16(
+            "android.permission.GET_PROCESS_STATE_AND_OOM_SCORE")))) {
+        ALOGE("Permission Denial: overrideProcessInfo method from pid=%d", callingPid);
+        return Status::fromServiceSpecificError(PERMISSION_DENIED);
+    }
+
+    if (client == nullptr) {
+        return Status::fromServiceSpecificError(BAD_VALUE);
+    }
+
+    Mutex::Autolock lock(mLock);
+    removeProcessInfoOverride_l(pid);
+
+    if (!mProcessInfo->overrideProcessInfo(pid, procState, oomScore)) {
+        // Override value is rejected by ProcessInfo.
+        return Status::fromServiceSpecificError(BAD_VALUE);
+    }
+
+    uintptr_t cookie = addCookieAndLink_l(client->asBinder(),
+            new OverrideProcessInfoDeathNotifier(ref<ResourceManagerService>(), pid));
+
+    mProcessInfoOverrideMap.emplace(pid, ProcessInfoOverride{cookie, client});
+
+    return Status::ok();
+}
+
+uintptr_t ResourceManagerService::addCookieAndLink_l(
+        ::ndk::SpAIBinder binder, const sp<DeathNotifier>& notifier) {
+    std::scoped_lock lock{sCookieLock};
+
+    uintptr_t cookie;
+    // Need to skip cookie 0 (if it wraps around). ResourceInfo has cookie initialized to 0
+    // indicating the death notifier is not created yet.
+    while ((cookie = ++sCookieCounter) == 0);
+    AIBinder_linkToDeath(binder.get(), mDeathRecipient.get(), (void*)cookie);
+    sCookieToDeathNotifierMap.emplace(cookie, notifier);
+
+    return cookie;
+}
+
+void ResourceManagerService::removeCookieAndUnlink_l(
+        ::ndk::SpAIBinder binder, uintptr_t cookie) {
+    std::scoped_lock lock{sCookieLock};
+    AIBinder_unlinkToDeath(binder.get(), mDeathRecipient.get(), (void*)cookie);
+    sCookieToDeathNotifierMap.erase(cookie);
+}
+
+void ResourceManagerService::removeProcessInfoOverride(int pid) {
+    Mutex::Autolock lock(mLock);
+
+    removeProcessInfoOverride_l(pid);
+}
+
+void ResourceManagerService::removeProcessInfoOverride_l(int pid) {
+    auto it = mProcessInfoOverrideMap.find(pid);
+    if (it == mProcessInfoOverrideMap.end()) {
+        return;
+    }
+
+    mProcessInfo->removeProcessInfoOverride(pid);
+
+    removeCookieAndUnlink_l(it->second.client->asBinder(), it->second.cookie);
+
+    mProcessInfoOverrideMap.erase(pid);
+}
+
 Status ResourceManagerService::markClientForPendingRemoval(int32_t pid, int64_t clientId) {
     String8 log = String8::format(
             "markClientForPendingRemoval(pid %d, clientId %lld)",
diff --git a/services/mediaresourcemanager/ResourceManagerService.h b/services/mediaresourcemanager/ResourceManagerService.h
index 49c247e..1aa1e09 100644
--- a/services/mediaresourcemanager/ResourceManagerService.h
+++ b/services/mediaresourcemanager/ResourceManagerService.h
@@ -19,6 +19,7 @@
 #define ANDROID_MEDIA_RESOURCEMANAGERSERVICE_H
 
 #include <map>
+#include <mutex>
 
 #include <aidl/android/media/BnResourceManagerService.h>
 #include <arpa/inet.h>
@@ -33,6 +34,7 @@
 
 class DeathNotifier;
 class ResourceManagerService;
+class ResourceObserverService;
 class ServiceLog;
 struct ProcessInfoInterface;
 
@@ -50,7 +52,7 @@
     int64_t clientId;
     uid_t uid;
     std::shared_ptr<IResourceManagerClient> client;
-    sp<DeathNotifier> deathNotifier;
+    uintptr_t cookie{0};
     ResourceList resources;
     bool pendingRemoval{false};
 };
@@ -59,22 +61,6 @@
 typedef KeyedVector<int64_t, ResourceInfo> ResourceInfos;
 typedef KeyedVector<int, ResourceInfos> PidResourceInfosMap;
 
-class DeathNotifier : public RefBase {
-public:
-    DeathNotifier(const std::shared_ptr<ResourceManagerService> &service,
-            int pid, int64_t clientId);
-
-    ~DeathNotifier() {}
-
-    // Implement death recipient
-    static void BinderDiedCallback(void* cookie);
-    void binderDied();
-
-private:
-    std::weak_ptr<ResourceManagerService> mService;
-    int mPid;
-    int64_t mClientId;
-};
 class ResourceManagerService : public BnResourceManagerService {
 public:
     struct SystemCallbackInterface : public RefBase {
@@ -95,6 +81,8 @@
             const sp<ProcessInfoInterface> &processInfo,
             const sp<SystemCallbackInterface> &systemResource);
     virtual ~ResourceManagerService();
+    void setObserverService(
+            const std::shared_ptr<ResourceObserverService>& observerService);
 
     // IResourceManagerService interface
     Status config(const std::vector<MediaResourcePolicyParcel>& policies) override;
@@ -125,12 +113,20 @@
             int originalPid,
             int newPid) override;
 
+    Status overrideProcessInfo(
+            const std::shared_ptr<IResourceManagerClient>& client,
+            int pid,
+            int procState,
+            int oomScore) override;
+
     Status markClientForPendingRemoval(int32_t pid, int64_t clientId) override;
 
     Status removeResource(int pid, int64_t clientId, bool checkValid);
 
 private:
     friend class ResourceManagerServiceTest;
+    friend class DeathNotifier;
+    friend class OverrideProcessInfoDeathNotifier;
 
     // Gets the list of all the clients who own the specified resource type.
     // Returns false if any client belongs to a process with higher priority than the
@@ -170,6 +166,12 @@
     // Get priority from process's pid
     bool getPriority_l(int pid, int* priority);
 
+    void removeProcessInfoOverride(int pid);
+
+    void removeProcessInfoOverride_l(int pid);
+    uintptr_t addCookieAndLink_l(::ndk::SpAIBinder binder, const sp<DeathNotifier>& notifier);
+    void removeCookieAndUnlink_l(::ndk::SpAIBinder binder, uintptr_t cookie);
+
     mutable Mutex mLock;
     sp<ProcessInfoInterface> mProcessInfo;
     sp<SystemCallbackInterface> mSystemCB;
@@ -179,7 +181,17 @@
     bool mSupportsSecureWithNonSecureCodec;
     int32_t mCpuBoostCount;
     ::ndk::ScopedAIBinder_DeathRecipient mDeathRecipient;
+    struct ProcessInfoOverride {
+        uintptr_t cookie;
+        std::shared_ptr<IResourceManagerClient> client;
+    };
     std::map<int, int> mOverridePidMap;
+    std::map<pid_t, ProcessInfoOverride> mProcessInfoOverrideMap;
+    static std::mutex sCookieLock;
+    static uintptr_t sCookieCounter GUARDED_BY(sCookieLock);
+    static std::map<uintptr_t, sp<DeathNotifier> > sCookieToDeathNotifierMap
+            GUARDED_BY(sCookieLock);
+    std::shared_ptr<ResourceObserverService> mObserverService;
 };
 
 // ----------------------------------------------------------------------------
diff --git a/services/mediaresourcemanager/ResourceObserverService.cpp b/services/mediaresourcemanager/ResourceObserverService.cpp
new file mode 100644
index 0000000..7c4c875
--- /dev/null
+++ b/services/mediaresourcemanager/ResourceObserverService.cpp
@@ -0,0 +1,312 @@
+/**
+ *
+ * Copyright 2020, The Android Open Source Project
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ *     http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+//#define LOG_NDEBUG 0
+#define LOG_TAG "ResourceObserverService"
+#include <utils/Log.h>
+
+#include <android/binder_manager.h>
+#include <android/binder_process.h>
+#include <binder/IServiceManager.h>
+#include <utils/String16.h>
+#include <aidl/android/media/MediaResourceParcel.h>
+
+#include "ResourceObserverService.h"
+
+namespace aidl {
+namespace android {
+namespace media {
+bool operator<(const MediaObservableFilter& lhs, const MediaObservableFilter &rhs) {
+    return lhs.type < rhs.type || (lhs.type == rhs.type && lhs.eventFilter < rhs.eventFilter);
+}
+}}} // namespace ::aidl::android::media
+
+namespace android {
+
+using ::aidl::android::media::MediaResourceParcel;
+using ::aidl::android::media::MediaObservableEvent;
+
+// MediaObservableEvent will be used as uint64_t flags.
+static_assert(sizeof(MediaObservableEvent) == sizeof(uint64_t));
+
+static std::vector<MediaObservableEvent> sEvents = {
+        MediaObservableEvent::kBusy,
+        MediaObservableEvent::kIdle,
+};
+
+static MediaObservableType getObservableType(const MediaResourceParcel& res) {
+    if (res.subType == MediaResourceSubType::kVideoCodec) {
+        if (res.type == MediaResourceType::kNonSecureCodec) {
+            return MediaObservableType::kVideoNonSecureCodec;
+        }
+        if (res.type == MediaResourceType::kSecureCodec) {
+            return MediaObservableType::kVideoSecureCodec;
+        }
+    }
+    return MediaObservableType::kInvalid;
+}
+
+//static
+std::mutex ResourceObserverService::sDeathRecipientLock;
+//static
+std::map<uintptr_t, std::shared_ptr<ResourceObserverService::DeathRecipient> >
+ResourceObserverService::sDeathRecipientMap;
+
+struct ResourceObserverService::DeathRecipient {
+    DeathRecipient(ResourceObserverService* _service,
+            const std::shared_ptr<IResourceObserver>& _observer)
+        : service(_service), observer(_observer) {}
+    ~DeathRecipient() {}
+
+    void binderDied() {
+        if (service != nullptr) {
+            service->unregisterObserver(observer);
+        }
+    }
+
+    ResourceObserverService* service;
+    std::shared_ptr<IResourceObserver> observer;
+};
+
+// static
+void ResourceObserverService::BinderDiedCallback(void* cookie) {
+    uintptr_t id = reinterpret_cast<uintptr_t>(cookie);
+
+    ALOGW("Observer %lld is dead", (long long)id);
+
+    std::shared_ptr<DeathRecipient> recipient;
+
+    {
+        std::scoped_lock lock{sDeathRecipientLock};
+
+        auto it = sDeathRecipientMap.find(id);
+        if (it != sDeathRecipientMap.end()) {
+            recipient = it->second;
+        }
+    }
+
+    if (recipient != nullptr) {
+        recipient->binderDied();
+    }
+}
+
+//static
+std::shared_ptr<ResourceObserverService> ResourceObserverService::instantiate() {
+    std::shared_ptr<ResourceObserverService> observerService =
+            ::ndk::SharedRefBase::make<ResourceObserverService>();
+    binder_status_t status = AServiceManager_addService(observerService->asBinder().get(),
+            ResourceObserverService::getServiceName());
+    if (status != STATUS_OK) {
+        return nullptr;
+    }
+    return observerService;
+}
+
+ResourceObserverService::ResourceObserverService()
+    : mDeathRecipient(AIBinder_DeathRecipient_new(BinderDiedCallback)) {}
+
+binder_status_t ResourceObserverService::dump(
+        int fd, const char** /*args*/, uint32_t /*numArgs*/) {
+    String8 result;
+
+    if (checkCallingPermission(String16("android.permission.DUMP")) == false) {
+        result.format("Permission Denial: "
+                "can't dump ResourceManagerService from pid=%d, uid=%d\n",
+                AIBinder_getCallingPid(),
+                AIBinder_getCallingUid());
+        write(fd, result.string(), result.size());
+        return PERMISSION_DENIED;
+    }
+
+    result.appendFormat("ResourceObserverService: %p\n", this);
+    result.appendFormat("  Registered Observers: %zu\n", mObserverInfoMap.size());
+
+    {
+        std::scoped_lock lock{mObserverLock};
+
+        for (auto &observer : mObserverInfoMap) {
+            result.appendFormat("    Observer %p:\n", observer.second.binder.get());
+            for (auto &observable : observer.second.filters) {
+                String8 enabledEventsStr;
+                for (auto &event : sEvents) {
+                    if (((uint64_t)observable.eventFilter & (uint64_t)event) != 0) {
+                        if (!enabledEventsStr.isEmpty()) {
+                            enabledEventsStr.append("|");
+                        }
+                        enabledEventsStr.append(toString(event).c_str());
+                    }
+                }
+                result.appendFormat("      %s: %s\n",
+                        toString(observable.type).c_str(), enabledEventsStr.c_str());
+            }
+        }
+    }
+
+    write(fd, result.string(), result.size());
+    return OK;
+}
+
+Status ResourceObserverService::registerObserver(
+        const std::shared_ptr<IResourceObserver>& in_observer,
+        const std::vector<MediaObservableFilter>& in_filters) {
+    // TODO(chz): Guard this by a permission.
+
+    ::ndk::SpAIBinder binder = in_observer->asBinder();
+
+    {
+        std::scoped_lock lock{mObserverLock};
+
+        if (mObserverInfoMap.find((uintptr_t)binder.get()) != mObserverInfoMap.end()) {
+            return Status::fromServiceSpecificError(ALREADY_EXISTS);
+        }
+
+        if (in_filters.empty()) {
+            return Status::fromServiceSpecificError(BAD_VALUE);
+        }
+
+        // Add observer info.
+        mObserverInfoMap.emplace((uintptr_t)binder.get(),
+                ObserverInfo{binder, in_observer, in_filters});
+
+        // Add observer to observable->subscribers map.
+        for (auto &filter : in_filters) {
+            for (auto &event : sEvents) {
+                if (!((uint64_t)filter.eventFilter & (uint64_t)event)) {
+                    continue;
+                }
+                MediaObservableFilter key{filter.type, event};
+                mObservableToSubscribersMap[key].emplace((uintptr_t)binder.get(), in_observer);
+            }
+        }
+    }
+
+    // Add death binder and link.
+    uintptr_t cookie = (uintptr_t)binder.get();
+    {
+        std::scoped_lock lock{sDeathRecipientLock};
+        sDeathRecipientMap.emplace(
+                cookie, std::make_shared<DeathRecipient>(this, in_observer));
+    }
+
+    AIBinder_linkToDeath(binder.get(), mDeathRecipient.get(),
+                         reinterpret_cast<void*>(cookie));
+
+    return Status::ok();
+}
+
+Status ResourceObserverService::unregisterObserver(
+        const std::shared_ptr<IResourceObserver>& in_observer) {
+    // TODO(chz): Guard this by a permission.
+
+    ::ndk::SpAIBinder binder = in_observer->asBinder();
+
+    {
+        std::scoped_lock lock{mObserverLock};
+
+        auto it = mObserverInfoMap.find((uintptr_t)binder.get());
+        if (it == mObserverInfoMap.end()) {
+            return Status::fromServiceSpecificError(NAME_NOT_FOUND);
+        }
+
+        // Remove observer from observable->subscribers map.
+        for (auto &filter : it->second.filters) {
+            for (auto &event : sEvents) {
+                if (!((uint64_t)filter.eventFilter & (uint64_t)event)) {
+                    continue;
+                }
+                MediaObservableFilter key{filter.type, event};
+                mObservableToSubscribersMap[key].erase((uintptr_t)binder.get());
+
+                //Remove the entry if there's no more subscribers.
+                if (mObservableToSubscribersMap[key].empty()) {
+                    mObservableToSubscribersMap.erase(key);
+                }
+            }
+        }
+
+        // Remove observer info.
+        mObserverInfoMap.erase(it);
+    }
+
+    // Unlink and remove death binder.
+    uintptr_t cookie = (uintptr_t)binder.get();
+    AIBinder_unlinkToDeath(binder.get(), mDeathRecipient.get(),
+            reinterpret_cast<void*>(cookie));
+
+    {
+        std::scoped_lock lock{sDeathRecipientLock};
+        sDeathRecipientMap.erase(cookie);
+    }
+
+    return Status::ok();
+}
+
+void ResourceObserverService::notifyObservers(
+        MediaObservableEvent event, int uid, int pid, const ResourceList &resources) {
+    struct CalleeInfo {
+        std::shared_ptr<IResourceObserver> observer;
+        std::vector<MediaObservableParcel> monitors;
+    };
+    // Build a consolidated list of observers to call with their respective observables.
+    std::map<uintptr_t, CalleeInfo> calleeList;
+
+    {
+        std::scoped_lock lock{mObserverLock};
+
+        for (auto &res : resources) {
+            // Skip if this resource doesn't map to any observable type.
+            MediaObservableType observableType = getObservableType(res.second);
+            if (observableType == MediaObservableType::kInvalid) {
+                continue;
+            }
+            MediaObservableFilter key{observableType, event};
+            // Skip if no one subscribed to this observable.
+            auto observableIt = mObservableToSubscribersMap.find(key);
+            if (observableIt == mObservableToSubscribersMap.end()) {
+                continue;
+            }
+            // Loop through all subsribers.
+            for (auto &subscriber : observableIt->second) {
+                auto calleeIt = calleeList.find(subscriber.first);
+                if (calleeIt == calleeList.end()) {
+                    calleeList.emplace(subscriber.first, CalleeInfo{
+                        subscriber.second, {{observableType, res.second.value}}});
+                } else {
+                    calleeIt->second.monitors.push_back({observableType, res.second.value});
+                }
+            }
+        }
+    }
+
+    // Finally call the observers about the status change.
+    for (auto &calleeInfo : calleeList) {
+        calleeInfo.second.observer->onStatusChanged(
+                event, uid, pid, calleeInfo.second.monitors);
+    }
+}
+
+void ResourceObserverService::onResourceAdded(
+        int uid, int pid, const ResourceList &resources) {
+    notifyObservers(MediaObservableEvent::kBusy, uid, pid, resources);
+}
+
+void ResourceObserverService::onResourceRemoved(
+        int uid, int pid, const ResourceList &resources) {
+    notifyObservers(MediaObservableEvent::kIdle, uid, pid, resources);
+}
+
+} // namespace android
diff --git a/services/mediaresourcemanager/ResourceObserverService.h b/services/mediaresourcemanager/ResourceObserverService.h
new file mode 100644
index 0000000..46bc5fb
--- /dev/null
+++ b/services/mediaresourcemanager/ResourceObserverService.h
@@ -0,0 +1,95 @@
+/**
+ *
+ * Copyright 2020, The Android Open Source Project
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ *     http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+#ifndef ANDROID_MEDIA_RESOURCE_OBSERVER_SERVICE_H
+#define ANDROID_MEDIA_RESOURCE_OBSERVER_SERVICE_H
+
+#include <map>
+
+#include <aidl/android/media/BnResourceObserverService.h>
+#include "ResourceManagerService.h"
+
+namespace android {
+
+using Status = ::ndk::ScopedAStatus;
+using ::aidl::android::media::BnResourceObserverService;
+using ::aidl::android::media::IResourceObserver;
+using ::aidl::android::media::MediaObservableFilter;
+using ::aidl::android::media::MediaObservableParcel;
+using ::aidl::android::media::MediaObservableType;
+using ::aidl::android::media::MediaObservableEvent;
+
+class ResourceObserverService : public BnResourceObserverService {
+public:
+
+    static char const *getServiceName() { return "media.resource_observer"; }
+    static std::shared_ptr<ResourceObserverService> instantiate();
+
+    virtual inline binder_status_t dump(
+            int /*fd*/, const char** /*args*/, uint32_t /*numArgs*/);
+
+    ResourceObserverService();
+    virtual ~ResourceObserverService() {}
+
+    // IResourceObserverService interface
+    Status registerObserver(const std::shared_ptr<IResourceObserver>& in_observer,
+            const std::vector<MediaObservableFilter>& in_filters) override;
+
+    Status unregisterObserver(const std::shared_ptr<IResourceObserver>& in_observer) override;
+    // ~IResourceObserverService interface
+
+    // Called by ResourceManagerService when resources are added.
+    void onResourceAdded(int uid, int pid, const ResourceList &resources);
+
+    // Called by ResourceManagerService when resources are removed.
+    void onResourceRemoved(int uid, int pid, const ResourceList &resources);
+
+private:
+    struct ObserverInfo {
+        ::ndk::SpAIBinder binder;
+        std::shared_ptr<IResourceObserver> observer;
+        std::vector<MediaObservableFilter> filters;
+    };
+    struct DeathRecipient;
+
+    // Below maps are all keyed on the observer's binder ptr value.
+    using ObserverInfoMap = std::map<uintptr_t, ObserverInfo>;
+    using SubscriberMap = std::map<uintptr_t, std::shared_ptr<IResourceObserver>>;
+
+    std::mutex mObserverLock;
+    // Binder->ObserverInfo
+    ObserverInfoMap mObserverInfoMap GUARDED_BY(mObserverLock);
+    // Observable(<type,event>)->Subscribers
+    std::map<MediaObservableFilter, SubscriberMap> mObservableToSubscribersMap
+            GUARDED_BY(mObserverLock);
+
+    ::ndk::ScopedAIBinder_DeathRecipient mDeathRecipient;
+
+    // Binder death handling.
+    static std::mutex sDeathRecipientLock;
+    static std::map<uintptr_t, std::shared_ptr<DeathRecipient>> sDeathRecipientMap
+            GUARDED_BY(sDeathRecipientLock);
+    static void BinderDiedCallback(void* cookie);
+
+    void notifyObservers(MediaObservableEvent event,
+            int uid, int pid, const ResourceList &resources);
+};
+
+// ----------------------------------------------------------------------------
+} // namespace android
+
+#endif // ANDROID_MEDIA_RESOURCE_OBSERVER_SERVICE_H
diff --git a/services/mediaresourcemanager/TEST_MAPPING b/services/mediaresourcemanager/TEST_MAPPING
index 418b159..52ad441 100644
--- a/services/mediaresourcemanager/TEST_MAPPING
+++ b/services/mediaresourcemanager/TEST_MAPPING
@@ -5,6 +5,9 @@
     },
     {
        "name": "ServiceLog_test"
+    },
+    {
+       "name": "ResourceObserverService_test"
     }
   ]
 }
diff --git a/media/libmedia/aidl/android/media/IResourceManagerClient.aidl b/services/mediaresourcemanager/aidl/android/media/IResourceManagerClient.aidl
similarity index 100%
rename from media/libmedia/aidl/android/media/IResourceManagerClient.aidl
rename to services/mediaresourcemanager/aidl/android/media/IResourceManagerClient.aidl
diff --git a/media/libmedia/aidl/android/media/IResourceManagerService.aidl b/services/mediaresourcemanager/aidl/android/media/IResourceManagerService.aidl
similarity index 78%
rename from media/libmedia/aidl/android/media/IResourceManagerService.aidl
rename to services/mediaresourcemanager/aidl/android/media/IResourceManagerService.aidl
index 1b2d522..5cf8686 100644
--- a/media/libmedia/aidl/android/media/IResourceManagerService.aidl
+++ b/services/mediaresourcemanager/aidl/android/media/IResourceManagerService.aidl
@@ -96,6 +96,28 @@
     void overridePid(int originalPid, int newPid);
 
     /**
+     * Override the process state and OOM score of the calling process with the
+     * the specified values. This is used by native service processes to specify
+     * these values for ResourceManagerService to use. ResourceManagerService usually
+     * gets these values from ActivityManagerService, however, ActivityManagerService
+     * doesn't track native service processes.
+     *
+     * @param client a token for the ResourceManagerService to link to the caller and
+     *              receive notification if it goes away. This is needed for clearing
+     *              the overrides.
+     * @param pid pid of the calling process.
+     * @param procState the process state value that ResourceManagerService should
+     *                  use for this pid.
+     * @param oomScore the oom score value that ResourceManagerService should
+     *                  use for this pid.
+     */
+    void overrideProcessInfo(
+            IResourceManagerClient client,
+            int pid,
+            int procState,
+            int oomScore);
+
+    /**
      * Mark a client for pending removal
      *
      * @param pid pid from which the client's resources will be removed.
diff --git a/services/mediaresourcemanager/aidl/android/media/IResourceObserver.aidl b/services/mediaresourcemanager/aidl/android/media/IResourceObserver.aidl
new file mode 100644
index 0000000..462009a
--- /dev/null
+++ b/services/mediaresourcemanager/aidl/android/media/IResourceObserver.aidl
@@ -0,0 +1,39 @@
+/**
+ * Copyright (c) 2020, The Android Open Source Project
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ *     http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+package android.media;
+
+import android.media.MediaObservableEvent;
+import android.media.MediaObservableParcel;
+
+/**
+ * IResourceObserver interface for receiving observable resource updates
+ * from IResourceObserverService.
+ *
+ * {@hide}
+ */
+interface IResourceObserver {
+    /**
+     * Called when an observed resource is granted to a client.
+     *
+     * @param event the status change that happened to the resource.
+     * @param uid uid to which the resource is associated.
+     * @param pid pid to which the resource is associated.
+     * @param observables the resources whose status has changed.
+     */
+    oneway void onStatusChanged(MediaObservableEvent event,
+        int uid, int pid, in MediaObservableParcel[] observables);
+}
diff --git a/services/mediaresourcemanager/aidl/android/media/IResourceObserverService.aidl b/services/mediaresourcemanager/aidl/android/media/IResourceObserverService.aidl
new file mode 100644
index 0000000..08f4ca0
--- /dev/null
+++ b/services/mediaresourcemanager/aidl/android/media/IResourceObserverService.aidl
@@ -0,0 +1,49 @@
+/**
+ * Copyright (c) 2020, The Android Open Source Project
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ *     http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+package android.media;
+
+import android.media.IResourceObserver;
+import android.media.MediaObservableFilter;
+
+/**
+ * IResourceObserverService interface for registering an IResourceObserver
+ * callback to receive status updates about observable media resources.
+ *
+ * {@hide}
+ */
+interface IResourceObserverService {
+
+    /**
+     * Register an observer on the IResourceObserverService to receive
+     * status updates for observable resources.
+     *
+     * @param observer the observer to register.
+     * @param filters an array of filters for resources and events to receive
+     *                updates for.
+     */
+    void registerObserver(
+            IResourceObserver observer,
+            in MediaObservableFilter[] filters);
+
+    /**
+     * Unregister an observer from the IResourceObserverService.
+     * The observer will stop receiving the status updates.
+     *
+     * @param observer the observer to unregister.
+     */
+    void unregisterObserver(IResourceObserver observer);
+}
diff --git a/services/mediaresourcemanager/aidl/android/media/MediaObservableEvent.aidl b/services/mediaresourcemanager/aidl/android/media/MediaObservableEvent.aidl
new file mode 100644
index 0000000..56ab24d
--- /dev/null
+++ b/services/mediaresourcemanager/aidl/android/media/MediaObservableEvent.aidl
@@ -0,0 +1,44 @@
+/**
+ * Copyright (c) 2020, The Android Open Source Project
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ *     http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+package android.media;
+
+/**
+ * Enums for media observable events.
+ *
+ * These values are used as bitmasks to indicate the events that the
+ * observer is interested in in the MediaObservableFilter objects passed to
+ * IResourceObserverService::registerObserver().
+ *
+ * {@hide}
+ */
+@Backing(type="long")
+enum MediaObservableEvent {
+    /**
+     * A media resource is granted to a client and becomes busy.
+     */
+    kBusy = 1,
+
+    /**
+     * A media resource is released by a client and becomes idle.
+     */
+    kIdle = 2,
+
+    /**
+     * A bitmask that covers all observable events defined.
+     */
+    kAll = ~0,
+}
diff --git a/services/mediaresourcemanager/aidl/android/media/MediaObservableFilter.aidl b/services/mediaresourcemanager/aidl/android/media/MediaObservableFilter.aidl
new file mode 100644
index 0000000..38f7e39
--- /dev/null
+++ b/services/mediaresourcemanager/aidl/android/media/MediaObservableFilter.aidl
@@ -0,0 +1,43 @@
+/**
+ * Copyright (c) 2020, The Android Open Source Project
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ *     http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+package android.media;
+
+import android.media.MediaObservableType;
+import android.media.MediaObservableEvent;
+
+/**
+ * Description of an observable resource and its associated events that the
+ * observer is interested in.
+ *
+ * {@hide}
+ */
+parcelable MediaObservableFilter {
+    /**
+     * Type of the observable media resource.
+     */
+    MediaObservableType type;
+
+    /**
+     * Events that the observer is interested in.
+     *
+     * This field is a bitwise-OR of the events in MediaObservableEvent. If a
+     * particular event's bit is set, it means that updates should be sent for
+     * that event. For example, if the observer is only interested in receiving
+     * updates when a resource becomes available, it should only set 'kIdle'.
+     */
+    MediaObservableEvent eventFilter;
+}
diff --git a/services/mediaresourcemanager/aidl/android/media/MediaObservableParcel.aidl b/services/mediaresourcemanager/aidl/android/media/MediaObservableParcel.aidl
new file mode 100644
index 0000000..c4233e1
--- /dev/null
+++ b/services/mediaresourcemanager/aidl/android/media/MediaObservableParcel.aidl
@@ -0,0 +1,37 @@
+/**
+ * Copyright (c) 2020, The Android Open Source Project
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ *     http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+package android.media;
+
+import android.media.MediaObservableType;
+
+/**
+ * Description of an observable resource whose status has changed.
+ *
+ * {@hide}
+ */
+parcelable MediaObservableParcel {
+    /**
+     * Type of the observable media resource.
+     */
+    MediaObservableType type;// = MediaObservableType::kInvalid;
+
+    /**
+     * Number of units of the observable resource (number of codecs, bytes of
+     * graphic memory, etc.).
+     */
+    long value = 0;
+}
diff --git a/services/mediaresourcemanager/aidl/android/media/MediaObservableType.aidl b/services/mediaresourcemanager/aidl/android/media/MediaObservableType.aidl
new file mode 100644
index 0000000..ed202da
--- /dev/null
+++ b/services/mediaresourcemanager/aidl/android/media/MediaObservableType.aidl
@@ -0,0 +1,35 @@
+/**
+ * Copyright (c) 2020, The Android Open Source Project
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ *     http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+package android.media;
+
+/**
+ * Type enums of observable media resources.
+ *
+ * {@hide}
+ */
+@Backing(type="int")
+enum MediaObservableType {
+    kInvalid = 0,
+
+    //kVideoStart = 1000,
+    kVideoSecureCodec = 1000,
+    kVideoNonSecureCodec = 1001,
+
+    //kAudioStart = 2000,
+
+    //kGraphicMemory = 3000,
+}
diff --git a/media/libmedia/aidl/android/media/MediaResourceParcel.aidl b/services/mediaresourcemanager/aidl/android/media/MediaResourceParcel.aidl
similarity index 100%
rename from media/libmedia/aidl/android/media/MediaResourceParcel.aidl
rename to services/mediaresourcemanager/aidl/android/media/MediaResourceParcel.aidl
diff --git a/media/libmedia/aidl/android/media/MediaResourcePolicyParcel.aidl b/services/mediaresourcemanager/aidl/android/media/MediaResourcePolicyParcel.aidl
similarity index 100%
rename from media/libmedia/aidl/android/media/MediaResourcePolicyParcel.aidl
rename to services/mediaresourcemanager/aidl/android/media/MediaResourcePolicyParcel.aidl
diff --git a/media/libmedia/aidl/android/media/MediaResourceSubType.aidl b/services/mediaresourcemanager/aidl/android/media/MediaResourceSubType.aidl
similarity index 100%
rename from media/libmedia/aidl/android/media/MediaResourceSubType.aidl
rename to services/mediaresourcemanager/aidl/android/media/MediaResourceSubType.aidl
diff --git a/media/libmedia/aidl/android/media/MediaResourceType.aidl b/services/mediaresourcemanager/aidl/android/media/MediaResourceType.aidl
similarity index 100%
rename from media/libmedia/aidl/android/media/MediaResourceType.aidl
rename to services/mediaresourcemanager/aidl/android/media/MediaResourceType.aidl
diff --git a/services/mediaresourcemanager/test/Android.bp b/services/mediaresourcemanager/test/Android.bp
index 6b2ef69..308ee91 100644
--- a/services/mediaresourcemanager/test/Android.bp
+++ b/services/mediaresourcemanager/test/Android.bp
@@ -40,3 +40,28 @@
         "-Wall",
     ],
 }
+
+cc_test {
+    name: "ResourceObserverService_test",
+    srcs: ["ResourceObserverService_test.cpp"],
+    test_suites: ["device-tests"],
+    static_libs: [
+        "libresourcemanagerservice",
+        "resourceobserver_aidl_interface-ndk_platform",
+    ],
+    shared_libs: [
+        "libbinder",
+        "libbinder_ndk",
+        "liblog",
+        "libmedia",
+        "libutils",
+    ],
+    include_dirs: [
+        "frameworks/av/include",
+        "frameworks/av/services/mediaresourcemanager",
+    ],
+    cflags: [
+        "-Werror",
+        "-Wall",
+    ],
+}
diff --git a/services/mediaresourcemanager/test/ResourceManagerServiceTestUtils.h b/services/mediaresourcemanager/test/ResourceManagerServiceTestUtils.h
new file mode 100644
index 0000000..4cf5f0a
--- /dev/null
+++ b/services/mediaresourcemanager/test/ResourceManagerServiceTestUtils.h
@@ -0,0 +1,224 @@
+/*
+ * Copyright 2015 The Android Open Source Project
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ *      http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+#include <gtest/gtest.h>
+
+#include "ResourceManagerService.h"
+#include <aidl/android/media/BnResourceManagerClient.h>
+#include <media/MediaResource.h>
+#include <media/MediaResourcePolicy.h>
+#include <media/stagefright/foundation/ADebug.h>
+#include <media/stagefright/ProcessInfoInterface.h>
+
+namespace aidl {
+namespace android {
+namespace media {
+bool operator== (const MediaResourceParcel& lhs, const MediaResourceParcel& rhs) {
+    return lhs.type == rhs.type && lhs.subType == rhs.subType &&
+            lhs.id == rhs.id && lhs.value == rhs.value;
+}
+}}}
+
+namespace android {
+
+using Status = ::ndk::ScopedAStatus;
+using ::aidl::android::media::BnResourceManagerClient;
+using ::aidl::android::media::IResourceManagerService;
+using ::aidl::android::media::IResourceManagerClient;
+using ::aidl::android::media::MediaResourceParcel;
+
+static int64_t getId(const std::shared_ptr<IResourceManagerClient>& client) {
+    return (int64_t) client.get();
+}
+
+struct TestProcessInfo : public ProcessInfoInterface {
+    TestProcessInfo() {}
+    virtual ~TestProcessInfo() {}
+
+    virtual bool getPriority(int pid, int *priority) {
+        // For testing, use pid as priority.
+        // Lower the value higher the priority.
+        *priority = pid;
+        return true;
+    }
+
+    virtual bool isValidPid(int /* pid */) {
+        return true;
+    }
+
+    virtual bool overrideProcessInfo(
+            int /* pid */, int /* procState */, int /* oomScore */) {
+        return true;
+    }
+
+    virtual void removeProcessInfoOverride(int /* pid */) {
+    }
+
+private:
+    DISALLOW_EVIL_CONSTRUCTORS(TestProcessInfo);
+};
+
+struct TestSystemCallback :
+        public ResourceManagerService::SystemCallbackInterface {
+    TestSystemCallback() :
+        mLastEvent({EventType::INVALID, 0}), mEventCount(0) {}
+
+    enum EventType {
+        INVALID          = -1,
+        VIDEO_ON         = 0,
+        VIDEO_OFF        = 1,
+        VIDEO_RESET      = 2,
+        CPUSET_ENABLE    = 3,
+        CPUSET_DISABLE   = 4,
+    };
+
+    struct EventEntry {
+        EventType type;
+        int arg;
+    };
+
+    virtual void noteStartVideo(int uid) override {
+        mLastEvent = {EventType::VIDEO_ON, uid};
+        mEventCount++;
+    }
+
+    virtual void noteStopVideo(int uid) override {
+        mLastEvent = {EventType::VIDEO_OFF, uid};
+        mEventCount++;
+    }
+
+    virtual void noteResetVideo() override {
+        mLastEvent = {EventType::VIDEO_RESET, 0};
+        mEventCount++;
+    }
+
+    virtual bool requestCpusetBoost(bool enable) override {
+        mLastEvent = {enable ? EventType::CPUSET_ENABLE : EventType::CPUSET_DISABLE, 0};
+        mEventCount++;
+        return true;
+    }
+
+    size_t eventCount() { return mEventCount; }
+    EventType lastEventType() { return mLastEvent.type; }
+    EventEntry lastEvent() { return mLastEvent; }
+
+protected:
+    virtual ~TestSystemCallback() {}
+
+private:
+    EventEntry mLastEvent;
+    size_t mEventCount;
+
+    DISALLOW_EVIL_CONSTRUCTORS(TestSystemCallback);
+};
+
+
+struct TestClient : public BnResourceManagerClient {
+    TestClient(int pid, const std::shared_ptr<ResourceManagerService> &service)
+        : mReclaimed(false), mPid(pid), mService(service) {}
+
+    Status reclaimResource(bool* _aidl_return) override {
+        mService->removeClient(mPid, getId(ref<TestClient>()));
+        mReclaimed = true;
+        *_aidl_return = true;
+        return Status::ok();
+    }
+
+    Status getName(::std::string* _aidl_return) override {
+        *_aidl_return = "test_client";
+        return Status::ok();
+    }
+
+    bool reclaimed() const {
+        return mReclaimed;
+    }
+
+    void reset() {
+        mReclaimed = false;
+    }
+
+    virtual ~TestClient() {}
+
+private:
+    bool mReclaimed;
+    int mPid;
+    std::shared_ptr<ResourceManagerService> mService;
+    DISALLOW_EVIL_CONSTRUCTORS(TestClient);
+};
+
+static const int kTestPid1 = 30;
+static const int kTestUid1 = 1010;
+
+static const int kTestPid2 = 20;
+static const int kTestUid2 = 1011;
+
+static const int kLowPriorityPid = 40;
+static const int kMidPriorityPid = 25;
+static const int kHighPriorityPid = 10;
+
+using EventType = TestSystemCallback::EventType;
+using EventEntry = TestSystemCallback::EventEntry;
+bool operator== (const EventEntry& lhs, const EventEntry& rhs) {
+    return lhs.type == rhs.type && lhs.arg == rhs.arg;
+}
+
+#define CHECK_STATUS_TRUE(condition) \
+    EXPECT_TRUE((condition).isOk() && (result))
+
+#define CHECK_STATUS_FALSE(condition) \
+    EXPECT_TRUE((condition).isOk() && !(result))
+
+class ResourceManagerServiceTestBase : public ::testing::Test {
+public:
+    ResourceManagerServiceTestBase()
+        : mSystemCB(new TestSystemCallback()),
+          mService(::ndk::SharedRefBase::make<ResourceManagerService>(
+                  new TestProcessInfo, mSystemCB)),
+          mTestClient1(::ndk::SharedRefBase::make<TestClient>(kTestPid1, mService)),
+          mTestClient2(::ndk::SharedRefBase::make<TestClient>(kTestPid2, mService)),
+          mTestClient3(::ndk::SharedRefBase::make<TestClient>(kTestPid2, mService)) {
+    }
+
+    sp<TestSystemCallback> mSystemCB;
+    std::shared_ptr<ResourceManagerService> mService;
+    std::shared_ptr<IResourceManagerClient> mTestClient1;
+    std::shared_ptr<IResourceManagerClient> mTestClient2;
+    std::shared_ptr<IResourceManagerClient> mTestClient3;
+
+protected:
+    static bool isEqualResources(const std::vector<MediaResourceParcel> &resources1,
+            const ResourceList &resources2) {
+        // convert resource1 to ResourceList
+        ResourceList r1;
+        for (size_t i = 0; i < resources1.size(); ++i) {
+            const auto &res = resources1[i];
+            const auto resType = std::tuple(res.type, res.subType, res.id);
+            r1[resType] = res;
+        }
+        return r1 == resources2;
+    }
+
+    static void expectEqResourceInfo(const ResourceInfo &info,
+            int uid,
+            std::shared_ptr<IResourceManagerClient> client,
+            const std::vector<MediaResourceParcel> &resources) {
+        EXPECT_EQ(uid, info.uid);
+        EXPECT_EQ(client, info.client);
+        EXPECT_TRUE(isEqualResources(resources, info.resources));
+    }
+};
+
+} // namespace android
diff --git a/services/mediaresourcemanager/test/ResourceManagerService_test.cpp b/services/mediaresourcemanager/test/ResourceManagerService_test.cpp
index 702935d..15601aa 100644
--- a/services/mediaresourcemanager/test/ResourceManagerService_test.cpp
+++ b/services/mediaresourcemanager/test/ResourceManagerService_test.cpp
@@ -16,197 +16,17 @@
 
 //#define LOG_NDEBUG 0
 #define LOG_TAG "ResourceManagerService_test"
+
 #include <utils/Log.h>
 
-#include <gtest/gtest.h>
-
+#include "ResourceManagerServiceTestUtils.h"
 #include "ResourceManagerService.h"
-#include <aidl/android/media/BnResourceManagerClient.h>
-#include <media/MediaResource.h>
-#include <media/MediaResourcePolicy.h>
-#include <media/stagefright/foundation/ADebug.h>
-#include <media/stagefright/ProcessInfoInterface.h>
-
-namespace aidl {
-namespace android {
-namespace media {
-bool operator== (const MediaResourceParcel& lhs, const MediaResourceParcel& rhs) {
-    return lhs.type == rhs.type && lhs.subType == rhs.subType &&
-            lhs.id == rhs.id && lhs.value == rhs.value;
-}}}}
 
 namespace android {
 
-using Status = ::ndk::ScopedAStatus;
-using ::aidl::android::media::BnResourceManagerClient;
-using ::aidl::android::media::IResourceManagerService;
-using ::aidl::android::media::IResourceManagerClient;
-
-static int64_t getId(const std::shared_ptr<IResourceManagerClient>& client) {
-    return (int64_t) client.get();
-}
-
-struct TestProcessInfo : public ProcessInfoInterface {
-    TestProcessInfo() {}
-    virtual ~TestProcessInfo() {}
-
-    virtual bool getPriority(int pid, int *priority) {
-        // For testing, use pid as priority.
-        // Lower the value higher the priority.
-        *priority = pid;
-        return true;
-    }
-
-    virtual bool isValidPid(int /* pid */) {
-        return true;
-    }
-
-private:
-    DISALLOW_EVIL_CONSTRUCTORS(TestProcessInfo);
-};
-
-struct TestSystemCallback :
-        public ResourceManagerService::SystemCallbackInterface {
-    TestSystemCallback() :
-        mLastEvent({EventType::INVALID, 0}), mEventCount(0) {}
-
-    enum EventType {
-        INVALID          = -1,
-        VIDEO_ON         = 0,
-        VIDEO_OFF        = 1,
-        VIDEO_RESET      = 2,
-        CPUSET_ENABLE    = 3,
-        CPUSET_DISABLE   = 4,
-    };
-
-    struct EventEntry {
-        EventType type;
-        int arg;
-    };
-
-    virtual void noteStartVideo(int uid) override {
-        mLastEvent = {EventType::VIDEO_ON, uid};
-        mEventCount++;
-    }
-
-    virtual void noteStopVideo(int uid) override {
-        mLastEvent = {EventType::VIDEO_OFF, uid};
-        mEventCount++;
-    }
-
-    virtual void noteResetVideo() override {
-        mLastEvent = {EventType::VIDEO_RESET, 0};
-        mEventCount++;
-    }
-
-    virtual bool requestCpusetBoost(bool enable) override {
-        mLastEvent = {enable ? EventType::CPUSET_ENABLE : EventType::CPUSET_DISABLE, 0};
-        mEventCount++;
-        return true;
-    }
-
-    size_t eventCount() { return mEventCount; }
-    EventType lastEventType() { return mLastEvent.type; }
-    EventEntry lastEvent() { return mLastEvent; }
-
-protected:
-    virtual ~TestSystemCallback() {}
-
-private:
-    EventEntry mLastEvent;
-    size_t mEventCount;
-
-    DISALLOW_EVIL_CONSTRUCTORS(TestSystemCallback);
-};
-
-
-struct TestClient : public BnResourceManagerClient {
-    TestClient(int pid, const std::shared_ptr<ResourceManagerService> &service)
-        : mReclaimed(false), mPid(pid), mService(service) {}
-
-    Status reclaimResource(bool* _aidl_return) override {
-        mService->removeClient(mPid, getId(ref<TestClient>()));
-        mReclaimed = true;
-        *_aidl_return = true;
-        return Status::ok();
-    }
-
-    Status getName(::std::string* _aidl_return) override {
-        *_aidl_return = "test_client";
-        return Status::ok();
-    }
-
-    bool reclaimed() const {
-        return mReclaimed;
-    }
-
-    void reset() {
-        mReclaimed = false;
-    }
-
-    virtual ~TestClient() {}
-
-private:
-    bool mReclaimed;
-    int mPid;
-    std::shared_ptr<ResourceManagerService> mService;
-    DISALLOW_EVIL_CONSTRUCTORS(TestClient);
-};
-
-static const int kTestPid1 = 30;
-static const int kTestUid1 = 1010;
-
-static const int kTestPid2 = 20;
-static const int kTestUid2 = 1011;
-
-static const int kLowPriorityPid = 40;
-static const int kMidPriorityPid = 25;
-static const int kHighPriorityPid = 10;
-
-using EventType = TestSystemCallback::EventType;
-using EventEntry = TestSystemCallback::EventEntry;
-bool operator== (const EventEntry& lhs, const EventEntry& rhs) {
-    return lhs.type == rhs.type && lhs.arg == rhs.arg;
-}
-
-#define CHECK_STATUS_TRUE(condition) \
-    EXPECT_TRUE((condition).isOk() && (result))
-
-#define CHECK_STATUS_FALSE(condition) \
-    EXPECT_TRUE((condition).isOk() && !(result))
-
-class ResourceManagerServiceTest : public ::testing::Test {
+class ResourceManagerServiceTest : public ResourceManagerServiceTestBase {
 public:
-    ResourceManagerServiceTest()
-        : mSystemCB(new TestSystemCallback()),
-          mService(::ndk::SharedRefBase::make<ResourceManagerService>(
-                  new TestProcessInfo, mSystemCB)),
-          mTestClient1(::ndk::SharedRefBase::make<TestClient>(kTestPid1, mService)),
-          mTestClient2(::ndk::SharedRefBase::make<TestClient>(kTestPid2, mService)),
-          mTestClient3(::ndk::SharedRefBase::make<TestClient>(kTestPid2, mService)) {
-    }
-
-protected:
-    static bool isEqualResources(const std::vector<MediaResourceParcel> &resources1,
-            const ResourceList &resources2) {
-        // convert resource1 to ResourceList
-        ResourceList r1;
-        for (size_t i = 0; i < resources1.size(); ++i) {
-            const auto &res = resources1[i];
-            const auto resType = std::tuple(res.type, res.subType, res.id);
-            r1[resType] = res;
-        }
-        return r1 == resources2;
-    }
-
-    static void expectEqResourceInfo(const ResourceInfo &info,
-            int uid,
-            std::shared_ptr<IResourceManagerClient> client,
-            const std::vector<MediaResourceParcel> &resources) {
-        EXPECT_EQ(uid, info.uid);
-        EXPECT_EQ(client, info.client);
-        EXPECT_TRUE(isEqualResources(resources, info.resources));
-    }
+    ResourceManagerServiceTest() : ResourceManagerServiceTestBase() {}
 
     void verifyClients(bool c1, bool c2, bool c3) {
         TestClient *client1 = static_cast<TestClient*>(mTestClient1.get());
@@ -881,12 +701,6 @@
         EXPECT_EQ(4u, mSystemCB->eventCount());
         EXPECT_EQ(EventType::CPUSET_DISABLE, mSystemCB->lastEventType());
     }
-
-    sp<TestSystemCallback> mSystemCB;
-    std::shared_ptr<ResourceManagerService> mService;
-    std::shared_ptr<IResourceManagerClient> mTestClient1;
-    std::shared_ptr<IResourceManagerClient> mTestClient2;
-    std::shared_ptr<IResourceManagerClient> mTestClient3;
 };
 
 TEST_F(ResourceManagerServiceTest, config) {
diff --git a/services/mediaresourcemanager/test/ResourceObserverService_test.cpp b/services/mediaresourcemanager/test/ResourceObserverService_test.cpp
new file mode 100644
index 0000000..4c26246
--- /dev/null
+++ b/services/mediaresourcemanager/test/ResourceObserverService_test.cpp
@@ -0,0 +1,463 @@
+/*
+ * Copyright 2020 The Android Open Source Project
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ *      http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+//#define LOG_NDEBUG 0
+#define LOG_TAG "ResourceObserverService_test"
+
+#include <iostream>
+#include <list>
+
+#include <aidl/android/media/BnResourceObserver.h>
+#include <utils/Log.h>
+#include "ResourceObserverService.h"
+#include "ResourceManagerServiceTestUtils.h"
+
+namespace aidl {
+namespace android {
+namespace media {
+bool operator==(const MediaObservableParcel& lhs, const MediaObservableParcel& rhs) {
+    return lhs.type == rhs.type && lhs.value == rhs.value;
+}
+}}} // namespace ::aidl::android::media
+
+namespace android {
+
+using ::aidl::android::media::BnResourceObserver;
+using ::aidl::android::media::MediaObservableParcel;
+using ::aidl::android::media::MediaObservableType;
+
+#define BUSY ::aidl::android::media::MediaObservableEvent::kBusy
+#define IDLE ::aidl::android::media::MediaObservableEvent::kIdle
+#define ALL ::aidl::android::media::MediaObservableEvent::kAll
+
+struct EventTracker {
+    struct Event {
+        enum { NoEvent, Busy, Idle } type = NoEvent;
+        int uid = 0;
+        int pid = 0;
+        std::vector<MediaObservableParcel> observables;
+    };
+
+    static const Event NoEvent;
+
+    static std::string toString(const MediaObservableParcel& observable) {
+        return "{" + ::aidl::android::media::toString(observable.type)
+        + ", " + std::to_string(observable.value) + "}";
+    }
+    static std::string toString(const Event& event) {
+        std::string eventStr;
+        switch (event.type) {
+        case Event::Busy:
+            eventStr = "Busy";
+            break;
+        case Event::Idle:
+            eventStr = "Idle";
+            break;
+        default:
+            return "NoEvent";
+        }
+        std::string observableStr;
+        for (auto &observable : event.observables) {
+            if (!observableStr.empty()) {
+                observableStr += ", ";
+            }
+            observableStr += toString(observable);
+        }
+        return "{" + eventStr + ", " + std::to_string(event.uid) + ", "
+                + std::to_string(event.pid) + ", {" + observableStr + "}}";
+    }
+
+    static Event Busy(int uid, int pid, const std::vector<MediaObservableParcel>& observables) {
+        return { Event::Busy, uid, pid, observables };
+    }
+    static Event Idle(int uid, int pid, const std::vector<MediaObservableParcel>& observables) {
+        return { Event::Idle, uid, pid, observables };
+    }
+
+    // Pop 1 event from front, wait for up to timeoutUs if empty.
+    const Event& pop(int64_t timeoutUs = 0) {
+        std::unique_lock lock(mLock);
+
+        if (mEventQueue.empty() && timeoutUs > 0) {
+            mCondition.wait_for(lock, std::chrono::microseconds(timeoutUs));
+        }
+
+        if (mEventQueue.empty()) {
+            mPoppedEvent = NoEvent;
+        } else {
+            mPoppedEvent = *mEventQueue.begin();
+            mEventQueue.pop_front();
+        }
+
+        return mPoppedEvent;
+    }
+
+    // Push 1 event to back.
+    void append(const Event& event) {
+        ALOGD("%s", toString(event).c_str());
+
+        std::unique_lock lock(mLock);
+
+        mEventQueue.push_back(event);
+        mCondition.notify_one();
+    }
+
+private:
+    std::mutex mLock;
+    std::condition_variable mCondition;
+    Event mPoppedEvent;
+    std::list<Event> mEventQueue;
+};
+
+const EventTracker::Event EventTracker::NoEvent;
+
+// Operators for GTest macros.
+bool operator==(const EventTracker::Event& lhs, const EventTracker::Event& rhs) {
+    return lhs.type == rhs.type && lhs.uid == rhs.uid && lhs.pid == rhs.pid &&
+            lhs.observables == rhs.observables;
+}
+
+std::ostream& operator<<(std::ostream& str, const EventTracker::Event& v) {
+    str << EventTracker::toString(v);
+    return str;
+}
+
+struct TestObserver : public BnResourceObserver, public EventTracker {
+    TestObserver(const char *name) : mName(name) {}
+    ~TestObserver() = default;
+    Status onStatusChanged(MediaObservableEvent event, int32_t uid, int32_t pid,
+            const std::vector<MediaObservableParcel>& observables) override {
+        ALOGD("%s: %s", mName.c_str(), __FUNCTION__);
+        if (event == MediaObservableEvent::kBusy) {
+            append(Busy(uid, pid, observables));
+        } else {
+            append(Idle(uid, pid, observables));
+        }
+
+        return Status::ok();
+    }
+    std::string mName;
+};
+
+class ResourceObserverServiceTest : public ResourceManagerServiceTestBase {
+public:
+    ResourceObserverServiceTest() : ResourceManagerServiceTestBase(),
+        mObserverService(::ndk::SharedRefBase::make<ResourceObserverService>()),
+        mTestObserver1(::ndk::SharedRefBase::make<TestObserver>("observer1")),
+        mTestObserver2(::ndk::SharedRefBase::make<TestObserver>("observer2")),
+        mTestObserver3(::ndk::SharedRefBase::make<TestObserver>("observer3")) {
+        mService->setObserverService(mObserverService);
+    }
+
+    void registerObservers(MediaObservableEvent filter = ALL) {
+        std::vector<MediaObservableFilter> filters1, filters2, filters3;
+        filters1 = {{MediaObservableType::kVideoSecureCodec, filter}};
+        filters2 = {{MediaObservableType::kVideoNonSecureCodec, filter}};
+        filters3 = {{MediaObservableType::kVideoSecureCodec, filter},
+                   {MediaObservableType::kVideoNonSecureCodec, filter}};
+
+        // mTestObserver1 monitors secure video codecs.
+        EXPECT_TRUE(mObserverService->registerObserver(mTestObserver1, filters1).isOk());
+
+        // mTestObserver2 monitors non-secure video codecs.
+        EXPECT_TRUE(mObserverService->registerObserver(mTestObserver2, filters2).isOk());
+
+        // mTestObserver3 monitors both secure & non-secure video codecs.
+        EXPECT_TRUE(mObserverService->registerObserver(mTestObserver3, filters3).isOk());
+    }
+
+protected:
+    std::shared_ptr<ResourceObserverService> mObserverService;
+    std::shared_ptr<TestObserver> mTestObserver1;
+    std::shared_ptr<TestObserver> mTestObserver2;
+    std::shared_ptr<TestObserver> mTestObserver3;
+};
+
+TEST_F(ResourceObserverServiceTest, testRegisterObserver) {
+    std::vector<MediaObservableFilter> filters1;
+    Status status;
+
+    // Register with empty observables should fail.
+    status = mObserverService->registerObserver(mTestObserver1, filters1);
+    EXPECT_FALSE(status.isOk());
+    EXPECT_EQ(status.getServiceSpecificError(), BAD_VALUE);
+
+    // mTestObserver1 monitors secure video codecs.
+    filters1 = {{MediaObservableType::kVideoSecureCodec, ALL}};
+    EXPECT_TRUE(mObserverService->registerObserver(mTestObserver1, filters1).isOk());
+
+    // Register duplicates should fail.
+    status = mObserverService->registerObserver(mTestObserver1, filters1);
+    EXPECT_FALSE(status.isOk());
+    EXPECT_EQ(status.getServiceSpecificError(), ALREADY_EXISTS);
+}
+
+TEST_F(ResourceObserverServiceTest, testUnregisterObserver) {
+    std::vector<MediaObservableFilter> filters1;
+    Status status;
+
+    // Unregister without registering first should fail.
+    status = mObserverService->unregisterObserver(mTestObserver1);
+    EXPECT_FALSE(status.isOk());
+    EXPECT_EQ(status.getServiceSpecificError(), NAME_NOT_FOUND);
+
+    // mTestObserver1 monitors secure video codecs.
+    filters1 = {{MediaObservableType::kVideoSecureCodec, ALL}};
+    EXPECT_TRUE(mObserverService->registerObserver(mTestObserver1, filters1).isOk());
+    EXPECT_TRUE(mObserverService->unregisterObserver(mTestObserver1).isOk());
+
+    // Unregister again should fail.
+    status = mObserverService->unregisterObserver(mTestObserver1);
+    EXPECT_FALSE(status.isOk());
+    EXPECT_EQ(status.getServiceSpecificError(), NAME_NOT_FOUND);
+}
+
+TEST_F(ResourceObserverServiceTest, testAddResourceBasic) {
+    registerObservers();
+
+    std::vector<MediaObservableParcel> observables1, observables2, observables3;
+    observables1 = {{MediaObservableType::kVideoSecureCodec, 1}};
+    observables2 = {{MediaObservableType::kVideoNonSecureCodec, 1}};
+    observables3 = {{MediaObservableType::kVideoSecureCodec, 1},
+                   {MediaObservableType::kVideoNonSecureCodec, 1}};
+
+    std::vector<MediaResourceParcel> resources;
+    // Add secure video codec.
+    resources = {MediaResource::CodecResource(1 /*secure*/, 1 /*video*/)};
+    mService->addResource(kTestPid1, kTestUid1, getId(mTestClient1), mTestClient1, resources);
+    EXPECT_EQ(mTestObserver1->pop(), EventTracker::Busy(kTestUid1, kTestPid1, observables1));
+    EXPECT_EQ(mTestObserver2->pop(), EventTracker::NoEvent);
+    EXPECT_EQ(mTestObserver3->pop(), EventTracker::Busy(kTestUid1, kTestPid1, observables1));
+
+    // Add non-secure video codec.
+    resources = {MediaResource::CodecResource(0 /*secure*/, 1 /*video*/)};
+    mService->addResource(kTestPid2, kTestUid2, getId(mTestClient2), mTestClient2, resources);
+    EXPECT_EQ(mTestObserver1->pop(), EventTracker::NoEvent);
+    EXPECT_EQ(mTestObserver2->pop(), EventTracker::Busy(kTestUid2, kTestPid2, observables2));
+    EXPECT_EQ(mTestObserver3->pop(), EventTracker::Busy(kTestUid2, kTestPid2, observables2));
+
+    // Add secure & non-secure video codecs.
+    resources = {MediaResource::CodecResource(1 /*secure*/, 1 /*video*/),
+                 MediaResource::CodecResource(0 /*secure*/, 1 /*video*/)};
+    mService->addResource(kTestPid2, kTestUid2, getId(mTestClient3), mTestClient3, resources);
+    EXPECT_EQ(mTestObserver1->pop(), EventTracker::Busy(kTestUid2, kTestPid2, observables1));
+    EXPECT_EQ(mTestObserver2->pop(), EventTracker::Busy(kTestUid2, kTestPid2, observables2));
+    EXPECT_EQ(mTestObserver3->pop(), EventTracker::Busy(kTestUid2, kTestPid2, observables3));
+
+    // Add additional audio codecs, should be ignored.
+    resources.push_back(MediaResource::CodecResource(1 /*secure*/, 0 /*video*/));
+    resources.push_back(MediaResource::CodecResource(0 /*secure*/, 0 /*video*/));
+    mService->addResource(kTestPid1, kTestUid1, getId(mTestClient1), mTestClient1, resources);
+    EXPECT_EQ(mTestObserver1->pop(), EventTracker::Busy(kTestUid1, kTestPid1, observables1));
+    EXPECT_EQ(mTestObserver2->pop(), EventTracker::Busy(kTestUid1, kTestPid1, observables2));
+    EXPECT_EQ(mTestObserver3->pop(), EventTracker::Busy(kTestUid1, kTestPid1, observables3));
+}
+
+TEST_F(ResourceObserverServiceTest, testAddResourceMultiple) {
+    registerObservers();
+
+    std::vector<MediaObservableParcel> observables1, observables2, observables3;
+    observables1 = {{MediaObservableType::kVideoSecureCodec, 1}};
+    observables2 = {{MediaObservableType::kVideoNonSecureCodec, 1}};
+    observables3 = {{MediaObservableType::kVideoSecureCodec, 1},
+                   {MediaObservableType::kVideoNonSecureCodec, 1}};
+
+    std::vector<MediaResourceParcel> resources;
+
+    // Add multiple secure & non-secure video codecs.
+    // Multiple entries of the same type should be merged, count should be propagated correctly.
+    resources = {MediaResource::CodecResource(1 /*secure*/, 1 /*video*/),
+                 MediaResource::CodecResource(1 /*secure*/, 1 /*video*/),
+                 MediaResource::CodecResource(0 /*secure*/, 1 /*video*/, 3 /*count*/)};
+    observables1 = {{MediaObservableType::kVideoSecureCodec, 2}};
+    observables2 = {{MediaObservableType::kVideoNonSecureCodec, 3}};
+    observables3 = {{MediaObservableType::kVideoSecureCodec, 2},
+                   {MediaObservableType::kVideoNonSecureCodec, 3}};
+    mService->addResource(kTestPid2, kTestUid2, getId(mTestClient3), mTestClient3, resources);
+    EXPECT_EQ(mTestObserver1->pop(), EventTracker::Busy(kTestUid2, kTestPid2, observables1));
+    EXPECT_EQ(mTestObserver2->pop(), EventTracker::Busy(kTestUid2, kTestPid2, observables2));
+    EXPECT_EQ(mTestObserver3->pop(), EventTracker::Busy(kTestUid2, kTestPid2, observables3));
+}
+
+TEST_F(ResourceObserverServiceTest, testRemoveResourceBasic) {
+    registerObservers();
+
+    std::vector<MediaObservableParcel> observables1, observables2, observables3;
+    observables1 = {{MediaObservableType::kVideoSecureCodec, 1}};
+    observables2 = {{MediaObservableType::kVideoNonSecureCodec, 1}};
+    observables3 = {{MediaObservableType::kVideoSecureCodec, 1},
+                   {MediaObservableType::kVideoNonSecureCodec, 1}};
+
+    std::vector<MediaResourceParcel> resources;
+    // Add secure video codec to client1.
+    resources = {MediaResource::CodecResource(1 /*secure*/, 1 /*video*/)};
+    mService->addResource(kTestPid1, kTestUid1, getId(mTestClient1), mTestClient1, resources);
+    EXPECT_EQ(mTestObserver1->pop(), EventTracker::Busy(kTestUid1, kTestPid1, observables1));
+    EXPECT_EQ(mTestObserver2->pop(), EventTracker::NoEvent);
+    EXPECT_EQ(mTestObserver3->pop(), EventTracker::Busy(kTestUid1, kTestPid1, observables1));
+    // Remove secure video codec. observer 1&3 should receive updates.
+    mService->removeResource(kTestPid1, getId(mTestClient1), resources);
+    EXPECT_EQ(mTestObserver1->pop(), EventTracker::Idle(kTestUid1, kTestPid1, observables1));
+    EXPECT_EQ(mTestObserver2->pop(), EventTracker::NoEvent);
+    EXPECT_EQ(mTestObserver3->pop(), EventTracker::Idle(kTestUid1, kTestPid1, observables1));
+    // Remove secure video codec again, should have no event.
+    mService->removeResource(kTestPid1, getId(mTestClient1), resources);
+    EXPECT_EQ(mTestObserver1->pop(), EventTracker::NoEvent);
+    EXPECT_EQ(mTestObserver2->pop(), EventTracker::NoEvent);
+    EXPECT_EQ(mTestObserver3->pop(), EventTracker::NoEvent);
+    // Remove client1, should have no event.
+    mService->removeClient(kTestPid1, getId(mTestClient1));
+    EXPECT_EQ(mTestObserver1->pop(), EventTracker::NoEvent);
+    EXPECT_EQ(mTestObserver2->pop(), EventTracker::NoEvent);
+    EXPECT_EQ(mTestObserver3->pop(), EventTracker::NoEvent);
+
+    // Add non-secure video codec to client2.
+    resources = {MediaResource::CodecResource(0 /*secure*/, 1 /*video*/)};
+    mService->addResource(kTestPid2, kTestUid2, getId(mTestClient2), mTestClient2, resources);
+    EXPECT_EQ(mTestObserver1->pop(), EventTracker::NoEvent);
+    EXPECT_EQ(mTestObserver2->pop(), EventTracker::Busy(kTestUid2, kTestPid2, observables2));
+    EXPECT_EQ(mTestObserver3->pop(), EventTracker::Busy(kTestUid2, kTestPid2, observables2));
+    // Remove client2, observer 2&3 should receive updates.
+    mService->removeClient(kTestPid2, getId(mTestClient2));
+    EXPECT_EQ(mTestObserver1->pop(), EventTracker::NoEvent);
+    EXPECT_EQ(mTestObserver2->pop(), EventTracker::Idle(kTestUid2, kTestPid2, observables2));
+    EXPECT_EQ(mTestObserver3->pop(), EventTracker::Idle(kTestUid2, kTestPid2, observables2));
+    // Remove non-secure codec after client2 removed, should have no event.
+    mService->removeResource(kTestPid2, getId(mTestClient2), resources);
+    EXPECT_EQ(mTestObserver1->pop(), EventTracker::NoEvent);
+    EXPECT_EQ(mTestObserver2->pop(), EventTracker::NoEvent);
+    EXPECT_EQ(mTestObserver3->pop(), EventTracker::NoEvent);
+    // Remove client2 again, should have no event.
+    mService->removeClient(kTestPid2, getId(mTestClient2));
+    EXPECT_EQ(mTestObserver1->pop(), EventTracker::NoEvent);
+    EXPECT_EQ(mTestObserver2->pop(), EventTracker::NoEvent);
+    EXPECT_EQ(mTestObserver3->pop(), EventTracker::NoEvent);
+
+    // Add secure & non-secure video codecs, plus audio codecs (that's ignored).
+    resources = {MediaResource::CodecResource(1 /*secure*/, 1 /*video*/),
+                 MediaResource::CodecResource(0 /*secure*/, 1 /*video*/),
+                 MediaResource::CodecResource(1 /*secure*/, 0 /*video*/),
+                 MediaResource::CodecResource(0 /*secure*/, 0 /*video*/)};
+    mService->addResource(kTestPid2, kTestUid2, getId(mTestClient3), mTestClient3, resources);
+    EXPECT_EQ(mTestObserver1->pop(), EventTracker::Busy(kTestUid2, kTestPid2, observables1));
+    EXPECT_EQ(mTestObserver2->pop(), EventTracker::Busy(kTestUid2, kTestPid2, observables2));
+    EXPECT_EQ(mTestObserver3->pop(), EventTracker::Busy(kTestUid2, kTestPid2, observables3));
+    // Remove one audio codec, should have no event.
+    resources = {MediaResource::CodecResource(1 /*secure*/, 0 /*video*/)};
+    mService->removeResource(kTestPid2, getId(mTestClient3), resources);
+    EXPECT_EQ(mTestObserver1->pop(), EventTracker::NoEvent);
+    EXPECT_EQ(mTestObserver2->pop(), EventTracker::NoEvent);
+    EXPECT_EQ(mTestObserver3->pop(), EventTracker::NoEvent);
+    // Remove the other audio codec and the secure video codec, only secure video codec
+    // removal should be reported.
+    resources = {MediaResource::CodecResource(0 /*secure*/, 0 /*video*/),
+                 MediaResource::CodecResource(1 /*secure*/, 1 /*video*/)};
+    mService->removeResource(kTestPid2, getId(mTestClient3), resources);
+    EXPECT_EQ(mTestObserver1->pop(), EventTracker::Idle(kTestUid2, kTestPid2, observables1));
+    EXPECT_EQ(mTestObserver2->pop(), EventTracker::NoEvent);
+    EXPECT_EQ(mTestObserver3->pop(), EventTracker::Idle(kTestUid2, kTestPid2, observables1));
+    // Remove client3 entirely. Non-secure video codec removal should be reported.
+    mService->removeClient(kTestPid2, getId(mTestClient3));
+    EXPECT_EQ(mTestObserver1->pop(), EventTracker::NoEvent);
+    EXPECT_EQ(mTestObserver2->pop(), EventTracker::Idle(kTestUid2, kTestPid2, observables2));
+    EXPECT_EQ(mTestObserver3->pop(), EventTracker::Idle(kTestUid2, kTestPid2, observables2));
+}
+
+TEST_F(ResourceObserverServiceTest, testRemoveResourceMultiple) {
+    registerObservers();
+
+    std::vector<MediaObservableParcel> observables1, observables2, observables3;
+    observables1 = {{MediaObservableType::kVideoSecureCodec, 1}};
+    observables2 = {{MediaObservableType::kVideoNonSecureCodec, 1}};
+    observables3 = {{MediaObservableType::kVideoSecureCodec, 1},
+                    {MediaObservableType::kVideoNonSecureCodec, 1}};
+
+    std::vector<MediaResourceParcel> resources;
+
+    // Add multiple secure & non-secure video codecs, plus audio codecs (that's ignored).
+    // (ResourceManager will merge these internally.)
+    resources = {MediaResource::CodecResource(1 /*secure*/, 1 /*video*/),
+                 MediaResource::CodecResource(0 /*secure*/, 1 /*video*/, 4 /*count*/),
+                 MediaResource::CodecResource(1 /*secure*/, 0 /*video*/),
+                 MediaResource::CodecResource(0 /*secure*/, 0 /*video*/)};
+    mService->addResource(kTestPid2, kTestUid2, getId(mTestClient3), mTestClient3, resources);
+    observables1 = {{MediaObservableType::kVideoSecureCodec, 1}};
+    observables2 = {{MediaObservableType::kVideoNonSecureCodec, 4}};
+    observables3 = {{MediaObservableType::kVideoSecureCodec, 1},
+                    {MediaObservableType::kVideoNonSecureCodec, 4}};
+    EXPECT_EQ(mTestObserver1->pop(), EventTracker::Busy(kTestUid2, kTestPid2, observables1));
+    EXPECT_EQ(mTestObserver2->pop(), EventTracker::Busy(kTestUid2, kTestPid2, observables2));
+    EXPECT_EQ(mTestObserver3->pop(), EventTracker::Busy(kTestUid2, kTestPid2, observables3));
+    // Remove one audio codec, 2 secure video codecs and 2 non-secure video codecs.
+    // 1 secure video codec removal and 2 non-secure video codec removals should be reported.
+    resources = {MediaResource::CodecResource(0 /*secure*/, 0 /*video*/),
+                 MediaResource::CodecResource(1 /*secure*/, 1 /*video*/),
+                 MediaResource::CodecResource(1 /*secure*/, 1 /*video*/),
+                 MediaResource::CodecResource(0 /*secure*/, 1 /*video*/, 2 /*count*/)};
+    mService->removeResource(kTestPid2, getId(mTestClient3), resources);
+    observables1 = {{MediaObservableType::kVideoSecureCodec, 1}};
+    observables2 = {{MediaObservableType::kVideoNonSecureCodec, 2}};
+    observables3 = {{MediaObservableType::kVideoSecureCodec, 1},
+                    {MediaObservableType::kVideoNonSecureCodec, 2}};
+    EXPECT_EQ(mTestObserver1->pop(), EventTracker::Idle(kTestUid2, kTestPid2, observables1));
+    EXPECT_EQ(mTestObserver2->pop(), EventTracker::Idle(kTestUid2, kTestPid2, observables2));
+    EXPECT_EQ(mTestObserver3->pop(), EventTracker::Idle(kTestUid2, kTestPid2, observables3));
+    // Remove client3 entirely. 2 non-secure video codecs removal should be reported.
+    mService->removeClient(kTestPid2, getId(mTestClient3));
+    EXPECT_EQ(mTestObserver1->pop(), EventTracker::NoEvent);
+    EXPECT_EQ(mTestObserver2->pop(), EventTracker::Idle(kTestUid2, kTestPid2, observables2));
+    EXPECT_EQ(mTestObserver3->pop(), EventTracker::Idle(kTestUid2, kTestPid2, observables2));
+}
+
+TEST_F(ResourceObserverServiceTest, testEventFilters) {
+    // Register observers with different event filters.
+    std::vector<MediaObservableFilter> filters1, filters2, filters3;
+    filters1 = {{MediaObservableType::kVideoSecureCodec, BUSY}};
+    filters2 = {{MediaObservableType::kVideoNonSecureCodec, IDLE}};
+    filters3 = {{MediaObservableType::kVideoSecureCodec, IDLE},
+               {MediaObservableType::kVideoNonSecureCodec, BUSY}};
+
+    // mTestObserver1 monitors secure video codecs.
+    EXPECT_TRUE(mObserverService->registerObserver(mTestObserver1, filters1).isOk());
+
+    // mTestObserver2 monitors non-secure video codecs.
+    EXPECT_TRUE(mObserverService->registerObserver(mTestObserver2, filters2).isOk());
+
+    // mTestObserver3 monitors both secure & non-secure video codecs.
+    EXPECT_TRUE(mObserverService->registerObserver(mTestObserver3, filters3).isOk());
+
+    std::vector<MediaObservableParcel> observables1, observables2;
+    observables1 = {{MediaObservableType::kVideoSecureCodec, 1}};
+    observables2 = {{MediaObservableType::kVideoNonSecureCodec, 1}};
+
+    std::vector<MediaResourceParcel> resources;
+
+    // Add secure & non-secure video codecs.
+    resources = {MediaResource::CodecResource(1 /*secure*/, 1 /*video*/),
+                 MediaResource::CodecResource(0 /*secure*/, 1 /*video*/)};
+    mService->addResource(kTestPid2, kTestUid2, getId(mTestClient3), mTestClient3, resources);
+    EXPECT_EQ(mTestObserver1->pop(), EventTracker::Busy(kTestUid2, kTestPid2, observables1));
+    EXPECT_EQ(mTestObserver2->pop(), EventTracker::NoEvent);
+    EXPECT_EQ(mTestObserver3->pop(), EventTracker::Busy(kTestUid2, kTestPid2, observables2));
+
+    // Remove secure & non-secure video codecs.
+    mService->removeResource(kTestPid2, getId(mTestClient3), resources);
+    EXPECT_EQ(mTestObserver1->pop(), EventTracker::NoEvent);
+    EXPECT_EQ(mTestObserver2->pop(), EventTracker::Idle(kTestUid2, kTestPid2, observables2));
+    EXPECT_EQ(mTestObserver3->pop(), EventTracker::Idle(kTestUid2, kTestPid2, observables1));
+}
+
+} // namespace android
diff --git a/services/mediaresourcemanager/test/build_and_run_all_unit_tests.sh b/services/mediaresourcemanager/test/build_and_run_all_unit_tests.sh
new file mode 100755
index 0000000..1c4ae98
--- /dev/null
+++ b/services/mediaresourcemanager/test/build_and_run_all_unit_tests.sh
@@ -0,0 +1,34 @@
+#!/bin/bash
+#
+# Run tests in this directory.
+#
+
+if [ "$SYNC_FINISHED" != true ]; then
+  if [ -z "$ANDROID_BUILD_TOP" ]; then
+      echo "Android build environment not set"
+      exit -1
+  fi
+
+  # ensure we have mm
+  . $ANDROID_BUILD_TOP/build/envsetup.sh
+
+  mm
+
+  echo "waiting for device"
+
+  adb root && adb wait-for-device remount && adb sync
+fi
+
+echo "========================================"
+
+echo "testing ResourceManagerService"
+#adb shell /data/nativetest64/ResourceManagerService_test/ResourceManagerService_test
+adb shell /data/nativetest/ResourceManagerService_test/ResourceManagerService_test
+
+echo "testing ServiceLog"
+#adb shell /data/nativetest64/ServiceLog_test/ServiceLog_test
+adb shell /data/nativetest/ServiceLog_test/ServiceLog_test
+
+echo "testing ResourceObserverService"
+#adb shell /data/nativetest64/ResourceObserverService_test/ResourceObserverService_test
+adb shell /data/nativetest/ResourceObserverService_test/ResourceObserverService_test
diff --git a/services/mediatranscoding/MediaTranscodingService.cpp b/services/mediatranscoding/MediaTranscodingService.cpp
index ef7d6d2..eb3a873 100644
--- a/services/mediatranscoding/MediaTranscodingService.cpp
+++ b/services/mediatranscoding/MediaTranscodingService.cpp
@@ -25,8 +25,8 @@
 #include <media/TranscoderWrapper.h>
 #include <media/TranscodingClientManager.h>
 #include <media/TranscodingJobScheduler.h>
+#include <media/TranscodingResourcePolicy.h>
 #include <media/TranscodingUidPolicy.h>
-#include <private/android_filesystem_config.h>
 #include <utils/Log.h>
 #include <utils/Vector.h>
 
@@ -40,28 +40,16 @@
             errorCode,                                \
             String8::format("%s:%d: " errorString, __FUNCTION__, __LINE__, ##__VA_ARGS__))
 
-// Can MediaTranscoding service trust the caller based on the calling UID?
-// TODO(hkuang): Add MediaProvider's UID.
-static bool isTrustedCallingUid(uid_t uid) {
-    switch (uid) {
-    case AID_ROOT:  // root user
-    case AID_SYSTEM:
-    case AID_SHELL:
-    case AID_MEDIA:  // mediaserver
-        return true;
-    default:
-        return false;
-    }
-}
-
 MediaTranscodingService::MediaTranscodingService(
         const std::shared_ptr<TranscoderInterface>& transcoder)
       : mUidPolicy(new TranscodingUidPolicy()),
-        mJobScheduler(new TranscodingJobScheduler(transcoder, mUidPolicy)),
+        mResourcePolicy(new TranscodingResourcePolicy()),
+        mJobScheduler(new TranscodingJobScheduler(transcoder, mUidPolicy, mResourcePolicy)),
         mClientManager(new TranscodingClientManager(mJobScheduler)) {
     ALOGV("MediaTranscodingService is created");
     transcoder->setCallback(mJobScheduler);
     mUidPolicy->setCallback(mJobScheduler);
+    mResourcePolicy->setCallback(mJobScheduler);
 }
 
 MediaTranscodingService::~MediaTranscodingService() {
@@ -113,51 +101,18 @@
 
 Status MediaTranscodingService::registerClient(
         const std::shared_ptr<ITranscodingClientCallback>& in_callback,
-        const std::string& in_clientName, const std::string& in_opPackageName, int32_t in_clientUid,
-        int32_t in_clientPid, std::shared_ptr<ITranscodingClient>* _aidl_return) {
+        const std::string& in_clientName, const std::string& in_opPackageName,
+        std::shared_ptr<ITranscodingClient>* _aidl_return) {
     if (in_callback == nullptr) {
         *_aidl_return = nullptr;
         return STATUS_ERROR_FMT(ERROR_ILLEGAL_ARGUMENT, "Client callback cannot be null!");
     }
 
-    int32_t callingPid = AIBinder_getCallingPid();
-    int32_t callingUid = AIBinder_getCallingUid();
-
-    // Check if we can trust clientUid. Only privilege caller could forward the
-    // uid on app client's behalf.
-    if (in_clientUid == USE_CALLING_UID) {
-        in_clientUid = callingUid;
-    } else if (!isTrustedCallingUid(callingUid)) {
-        ALOGE("MediaTranscodingService::registerClient failed (calling PID %d, calling UID %d) "
-              "rejected "
-              "(don't trust clientUid %d)",
-              in_clientPid, in_clientUid, in_clientUid);
-        return STATUS_ERROR_FMT(ERROR_PERMISSION_DENIED,
-                                "Untrusted caller (calling PID %d, UID %d) trying to "
-                                "register client",
-                                in_clientPid, in_clientUid);
-    }
-
-    // Check if we can trust clientPid. Only privilege caller could forward the
-    // pid on app client's behalf.
-    if (in_clientPid == USE_CALLING_PID) {
-        in_clientPid = callingPid;
-    } else if (!isTrustedCallingUid(callingUid)) {
-        ALOGE("MediaTranscodingService::registerClient client failed (calling PID %d, calling UID "
-              "%d) rejected "
-              "(don't trust clientPid %d)",
-              in_clientPid, in_clientUid, in_clientPid);
-        return STATUS_ERROR_FMT(ERROR_PERMISSION_DENIED,
-                                "Untrusted caller (calling PID %d, UID %d) trying to "
-                                "register client",
-                                in_clientPid, in_clientUid);
-    }
-
     // Creates the client and uses its process id as client id.
     std::shared_ptr<ITranscodingClient> newClient;
 
-    status_t err = mClientManager->addClient(in_callback, in_clientPid, in_clientUid, in_clientName,
-                                             in_opPackageName, &newClient);
+    status_t err =
+            mClientManager->addClient(in_callback, in_clientName, in_opPackageName, &newClient);
     if (err != OK) {
         *_aidl_return = nullptr;
         return STATUS_ERROR_FMT(err, "Failed to add client to TranscodingClientManager");
diff --git a/services/mediatranscoding/MediaTranscodingService.h b/services/mediatranscoding/MediaTranscodingService.h
index 505239c..0fe6864 100644
--- a/services/mediatranscoding/MediaTranscodingService.h
+++ b/services/mediatranscoding/MediaTranscodingService.h
@@ -32,6 +32,7 @@
 class TranscodingJobScheduler;
 class TranscoderInterface;
 class UidPolicyInterface;
+class ResourcePolicyInterface;
 
 class MediaTranscodingService : public BnMediaTranscodingService {
 public:
@@ -47,7 +48,6 @@
 
     Status registerClient(const std::shared_ptr<ITranscodingClientCallback>& in_callback,
                           const std::string& in_clientName, const std::string& in_opPackageName,
-                          int32_t in_clientUid, int32_t in_clientPid,
                           std::shared_ptr<ITranscodingClient>* _aidl_return) override;
 
     Status getNumOfClients(int32_t* _aidl_return) override;
@@ -60,6 +60,7 @@
     mutable std::mutex mServiceLock;
 
     std::shared_ptr<UidPolicyInterface> mUidPolicy;
+    std::shared_ptr<ResourcePolicyInterface> mResourcePolicy;
     std::shared_ptr<TranscodingJobScheduler> mJobScheduler;
     std::shared_ptr<TranscodingClientManager> mClientManager;
 };
diff --git a/services/mediatranscoding/tests/Android.bp b/services/mediatranscoding/tests/Android.bp
index 364a198..6497685 100644
--- a/services/mediatranscoding/tests/Android.bp
+++ b/services/mediatranscoding/tests/Android.bp
@@ -25,14 +25,6 @@
     static_libs: [
         "mediatranscoding_aidl_interface-ndk_platform",
     ],
-}
-
-// MediaTranscodingService unit test using simulated transcoder
-cc_test {
-    name: "mediatranscodingservice_simulated_tests",
-    defaults: ["mediatranscodingservice_test_defaults"],
-
-    srcs: ["mediatranscodingservice_simulated_tests.cpp"],
 
     required: [
         "TranscodingUidPolicy_TestAppA",
@@ -41,6 +33,14 @@
     ],
 }
 
+// MediaTranscodingService unit test using simulated transcoder
+cc_test {
+    name: "mediatranscodingservice_simulated_tests",
+    defaults: ["mediatranscodingservice_test_defaults"],
+
+    srcs: ["mediatranscodingservice_simulated_tests.cpp"],
+}
+
 // MediaTranscodingService unit test using real transcoder
 cc_test {
     name: "mediatranscodingservice_real_tests",
@@ -48,3 +48,11 @@
 
     srcs: ["mediatranscodingservice_real_tests.cpp"],
 }
+
+// MediaTranscodingService unit test related to resource management
+cc_test {
+    name: "mediatranscodingservice_resource_tests",
+    defaults: ["mediatranscodingservice_test_defaults"],
+
+    srcs: ["mediatranscodingservice_resource_tests.cpp"],
+}
diff --git a/services/mediatranscoding/tests/MediaTranscodingServiceTestHelper.h b/services/mediatranscoding/tests/MediaTranscodingServiceTestHelper.h
index 53fd7ec..0af572e 100644
--- a/services/mediatranscoding/tests/MediaTranscodingServiceTestHelper.h
+++ b/services/mediatranscoding/tests/MediaTranscodingServiceTestHelper.h
@@ -58,6 +58,9 @@
 constexpr uid_t kClientUid = 5000;
 #define UID(n) (kClientUid + (n))
 
+constexpr pid_t kClientPid = 10000;
+#define PID(n) (kClientPid + (n))
+
 constexpr int32_t kClientId = 0;
 #define CLIENT(n) (kClientId + (n))
 
@@ -168,6 +171,32 @@
         return mPoppedEvent;
     }
 
+    bool waitForSpecificEventAndPop(const Event& target, std::list<Event>* outEvents,
+                                    int64_t timeoutUs = 0) {
+        std::unique_lock lock(mLock);
+
+        auto startTime = std::chrono::system_clock::now();
+
+        std::list<Event>::iterator it;
+        while (((it = std::find(mEventQueue.begin(), mEventQueue.end(), target)) ==
+                mEventQueue.end()) &&
+               timeoutUs > 0) {
+            std::cv_status status = mCondition.wait_for(lock, std::chrono::microseconds(timeoutUs));
+            if (status == std::cv_status::timeout) {
+                break;
+            }
+            std::chrono::microseconds elapsedTime = std::chrono::system_clock::now() - startTime;
+            timeoutUs -= elapsedTime.count();
+        }
+
+        if (it == mEventQueue.end()) {
+            return false;
+        }
+        *outEvents = std::list<Event>(mEventQueue.begin(), std::next(it));
+        mEventQueue.erase(mEventQueue.begin(), std::next(it));
+        return true;
+    }
+
     // Push 1 event to back.
     void append(const Event& event,
                 const TranscodingErrorCode err = TranscodingErrorCode::kNoError) {
@@ -186,7 +215,7 @@
         mUpdateCount++;
     }
 
-    int getUpdateCount(int *lastProgress) {
+    int getUpdateCount(int* lastProgress) {
         std::unique_lock lock(mLock);
         *lastProgress = mLastProgress;
         return mUpdateCount;
@@ -217,9 +246,21 @@
     return str;
 }
 
-struct TestClientCallback : public BnTranscodingClientCallback, public EventTracker {
-    TestClientCallback(int32_t id) : mClientId(id) {
-        ALOGI("TestClientCallback %d Created", mClientId);
+static constexpr bool success = true;
+static constexpr bool fail = false;
+
+struct TestClientCallback : public BnTranscodingClientCallback,
+                            public EventTracker,
+                            public std::enable_shared_from_this<TestClientCallback> {
+    TestClientCallback(const char* packageName, int32_t id)
+          : mClientId(id), mClientPid(PID(id)), mClientUid(UID(id)), mPackageName(packageName) {
+        ALOGI("TestClientCallback %d created: pid %d, uid %d", id, PID(id), UID(id));
+
+        // Use package uid if that's available.
+        uid_t packageUid;
+        if (getUidForPackage(String16(packageName), 0 /*userId*/, packageUid) == NO_ERROR) {
+            mClientUid = packageUid;
+        }
     }
 
     virtual ~TestClientCallback() { ALOGI("TestClientCallback %d destroyed", mClientId); }
@@ -285,7 +326,99 @@
         return Status::ok();
     }
 
+    Status registerClient(const char* packageName,
+                          const std::shared_ptr<IMediaTranscodingService>& service) {
+        // Override the default uid if the package uid is found.
+        uid_t uid;
+        if (getUidForPackage(String16(packageName), 0 /*userId*/, uid) == NO_ERROR) {
+            mClientUid = uid;
+        }
+
+        ALOGD("registering %s with uid %d", packageName, mClientUid);
+
+        std::shared_ptr<ITranscodingClient> client;
+        Status status =
+                service->registerClient(shared_from_this(), kClientName, packageName, &client);
+
+        mClient = status.isOk() ? client : nullptr;
+        return status;
+    }
+
+    Status unregisterClient() {
+        Status status;
+        if (mClient != nullptr) {
+            status = mClient->unregister();
+            mClient = nullptr;
+        }
+        return status;
+    }
+
+    template <bool expectation = success>
+    bool submit(int32_t jobId, const char* sourceFilePath, const char* destinationFilePath,
+                TranscodingJobPriority priority = TranscodingJobPriority::kNormal,
+                int bitrateBps = -1, int overridePid = -1, int overrideUid = -1) {
+        constexpr bool shouldSucceed = (expectation == success);
+        bool result;
+        TranscodingRequestParcel request;
+        TranscodingJobParcel job;
+
+        request.sourceFilePath = sourceFilePath;
+        request.destinationFilePath = destinationFilePath;
+        request.priority = priority;
+        request.clientPid = (overridePid == -1) ? mClientPid : overridePid;
+        request.clientUid = (overrideUid == -1) ? mClientUid : overrideUid;
+        if (bitrateBps > 0) {
+            request.requestedVideoTrackFormat.emplace(TranscodingVideoTrackFormat());
+            request.requestedVideoTrackFormat->bitrateBps = bitrateBps;
+        }
+        Status status = mClient->submitRequest(request, &job, &result);
+
+        EXPECT_TRUE(status.isOk());
+        EXPECT_EQ(result, shouldSucceed);
+        if (shouldSucceed) {
+            EXPECT_EQ(job.jobId, jobId);
+        }
+
+        return status.isOk() && (result == shouldSucceed) && (!shouldSucceed || job.jobId == jobId);
+    }
+
+    template <bool expectation = success>
+    bool cancel(int32_t jobId) {
+        constexpr bool shouldSucceed = (expectation == success);
+        bool result;
+        Status status = mClient->cancelJob(jobId, &result);
+
+        EXPECT_TRUE(status.isOk());
+        EXPECT_EQ(result, shouldSucceed);
+
+        return status.isOk() && (result == shouldSucceed);
+    }
+
+    template <bool expectation = success>
+    bool getJob(int32_t jobId, const char* sourceFilePath, const char* destinationFilePath) {
+        constexpr bool shouldSucceed = (expectation == success);
+        bool result;
+        TranscodingJobParcel job;
+        Status status = mClient->getJobWithId(jobId, &job, &result);
+
+        EXPECT_TRUE(status.isOk());
+        EXPECT_EQ(result, shouldSucceed);
+        if (shouldSucceed) {
+            EXPECT_EQ(job.jobId, jobId);
+            EXPECT_EQ(job.request.sourceFilePath, sourceFilePath);
+        }
+
+        return status.isOk() && (result == shouldSucceed) &&
+               (!shouldSucceed ||
+                (job.jobId == jobId && job.request.sourceFilePath == sourceFilePath &&
+                 job.request.destinationFilePath == destinationFilePath));
+    }
+
     int32_t mClientId;
+    pid_t mClientPid;
+    uid_t mClientUid;
+    std::string mPackageName;
+    std::shared_ptr<ITranscodingClient> mClient;
 };
 
 class MediaTranscodingServiceTestBase : public ::testing::Test {
@@ -306,37 +439,31 @@
             ALOGE("Failed to connect to the media.trascoding service.");
             return;
         }
-        mClientCallback1 = ::ndk::SharedRefBase::make<TestClientCallback>(CLIENT(1));
-        mClientCallback2 = ::ndk::SharedRefBase::make<TestClientCallback>(CLIENT(2));
-        mClientCallback3 = ::ndk::SharedRefBase::make<TestClientCallback>(CLIENT(3));
+        mClient1 = ::ndk::SharedRefBase::make<TestClientCallback>(kClientPackageA, 1);
+        mClient2 = ::ndk::SharedRefBase::make<TestClientCallback>(kClientPackageB, 2);
+        mClient3 = ::ndk::SharedRefBase::make<TestClientCallback>(kClientPackageC, 3);
     }
 
-    std::shared_ptr<ITranscodingClient> registerOneClient(
-            const char* packageName, const std::shared_ptr<TestClientCallback>& callback,
-            uid_t defaultUid) {
-        uid_t uid;
-        if (getUidForPackage(String16(packageName), 0 /*userId*/, uid) != NO_ERROR) {
-            uid = defaultUid;
-        }
-
-        ALOGD("registering %s with uid %d", packageName, uid);
+    Status registerOneClient(const std::shared_ptr<TestClientCallback>& callback) {
+        ALOGD("registering %s with uid %d", callback->mPackageName.c_str(), callback->mClientUid);
 
         std::shared_ptr<ITranscodingClient> client;
-        Status status = mService->registerClient(callback, kClientName, packageName, uid,
-                                                 kClientUseCallingPid, &client);
-        return status.isOk() ? client : nullptr;
+        Status status =
+                mService->registerClient(callback, kClientName, callback->mPackageName, &client);
+
+        if (status.isOk()) {
+            callback->mClient = client;
+        } else {
+            callback->mClient = nullptr;
+        }
+        return status;
     }
 
     void registerMultipleClients() {
         // Register 3 clients.
-        mClient1 = registerOneClient(kClientPackageA, mClientCallback1, UID(1));
-        EXPECT_TRUE(mClient1 != nullptr);
-
-        mClient2 = registerOneClient(kClientPackageB, mClientCallback2, UID(2));
-        EXPECT_TRUE(mClient2 != nullptr);
-
-        mClient3 = registerOneClient(kClientPackageC, mClientCallback3, UID(3));
-        EXPECT_TRUE(mClient3 != nullptr);
+        EXPECT_TRUE(registerOneClient(mClient1).isOk());
+        EXPECT_TRUE(registerOneClient(mClient2).isOk());
+        EXPECT_TRUE(registerOneClient(mClient3).isOk());
 
         // Check the number of clients.
         int32_t numOfClients;
@@ -346,99 +473,24 @@
     }
 
     void unregisterMultipleClients() {
-        Status status;
-
         // Unregister the clients.
-        status = mClient1->unregister();
-        EXPECT_TRUE(status.isOk());
-
-        status = mClient2->unregister();
-        EXPECT_TRUE(status.isOk());
-
-        status = mClient3->unregister();
-        EXPECT_TRUE(status.isOk());
+        EXPECT_TRUE(mClient1->unregisterClient().isOk());
+        EXPECT_TRUE(mClient2->unregisterClient().isOk());
+        EXPECT_TRUE(mClient3->unregisterClient().isOk());
 
         // Check the number of clients.
         int32_t numOfClients;
-        status = mService->getNumOfClients(&numOfClients);
+        Status status = mService->getNumOfClients(&numOfClients);
         EXPECT_TRUE(status.isOk());
         EXPECT_EQ(0, numOfClients);
     }
 
-    static constexpr bool success = true;
-    static constexpr bool fail = false;
-
-    template <bool expectation = success>
-    bool submit(const std::shared_ptr<ITranscodingClient>& client, int32_t jobId,
-                const char* sourceFilePath, const char* destinationFilePath,
-                TranscodingJobPriority priority = TranscodingJobPriority::kNormal,
-                int bitrateBps = -1) {
-        constexpr bool shouldSucceed = (expectation == success);
-        bool result;
-        TranscodingRequestParcel request;
-        TranscodingJobParcel job;
-
-        request.sourceFilePath = sourceFilePath;
-        request.destinationFilePath = destinationFilePath;
-        request.priority = priority;
-        if (bitrateBps > 0) {
-            request.requestedVideoTrackFormat.emplace(TranscodingVideoTrackFormat());
-            request.requestedVideoTrackFormat->bitrateBps = bitrateBps;
-        }
-        Status status = client->submitRequest(request, &job, &result);
-
-        EXPECT_TRUE(status.isOk());
-        EXPECT_EQ(result, shouldSucceed);
-        if (shouldSucceed) {
-            EXPECT_EQ(job.jobId, jobId);
-        }
-
-        return status.isOk() && (result == shouldSucceed) && (!shouldSucceed || job.jobId == jobId);
-    }
-
-    template <bool expectation = success>
-    bool cancel(const std::shared_ptr<ITranscodingClient>& client, int32_t jobId) {
-        constexpr bool shouldSucceed = (expectation == success);
-        bool result;
-        Status status = client->cancelJob(jobId, &result);
-
-        EXPECT_TRUE(status.isOk());
-        EXPECT_EQ(result, shouldSucceed);
-
-        return status.isOk() && (result == shouldSucceed);
-    }
-
-    template <bool expectation = success>
-    bool getJob(const std::shared_ptr<ITranscodingClient>& client, int32_t jobId,
-                const char* sourceFilePath, const char* destinationFilePath) {
-        constexpr bool shouldSucceed = (expectation == success);
-        bool result;
-        TranscodingJobParcel job;
-        Status status = client->getJobWithId(jobId, &job, &result);
-
-        EXPECT_TRUE(status.isOk());
-        EXPECT_EQ(result, shouldSucceed);
-        if (shouldSucceed) {
-            EXPECT_EQ(job.jobId, jobId);
-            EXPECT_EQ(job.request.sourceFilePath, sourceFilePath);
-        }
-
-        return status.isOk() && (result == shouldSucceed) &&
-               (!shouldSucceed ||
-                (job.jobId == jobId && job.request.sourceFilePath == sourceFilePath &&
-                 job.request.destinationFilePath == destinationFilePath));
-    }
-
     void deleteFile(const char* path) { unlink(path); }
 
     std::shared_ptr<IMediaTranscodingService> mService;
-    std::shared_ptr<TestClientCallback> mClientCallback1;
-    std::shared_ptr<TestClientCallback> mClientCallback2;
-    std::shared_ptr<TestClientCallback> mClientCallback3;
-    std::shared_ptr<ITranscodingClient> mClient1;
-    std::shared_ptr<ITranscodingClient> mClient2;
-    std::shared_ptr<ITranscodingClient> mClient3;
-    const char* mTestName;
+    std::shared_ptr<TestClientCallback> mClient1;
+    std::shared_ptr<TestClientCallback> mClient2;
+    std::shared_ptr<TestClientCallback> mClient3;
 };
 
 }  // namespace media
diff --git a/services/mediatranscoding/tests/TranscodingUidPolicyTestApp/TestAppA.xml b/services/mediatranscoding/tests/TranscodingUidPolicyTestApp/TestAppA.xml
index 91c14a5..0dff171 100644
--- a/services/mediatranscoding/tests/TranscodingUidPolicyTestApp/TestAppA.xml
+++ b/services/mediatranscoding/tests/TranscodingUidPolicyTestApp/TestAppA.xml
@@ -28,6 +28,14 @@
                 <category android:name="android.intent.category.LAUNCHER" />
             </intent-filter>
         </activity>
+        <activity android:name="com.android.tests.transcoding.ResourcePolicyTestActivity"
+            android:exported="true">
+            <intent-filter>
+                <action android:name="android.intent.action.MAIN" />
+                <category android:name="android.intent.category.DEFAULT"/>
+                <category android:name="android.intent.category.LAUNCHER" />
+            </intent-filter>
+        </activity>
     </application>
 </manifest>
 
diff --git a/services/mediatranscoding/tests/TranscodingUidPolicyTestApp/src/com/android/tests/transcoding/MainActivity.java b/services/mediatranscoding/tests/TranscodingUidPolicyTestApp/src/com/android/tests/transcoding/MainActivity.java
index 7295073..b79164d 100644
--- a/services/mediatranscoding/tests/TranscodingUidPolicyTestApp/src/com/android/tests/transcoding/MainActivity.java
+++ b/services/mediatranscoding/tests/TranscodingUidPolicyTestApp/src/com/android/tests/transcoding/MainActivity.java
@@ -46,7 +46,7 @@
     // Called before subsequent visible lifetimes
     // for an activity process.
     @Override
-    public void onRestart(){
+    public void onRestart() {
         super.onRestart();
         // Load changes knowing that the Activity has already
         // been visible within this process.
@@ -54,14 +54,14 @@
 
     // Called at the start of the visible lifetime.
     @Override
-    public void onStart(){
+    public void onStart() {
         super.onStart();
         // Apply any required UI change now that the Activity is visible.
     }
 
     // Called at the start of the active lifetime.
     @Override
-    public void onResume(){
+    public void onResume() {
         super.onResume();
         // Resume any paused UI updates, threads, or processes required
         // by the Activity but suspended when it was inactive.
@@ -80,7 +80,7 @@
 
     // Called at the end of the active lifetime.
     @Override
-    public void onPause(){
+    public void onPause() {
         // Suspend UI updates, threads, or CPU intensive processes
         // that don't need to be updated when the Activity isn't
         // the active foreground Activity.
@@ -89,7 +89,7 @@
 
     // Called at the end of the visible lifetime.
     @Override
-    public void onStop(){
+    public void onStop() {
         // Suspend remaining UI updates, threads, or processing
         // that aren't required when the Activity isn't visible.
         // Persist all edits or state changes
@@ -99,10 +99,9 @@
 
     // Sometimes called at the end of the full lifetime.
     @Override
-    public void onDestroy(){
+    public void onDestroy() {
         // Clean up any resources including ending threads,
         // closing database connections etc.
         super.onDestroy();
     }
-
 }
diff --git a/services/mediatranscoding/tests/TranscodingUidPolicyTestApp/src/com/android/tests/transcoding/ResourcePolicyTestActivity.java b/services/mediatranscoding/tests/TranscodingUidPolicyTestApp/src/com/android/tests/transcoding/ResourcePolicyTestActivity.java
new file mode 100644
index 0000000..c9e2ddb
--- /dev/null
+++ b/services/mediatranscoding/tests/TranscodingUidPolicyTestApp/src/com/android/tests/transcoding/ResourcePolicyTestActivity.java
@@ -0,0 +1,272 @@
+/*
+ * Copyright 2020 The Android Open Source Project
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ *      http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+package com.android.tests.transcoding;
+
+import android.app.Activity;
+import android.media.MediaCodec;
+import android.media.MediaCodecInfo;
+import android.media.MediaCodecInfo.CodecCapabilities;
+import android.media.MediaCodecInfo.VideoCapabilities;
+import android.media.MediaCodecList;
+import android.media.MediaFormat;
+import android.os.Bundle;
+import android.util.Log;
+import java.io.IOException;
+import java.util.Vector;
+
+public class ResourcePolicyTestActivity extends Activity {
+    public static final int TYPE_NONSECURE = 0;
+    public static final int TYPE_SECURE = 1;
+    public static final int TYPE_MIX = 2;
+
+    protected String TAG;
+    private static final int FRAME_RATE = 10;
+    private static final int IFRAME_INTERVAL = 10; // 10 seconds between I-frames
+    private static final String MIME = MediaFormat.MIMETYPE_VIDEO_AVC;
+    private static final int TIMEOUT_MS = 5000;
+
+    private Vector<MediaCodec> mCodecs = new Vector<MediaCodec>();
+
+    private class TestCodecCallback extends MediaCodec.Callback {
+        @Override
+        public void onInputBufferAvailable(MediaCodec codec, int index) {
+            Log.d(TAG, "onInputBufferAvailable " + codec.toString());
+        }
+
+        @Override
+        public void onOutputBufferAvailable(
+                MediaCodec codec, int index, MediaCodec.BufferInfo info) {
+            Log.d(TAG, "onOutputBufferAvailable " + codec.toString());
+        }
+
+        @Override
+        public void onError(MediaCodec codec, MediaCodec.CodecException e) {
+            Log.d(TAG, "onError " + codec.toString() + " errorCode " + e.getErrorCode());
+        }
+
+        @Override
+        public void onOutputFormatChanged(MediaCodec codec, MediaFormat format) {
+            Log.d(TAG, "onOutputFormatChanged " + codec.toString());
+        }
+    }
+
+    private MediaCodec.Callback mCallback = new TestCodecCallback();
+
+    private MediaFormat getTestFormat(CodecCapabilities caps, boolean securePlayback) {
+        VideoCapabilities vcaps = caps.getVideoCapabilities();
+        int width = vcaps.getSupportedWidths().getLower();
+        int height = vcaps.getSupportedHeightsFor(width).getLower();
+        int bitrate = vcaps.getBitrateRange().getLower();
+
+        MediaFormat format = MediaFormat.createVideoFormat(MIME, width, height);
+        format.setInteger(MediaFormat.KEY_COLOR_FORMAT, caps.colorFormats[0]);
+        format.setInteger(MediaFormat.KEY_BIT_RATE, bitrate);
+        format.setInteger(MediaFormat.KEY_FRAME_RATE, FRAME_RATE);
+        format.setInteger(MediaFormat.KEY_I_FRAME_INTERVAL, IFRAME_INTERVAL);
+        format.setFeatureEnabled(CodecCapabilities.FEATURE_SecurePlayback, securePlayback);
+        return format;
+    }
+
+    private MediaCodecInfo getTestCodecInfo(boolean securePlayback) {
+        // Use avc decoder for testing.
+        boolean isEncoder = false;
+
+        MediaCodecList mcl = new MediaCodecList(MediaCodecList.ALL_CODECS);
+        for (MediaCodecInfo info : mcl.getCodecInfos()) {
+            if (info.isEncoder() != isEncoder) {
+                continue;
+            }
+            CodecCapabilities caps;
+            try {
+                caps = info.getCapabilitiesForType(MIME);
+                boolean securePlaybackSupported =
+                        caps.isFeatureSupported(CodecCapabilities.FEATURE_SecurePlayback);
+                boolean securePlaybackRequired =
+                        caps.isFeatureRequired(CodecCapabilities.FEATURE_SecurePlayback);
+                if ((securePlayback && securePlaybackSupported)
+                        || (!securePlayback && !securePlaybackRequired)) {
+                    Log.d(TAG, "securePlayback " + securePlayback + " will use " + info.getName());
+                } else {
+                    Log.d(TAG, "securePlayback " + securePlayback + " skip " + info.getName());
+                    continue;
+                }
+            } catch (IllegalArgumentException e) {
+                // mime is not supported
+                continue;
+            }
+            return info;
+        }
+
+        return null;
+    }
+
+    protected int allocateCodecs(int max) {
+        Bundle extras = getIntent().getExtras();
+        int type = TYPE_NONSECURE;
+        if (extras != null) {
+            type = extras.getInt("test-type", type);
+            Log.d(TAG, "type is: " + type);
+        }
+
+        boolean shouldSkip = false;
+        boolean securePlayback;
+        if (type == TYPE_NONSECURE || type == TYPE_MIX) {
+            securePlayback = false;
+            MediaCodecInfo info = getTestCodecInfo(securePlayback);
+            if (info != null) {
+                allocateCodecs(max, info, securePlayback);
+            } else {
+                shouldSkip = true;
+            }
+        }
+
+        if (!shouldSkip) {
+            if (type == TYPE_SECURE || type == TYPE_MIX) {
+                securePlayback = true;
+                MediaCodecInfo info = getTestCodecInfo(securePlayback);
+                if (info != null) {
+                    allocateCodecs(max, info, securePlayback);
+                } else {
+                    shouldSkip = true;
+                }
+            }
+        }
+
+        if (shouldSkip) {
+            Log.d(TAG, "test skipped as there's no supported codec.");
+            finishWithResult(RESULT_OK);
+        }
+
+        Log.d(TAG, "allocateCodecs returned " + mCodecs.size());
+        return mCodecs.size();
+    }
+
+    protected void allocateCodecs(int max, MediaCodecInfo info, boolean securePlayback) {
+        String name = info.getName();
+        CodecCapabilities caps = info.getCapabilitiesForType(MIME);
+        MediaFormat format = getTestFormat(caps, securePlayback);
+        MediaCodec codec = null;
+        for (int i = mCodecs.size(); i < max; ++i) {
+            try {
+                Log.d(TAG, "Create codec " + name + " #" + i);
+                codec = MediaCodec.createByCodecName(name);
+                codec.setCallback(mCallback);
+                Log.d(TAG, "Configure codec " + format);
+                codec.configure(format, null, null, 0);
+                Log.d(TAG, "Start codec " + format);
+                codec.start();
+                mCodecs.add(codec);
+                codec = null;
+            } catch (IllegalArgumentException e) {
+                Log.d(TAG, "IllegalArgumentException " + e.getMessage());
+                break;
+            } catch (IOException e) {
+                Log.d(TAG, "IOException " + e.getMessage());
+                break;
+            } catch (MediaCodec.CodecException e) {
+                Log.d(TAG, "CodecException 0x" + Integer.toHexString(e.getErrorCode()));
+                break;
+            } finally {
+                if (codec != null) {
+                    Log.d(TAG, "release codec");
+                    codec.release();
+                    codec = null;
+                }
+            }
+        }
+    }
+
+    protected void finishWithResult(int result) {
+        for (int i = 0; i < mCodecs.size(); ++i) {
+            Log.d(TAG, "release codec #" + i);
+            mCodecs.get(i).release();
+        }
+        mCodecs.clear();
+        setResult(result);
+        finish();
+        Log.d(TAG, "activity finished");
+    }
+
+    private void doUseCodecs() {
+        int current = 0;
+        try {
+            for (current = 0; current < mCodecs.size(); ++current) {
+                mCodecs.get(current).getName();
+            }
+        } catch (MediaCodec.CodecException e) {
+            Log.d(TAG, "useCodecs got CodecException 0x" + Integer.toHexString(e.getErrorCode()));
+            if (e.getErrorCode() == MediaCodec.CodecException.ERROR_RECLAIMED) {
+                Log.d(TAG, "Remove codec " + current + " from the list");
+                mCodecs.get(current).release();
+                mCodecs.remove(current);
+                mGotReclaimedException = true;
+                mUseCodecs = false;
+            }
+            return;
+        }
+    }
+
+    private Thread mWorkerThread;
+    private volatile boolean mUseCodecs = true;
+    private volatile boolean mGotReclaimedException = false;
+    protected void useCodecs() {
+        mWorkerThread = new Thread(new Runnable() {
+            @Override
+            public void run() {
+                long start = System.currentTimeMillis();
+                long timeSinceStartedMs = 0;
+                while (mUseCodecs && (timeSinceStartedMs < TIMEOUT_MS)) {
+                    doUseCodecs();
+                    try {
+                        Thread.sleep(50 /* millis */);
+                    } catch (InterruptedException e) {
+                    }
+                    timeSinceStartedMs = System.currentTimeMillis() - start;
+                }
+                if (mGotReclaimedException) {
+                    Log.d(TAG, "Got expected reclaim exception.");
+                }
+                finishWithResult(RESULT_OK);
+            }
+        });
+        mWorkerThread.start();
+    }
+
+    private static final int MAX_INSTANCES = 32;
+
+    @Override
+    protected void onCreate(Bundle savedInstanceState) {
+        TAG = "ResourcePolicyTestActivity";
+
+        Log.d(TAG, "onCreate called.");
+        super.onCreate(savedInstanceState);
+
+        if (allocateCodecs(MAX_INSTANCES) == MAX_INSTANCES) {
+            // haven't reached the limit with MAX_INSTANCES, no need to wait for reclaim exception.
+            //mWaitForReclaim = false;
+            Log.d(TAG, "Didn't hit resource limitation");
+        }
+
+        useCodecs();
+    }
+
+    @Override
+    protected void onDestroy() {
+        Log.d(TAG, "onDestroy called.");
+        super.onDestroy();
+    }
+}
diff --git a/services/mediatranscoding/tests/build_and_run_all_unit_tests.sh b/services/mediatranscoding/tests/build_and_run_all_unit_tests.sh
index d66b340..1b42a22 100755
--- a/services/mediatranscoding/tests/build_and_run_all_unit_tests.sh
+++ b/services/mediatranscoding/tests/build_and_run_all_unit_tests.sh
@@ -37,6 +37,11 @@
 #adb shell /data/nativetest64/mediatranscodingservice_real_tests/mediatranscodingservice_real_tests
 adb shell /data/nativetest/mediatranscodingservice_real_tests/mediatranscodingservice_real_tests
 
+echo "[==========] running resource tests"
+adb shell kill -9 `pid media.transcoding`
+#adb shell /data/nativetest64/mediatranscodingservice_resource_tests/mediatranscodingservice_resource_tests
+adb shell /data/nativetest/mediatranscodingservice_resource_tests/mediatranscodingservice_resource_tests
+
 echo "[==========] removing debug properties"
 adb shell setprop debug.transcoding.simulated_transcoder \"\"
 adb shell kill -9 `pid media.transcoding`
diff --git a/services/mediatranscoding/tests/mediatranscodingservice_real_tests.cpp b/services/mediatranscoding/tests/mediatranscodingservice_real_tests.cpp
index 1def4b9..381bbf5 100644
--- a/services/mediatranscoding/tests/mediatranscodingservice_real_tests.cpp
+++ b/services/mediatranscoding/tests/mediatranscodingservice_real_tests.cpp
@@ -45,9 +45,11 @@
 
 class MediaTranscodingServiceRealTest : public MediaTranscodingServiceTestBase {
 public:
-    MediaTranscodingServiceRealTest() {}
+    MediaTranscodingServiceRealTest() { ALOGI("MediaTranscodingServiceResourceTest created"); }
 
-    void deleteFile(const char* path) { unlink(path); }
+    virtual ~MediaTranscodingServiceRealTest() {
+        ALOGI("MediaTranscodingServiceResourceTest destroyed");
+    }
 };
 
 TEST_F(MediaTranscodingServiceRealTest, TestInvalidSource) {
@@ -58,11 +60,11 @@
     deleteFile(dstPath);
 
     // Submit one job.
-    EXPECT_TRUE(submit(mClient1, 0, srcPath, dstPath, TranscodingJobPriority::kNormal, kBitRate));
+    EXPECT_TRUE(mClient1->submit(0, srcPath, dstPath, TranscodingJobPriority::kNormal, kBitRate));
 
     // Check expected error.
-    EXPECT_EQ(mClientCallback1->pop(kPaddingUs), EventTracker::Failed(CLIENT(1), 0));
-    EXPECT_EQ(mClientCallback1->getLastError(), TranscodingErrorCode::kErrorIO);
+    EXPECT_EQ(mClient1->pop(kPaddingUs), EventTracker::Failed(CLIENT(1), 0));
+    EXPECT_EQ(mClient1->getLastError(), TranscodingErrorCode::kErrorIO);
 
     unregisterMultipleClients();
 }
@@ -74,11 +76,11 @@
     deleteFile(dstPath);
 
     // Submit one job.
-    EXPECT_TRUE(submit(mClient1, 0, kShortSrcPath, dstPath));
+    EXPECT_TRUE(mClient1->submit(0, kShortSrcPath, dstPath));
 
     // Wait for job to finish.
-    EXPECT_EQ(mClientCallback1->pop(kPaddingUs), EventTracker::Start(CLIENT(1), 0));
-    EXPECT_EQ(mClientCallback1->pop(kJobWithPaddingUs), EventTracker::Finished(CLIENT(1), 0));
+    EXPECT_EQ(mClient1->pop(kPaddingUs), EventTracker::Start(CLIENT(1), 0));
+    EXPECT_EQ(mClient1->pop(kJobWithPaddingUs), EventTracker::Finished(CLIENT(1), 0));
 
     unregisterMultipleClients();
 }
@@ -91,11 +93,11 @@
 
     // Submit one job.
     EXPECT_TRUE(
-            submit(mClient1, 0, kShortSrcPath, dstPath, TranscodingJobPriority::kNormal, kBitRate));
+            mClient1->submit(0, kShortSrcPath, dstPath, TranscodingJobPriority::kNormal, kBitRate));
 
     // Wait for job to finish.
-    EXPECT_EQ(mClientCallback1->pop(kPaddingUs), EventTracker::Start(CLIENT(1), 0));
-    EXPECT_EQ(mClientCallback1->pop(kJobWithPaddingUs), EventTracker::Finished(CLIENT(1), 0));
+    EXPECT_EQ(mClient1->pop(kPaddingUs), EventTracker::Start(CLIENT(1), 0));
+    EXPECT_EQ(mClient1->pop(kJobWithPaddingUs), EventTracker::Finished(CLIENT(1), 0));
 
     unregisterMultipleClients();
 }
@@ -108,16 +110,16 @@
 
     // Submit one job.
     EXPECT_TRUE(
-            submit(mClient1, 0, kLongSrcPath, dstPath, TranscodingJobPriority::kNormal, kBitRate));
+            mClient1->submit(0, kLongSrcPath, dstPath, TranscodingJobPriority::kNormal, kBitRate));
 
     // Wait for job to finish.
-    EXPECT_EQ(mClientCallback1->pop(kPaddingUs), EventTracker::Start(CLIENT(1), 0));
-    EXPECT_EQ(mClientCallback1->pop(kJobWithPaddingUs), EventTracker::Finished(CLIENT(1), 0));
+    EXPECT_EQ(mClient1->pop(kPaddingUs), EventTracker::Start(CLIENT(1), 0));
+    EXPECT_EQ(mClient1->pop(kJobWithPaddingUs), EventTracker::Finished(CLIENT(1), 0));
 
     // Check the progress update messages are received. For this clip (around ~15 second long),
     // expect at least 10 updates, and the last update should be 100.
     int lastProgress;
-    EXPECT_GE(mClientCallback1->getUpdateCount(&lastProgress), 10);
+    EXPECT_GE(mClient1->getUpdateCount(&lastProgress), 10);
     EXPECT_EQ(lastProgress, 100);
 
     unregisterMultipleClients();
@@ -137,18 +139,18 @@
     deleteFile(dstPath0);
     deleteFile(dstPath1);
     // Submit one job, should start immediately.
-    EXPECT_TRUE(submit(mClient1, 0, srcPath0, dstPath0, TranscodingJobPriority::kNormal, kBitRate));
-    EXPECT_EQ(mClientCallback1->pop(kPaddingUs), EventTracker::Start(CLIENT(1), 0));
-    EXPECT_TRUE(getJob(mClient1, 0, srcPath0, dstPath0));
+    EXPECT_TRUE(mClient1->submit(0, srcPath0, dstPath0, TranscodingJobPriority::kNormal, kBitRate));
+    EXPECT_EQ(mClient1->pop(kPaddingUs), EventTracker::Start(CLIENT(1), 0));
+    EXPECT_TRUE(mClient1->getJob(0, srcPath0, dstPath0));
 
     // Test cancel job immediately, getJob should fail after cancel.
-    EXPECT_TRUE(cancel(mClient1, 0));
-    EXPECT_TRUE(getJob<fail>(mClient1, 0, "", ""));
+    EXPECT_TRUE(mClient1->cancel(0));
+    EXPECT_TRUE(mClient1->getJob<fail>(0, "", ""));
 
     // Submit new job, new job should start immediately and finish.
-    EXPECT_TRUE(submit(mClient1, 1, srcPath1, dstPath1, TranscodingJobPriority::kNormal, kBitRate));
-    EXPECT_EQ(mClientCallback1->pop(kPaddingUs), EventTracker::Start(CLIENT(1), 1));
-    EXPECT_EQ(mClientCallback1->pop(kJobWithPaddingUs), EventTracker::Finished(CLIENT(1), 1));
+    EXPECT_TRUE(mClient1->submit(1, srcPath1, dstPath1, TranscodingJobPriority::kNormal, kBitRate));
+    EXPECT_EQ(mClient1->pop(kPaddingUs), EventTracker::Start(CLIENT(1), 1));
+    EXPECT_EQ(mClient1->pop(kJobWithPaddingUs), EventTracker::Finished(CLIENT(1), 1));
 
     unregisterMultipleClients();
 }
@@ -167,20 +169,20 @@
     deleteFile(dstPath0);
     deleteFile(dstPath1);
     // Submit two jobs, job 0 should start immediately, job 1 should be queued.
-    EXPECT_TRUE(submit(mClient1, 0, srcPath0, dstPath0, TranscodingJobPriority::kNormal, kBitRate));
-    EXPECT_TRUE(submit(mClient1, 1, srcPath1, dstPath1, TranscodingJobPriority::kNormal, kBitRate));
-    EXPECT_EQ(mClientCallback1->pop(kPaddingUs), EventTracker::Start(CLIENT(1), 0));
-    EXPECT_TRUE(getJob(mClient1, 0, srcPath0, dstPath0));
-    EXPECT_TRUE(getJob(mClient1, 1, srcPath1, dstPath1));
+    EXPECT_TRUE(mClient1->submit(0, srcPath0, dstPath0, TranscodingJobPriority::kNormal, kBitRate));
+    EXPECT_TRUE(mClient1->submit(1, srcPath1, dstPath1, TranscodingJobPriority::kNormal, kBitRate));
+    EXPECT_EQ(mClient1->pop(kPaddingUs), EventTracker::Start(CLIENT(1), 0));
+    EXPECT_TRUE(mClient1->getJob(0, srcPath0, dstPath0));
+    EXPECT_TRUE(mClient1->getJob(1, srcPath1, dstPath1));
 
     // Job 0 (longtest) shouldn't finish in 1 seconds.
-    EXPECT_EQ(mClientCallback1->pop(1000000), EventTracker::NoEvent);
+    EXPECT_EQ(mClient1->pop(1000000), EventTracker::NoEvent);
 
     // Now cancel job 0. Job 1 should start immediately and finish.
-    EXPECT_TRUE(cancel(mClient1, 0));
-    EXPECT_TRUE(getJob<fail>(mClient1, 0, "", ""));
-    EXPECT_EQ(mClientCallback1->pop(kPaddingUs), EventTracker::Start(CLIENT(1), 1));
-    EXPECT_EQ(mClientCallback1->pop(kJobWithPaddingUs), EventTracker::Finished(CLIENT(1), 1));
+    EXPECT_TRUE(mClient1->cancel(0));
+    EXPECT_TRUE(mClient1->getJob<fail>(0, "", ""));
+    EXPECT_EQ(mClient1->pop(kPaddingUs), EventTracker::Start(CLIENT(1), 1));
+    EXPECT_EQ(mClient1->pop(kJobWithPaddingUs), EventTracker::Finished(CLIENT(1), 1));
 
     unregisterMultipleClients();
 }
@@ -196,35 +198,35 @@
     deleteFile(dstPath1);
 
     // Submit one offline job, should start immediately.
-    EXPECT_TRUE(submit(mClient1, 0, srcPath0, dstPath0, TranscodingJobPriority::kUnspecified,
-                       kBitRate));
-    EXPECT_EQ(mClientCallback1->pop(kPaddingUs), EventTracker::Start(CLIENT(1), 0));
+    EXPECT_TRUE(mClient1->submit(0, srcPath0, dstPath0, TranscodingJobPriority::kUnspecified,
+                                 kBitRate));
+    EXPECT_EQ(mClient1->pop(kPaddingUs), EventTracker::Start(CLIENT(1), 0));
     // Test get job after starts.
-    EXPECT_TRUE(getJob(mClient1, 0, srcPath0, dstPath0));
+    EXPECT_TRUE(mClient1->getJob(0, srcPath0, dstPath0));
 
     // Submit one realtime job.
-    EXPECT_TRUE(submit(mClient1, 1, srcPath1, dstPath1, TranscodingJobPriority::kNormal, kBitRate));
+    EXPECT_TRUE(mClient1->submit(1, srcPath1, dstPath1, TranscodingJobPriority::kNormal, kBitRate));
 
     // Offline job should pause.
-    EXPECT_EQ(mClientCallback1->pop(kPaddingUs), EventTracker::Pause(CLIENT(1), 0));
-    EXPECT_TRUE(getJob(mClient1, 0, srcPath0, dstPath0));
+    EXPECT_EQ(mClient1->pop(kPaddingUs), EventTracker::Pause(CLIENT(1), 0));
+    EXPECT_TRUE(mClient1->getJob(0, srcPath0, dstPath0));
 
     // Realtime job should start immediately, and run to finish.
-    EXPECT_EQ(mClientCallback1->pop(kPaddingUs), EventTracker::Start(CLIENT(1), 1));
-    EXPECT_EQ(mClientCallback1->pop(kJobWithPaddingUs), EventTracker::Finished(CLIENT(1), 1));
+    EXPECT_EQ(mClient1->pop(kPaddingUs), EventTracker::Start(CLIENT(1), 1));
+    EXPECT_EQ(mClient1->pop(kJobWithPaddingUs), EventTracker::Finished(CLIENT(1), 1));
 
     // Test get job after finish fails.
-    EXPECT_TRUE(getJob<fail>(mClient1, 1, "", ""));
+    EXPECT_TRUE(mClient1->getJob<fail>(1, "", ""));
 
     // Then offline job should resume.
-    EXPECT_EQ(mClientCallback1->pop(kPaddingUs), EventTracker::Resume(CLIENT(1), 0));
+    EXPECT_EQ(mClient1->pop(kPaddingUs), EventTracker::Resume(CLIENT(1), 0));
     // Test get job after resume.
-    EXPECT_TRUE(getJob(mClient1, 0, srcPath0, dstPath0));
+    EXPECT_TRUE(mClient1->getJob(0, srcPath0, dstPath0));
 
     // Offline job should finish.
-    EXPECT_EQ(mClientCallback1->pop(kJobWithPaddingUs), EventTracker::Finished(CLIENT(1), 0));
+    EXPECT_EQ(mClient1->pop(kJobWithPaddingUs), EventTracker::Finished(CLIENT(1), 0));
     // Test get job after finish fails.
-    EXPECT_TRUE(getJob<fail>(mClient1, 0, "", ""));
+    EXPECT_TRUE(mClient1->getJob<fail>(0, "", ""));
 
     unregisterMultipleClients();
 }
@@ -256,31 +258,31 @@
 
     // Submit job to Client1.
     ALOGD("Submitting job to client1 (app A) ...");
-    EXPECT_TRUE(submit(mClient1, 0, srcPath0, dstPath0, TranscodingJobPriority::kNormal, kBitRate));
+    EXPECT_TRUE(mClient1->submit(0, srcPath0, dstPath0, TranscodingJobPriority::kNormal, kBitRate));
 
     // Client1's job should start immediately.
-    EXPECT_EQ(mClientCallback1->pop(kPaddingUs), EventTracker::Start(CLIENT(1), 0));
+    EXPECT_EQ(mClient1->pop(kPaddingUs), EventTracker::Start(CLIENT(1), 0));
 
     ALOGD("Moving app B to top...");
     EXPECT_TRUE(ShellHelper::Start(kClientPackageB, kTestActivityName));
 
     // Client1's job should continue to run, since Client2 (app B) doesn't have any job.
-    EXPECT_EQ(mClientCallback1->pop(1000000), EventTracker::NoEvent);
+    EXPECT_EQ(mClient1->pop(1000000), EventTracker::NoEvent);
 
     // Submit job to Client2.
     ALOGD("Submitting job to client2 (app B) ...");
-    EXPECT_TRUE(submit(mClient2, 0, srcPath1, dstPath1, TranscodingJobPriority::kNormal, kBitRate));
+    EXPECT_TRUE(mClient2->submit(0, srcPath1, dstPath1, TranscodingJobPriority::kNormal, kBitRate));
 
     // Client1's job should pause, client2's job should start.
-    EXPECT_EQ(mClientCallback1->pop(kPaddingUs), EventTracker::Pause(CLIENT(1), 0));
-    EXPECT_EQ(mClientCallback2->pop(kPaddingUs), EventTracker::Start(CLIENT(2), 0));
+    EXPECT_EQ(mClient1->pop(kPaddingUs), EventTracker::Pause(CLIENT(1), 0));
+    EXPECT_EQ(mClient2->pop(kPaddingUs), EventTracker::Start(CLIENT(2), 0));
 
     // Client2's job should finish, then Client1's job should resume.
-    EXPECT_EQ(mClientCallback2->pop(kJobWithPaddingUs), EventTracker::Finished(CLIENT(2), 0));
-    EXPECT_EQ(mClientCallback1->pop(kPaddingUs), EventTracker::Resume(CLIENT(1), 0));
+    EXPECT_EQ(mClient2->pop(kJobWithPaddingUs), EventTracker::Finished(CLIENT(2), 0));
+    EXPECT_EQ(mClient1->pop(kPaddingUs), EventTracker::Resume(CLIENT(1), 0));
 
     // Client1's job should finish.
-    EXPECT_EQ(mClientCallback1->pop(kJobWithPaddingUs), EventTracker::Finished(CLIENT(1), 0));
+    EXPECT_EQ(mClient1->pop(kJobWithPaddingUs), EventTracker::Finished(CLIENT(1), 0));
 
     unregisterMultipleClients();
 
diff --git a/services/mediatranscoding/tests/mediatranscodingservice_resource_tests.cpp b/services/mediatranscoding/tests/mediatranscodingservice_resource_tests.cpp
new file mode 100644
index 0000000..31697d5
--- /dev/null
+++ b/services/mediatranscoding/tests/mediatranscodingservice_resource_tests.cpp
@@ -0,0 +1,134 @@
+/*
+ * Copyright (C) 2020 The Android Open Source Project
+ *
+ * Licensed under the Apache License, Version 2.0 (the "License");
+ * you may not use this file except in compliance with the License.
+ * You may obtain a copy of the License at
+ *
+ *      http://www.apache.org/licenses/LICENSE-2.0
+ *
+ * Unless required by applicable law or agreed to in writing, software
+ * distributed under the License is distributed on an "AS IS" BASIS,
+ * WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
+ * See the License for the specific language governing permissions and
+ * limitations under the License.
+ */
+
+// Unit Test for MediaTranscodingService.
+
+//#define LOG_NDEBUG 0
+#define LOG_TAG "MediaTranscodingServiceRealTest"
+
+#include "MediaTranscodingServiceTestHelper.h"
+
+/*
+ * Tests media transcoding service with real transcoder.
+ *
+ * Uses the same test assets as the MediaTranscoder unit tests. Before running the test,
+ * please make sure to push the test assets to /sdcard:
+ *
+ * adb push $TOP/frameworks/av/media/libmediatranscoding/transcoder/tests/assets /data/local/tmp/TranscodingTestAssets
+ */
+namespace android {
+
+namespace media {
+
+constexpr int64_t kPaddingUs = 400000;
+constexpr int32_t kBitRate = 8 * 1000 * 1000;  // 8Mbs
+
+constexpr const char* kLongSrcPath = "/data/local/tmp/TranscodingTestAssets/longtest_15s.mp4";
+
+constexpr const char* kResourcePolicyTestActivity =
+        "/com.android.tests.transcoding.ResourcePolicyTestActivity";
+
+#define OUTPATH(name) "/data/local/tmp/MediaTranscodingService_" #name ".MP4"
+
+class MediaTranscodingServiceResourceTest : public MediaTranscodingServiceTestBase {
+public:
+    MediaTranscodingServiceResourceTest() { ALOGI("MediaTranscodingServiceResourceTest created"); }
+
+    virtual ~MediaTranscodingServiceResourceTest() {
+        ALOGI("MediaTranscodingServiceResourceTest destroyed");
+    }
+};
+
+/**
+ * Basic testing for handling resource lost.
+ *
+ * This test starts a transcoding job (that's somewhat long and takes several seconds),
+ * then launches an activity that allocates video codec instances until it hits insufficient
+ * resource error. Because the activity is running in foreground,
+ * ResourceManager would reclaim codecs from transcoding service which should
+ * cause the job to be paused. The activity will hold the codecs for a few seconds
+ * before releasing them, and the transcoding service should be able to resume
+ * and complete the job.
+ */
+TEST_F(MediaTranscodingServiceResourceTest, TestResourceLost) {
+    ALOGD("TestResourceLost starting...");
+
+    EXPECT_TRUE(ShellHelper::RunCmd("input keyevent KEYCODE_WAKEUP"));
+    EXPECT_TRUE(ShellHelper::RunCmd("wm dismiss-keyguard"));
+    EXPECT_TRUE(ShellHelper::Stop(kClientPackageA));
+
+    registerMultipleClients();
+
+    const char* srcPath0 = kLongSrcPath;
+    const char* dstPath0 = OUTPATH(TestPauseResumeMultiClients_Client0);
+    deleteFile(dstPath0);
+
+    ALOGD("Moving app A to top...");
+    EXPECT_TRUE(ShellHelper::Start(kClientPackageA, kTestActivityName));
+
+    // Submit job to Client1.
+    ALOGD("Submitting job to client1 (app A) ...");
+    EXPECT_TRUE(mClient1->submit(0, srcPath0, dstPath0, TranscodingJobPriority::kNormal, kBitRate));
+
+    // Client1's job should start immediately.
+    EXPECT_EQ(mClient1->pop(kPaddingUs), EventTracker::Start(CLIENT(1), 0));
+
+    // Launch ResourcePolicyTestActivity, which will try to allocate up to 32
+    // instances, which should trigger insufficient resources on most devices.
+    // (Note that it's possible that the device supports a very high number of
+    // resource instances, in which case we'll simply require that the job completes.)
+    ALOGD("Launch ResourcePolicyTestActivity...");
+    EXPECT_TRUE(ShellHelper::Start(kClientPackageA, kResourcePolicyTestActivity));
+
+    // The basic requirement is that the job should complete. Wait for finish
+    // event to come and pop up all events received.
+    std::list<EventTracker::Event> events;
+    EXPECT_TRUE(mClient1->waitForSpecificEventAndPop(EventTracker::Finished(CLIENT(1), 0), &events,
+                                                     15000000));
+
+    // If there is only 1 event, it must be finish (otherwise waitForSpecificEventAndPop
+    // woudldn't pop up anything), and we're ok.
+    //
+    // TODO: If there is only 1 event (finish), and no pause/resume happened, we need
+    // to verify that the ResourcePolicyTestActivity actually was able to allocate
+    // all 32 instances without hitting insufficient resources. Otherwise, it could
+    // be that ResourceManager was not able to reclaim codecs from the transcoding
+    // service at all, which means the resource management is broken.
+    if (events.size() > 1) {
+        EXPECT_TRUE(events.size() >= 3);
+        size_t i = 0;
+        for (auto& event : events) {
+            if (i == 0) {
+                EXPECT_EQ(event, EventTracker::Pause(CLIENT(1), 0));
+            } else if (i == events.size() - 2) {
+                EXPECT_EQ(event, EventTracker::Resume(CLIENT(1), 0));
+            } else if (i == events.size() - 1) {
+                EXPECT_EQ(event, EventTracker::Finished(CLIENT(1), 0));
+            } else {
+                EXPECT_TRUE(event == EventTracker::Pause(CLIENT(1), 0) ||
+                            event == EventTracker::Resume(CLIENT(1), 0));
+            }
+            i++;
+        }
+    }
+
+    unregisterMultipleClients();
+
+    EXPECT_TRUE(ShellHelper::Stop(kClientPackageA));
+}
+
+}  // namespace media
+}  // namespace android
diff --git a/services/mediatranscoding/tests/mediatranscodingservice_simulated_tests.cpp b/services/mediatranscoding/tests/mediatranscodingservice_simulated_tests.cpp
index 42b5877..c912b03 100644
--- a/services/mediatranscoding/tests/mediatranscodingservice_simulated_tests.cpp
+++ b/services/mediatranscoding/tests/mediatranscodingservice_simulated_tests.cpp
@@ -47,11 +47,10 @@
 // Note that -1 is valid and means using calling pid/uid for the service. But only privilege caller could
 // use them. This test is not a privilege caller.
 constexpr int32_t kInvalidClientPid = -5;
+constexpr int32_t kInvalidClientUid = -10;
 constexpr const char* kInvalidClientName = "";
 constexpr const char* kInvalidClientOpPackageName = "";
 
-constexpr int32_t kClientUseCallingUid = IMediaTranscodingService::USE_CALLING_UID;
-
 constexpr int64_t kPaddingUs = 1000000;
 constexpr int64_t kJobWithPaddingUs = SimulatedTranscoder::kJobDurationUs + kPaddingUs;
 
@@ -59,24 +58,18 @@
 
 class MediaTranscodingServiceSimulatedTest : public MediaTranscodingServiceTestBase {
 public:
-    MediaTranscodingServiceSimulatedTest() {}
+    MediaTranscodingServiceSimulatedTest() { ALOGI("MediaTranscodingServiceResourceTest created"); }
+
+    virtual ~MediaTranscodingServiceSimulatedTest() {
+        ALOGI("MediaTranscodingServiceResourceTest destroyed");
+    }
 };
 
 TEST_F(MediaTranscodingServiceSimulatedTest, TestRegisterNullClient) {
     std::shared_ptr<ITranscodingClient> client;
 
     // Register the client with null callback.
-    Status status = mService->registerClient(nullptr, kClientName, kClientOpPackageName,
-                                             kClientUseCallingUid, kClientUseCallingPid, &client);
-    EXPECT_FALSE(status.isOk());
-}
-
-TEST_F(MediaTranscodingServiceSimulatedTest, TestRegisterClientWithInvalidClientPid) {
-    std::shared_ptr<ITranscodingClient> client;
-
-    // Register the client with the service.
-    Status status = mService->registerClient(mClientCallback1, kClientName, kClientOpPackageName,
-                                             kClientUseCallingUid, kInvalidClientPid, &client);
+    Status status = mService->registerClient(nullptr, kClientName, kClientOpPackageName, &client);
     EXPECT_FALSE(status.isOk());
 }
 
@@ -84,9 +77,8 @@
     std::shared_ptr<ITranscodingClient> client;
 
     // Register the client with the service.
-    Status status = mService->registerClient(mClientCallback1, kInvalidClientName,
-                                             kInvalidClientOpPackageName, kClientUseCallingUid,
-                                             kClientUseCallingPid, &client);
+    Status status = mService->registerClient(mClient1, kInvalidClientName,
+                                             kInvalidClientOpPackageName, &client);
     EXPECT_FALSE(status.isOk());
 }
 
@@ -95,16 +87,14 @@
 
     // Register the client with the service.
     Status status =
-            mService->registerClient(mClientCallback1, kClientName, kInvalidClientOpPackageName,
-                                     kClientUseCallingUid, kClientUseCallingPid, &client);
+            mService->registerClient(mClient1, kClientName, kInvalidClientOpPackageName, &client);
     EXPECT_FALSE(status.isOk());
 }
 
 TEST_F(MediaTranscodingServiceSimulatedTest, TestRegisterOneClient) {
     std::shared_ptr<ITranscodingClient> client;
 
-    Status status = mService->registerClient(mClientCallback1, kClientName, kClientOpPackageName,
-                                             kClientUseCallingUid, kClientUseCallingPid, &client);
+    Status status = mService->registerClient(mClient1, kClientName, kClientOpPackageName, &client);
     EXPECT_TRUE(status.isOk());
 
     // Validate the client.
@@ -129,8 +119,7 @@
 TEST_F(MediaTranscodingServiceSimulatedTest, TestRegisterClientTwice) {
     std::shared_ptr<ITranscodingClient> client;
 
-    Status status = mService->registerClient(mClientCallback1, kClientName, kClientOpPackageName,
-                                             kClientUseCallingUid, kClientUseCallingPid, &client);
+    Status status = mService->registerClient(mClient1, kClientName, kClientOpPackageName, &client);
     EXPECT_TRUE(status.isOk());
 
     // Validate the client.
@@ -138,8 +127,7 @@
 
     // Register the client again and expects failure.
     std::shared_ptr<ITranscodingClient> client1;
-    status = mService->registerClient(mClientCallback1, kClientName, kClientOpPackageName,
-                                      kClientUseCallingUid, kClientUseCallingPid, &client1);
+    status = mService->registerClient(mClient1, kClientName, kClientOpPackageName, &client1);
     EXPECT_FALSE(status.isOk());
 
     // Unregister the client.
@@ -156,18 +144,18 @@
     registerMultipleClients();
 
     // Submit 2 requests on client1 first.
-    EXPECT_TRUE(submit(mClient1, 0, "test_source_file", "test_destination_file"));
-    EXPECT_TRUE(submit(mClient1, 1, "test_source_file", "test_destination_file"));
+    EXPECT_TRUE(mClient1->submit(0, "test_source_file", "test_destination_file"));
+    EXPECT_TRUE(mClient1->submit(1, "test_source_file", "test_destination_file"));
 
     // Submit 2 requests on client2, jobId should be independent for each client.
-    EXPECT_TRUE(submit(mClient2, 0, "test_source_file", "test_destination_file"));
-    EXPECT_TRUE(submit(mClient2, 1, "test_source_file", "test_destination_file"));
+    EXPECT_TRUE(mClient2->submit(0, "test_source_file", "test_destination_file"));
+    EXPECT_TRUE(mClient2->submit(1, "test_source_file", "test_destination_file"));
 
     // Cancel all jobs.
-    EXPECT_TRUE(cancel(mClient1, 0));
-    EXPECT_TRUE(cancel(mClient1, 1));
-    EXPECT_TRUE(cancel(mClient2, 0));
-    EXPECT_TRUE(cancel(mClient2, 1));
+    EXPECT_TRUE(mClient1->cancel(0));
+    EXPECT_TRUE(mClient1->cancel(1));
+    EXPECT_TRUE(mClient2->cancel(0));
+    EXPECT_TRUE(mClient2->cancel(1));
 
     unregisterMultipleClients();
 }
@@ -176,32 +164,36 @@
     registerMultipleClients();
 
     // Test jobId assignment.
-    EXPECT_TRUE(submit(mClient1, 0, "test_source_file_0", "test_destination_file"));
-    EXPECT_TRUE(submit(mClient1, 1, "test_source_file_1", "test_destination_file"));
-    EXPECT_TRUE(submit(mClient1, 2, "test_source_file_2", "test_destination_file"));
+    EXPECT_TRUE(mClient1->submit(0, "test_source_file_0", "test_destination_file"));
+    EXPECT_TRUE(mClient1->submit(1, "test_source_file_1", "test_destination_file"));
+    EXPECT_TRUE(mClient1->submit(2, "test_source_file_2", "test_destination_file"));
 
     // Test submit bad request (no valid sourceFilePath) fails.
-    EXPECT_TRUE(submit<fail>(mClient1, 0, "", ""));
+    EXPECT_TRUE(mClient1->submit<fail>(0, "", ""));
+
+    // Test submit bad request (no valid sourceFilePath) fails.
+    EXPECT_TRUE(mClient1->submit<fail>(0, "src", "dst", TranscodingJobPriority::kNormal, 1000000,
+                                       kInvalidClientPid, kInvalidClientUid));
 
     // Test cancel non-existent job fails.
-    EXPECT_TRUE(cancel<fail>(mClient1, 100));
+    EXPECT_TRUE(mClient1->cancel<fail>(100));
 
     // Job 0 should start immediately and finish in 2 seconds, followed by Job 1 start.
-    EXPECT_EQ(mClientCallback1->pop(kPaddingUs), EventTracker::Start(CLIENT(1), 0));
-    EXPECT_EQ(mClientCallback1->pop(kJobWithPaddingUs), EventTracker::Finished(CLIENT(1), 0));
-    EXPECT_EQ(mClientCallback1->pop(kPaddingUs), EventTracker::Start(CLIENT(1), 1));
+    EXPECT_EQ(mClient1->pop(kPaddingUs), EventTracker::Start(CLIENT(1), 0));
+    EXPECT_EQ(mClient1->pop(kJobWithPaddingUs), EventTracker::Finished(CLIENT(1), 0));
+    EXPECT_EQ(mClient1->pop(kPaddingUs), EventTracker::Start(CLIENT(1), 1));
 
     // Test cancel valid jobId in random order.
     // Test cancel finished job fails.
-    EXPECT_TRUE(cancel(mClient1, 2));
-    EXPECT_TRUE(cancel<fail>(mClient1, 0));
-    EXPECT_TRUE(cancel(mClient1, 1));
+    EXPECT_TRUE(mClient1->cancel(2));
+    EXPECT_TRUE(mClient1->cancel<fail>(0));
+    EXPECT_TRUE(mClient1->cancel(1));
 
     // Test cancel job again fails.
-    EXPECT_TRUE(cancel<fail>(mClient1, 1));
+    EXPECT_TRUE(mClient1->cancel<fail>(1));
 
     // Test no more events arriving after cancel.
-    EXPECT_EQ(mClientCallback1->pop(kJobWithPaddingUs), EventTracker::NoEvent);
+    EXPECT_EQ(mClient1->pop(kJobWithPaddingUs), EventTracker::NoEvent);
 
     unregisterMultipleClients();
 }
@@ -210,36 +202,36 @@
     registerMultipleClients();
 
     // Submit 3 requests.
-    EXPECT_TRUE(submit(mClient1, 0, "test_source_file_0", "test_destination_file_0"));
-    EXPECT_TRUE(submit(mClient1, 1, "test_source_file_1", "test_destination_file_1"));
-    EXPECT_TRUE(submit(mClient1, 2, "test_source_file_2", "test_destination_file_2"));
+    EXPECT_TRUE(mClient1->submit(0, "test_source_file_0", "test_destination_file_0"));
+    EXPECT_TRUE(mClient1->submit(1, "test_source_file_1", "test_destination_file_1"));
+    EXPECT_TRUE(mClient1->submit(2, "test_source_file_2", "test_destination_file_2"));
 
     // Test get jobs by id.
-    EXPECT_TRUE(getJob(mClient1, 2, "test_source_file_2", "test_destination_file_2"));
-    EXPECT_TRUE(getJob(mClient1, 1, "test_source_file_1", "test_destination_file_1"));
-    EXPECT_TRUE(getJob(mClient1, 0, "test_source_file_0", "test_destination_file_0"));
+    EXPECT_TRUE(mClient1->getJob(2, "test_source_file_2", "test_destination_file_2"));
+    EXPECT_TRUE(mClient1->getJob(1, "test_source_file_1", "test_destination_file_1"));
+    EXPECT_TRUE(mClient1->getJob(0, "test_source_file_0", "test_destination_file_0"));
 
     // Test get job by invalid id fails.
-    EXPECT_TRUE(getJob<fail>(mClient1, 100, "", ""));
-    EXPECT_TRUE(getJob<fail>(mClient1, -1, "", ""));
+    EXPECT_TRUE(mClient1->getJob<fail>(100, "", ""));
+    EXPECT_TRUE(mClient1->getJob<fail>(-1, "", ""));
 
     // Test get job after cancel fails.
-    EXPECT_TRUE(cancel(mClient1, 2));
-    EXPECT_TRUE(getJob<fail>(mClient1, 2, "", ""));
+    EXPECT_TRUE(mClient1->cancel(2));
+    EXPECT_TRUE(mClient1->getJob<fail>(2, "", ""));
 
     // Job 0 should start immediately and finish in 2 seconds, followed by Job 1 start.
-    EXPECT_EQ(mClientCallback1->pop(kPaddingUs), EventTracker::Start(CLIENT(1), 0));
-    EXPECT_EQ(mClientCallback1->pop(kJobWithPaddingUs), EventTracker::Finished(CLIENT(1), 0));
-    EXPECT_EQ(mClientCallback1->pop(kPaddingUs), EventTracker::Start(CLIENT(1), 1));
+    EXPECT_EQ(mClient1->pop(kPaddingUs), EventTracker::Start(CLIENT(1), 0));
+    EXPECT_EQ(mClient1->pop(kJobWithPaddingUs), EventTracker::Finished(CLIENT(1), 0));
+    EXPECT_EQ(mClient1->pop(kPaddingUs), EventTracker::Start(CLIENT(1), 1));
 
     // Test get job after finish fails.
-    EXPECT_TRUE(getJob<fail>(mClient1, 0, "", ""));
+    EXPECT_TRUE(mClient1->getJob<fail>(0, "", ""));
 
     // Test get the remaining job 1.
-    EXPECT_TRUE(getJob(mClient1, 1, "test_source_file_1", "test_destination_file_1"));
+    EXPECT_TRUE(mClient1->getJob(1, "test_source_file_1", "test_destination_file_1"));
 
     // Cancel remaining job 1.
-    EXPECT_TRUE(cancel(mClient1, 1));
+    EXPECT_TRUE(mClient1->cancel(1));
 
     unregisterMultipleClients();
 }
@@ -248,36 +240,36 @@
     registerMultipleClients();
 
     // Submit some offline jobs first.
-    EXPECT_TRUE(submit(mClient1, 0, "test_source_file_0", "test_destination_file_0",
-                       TranscodingJobPriority::kUnspecified));
-    EXPECT_TRUE(submit(mClient1, 1, "test_source_file_1", "test_destination_file_1",
-                       TranscodingJobPriority::kUnspecified));
+    EXPECT_TRUE(mClient1->submit(0, "test_source_file_0", "test_destination_file_0",
+                                 TranscodingJobPriority::kUnspecified));
+    EXPECT_TRUE(mClient1->submit(1, "test_source_file_1", "test_destination_file_1",
+                                 TranscodingJobPriority::kUnspecified));
 
     // Job 0 should start immediately.
-    EXPECT_EQ(mClientCallback1->pop(kPaddingUs), EventTracker::Start(CLIENT(1), 0));
+    EXPECT_EQ(mClient1->pop(kPaddingUs), EventTracker::Start(CLIENT(1), 0));
 
     // Submit more real-time jobs.
-    EXPECT_TRUE(submit(mClient1, 2, "test_source_file_2", "test_destination_file_2"));
-    EXPECT_TRUE(submit(mClient1, 3, "test_source_file_3", "test_destination_file_3"));
+    EXPECT_TRUE(mClient1->submit(2, "test_source_file_2", "test_destination_file_2"));
+    EXPECT_TRUE(mClient1->submit(3, "test_source_file_3", "test_destination_file_3"));
 
     // Job 0 should pause immediately and job 2 should start.
-    EXPECT_EQ(mClientCallback1->pop(kPaddingUs), EventTracker::Pause(CLIENT(1), 0));
-    EXPECT_EQ(mClientCallback1->pop(kPaddingUs), EventTracker::Start(CLIENT(1), 2));
+    EXPECT_EQ(mClient1->pop(kPaddingUs), EventTracker::Pause(CLIENT(1), 0));
+    EXPECT_EQ(mClient1->pop(kPaddingUs), EventTracker::Start(CLIENT(1), 2));
 
     // Job 2 should finish in 2 seconds and job 3 should start.
-    EXPECT_EQ(mClientCallback1->pop(kJobWithPaddingUs), EventTracker::Finished(CLIENT(1), 2));
-    EXPECT_EQ(mClientCallback1->pop(kPaddingUs), EventTracker::Start(CLIENT(1), 3));
+    EXPECT_EQ(mClient1->pop(kJobWithPaddingUs), EventTracker::Finished(CLIENT(1), 2));
+    EXPECT_EQ(mClient1->pop(kPaddingUs), EventTracker::Start(CLIENT(1), 3));
 
     // Cancel job 3 now
-    EXPECT_TRUE(cancel(mClient1, 3));
+    EXPECT_TRUE(mClient1->cancel(3));
 
     // Job 0 should resume and finish in 2 seconds, followed by job 1 start.
-    EXPECT_EQ(mClientCallback1->pop(kPaddingUs), EventTracker::Resume(CLIENT(1), 0));
-    EXPECT_EQ(mClientCallback1->pop(kJobWithPaddingUs), EventTracker::Finished(CLIENT(1), 0));
-    EXPECT_EQ(mClientCallback1->pop(kPaddingUs), EventTracker::Start(CLIENT(1), 1));
+    EXPECT_EQ(mClient1->pop(kPaddingUs), EventTracker::Resume(CLIENT(1), 0));
+    EXPECT_EQ(mClient1->pop(kJobWithPaddingUs), EventTracker::Finished(CLIENT(1), 0));
+    EXPECT_EQ(mClient1->pop(kPaddingUs), EventTracker::Start(CLIENT(1), 1));
 
     // Cancel remaining job 1.
-    EXPECT_TRUE(cancel(mClient1, 1));
+    EXPECT_TRUE(mClient1->cancel(1));
 
     unregisterMultipleClients();
 }
@@ -286,8 +278,7 @@
     std::shared_ptr<ITranscodingClient> client;
 
     // Register a client, then unregister.
-    Status status = mService->registerClient(mClientCallback1, kClientName, kClientOpPackageName,
-                                             kClientUseCallingUid, kClientUseCallingPid, &client);
+    Status status = mService->registerClient(mClient1, kClientName, kClientOpPackageName, &client);
     EXPECT_TRUE(status.isOk());
 
     status = client->unregister();
@@ -323,41 +314,41 @@
 
     // Submit 3 requests.
     ALOGD("Submitting job to client1 (app A) ...");
-    EXPECT_TRUE(submit(mClient1, 0, "test_source_file_0", "test_destination_file_0"));
-    EXPECT_TRUE(submit(mClient1, 1, "test_source_file_1", "test_destination_file_1"));
-    EXPECT_TRUE(submit(mClient1, 2, "test_source_file_2", "test_destination_file_2"));
+    EXPECT_TRUE(mClient1->submit(0, "test_source_file_0", "test_destination_file_0"));
+    EXPECT_TRUE(mClient1->submit(1, "test_source_file_1", "test_destination_file_1"));
+    EXPECT_TRUE(mClient1->submit(2, "test_source_file_2", "test_destination_file_2"));
 
     // Job 0 should start immediately.
-    EXPECT_EQ(mClientCallback1->pop(kPaddingUs), EventTracker::Start(CLIENT(1), 0));
+    EXPECT_EQ(mClient1->pop(kPaddingUs), EventTracker::Start(CLIENT(1), 0));
 
     ALOGD("Moving app B to top...");
     EXPECT_TRUE(ShellHelper::Start(kClientPackageB, kTestActivityName));
 
     // Job 0 should continue and finish in 2 seconds, then job 1 should start.
-    EXPECT_EQ(mClientCallback1->pop(kJobWithPaddingUs), EventTracker::Finished(CLIENT(1), 0));
-    EXPECT_EQ(mClientCallback1->pop(kPaddingUs), EventTracker::Start(CLIENT(1), 1));
+    EXPECT_EQ(mClient1->pop(kJobWithPaddingUs), EventTracker::Finished(CLIENT(1), 0));
+    EXPECT_EQ(mClient1->pop(kPaddingUs), EventTracker::Start(CLIENT(1), 1));
 
     ALOGD("Submitting job to client2 (app B) ...");
-    EXPECT_TRUE(submit(mClient2, 0, "test_source_file_0", "test_destination_file_0"));
+    EXPECT_TRUE(mClient2->submit(0, "test_source_file_0", "test_destination_file_0"));
 
     // Client1's job should pause, client2's job should start.
-    EXPECT_EQ(mClientCallback1->pop(kPaddingUs), EventTracker::Pause(CLIENT(1), 1));
-    EXPECT_EQ(mClientCallback2->pop(kPaddingUs), EventTracker::Start(CLIENT(2), 0));
+    EXPECT_EQ(mClient1->pop(kPaddingUs), EventTracker::Pause(CLIENT(1), 1));
+    EXPECT_EQ(mClient2->pop(kPaddingUs), EventTracker::Start(CLIENT(2), 0));
 
     ALOGD("Moving app A back to top...");
     EXPECT_TRUE(ShellHelper::Start(kClientPackageA, kTestActivityName));
 
     // Client2's job should pause, client1's job 1 should resume.
-    EXPECT_EQ(mClientCallback2->pop(kPaddingUs), EventTracker::Pause(CLIENT(2), 0));
-    EXPECT_EQ(mClientCallback1->pop(kPaddingUs), EventTracker::Resume(CLIENT(1), 1));
+    EXPECT_EQ(mClient2->pop(kPaddingUs), EventTracker::Pause(CLIENT(2), 0));
+    EXPECT_EQ(mClient1->pop(kPaddingUs), EventTracker::Resume(CLIENT(1), 1));
 
     // Client2's job 1 should finish in 2 seconds, then its job 2 should start.
-    EXPECT_EQ(mClientCallback1->pop(kJobWithPaddingUs), EventTracker::Finished(CLIENT(1), 1));
-    EXPECT_EQ(mClientCallback1->pop(kPaddingUs), EventTracker::Start(CLIENT(1), 2));
+    EXPECT_EQ(mClient1->pop(kJobWithPaddingUs), EventTracker::Finished(CLIENT(1), 1));
+    EXPECT_EQ(mClient1->pop(kPaddingUs), EventTracker::Start(CLIENT(1), 2));
 
     // After client2's jobs finish, client1's job should resume.
-    EXPECT_EQ(mClientCallback1->pop(kJobWithPaddingUs), EventTracker::Finished(CLIENT(1), 2));
-    EXPECT_EQ(mClientCallback2->pop(kPaddingUs), EventTracker::Resume(CLIENT(2), 0));
+    EXPECT_EQ(mClient1->pop(kJobWithPaddingUs), EventTracker::Finished(CLIENT(1), 2));
+    EXPECT_EQ(mClient2->pop(kPaddingUs), EventTracker::Resume(CLIENT(2), 0));
 
     unregisterMultipleClients();
 
diff --git a/services/oboeservice/AAudioClientTracker.cpp b/services/oboeservice/AAudioClientTracker.cpp
index 9d9ca63..3ec8dea 100644
--- a/services/oboeservice/AAudioClientTracker.cpp
+++ b/services/oboeservice/AAudioClientTracker.cpp
@@ -198,7 +198,7 @@
         for (const auto& serviceStream : streamsToClose) {
             aaudio_handle_t handle = serviceStream->getHandle();
             ALOGW("binderDied() close abandoned stream 0x%08X\n", handle);
-            aaudioService->closeStream(handle);
+            aaudioService->asAAudioServiceInterface().closeStream(handle);
         }
         // mStreams should be empty now
     }
diff --git a/services/oboeservice/AAudioClientTracker.h b/services/oboeservice/AAudioClientTracker.h
index 943b809..facfc3b 100644
--- a/services/oboeservice/AAudioClientTracker.h
+++ b/services/oboeservice/AAudioClientTracker.h
@@ -24,7 +24,7 @@
 #include <utils/Singleton.h>
 
 #include <aaudio/AAudio.h>
-#include "binding/IAAudioClient.h"
+#include <aaudio/IAAudioClient.h>
 #include "AAudioService.h"
 
 namespace aaudio {
@@ -46,7 +46,7 @@
      */
     std::string dump() const;
 
-    aaudio_result_t registerClient(pid_t pid, const android::sp<android::IAAudioClient>& client);
+    aaudio_result_t registerClient(pid_t pid, const android::sp<IAAudioClient>& client);
 
     void unregisterClient(pid_t pid);
 
diff --git a/services/oboeservice/AAudioService.cpp b/services/oboeservice/AAudioService.cpp
index 22cdb35..69e58f6 100644
--- a/services/oboeservice/AAudioService.cpp
+++ b/services/oboeservice/AAudioService.cpp
@@ -32,26 +32,26 @@
 #include "AAudioService.h"
 #include "AAudioServiceStreamMMAP.h"
 #include "AAudioServiceStreamShared.h"
-#include "binding/IAAudioService.h"
 
 using namespace android;
 using namespace aaudio;
 
 #define MAX_STREAMS_PER_PROCESS   8
+#define AIDL_RETURN(x) *_aidl_return = (x); return Status::ok();
+
 
 using android::AAudioService;
+using binder::Status;
 
 android::AAudioService::AAudioService()
-    : BnAAudioService() {
+    : BnAAudioService(),
+      mAdapter(this) {
     mAudioClient.clientUid = getuid();   // TODO consider using geteuid()
     mAudioClient.clientPid = getpid();
     mAudioClient.packageName = String16("");
     AAudioClientTracker::getInstance().setAAudioService(this);
 }
 
-AAudioService::~AAudioService() {
-}
-
 status_t AAudioService::dump(int fd, const Vector<String16>& args) {
     std::string result;
 
@@ -72,18 +72,21 @@
     return NO_ERROR;
 }
 
-void AAudioService::registerClient(const sp<IAAudioClient>& client) {
+Status AAudioService::registerClient(const sp<IAAudioClient> &client) {
     pid_t pid = IPCThreadState::self()->getCallingPid();
     AAudioClientTracker::getInstance().registerClient(pid, client);
+    return Status::ok();
 }
 
-bool AAudioService::isCallerInService() {
-    return mAudioClient.clientPid == IPCThreadState::self()->getCallingPid() &&
-        mAudioClient.clientUid == IPCThreadState::self()->getCallingUid();
-}
+Status
+AAudioService::openStream(const StreamRequest &_request, StreamParameters* _paramsOut,
+                          int32_t *_aidl_return) {
+    static_assert(std::is_same_v<aaudio_result_t, std::decay_t<typeof(*_aidl_return)>>);
 
-aaudio_handle_t AAudioService::openStream(const aaudio::AAudioStreamRequest &request,
-                                          aaudio::AAudioStreamConfiguration &configurationOutput) {
+    // Create wrapper objects for simple usage of the parcelables.
+    const AAudioStreamRequest request(_request);
+    AAudioStreamConfiguration paramsOut;
+
     // A lock in is used to order the opening of endpoints when an
     // EXCLUSIVE endpoint is stolen. We want the order to be:
     // 1) Thread A opens exclusive MMAP endpoint
@@ -108,13 +111,13 @@
         if (count >= MAX_STREAMS_PER_PROCESS) {
             ALOGE("openStream(): exceeded max streams per process %d >= %d",
                   count,  MAX_STREAMS_PER_PROCESS);
-            return AAUDIO_ERROR_UNAVAILABLE;
+            AIDL_RETURN(AAUDIO_ERROR_UNAVAILABLE);
         }
     }
 
     if (sharingMode != AAUDIO_SHARING_MODE_EXCLUSIVE && sharingMode != AAUDIO_SHARING_MODE_SHARED) {
         ALOGE("openStream(): unrecognized sharing mode = %d", sharingMode);
-        return AAUDIO_ERROR_ILLEGAL_ARGUMENT;
+        AIDL_RETURN(AAUDIO_ERROR_ILLEGAL_ARGUMENT);
     }
 
     if (sharingMode == AAUDIO_SHARING_MODE_EXCLUSIVE
@@ -147,29 +150,124 @@
 
     if (result != AAUDIO_OK) {
         serviceStream.clear();
-        return result;
+        AIDL_RETURN(result);
     } else {
         aaudio_handle_t handle = mStreamTracker.addStreamForHandle(serviceStream.get());
         serviceStream->setHandle(handle);
         pid_t pid = request.getProcessId();
         AAudioClientTracker::getInstance().registerClientStream(pid, serviceStream);
-        configurationOutput.copyFrom(*serviceStream);
+        paramsOut.copyFrom(*serviceStream);
+        *_paramsOut = std::move(paramsOut).parcelable();
         // Log open in MediaMetrics after we have the handle because we need the handle to
         // create the metrics ID.
         serviceStream->logOpen(handle);
         ALOGV("%s(): return handle = 0x%08X", __func__, handle);
-        return handle;
+        AIDL_RETURN(handle);
     }
 }
 
-aaudio_result_t AAudioService::closeStream(aaudio_handle_t streamHandle) {
+Status AAudioService::closeStream(int32_t streamHandle, int32_t *_aidl_return) {
+    static_assert(std::is_same_v<aaudio_result_t, std::decay_t<typeof(*_aidl_return)>>);
+
     // Check permission and ownership first.
     sp<AAudioServiceStreamBase> serviceStream = convertHandleToServiceStream(streamHandle);
     if (serviceStream.get() == nullptr) {
         ALOGE("closeStream(0x%0x), illegal stream handle", streamHandle);
-        return AAUDIO_ERROR_INVALID_HANDLE;
+        AIDL_RETURN(AAUDIO_ERROR_INVALID_HANDLE);
     }
-    return closeStream(serviceStream);
+    AIDL_RETURN(closeStream(serviceStream));
+}
+
+Status AAudioService::getStreamDescription(int32_t streamHandle, Endpoint* endpoint,
+                                           int32_t *_aidl_return) {
+    static_assert(std::is_same_v<aaudio_result_t, std::decay_t<typeof(*_aidl_return)>>);
+
+    sp<AAudioServiceStreamBase> serviceStream = convertHandleToServiceStream(streamHandle);
+    if (serviceStream.get() == nullptr) {
+        ALOGE("getStreamDescription(), illegal stream handle = 0x%0x", streamHandle);
+        AIDL_RETURN(AAUDIO_ERROR_INVALID_HANDLE);
+    }
+    AudioEndpointParcelable endpointParcelable;
+    aaudio_result_t result = serviceStream->getDescription(endpointParcelable);
+    if (result == AAUDIO_OK) {
+        *endpoint = std::move(endpointParcelable).parcelable();
+    }
+    AIDL_RETURN(result);
+}
+
+Status AAudioService::startStream(int32_t streamHandle, int32_t *_aidl_return) {
+    static_assert(std::is_same_v<aaudio_result_t, std::decay_t<typeof(*_aidl_return)>>);
+
+    sp<AAudioServiceStreamBase> serviceStream = convertHandleToServiceStream(streamHandle);
+    if (serviceStream.get() == nullptr) {
+        ALOGW("%s(), invalid streamHandle = 0x%0x", __func__, streamHandle);
+        AIDL_RETURN(AAUDIO_ERROR_INVALID_HANDLE);
+    }
+    AIDL_RETURN(serviceStream->start());
+}
+
+Status AAudioService::pauseStream(int32_t streamHandle, int32_t *_aidl_return) {
+    static_assert(std::is_same_v<aaudio_result_t, std::decay_t<typeof(*_aidl_return)>>);
+
+    sp<AAudioServiceStreamBase> serviceStream = convertHandleToServiceStream(streamHandle);
+    if (serviceStream.get() == nullptr) {
+        ALOGW("%s(), invalid streamHandle = 0x%0x", __func__, streamHandle);
+        AIDL_RETURN(AAUDIO_ERROR_INVALID_HANDLE);
+    }
+    AIDL_RETURN(serviceStream->pause());
+}
+
+Status AAudioService::stopStream(int32_t streamHandle, int32_t *_aidl_return) {
+    static_assert(std::is_same_v<aaudio_result_t, std::decay_t<typeof(*_aidl_return)>>);
+
+    sp<AAudioServiceStreamBase> serviceStream = convertHandleToServiceStream(streamHandle);
+    if (serviceStream.get() == nullptr) {
+        ALOGW("%s(), invalid streamHandle = 0x%0x", __func__, streamHandle);
+        AIDL_RETURN(AAUDIO_ERROR_INVALID_HANDLE);
+    }
+    AIDL_RETURN(serviceStream->stop());
+}
+
+Status AAudioService::flushStream(int32_t streamHandle, int32_t *_aidl_return) {
+    static_assert(std::is_same_v<aaudio_result_t, std::decay_t<typeof(*_aidl_return)>>);
+
+    sp<AAudioServiceStreamBase> serviceStream = convertHandleToServiceStream(streamHandle);
+    if (serviceStream.get() == nullptr) {
+        ALOGW("%s(), invalid streamHandle = 0x%0x", __func__, streamHandle);
+        AIDL_RETURN(AAUDIO_ERROR_INVALID_HANDLE);
+    }
+    AIDL_RETURN(serviceStream->flush());
+}
+
+Status AAudioService::registerAudioThread(int32_t streamHandle, int32_t clientThreadId, int64_t periodNanoseconds,
+                                          int32_t *_aidl_return) {
+    static_assert(std::is_same_v<aaudio_result_t, std::decay_t<typeof(*_aidl_return)>>);
+
+    sp<AAudioServiceStreamBase> serviceStream = convertHandleToServiceStream(streamHandle);
+    if (serviceStream.get() == nullptr) {
+        ALOGW("%s(), invalid streamHandle = 0x%0x", __func__, streamHandle);
+        AIDL_RETURN(AAUDIO_ERROR_INVALID_HANDLE);
+    }
+    int32_t priority = isCallerInService()
+        ? kRealTimeAudioPriorityService : kRealTimeAudioPriorityClient;
+    AIDL_RETURN(serviceStream->registerAudioThread(clientThreadId, priority));
+}
+
+Status AAudioService::unregisterAudioThread(int32_t streamHandle, int32_t clientThreadId,
+                                            int32_t *_aidl_return) {
+    static_assert(std::is_same_v<aaudio_result_t, std::decay_t<typeof(*_aidl_return)>>);
+
+    sp<AAudioServiceStreamBase> serviceStream = convertHandleToServiceStream(streamHandle);
+    if (serviceStream.get() == nullptr) {
+        ALOGW("%s(), invalid streamHandle = 0x%0x", __func__, streamHandle);
+        AIDL_RETURN(AAUDIO_ERROR_INVALID_HANDLE);
+    }
+    AIDL_RETURN(serviceStream->unregisterAudioThread(clientThreadId));
+}
+
+bool AAudioService::isCallerInService() {
+    return mAudioClient.clientPid == IPCThreadState::self()->getCallingPid() &&
+        mAudioClient.clientUid == IPCThreadState::self()->getCallingUid();
 }
 
 aaudio_result_t AAudioService::closeStream(sp<AAudioServiceStreamBase> serviceStream) {
@@ -205,76 +303,6 @@
     return serviceStream;
 }
 
-aaudio_result_t AAudioService::getStreamDescription(
-                aaudio_handle_t streamHandle,
-                aaudio::AudioEndpointParcelable &parcelable) {
-    sp<AAudioServiceStreamBase> serviceStream = convertHandleToServiceStream(streamHandle);
-    if (serviceStream.get() == nullptr) {
-        ALOGE("getStreamDescription(), illegal stream handle = 0x%0x", streamHandle);
-        return AAUDIO_ERROR_INVALID_HANDLE;
-    }
-    return serviceStream->getDescription(parcelable);
-}
-
-aaudio_result_t AAudioService::startStream(aaudio_handle_t streamHandle) {
-    sp<AAudioServiceStreamBase> serviceStream = convertHandleToServiceStream(streamHandle);
-    if (serviceStream.get() == nullptr) {
-        ALOGW("%s(), invalid streamHandle = 0x%0x", __func__, streamHandle);
-        return AAUDIO_ERROR_INVALID_HANDLE;
-    }
-    return serviceStream->start();
-}
-
-aaudio_result_t AAudioService::pauseStream(aaudio_handle_t streamHandle) {
-    sp<AAudioServiceStreamBase> serviceStream = convertHandleToServiceStream(streamHandle);
-    if (serviceStream.get() == nullptr) {
-        ALOGW("%s(), invalid streamHandle = 0x%0x", __func__, streamHandle);
-        return AAUDIO_ERROR_INVALID_HANDLE;
-    }
-    return serviceStream->pause();
-}
-
-aaudio_result_t AAudioService::stopStream(aaudio_handle_t streamHandle) {
-    sp<AAudioServiceStreamBase> serviceStream = convertHandleToServiceStream(streamHandle);
-    if (serviceStream.get() == nullptr) {
-        ALOGW("%s(), invalid streamHandle = 0x%0x", __func__, streamHandle);
-        return AAUDIO_ERROR_INVALID_HANDLE;
-    }
-    return serviceStream->stop();
-}
-
-aaudio_result_t AAudioService::flushStream(aaudio_handle_t streamHandle) {
-    sp<AAudioServiceStreamBase> serviceStream = convertHandleToServiceStream(streamHandle);
-    if (serviceStream.get() == nullptr) {
-        ALOGW("%s(), invalid streamHandle = 0x%0x", __func__, streamHandle);
-        return AAUDIO_ERROR_INVALID_HANDLE;
-    }
-    return serviceStream->flush();
-}
-
-aaudio_result_t AAudioService::registerAudioThread(aaudio_handle_t streamHandle,
-                                                   pid_t clientThreadId,
-                                                   int64_t /* periodNanoseconds */) {
-    sp<AAudioServiceStreamBase> serviceStream = convertHandleToServiceStream(streamHandle);
-    if (serviceStream.get() == nullptr) {
-        ALOGW("%s(), invalid streamHandle = 0x%0x", __func__, streamHandle);
-        return AAUDIO_ERROR_INVALID_HANDLE;
-    }
-    int32_t priority = isCallerInService()
-        ? kRealTimeAudioPriorityService : kRealTimeAudioPriorityClient;
-    return serviceStream->registerAudioThread(clientThreadId, priority);
-}
-
-aaudio_result_t AAudioService::unregisterAudioThread(aaudio_handle_t streamHandle,
-                                                     pid_t clientThreadId) {
-    sp<AAudioServiceStreamBase> serviceStream = convertHandleToServiceStream(streamHandle);
-    if (serviceStream.get() == nullptr) {
-        ALOGW("%s(), invalid streamHandle = 0x%0x", __func__, streamHandle);
-        return AAUDIO_ERROR_INVALID_HANDLE;
-    }
-    return serviceStream->unregisterAudioThread(clientThreadId);
-}
-
 aaudio_result_t AAudioService::startClient(aaudio_handle_t streamHandle,
                                            const android::AudioClient& client,
                                            const audio_attributes_t *attr,
diff --git a/services/oboeservice/AAudioService.h b/services/oboeservice/AAudioService.h
index caf48a5..7c1b796 100644
--- a/services/oboeservice/AAudioService.h
+++ b/services/oboeservice/AAudioService.h
@@ -24,69 +24,71 @@
 #include <media/AudioClient.h>
 
 #include <aaudio/AAudio.h>
+#include <aaudio/BnAAudioService.h>
 
 #include "binding/AAudioCommon.h"
+#include "binding/AAudioBinderAdapter.h"
 #include "binding/AAudioServiceInterface.h"
-#include "binding/IAAudioService.h"
 
 #include "AAudioServiceStreamBase.h"
 #include "AAudioStreamTracker.h"
 
 namespace android {
 
+#define AAUDIO_SERVICE_NAME  "media.aaudio"
+
 class AAudioService :
     public BinderService<AAudioService>,
-    public BnAAudioService,
-    public aaudio::AAudioServiceInterface
+    public aaudio::BnAAudioService
 {
     friend class BinderService<AAudioService>;
 
 public:
     AAudioService();
-    virtual ~AAudioService();
+    virtual ~AAudioService() = default;
+
+    aaudio::AAudioServiceInterface& asAAudioServiceInterface() {
+        return mAdapter;
+    }
 
     static const char* getServiceName() { return AAUDIO_SERVICE_NAME; }
 
     virtual status_t        dump(int fd, const Vector<String16>& args) override;
 
-    virtual void            registerClient(const sp<IAAudioClient>& client);
+    binder::Status registerClient(const ::android::sp<::aaudio::IAAudioClient>& client) override;
 
-    aaudio::aaudio_handle_t openStream(const aaudio::AAudioStreamRequest &request,
-                                       aaudio::AAudioStreamConfiguration &configurationOutput)
-                                       override;
+    binder::Status openStream(const ::aaudio::StreamRequest& request,
+                              ::aaudio::StreamParameters* paramsOut,
+                              int32_t* _aidl_return) override;
 
-    /*
-     * This is called from Binder. It checks for permissions
-     * and converts the handle passed through Binder to a stream pointer.
-     */
-    aaudio_result_t closeStream(aaudio::aaudio_handle_t streamHandle) override;
+    binder::Status closeStream(int32_t streamHandle, int32_t* _aidl_return) override;
 
-    aaudio_result_t getStreamDescription(
-                aaudio::aaudio_handle_t streamHandle,
-                aaudio::AudioEndpointParcelable &parcelable) override;
+    binder::Status
+    getStreamDescription(int32_t streamHandle, ::aaudio::Endpoint* endpoint,
+                         int32_t* _aidl_return) override;
 
-    aaudio_result_t startStream(aaudio::aaudio_handle_t streamHandle) override;
+    binder::Status startStream(int32_t streamHandle, int32_t* _aidl_return) override;
 
-    aaudio_result_t pauseStream(aaudio::aaudio_handle_t streamHandle) override;
+    binder::Status pauseStream(int32_t streamHandle, int32_t* _aidl_return) override;
 
-    aaudio_result_t stopStream(aaudio::aaudio_handle_t streamHandle) override;
+    binder::Status stopStream(int32_t streamHandle, int32_t* _aidl_return) override;
 
-    aaudio_result_t flushStream(aaudio::aaudio_handle_t streamHandle) override;
+    binder::Status flushStream(int32_t streamHandle, int32_t* _aidl_return) override;
 
-    aaudio_result_t registerAudioThread(aaudio::aaudio_handle_t streamHandle,
-                                                pid_t tid,
-                                                int64_t periodNanoseconds) override;
+    binder::Status
+    registerAudioThread(int32_t streamHandle, int32_t clientThreadId, int64_t periodNanoseconds,
+                        int32_t* _aidl_return) override;
 
-    aaudio_result_t unregisterAudioThread(aaudio::aaudio_handle_t streamHandle,
-                                                  pid_t tid) override;
+    binder::Status unregisterAudioThread(int32_t streamHandle, int32_t clientThreadId,
+                                         int32_t* _aidl_return) override;
 
     aaudio_result_t startClient(aaudio::aaudio_handle_t streamHandle,
                                 const android::AudioClient& client,
                                 const audio_attributes_t *attr,
-                                audio_port_handle_t *clientHandle) override;
+                                audio_port_handle_t *clientHandle);
 
     aaudio_result_t stopClient(aaudio::aaudio_handle_t streamHandle,
-                                       audio_port_handle_t clientHandle) override;
+                                       audio_port_handle_t clientHandle);
 
  // ===============================================================================
  // The following public methods are only called from the service and NOT by Binder.
@@ -101,6 +103,29 @@
     aaudio_result_t closeStream(sp<aaudio::AAudioServiceStreamBase> serviceStream);
 
 private:
+    class Adapter : public aaudio::AAudioBinderAdapter {
+    public:
+        explicit Adapter(AAudioService *service)
+                : aaudio::AAudioBinderAdapter(service),
+                  mService(service) {}
+
+        aaudio_result_t startClient(aaudio::aaudio_handle_t streamHandle,
+                                    const android::AudioClient &client,
+                                    const audio_attributes_t *attr,
+                                    audio_port_handle_t *clientHandle) override {
+            return mService->startClient(streamHandle, client, attr, clientHandle);
+        }
+
+        aaudio_result_t stopClient(aaudio::aaudio_handle_t streamHandle,
+                                   audio_port_handle_t clientHandle) override {
+            return mService->stopClient(streamHandle, clientHandle);
+        }
+
+    private:
+        AAudioService* const mService;
+    };
+
+    Adapter mAdapter;
 
     /** @return true if the client is the audioserver
      */
diff --git a/services/oboeservice/AAudioServiceEndpointCapture.cpp b/services/oboeservice/AAudioServiceEndpointCapture.cpp
index 206a264..b86fe9d 100644
--- a/services/oboeservice/AAudioServiceEndpointCapture.cpp
+++ b/services/oboeservice/AAudioServiceEndpointCapture.cpp
@@ -35,9 +35,9 @@
 using namespace android;  // TODO just import names needed
 using namespace aaudio;   // TODO just import names needed
 
-AAudioServiceEndpointCapture::AAudioServiceEndpointCapture(AAudioService &audioService)
-    : AAudioServiceEndpointShared(
-            (AudioStreamInternal *)(new AudioStreamInternalCapture(audioService, true))) {
+AAudioServiceEndpointCapture::AAudioServiceEndpointCapture(AAudioService& audioService)
+        : AAudioServiceEndpointShared(
+                new AudioStreamInternalCapture(audioService.asAAudioServiceInterface(), true)) {
 }
 
 aaudio_result_t AAudioServiceEndpointCapture::open(const aaudio::AAudioStreamRequest &request) {
@@ -65,7 +65,7 @@
         result = getStreamInternal()->read(mDistributionBuffer.get(),
                 getFramesPerBurst(), timeoutNanos);
         if (result == AAUDIO_ERROR_DISCONNECTED) {
-            disconnectRegisteredStreams();
+            ALOGV("%s() read() returned AAUDIO_ERROR_DISCONNECTED, break", __func__);
             break;
         } else if (result != getFramesPerBurst()) {
             ALOGW("callbackLoop() read %d / %d",
diff --git a/services/oboeservice/AAudioServiceEndpointPlay.cpp b/services/oboeservice/AAudioServiceEndpointPlay.cpp
index 730d161..53cb70b 100644
--- a/services/oboeservice/AAudioServiceEndpointPlay.cpp
+++ b/services/oboeservice/AAudioServiceEndpointPlay.cpp
@@ -41,10 +41,9 @@
 
 #define BURSTS_PER_BUFFER_DEFAULT   2
 
-AAudioServiceEndpointPlay::AAudioServiceEndpointPlay(AAudioService &audioService)
-    : AAudioServiceEndpointShared(
-        (AudioStreamInternal *)(new AudioStreamInternalPlay(audioService, true))) {
-}
+AAudioServiceEndpointPlay::AAudioServiceEndpointPlay(AAudioService& audioService)
+        : AAudioServiceEndpointShared(
+                new AudioStreamInternalPlay(audioService.asAAudioServiceInterface(), true)) {}
 
 aaudio_result_t AAudioServiceEndpointPlay::open(const aaudio::AAudioStreamRequest &request) {
     aaudio_result_t result = AAudioServiceEndpointShared::open(request);
@@ -146,7 +145,7 @@
         result = getStreamInternal()->write(mMixer.getOutputBuffer(),
                                             getFramesPerBurst(), timeoutNanos);
         if (result == AAUDIO_ERROR_DISCONNECTED) {
-            AAudioServiceEndpointShared::disconnectRegisteredStreams();
+            ALOGV("%s() write() returned AAUDIO_ERROR_DISCONNECTED, break", __func__);
             break;
         } else if (result != getFramesPerBurst()) {
             ALOGW("callbackLoop() wrote %d / %d",
diff --git a/services/oboeservice/AAudioServiceStreamBase.cpp b/services/oboeservice/AAudioServiceStreamBase.cpp
index ea691cf..9736091 100644
--- a/services/oboeservice/AAudioServiceStreamBase.cpp
+++ b/services/oboeservice/AAudioServiceStreamBase.cpp
@@ -26,7 +26,6 @@
 #include <media/TypeConverter.h>
 #include <mediautils/SchedulingPolicyService.h>
 
-#include "binding/IAAudioService.h"
 #include "binding/AAudioServiceMessage.h"
 #include "core/AudioGlobal.h"
 #include "utility/AudioClock.h"
diff --git a/services/oboeservice/AAudioServiceStreamBase.h b/services/oboeservice/AAudioServiceStreamBase.h
index 51c26e9..f9efc2a 100644
--- a/services/oboeservice/AAudioServiceStreamBase.h
+++ b/services/oboeservice/AAudioServiceStreamBase.h
@@ -24,9 +24,10 @@
 #include <utils/RefBase.h>
 
 #include "fifo/FifoBuffer.h"
-#include "binding/IAAudioService.h"
 #include "binding/AudioEndpointParcelable.h"
 #include "binding/AAudioServiceMessage.h"
+#include "binding/AAudioStreamRequest.h"
+#include "core/AAudioStreamParameters.h"
 #include "utility/AAudioUtilities.h"
 #include "utility/AudioClock.h"
 
diff --git a/services/oboeservice/AAudioServiceStreamShared.cpp b/services/oboeservice/AAudioServiceStreamShared.cpp
index e88a81e..031468e 100644
--- a/services/oboeservice/AAudioServiceStreamShared.cpp
+++ b/services/oboeservice/AAudioServiceStreamShared.cpp
@@ -24,8 +24,6 @@
 
 #include <aaudio/AAudio.h>
 
-#include "binding/IAAudioService.h"
-
 #include "binding/AAudioServiceMessage.h"
 #include "AAudioServiceStreamBase.h"
 #include "AAudioServiceStreamShared.h"
diff --git a/services/oboeservice/Android.bp b/services/oboeservice/Android.bp
index 8b1e2c0..31e590e 100644
--- a/services/oboeservice/Android.bp
+++ b/services/oboeservice/Android.bp
@@ -55,6 +55,11 @@
         "libcutils",
         "liblog",
         "libutils",
+        "aaudio-aidl-cpp",
+    ],
+
+    export_shared_lib_headers: [
+        "libaaudio_internal",
     ],
 
     header_libs: [